summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorMatthieu Herrb <matthieu@cvs.openbsd.org>2006-11-26 19:55:05 +0000
committerMatthieu Herrb <matthieu@cvs.openbsd.org>2006-11-26 19:55:05 +0000
commit272778a516e6ff202471367a355b50dec474c044 (patch)
tree044d3bc53dd32fd9cadc53017c27444a34d08f32
parentca0064a8e95a2a4cf0ed6a2d8106d6d048c6b620 (diff)
Importing xf86-input-mouse 1.1.2
-rw-r--r--driver/xf86-input-mouse/COPYING12
-rw-r--r--driver/xf86-input-mouse/ChangeLog112
-rw-r--r--driver/xf86-input-mouse/Makefile.am29
-rw-r--r--driver/xf86-input-mouse/Makefile.in664
-rw-r--r--driver/xf86-input-mouse/README1278
-rw-r--r--driver/xf86-input-mouse/README.sgml1125
-rw-r--r--driver/xf86-input-mouse/aclocal.m47898
-rw-r--r--driver/xf86-input-mouse/config.guess1411
-rw-r--r--driver/xf86-input-mouse/config.h.in57
-rw-r--r--driver/xf86-input-mouse/config.sub1500
-rw-r--r--driver/xf86-input-mouse/configure21799
-rw-r--r--driver/xf86-input-mouse/configure.ac94
-rw-r--r--driver/xf86-input-mouse/depcomp530
-rw-r--r--driver/xf86-input-mouse/install-sh323
-rw-r--r--driver/xf86-input-mouse/ltmain.sh6911
-rw-r--r--driver/xf86-input-mouse/man/Makefile.am59
-rw-r--r--driver/xf86-input-mouse/man/Makefile.in425
-rw-r--r--driver/xf86-input-mouse/man/mousedrv.man248
-rw-r--r--driver/xf86-input-mouse/missing360
-rw-r--r--driver/xf86-input-mouse/src/Makefile.am31
-rw-r--r--driver/xf86-input-mouse/src/Makefile.in511
-rw-r--r--driver/xf86-input-mouse/src/mouse.c3796
-rw-r--r--driver/xf86-input-mouse/src/mouse.h15
-rw-r--r--driver/xf86-input-mouse/src/mousePriv.h80
-rw-r--r--driver/xf86-input-mouse/src/pnp.c792
25 files changed, 50060 insertions, 0 deletions
diff --git a/driver/xf86-input-mouse/COPYING b/driver/xf86-input-mouse/COPYING
new file mode 100644
index 000000000..7f33cbfd2
--- /dev/null
+++ b/driver/xf86-input-mouse/COPYING
@@ -0,0 +1,12 @@
+This is a stub file. This package has not yet had its complete licensing
+information compiled. Please see the individual source files for details on
+your rights to use and modify this software.
+
+Please submit updated COPYING files to the Xorg bugzilla:
+
+https://bugs.freedesktop.org/enter_bug.cgi?product=xorg
+
+All licensing questions regarding this software should be directed at the
+Xorg mailing list:
+
+http://lists.freedesktop.org/mailman/listinfo/xorg
diff --git a/driver/xf86-input-mouse/ChangeLog b/driver/xf86-input-mouse/ChangeLog
new file mode 100644
index 000000000..b0ff39252
--- /dev/null
+++ b/driver/xf86-input-mouse/ChangeLog
@@ -0,0 +1,112 @@
+2006-05-15 Matthias Hopf <mhopf@suse.de>
+
+ * configure.ac,src/mouse.c:
+ Bump to 1.1.1.
+
+2006-04-21 Matthias Hopf <mhopf@suse.de>
+
+ * man/mouse.man:
+ Fixed default for YAxisMapping.
+ Changed default for ZAxisMapping. Added short explanation.
+ * src/mouse.c: (MouseCommonOptions), (MouseReadInput):
+ Autodetect (one way only) single wheel only for EXPS2.
+ Use singlebit protocol for multiwheel EXPS2 mice.
+
+2006-04-20 Matthias Hopf <mhopf@suse.de>
+
+ * src/mouse.c: (MousePostEvent):
+ Overhaul of wheel processing. Does work correctly with multibit
+ zaxis events now.
+
+2006-04-06 Adam Jackson <ajax@freedesktop.org>
+
+ * configure.ac:
+ * src/mouse.c:
+ * src/pnp.c:
+ Unlibcwrap. Bump server version requirement. Bump to 1.1.0.
+
+2006-03-09 Eric Anholt <anholt@FreeBSD.org>
+
+ * src/mouse.c: (MouseCommonOptions):
+ Coverity #875: Correct several memory leaks in options parsing.
+
+2006-02-28 Adam Jackson <ajax@freedesktop.org>
+
+ * configure.ac:
+ * src/mouse.c:
+ Bump to 1.0.4.
+
+2006-02-02 Matthias Hopf <mhopf@suse.de>
+
+ * man/mouse.man:
+ Fixed ButtonMapping default.
+
+2006-01-17 Matthias Hopf <mhopf@suse.de>
+
+ * src/mouse.c: (MouseDoPostEvent):
+ Bug #5071: EmulateWheelTimeout didn't work as anticipated.
+
+2006-01-09 Daniel Stone <daniel@freedesktop.org>
+
+ * src/mouse.c:
+ Remove #ifdef PNP_MOUSE blocks, as it was always defined in the
+ monolith.
+
+2005-12-20 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ Update package version for X11R7 release.
+
+2005-12-19 Alan Coopersmith <alan.coopersmith@sun.com>
+
+ * man/mouse.man:
+ Update URL for mouse docs online.
+ Add VUID to supported protocols (used on Solaris).
+
+ * README.sgml:
+ Update docs for X11R6.9 & 7.0 releases.
+ Add note about new ButtonMapping option.
+ Explain changes due to "virtual mouse" support in Solaris 10.
+ Change "mices" to "mice".
+
+2005-12-14 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ * src/mouse.c:
+ Update package version number for final X11R7 release candidate.
+ Bump driver version number.
+
+2005-12-06 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * man/Makefile.am:
+ Change *man_SOURCES ==> *man_PRE to fix autotools warnings.
+
+2005-12-03 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ Update package version number for X11R7 RC3 release.
+
+2005-12-01 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ Remove extraneous AC_MSG_RESULT.
+
+2005-11-29 Adam Jackson <ajax@freedesktop.org>
+
+ * configure.ac:
+ Only build dlloader modules by default.
+
+2005-11-22 Daniel Stone <daniel@freedesktop.org>
+
+ * configure.ac:
+ Update dependency on xorg-server to >= 0.99.3, for MouseDriverRec changes.
+
+2005-11-09 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ Update package version number for X11R7 RC2 release.
+
+2005-11-01 Kevin E. Martin <kem-at-freedesktop-dot-org>
+
+ * configure.ac:
+ Update pkgcheck dependencies to work with separate build roots.
diff --git a/driver/xf86-input-mouse/Makefile.am b/driver/xf86-input-mouse/Makefile.am
new file mode 100644
index 000000000..2b6c46aa1
--- /dev/null
+++ b/driver/xf86-input-mouse/Makefile.am
@@ -0,0 +1,29 @@
+# Copyright 2005 Adam Jackson.
+#
+# Permission is hereby granted, free of charge, to any person obtaining a
+# copy of this software and associated documentation files (the "Software"),
+# to deal in the Software without restriction, including without limitation
+# on the rights to use, copy, modify, merge, publish, distribute, sub
+# license, and/or sell copies of the Software, and to permit persons to whom
+# the Software is furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice (including the next
+# paragraph) shall be included in all copies or substantial portions of the
+# Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL
+# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+AUTOMAKE_OPTIONS = foreign
+SUBDIRS = src man
+
+if BUILD_LINUXDOC
+README: README.sgml
+ $(MAKE_TEXT) README.sgml && mv README.txt README
+endif
+
+EXTRA_DIST = README.sgml
diff --git a/driver/xf86-input-mouse/Makefile.in b/driver/xf86-input-mouse/Makefile.in
new file mode 100644
index 000000000..1f24b2a47
--- /dev/null
+++ b/driver/xf86-input-mouse/Makefile.in
@@ -0,0 +1,664 @@
+# Makefile.in generated by automake 1.9.6 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# Copyright 2005 Adam Jackson.
+#
+# Permission is hereby granted, free of charge, to any person obtaining a
+# copy of this software and associated documentation files (the "Software"),
+# to deal in the Software without restriction, including without limitation
+# on the rights to use, copy, modify, merge, publish, distribute, sub
+# license, and/or sell copies of the Software, and to permit persons to whom
+# the Software is furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice (including the next
+# paragraph) shall be included in all copies or substantial portions of the
+# Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL
+# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+top_builddir = .
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+INSTALL = @INSTALL@
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+DIST_COMMON = README $(am__configure_deps) $(srcdir)/Makefile.am \
+ $(srcdir)/Makefile.in $(srcdir)/config.h.in \
+ $(top_srcdir)/configure COPYING ChangeLog config.guess \
+ config.sub depcomp install-sh ltmain.sh missing
+subdir = .
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno configure.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES =
+SOURCES =
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \
+ html-recursive info-recursive install-data-recursive \
+ install-exec-recursive install-info-recursive \
+ install-recursive installcheck-recursive installdirs-recursive \
+ pdf-recursive ps-recursive uninstall-info-recursive \
+ uninstall-recursive
+ETAGS = etags
+CTAGS = ctags
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+ { test ! -d $(distdir) \
+ || { find $(distdir) -type d ! -perm -200 -exec chmod u+w {} ';' \
+ && rm -fr $(distdir); }; }
+DIST_ARCHIVES = $(distdir).tar.gz $(distdir).tar.bz2
+GZIP_ENV = --best
+distuninstallcheck_listfiles = find . -type f -print
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+ADMIN_MAN_DIR = @ADMIN_MAN_DIR@
+ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@
+AMDEP_FALSE = @AMDEP_FALSE@
+AMDEP_TRUE = @AMDEP_TRUE@
+AMTAR = @AMTAR@
+APP_MAN_DIR = @APP_MAN_DIR@
+APP_MAN_SUFFIX = @APP_MAN_SUFFIX@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@
+BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@
+BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@
+BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DRIVER_MAN_DIR = @DRIVER_MAN_DIR@
+DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@
+DRIVER_NAME = @DRIVER_NAME@
+ECHO = @ECHO@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+F77 = @F77@
+FFLAGS = @FFLAGS@
+FILE_MAN_DIR = @FILE_MAN_DIR@
+FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIB_MAN_DIR = @LIB_MAN_DIR@
+LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@
+LINUXDOC = @LINUXDOC@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAINT = @MAINT@
+MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@
+MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@
+MAKEINFO = @MAKEINFO@
+MAKE_HTML = @MAKE_HTML@
+MAKE_PDF = @MAKE_PDF@
+MAKE_PS = @MAKE_PS@
+MAKE_TEXT = @MAKE_TEXT@
+MISC_MAN_DIR = @MISC_MAN_DIR@
+MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@
+OBJEXT = @OBJEXT@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+PS2PDF = @PS2PDF@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+XORG_CFLAGS = @XORG_CFLAGS@
+XORG_LIBS = @XORG_LIBS@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_F77 = @ac_ct_F77@
+ac_ct_RANLIB = @ac_ct_RANLIB@
+ac_ct_STRIP = @ac_ct_STRIP@
+ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@
+am__fastdepCC_FALSE = @am__fastdepCC_FALSE@
+am__fastdepCC_TRUE = @am__fastdepCC_TRUE@
+am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@
+am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+datadir = @datadir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+includedir = @includedir@
+infodir = @infodir@
+inputdir = @inputdir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+AUTOMAKE_OPTIONS = foreign
+SUBDIRS = src man
+EXTRA_DIST = README.sgml
+all: config.h
+ $(MAKE) $(AM_MAKEFLAGS) all-recursive
+
+.SUFFIXES:
+am--refresh:
+ @:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ echo ' cd $(srcdir) && $(AUTOMAKE) --foreign '; \
+ cd $(srcdir) && $(AUTOMAKE) --foreign \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+ cd $(top_srcdir) && \
+ $(AUTOMAKE) --foreign Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ echo ' $(SHELL) ./config.status'; \
+ $(SHELL) ./config.status;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ $(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+
+config.h: stamp-h1
+ @if test ! -f $@; then \
+ rm -f stamp-h1; \
+ $(MAKE) stamp-h1; \
+ else :; fi
+
+stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status
+ @rm -f stamp-h1
+ cd $(top_builddir) && $(SHELL) ./config.status config.h
+$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_srcdir) && $(AUTOHEADER)
+ rm -f stamp-h1
+ touch $@
+
+distclean-hdr:
+ -rm -f config.h stamp-h1
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool
+uninstall-info-am:
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+# (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+$(RECURSIVE_TARGETS):
+ @failcom='exit 1'; \
+ for f in x $$MAKEFLAGS; do \
+ case $$f in \
+ *=* | --[!k]*);; \
+ *k*) failcom='fail=yes';; \
+ esac; \
+ done; \
+ dot_seen=no; \
+ target=`echo $@ | sed s/-recursive//`; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ dot_seen=yes; \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done; \
+ if test "$$dot_seen" = "no"; then \
+ $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+ fi; test -z "$$fail"
+
+mostlyclean-recursive clean-recursive distclean-recursive \
+maintainer-clean-recursive:
+ @failcom='exit 1'; \
+ for f in x $$MAKEFLAGS; do \
+ case $$f in \
+ *=* | --[!k]*);; \
+ *k*) failcom='fail=yes';; \
+ esac; \
+ done; \
+ dot_seen=no; \
+ case "$@" in \
+ distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+ *) list='$(SUBDIRS)' ;; \
+ esac; \
+ rev=''; for subdir in $$list; do \
+ if test "$$subdir" = "."; then :; else \
+ rev="$$subdir $$rev"; \
+ fi; \
+ done; \
+ rev="$$rev ."; \
+ target=`echo $@ | sed s/-recursive//`; \
+ for subdir in $$rev; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done && test -z "$$fail"
+tags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+ done
+ctags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) ctags); \
+ done
+
+ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES)
+ list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ mkid -fID $$unique
+tags: TAGS
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+ include_option=--etags-include; \
+ empty_fix=.; \
+ else \
+ include_option=--include; \
+ empty_fix=; \
+ fi; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test ! -f $$subdir/TAGS || \
+ tags="$$tags $$include_option=$$here/$$subdir/TAGS"; \
+ fi; \
+ done; \
+ list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$tags $$unique; \
+ fi
+ctags: CTAGS
+CTAGS: ctags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(CTAGS_ARGS)$$tags$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$tags $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && cd $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) $$here
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+ $(am__remove_distdir)
+ mkdir $(distdir)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \
+ list='$(DISTFILES)'; for file in $$list; do \
+ case $$file in \
+ $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \
+ $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \
+ esac; \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test "$$dir" != "$$file" && test "$$dir" != "."; then \
+ dir="/$$dir"; \
+ $(mkdir_p) "$(distdir)$$dir"; \
+ else \
+ dir=''; \
+ fi; \
+ if test -d $$d/$$file; then \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \
+ fi; \
+ cp -pR $$d/$$file $(distdir)$$dir || exit 1; \
+ else \
+ test -f $(distdir)/$$file \
+ || cp -p $$d/$$file $(distdir)/$$file \
+ || exit 1; \
+ fi; \
+ done
+ list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test -d "$(distdir)/$$subdir" \
+ || $(mkdir_p) "$(distdir)/$$subdir" \
+ || exit 1; \
+ distdir=`$(am__cd) $(distdir) && pwd`; \
+ top_distdir=`$(am__cd) $(top_distdir) && pwd`; \
+ (cd $$subdir && \
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$$top_distdir" \
+ distdir="$$distdir/$$subdir" \
+ distdir) \
+ || exit 1; \
+ fi; \
+ done
+ -find $(distdir) -type d ! -perm -777 -exec chmod a+rwx {} \; -o \
+ ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -444 -exec $(SHELL) $(install_sh) -c -m a+r {} {} \; \
+ || chmod -R a+r $(distdir)
+dist-gzip: distdir
+ tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+ $(am__remove_distdir)
+dist-bzip2: distdir
+ tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2
+ $(am__remove_distdir)
+
+dist-tarZ: distdir
+ tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+ $(am__remove_distdir)
+
+dist-shar: distdir
+ shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz
+ $(am__remove_distdir)
+
+dist-zip: distdir
+ -rm -f $(distdir).zip
+ zip -rq $(distdir).zip $(distdir)
+ $(am__remove_distdir)
+
+dist dist-all: distdir
+ tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+ tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2
+ $(am__remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration. Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+ case '$(DIST_ARCHIVES)' in \
+ *.tar.gz*) \
+ GZIP=$(GZIP_ENV) gunzip -c $(distdir).tar.gz | $(am__untar) ;;\
+ *.tar.bz2*) \
+ bunzip2 -c $(distdir).tar.bz2 | $(am__untar) ;;\
+ *.tar.Z*) \
+ uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+ *.shar.gz*) \
+ GZIP=$(GZIP_ENV) gunzip -c $(distdir).shar.gz | unshar ;;\
+ *.zip*) \
+ unzip $(distdir).zip ;;\
+ esac
+ chmod -R a-w $(distdir); chmod a+w $(distdir)
+ mkdir $(distdir)/_build
+ mkdir $(distdir)/_inst
+ chmod a-w $(distdir)
+ dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+ && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+ && cd $(distdir)/_build \
+ && ../configure --srcdir=.. --prefix="$$dc_install_base" \
+ $(DISTCHECK_CONFIGURE_FLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) dvi \
+ && $(MAKE) $(AM_MAKEFLAGS) check \
+ && $(MAKE) $(AM_MAKEFLAGS) install \
+ && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+ && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+ distuninstallcheck \
+ && chmod -R a-w "$$dc_install_base" \
+ && ({ \
+ (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+ distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+ } || { rm -rf "$$dc_destdir"; exit 1; }) \
+ && rm -rf "$$dc_destdir" \
+ && $(MAKE) $(AM_MAKEFLAGS) dist \
+ && rm -rf $(DIST_ARCHIVES) \
+ && $(MAKE) $(AM_MAKEFLAGS) distcleancheck
+ $(am__remove_distdir)
+ @(echo "$(distdir) archives ready for distribution: "; \
+ list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+ sed -e '1{h;s/./=/g;p;x;}' -e '$${p;x;}'
+distuninstallcheck:
+ @cd $(distuninstallcheck_dir) \
+ && test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \
+ || { echo "ERROR: files left after uninstall:" ; \
+ if test -n "$(DESTDIR)"; then \
+ echo " (check DESTDIR support)"; \
+ fi ; \
+ $(distuninstallcheck_listfiles) ; \
+ exit 1; } >&2
+distcleancheck: distclean
+ @if test '$(srcdir)' = . ; then \
+ echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+ exit 1 ; \
+ fi
+ @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left in build directory after distclean:" ; \
+ $(distcleancheck_listfiles) ; \
+ exit 1; } >&2
+check-am: all-am
+check: check-recursive
+all-am: Makefile config.h
+installdirs: installdirs-recursive
+installdirs-am:
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ `test -z '$(STRIP)' || \
+ echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-hdr \
+ distclean-libtool distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+info: info-recursive
+
+info-am:
+
+install-data-am:
+
+install-exec-am:
+
+install-info: install-info-recursive
+
+install-man:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -rf $(top_srcdir)/autom4te.cache
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-info-am
+
+uninstall-info: uninstall-info-recursive
+
+.PHONY: $(RECURSIVE_TARGETS) CTAGS GTAGS all all-am am--refresh check \
+ check-am clean clean-generic clean-libtool clean-recursive \
+ ctags ctags-recursive dist dist-all dist-bzip2 dist-gzip \
+ dist-shar dist-tarZ dist-zip distcheck distclean \
+ distclean-generic distclean-hdr distclean-libtool \
+ distclean-recursive distclean-tags distcleancheck distdir \
+ distuninstallcheck dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am install-exec \
+ install-exec-am install-info install-info-am install-man \
+ install-strip installcheck installcheck-am installdirs \
+ installdirs-am maintainer-clean maintainer-clean-generic \
+ maintainer-clean-recursive mostlyclean mostlyclean-generic \
+ mostlyclean-libtool mostlyclean-recursive pdf pdf-am ps ps-am \
+ tags tags-recursive uninstall uninstall-am uninstall-info-am
+
+
+@BUILD_LINUXDOC_TRUE@README: README.sgml
+@BUILD_LINUXDOC_TRUE@ $(MAKE_TEXT) README.sgml && mv README.txt README
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/driver/xf86-input-mouse/README b/driver/xf86-input-mouse/README
new file mode 100644
index 000000000..0ba8f7bc3
--- /dev/null
+++ b/driver/xf86-input-mouse/README
@@ -0,0 +1,1278 @@
+ Mouse Support in X11R6.8
+ Kazutaka Yokota
+ 17 December 2002
+ ____________________________________________________________
+
+ Table of Contents
+
+
+ 1. Introduction
+ 2. Supported Hardware
+ 3. OS Support for Mice
+ 3.1 Summary of Supported Mouse Protocol Types
+ 3.2 BSD/OS
+ 3.3 FreeBSD
+ 3.4 FreeBSD(98)
+ 3.5 Interactive Unix
+ 3.6 Linux
+ 3.7 Linux/98
+ 3.8 LynxOS
+ 3.9 NetBSD
+ 3.10 NetBSD/pc98
+ 3.11 OpenBSD
+ 3.12 OS/2
+ 3.13 SCO
+ 3.14 Solaris
+ 3.15 SVR4
+ 3.16 PANIX
+
+ 4. Configuring Your Mouse
+ 5. xorg.conf Options
+ 5.1 Buttons
+ 5.2 ZAxisMappping
+ 5.3 Resolution
+ 5.4 Drag Lock Buttons
+
+ 6. Mouse Gallery
+ 6.1 MS IntelliMouse (serial, PS/2)
+ 6.2 MS IntelliMouse Explorer (PS/2, USB)
+ 6.3 Kensington Thinking Mouse and Kensington Expert Mouse (serial, PS/2)
+ 6.4 Genius NetScroll (PS/2)
+ 6.5 Genius NetMouse and NetMouse Pro (serial, PS/2)
+ 6.6 Genius NetScroll Optical (PS/2, USB)
+ 6.7 ALPS GlidePoint (serial, PS/2)
+ 6.8 ASCII MieMouse (serial, PS/2)
+ 6.9 Logitech MouseMan+ and FirstMouse+ (serial, PS/2)
+ 6.10 IBM ScrollPoint (PS/2)
+ 6.11 8D ScrollMouse (serial, PS/2)
+ 6.12 A4 Tech 4D mice (serial, PS/2, USB)
+
+ 7. Configuration Examples
+
+
+ ______________________________________________________________________
+
+ 1. Introduction
+
+
+ This document describes mouse support in X.org Foundation's X11R6.8
+ server.
+
+ Mouse configuration has often been mysterious task for novice users.
+ However, once you learn several basics, it is straightforward to write
+ the mouse "InputDevice" section in the xorg.conf file by hand.
+
+
+
+ 2. Supported Hardware
+
+
+ The X.org Foundation X server supports three classes of mice: serial,
+ bus and PS/2 mice.
+
+
+ Serial mouse
+ The serial mouse has been the most popular pointing device for
+ PCs. There have been numerous serial mouse models from a number
+ of manufactures. Despite the wide range of variations, there
+ have been relatively few protocols (data format) with which the
+ serial mouse talks to the host computer.
+
+ The modern serial mouse conforms to the PnP COM device
+ specification so that the host computer can automatically detect
+ the mouse and load an appropriate driver. The X server supports
+ this specification and can detect popular PnP serial mouse
+ models on most platforms.
+
+
+ Bus mouse
+ The bus mouse connects to a dedicated interface card in an
+ expansion slot. Some video cards, notably those from ATI, and
+ integrated I/O cards may also have a bus mouse connector. Some
+ bus mice are known as `InPort mouse'.
+
+ Note that some mouse manufactures have sold a package including
+ a serial mouse and a serial interface card. Don't confuse this
+ type of products with the genuine bus mouse.
+
+
+ PS/2 mouse
+ They are sometimes called `Mouse-port mouse'. The PS/2 mouse is
+ becoming increasingly common and popular.
+
+ The PS/2 mouse is an intelligent device and may have more than
+ three buttons and a wheel or a roller. The PS/2 mouse is
+ usually compatible with the original PS/2 mouse from IBM
+ immediately after power up. The PS/2 mouse with additional
+ features requires a specialized initialization procedure to
+ enable these features. Without proper initialization, it
+ behaves as though it were an ordinary two or three button mouse.
+
+
+ USB mouse
+ USB (Universal Serial Bus) ports are present on most modern
+ computers. Several devices can be plugged into this bus,
+ including mices and keyboards.
+
+ The server includes support for USB mices on some systems.
+
+ Many mice nowadays can be used both as a serial mouse and as a PS/2
+ mouse. They has a logic to distinguish which interface it is
+ connected to. However, the mouse which is not marketed as compatible
+ with both serial and PS/2 mouse interface lacks this logic and cannot
+ be used in such a way, even if you can find an appropriate adapter
+ with which you can connect the PS/2 mouse to a serial port or visa
+ versa.
+
+ X11R6.8 supports the mouse with a wheel, a roller or a knob. Its
+ action is detected as the Z (third) axis motion of the mouse. As the
+ X server or clients normally do not use the Z axis movement of the
+ pointing device, a configuration option, "ZAxisMapping", is provided
+ to assign the Z axis movement to another axis or a pair of buttons
+ (see below).
+ 3. OS Support for Mice
+
+
+
+ 3.1. Summary of Supported Mouse Protocol Types
+
+
+ Protocol Types
+ serial PnP BusMouse PS/2 Extended PS/2
+ OS platforms protocols serial protocol protocol protocols
+ "Auto" "BusMouse" "PS/2" "xxxPS/2" USB
+ -------------------------------------------------------------------------
+ BSD/OS Ok ? ? ? ? ?
+ FreeBSD Ok Ok Ok Ok SP*1 SP*1
+ FreeBSD(98) Ok ? Ok NA NA ?
+ Interactive Unix Ok NA ?*1 ?*1 NA ?
+ Linux Ok Ok Ok Ok Ok ?
+ Linux/98 Ok ? Ok NA NA ?
+ LynxOS Ok NA Ok Ok NA ?
+ NetBSD Ok Ok Ok SP*1 SP*1 SP*1
+ NetBSD/pc98 Ok ? Ok NA NA NA
+ OpenBSD Ok Ok Ok Ok*1 Ok*1 Ok*1
+ OS/2 SP*2 SP*2 SP*2 SP*2 SP*2 ?
+ SCO Ok ? SP*1 SP*1 NA ?
+ Solaris 2.x Ok NA*1 ?*1 Ok Ok SP*1
+ SVR4 Ok NA*1 SP*1 SP*1 NA ?
+ PANIX Ok ? SP*1 SP*1 NA ?
+
+ Ok: support is available, NA: not available, ?: untested or unknown.
+ SP: support is available in a different form
+
+ *1 Refer to the following sections for details.
+ *2 X11R6.8/OS2 will support any type of mouse that the OS supports,
+ whether it is serial, bus mouse, or PnP type.
+
+
+
+ 3.2. BSD/OS
+
+ No testing has been done with BSD/OS.
+
+
+ 3.3. FreeBSD
+
+ FreeBSD supports the "SysMouse" protocol which must be specified when
+ the moused daemon is running in versions 2.2.1 or later.
+
+ When running the mouseddaemon, you must always specify the
+ /dev/sysmouse device and the "SysMouse" protocol to the X server,
+ regardless of the actual type of your mouse.
+
+ FreeBSD versions 2.2.6 or later include the kernel-level support for
+ extended PS/2 mouse protocols and there is no need to specify the
+ exact protocol name to the X server. Instead specify the "PS/2" or
+ "Auto" protocol and the X server will automatically make use of the
+ kernel-level support.
+
+ In fact, "Auto" protocol support is really efficient in these
+ versions. You may always specify "Auto" to any mouse, serial, bus or
+ PS/2, unless the mouse is an old serial model which doesn't support
+ PnP.
+
+ FreeBSD versions 2.2.5 or earlier do not support extended PS/2 mouse
+ protocols ("xxxPS/2"). Always specify the "PS/2" protocol for any
+ PS/2 mouse in these versions regardless of the brand of the mouse.
+ FreeBSD versions 3.1 or later have support for USB mice. Specify the
+ "Auto" protocol for the /dev/ums0 device. (If the moused daemon is
+ running for the USB mouse, you must use /dev/sysmouse instead of
+ /dev/ums0 as explained above.) See the ums(4) manual page for details.
+
+
+ 3.4. FreeBSD(98)
+
+ The PS/2 mouse is not supported.
+
+
+ 3.5. Interactive Unix
+
+ The PnP serial mouse support (the "Auto" protocol) is not supported
+ for the moment.
+
+ The bus mouse and PS/2 mouse should be supported by using the
+ appropriate device drivers. Use /dev/mouse for the "BusMouse"
+ protocol and /dev/kdmouse for the "PS/2" protocol. These protocols
+ are untested but may work. Please send success/failure reports to
+ <michael.rohleder@stadt-frankfurt.de>.
+
+
+ 3.6. Linux
+
+ All protocol types should work.
+
+
+ 3.7. Linux/98
+
+ The PS/2 mouse is not supported.
+
+
+ 3.8. LynxOS
+
+ The PnP serial mouse support (the "Auto" protocol) is disabled in
+ LynxOS, because of limited TTY device driver functionality.
+
+
+ 3.9. NetBSD
+
+ NetBSD 1.3.x and former does not support extended PS/2 mouse protocols
+ ("xxxPS/2"). The PS/2 mouse device driver /dev/pms emulates the bus
+ mouse. Therefore, you should always specify the "BusMouse" protocol
+ for any PS/2 mouse regardless of the brand of the mouse.
+
+ The "wsmouse" protocol introduced in NetBSD 1.4 along with the wscons
+ console driver is supported. You need to run binaries compiled on
+ NetBSD 1.4 to have support for it though. Use "/dev/wsmouse0" for the
+ device. Refer to the wsmouse(4) manual page for kernel configuration
+ informations.
+
+ This driver also provides support for USB mices. See the ums(4) manual
+ page for details.
+
+
+ 3.10. NetBSD/pc98
+
+ The PS/2 mouse is not supported.
+
+
+ 3.11. OpenBSD
+
+ The raw PS/2 mouse device driver /dev/psm0 uses the raw PS/2 mouse
+ protocol.
+
+ OpenBSD 2.2 and earlier does not support extended PS/2 mouse protocols
+ ("xxxPS/2") . Therefore, you should specify the "PS/2" protocol for
+ any PS/2 mouse regardless of the brand of the mouse.
+
+ OpenBSD 2.3 and later support all extended PS/2 mouse protocols. You
+ can select the "Auto" protocol for PnP PS/2 mice or any specific
+ extended ("xxxPS/2") protocol for non PnP mice.
+
+ There is also a cooked PS/2 mouse device driver /dev/pms0 which
+ emulates the bus mouse. Specify the "BusMouse" protocol for any PS/2
+ mouse regardless of the brand of the mouse when using this device.
+
+ XFree86 3.3.6 support USB mices on OpenBSD 2.6 and later though the
+ generic Human Interface Device (hid) /dev/uhid*. Select the "usb"
+ protocol and the /dev/uhid* instance corresponding to your mouse as
+ the device name.
+
+
+ 3.12. OS/2
+
+ X11R6.8/OS2 always uses the native mouse driver of the operating
+ system and will support any type of pointer that the OS supports,
+ whether it is serial, bus mouse, or PnP type. If the mouse works
+ under Presentation Manager, it will also work under X11R6.8/OS2.
+
+ Always specify "OSMouse" as the protocol type.
+
+
+ 3.13. SCO
+
+ The bus and PS/2 mouse are supported with the "OSMouse" protocol type.
+
+ The "OSMouse" may also be used with the serial mouse.
+
+
+ 3.14. Solaris
+
+ Testing has been done with Solaris 2.5.1, 2.6, 7, 8, 9 and pre-release
+ versions of Solaris 10. Logitech and Microsoft bus mice have not been
+ tested, but might work with the /dev/logi and /dev/msm devices.
+ Standard 2 and 3 button PS/2 mice work with the "PS/2" protocol type
+ and the /dev/kdmouse device. USB mice work with the "VUID" protocol
+ type and the /dev/mouse device. The PnP serial mouse support (the
+ "Auto" protocol) has been tested and does not work. The "Auto"
+ protocol can however detect PS/2 and USB mice correctly.
+
+ Additional USB mice can be connected using the "VUID" protocol type
+ and the appropriate "/dev/usb/hid" device with the Option
+ "StreamsModule" "usbms" line included in the associated "InputDevice"
+ section.
+
+
+ 3.15. SVR4
+
+ The bus and PS/2 mouse may be supported with the "Xqueue" protocol
+ type.
+
+ The "Xqueue" may also be used with the serial mouse.
+
+ The PnP serial mouse support (the "Auto" protocol) is not tested.
+
+
+ 3.16. PANIX
+
+ The PC/AT version of PANIX supports the bus and PS/2 mouse with the
+ "Xqueue" protocol type. The PC-98 version of PANIX supports the bus
+ mouse with the "Xqueue" protocol type.
+
+
+ 4. Configuring Your Mouse
+
+
+ Before using the xorgconfig program to set up mouse configuration, you
+ must identify the interface type, the device name and the protocol
+ type of your mouse. Blindly trying every possible combination of
+ mouse settings will lead you nowhere.
+
+ The first thing you need to know is the interface type of the mouse
+ you are going to use. It can be determined by looking at the
+ connector of the mouse. The serial mouse has a D-Sub female 9- or
+ 25-pin connector. The bus mice have either a D-Sub male 9-pin
+ connector or a round DIN 9-pin connector. The PS/2 mouse is equipped
+ with a small, round DIN 6-pin connector. Some mice come with adapters
+ with which the connector can be converted to another. If you are to
+ use such an adapter, remember that the connector at the very end of
+ the mouse/adapter pair is what matters.
+
+ The next thing to decide is a device node to use for the given
+ interface. For the bus and PS/2 mice, there is little choice; your OS
+ most possibly offers just one device node each for the bus mouse and
+ PS/2 mouse. There may be more than one serial port to which the
+ serial mouse can be attached.
+
+ The next step is to guess the appropriate protocol type for the mouse.
+ The X server may be able to select a protocol type for the given mouse
+ automatically in some cases. Otherwise, the user has to choose one
+ manually. Follow the guidelines below.
+
+
+ Bus mouse
+ The bus and InPort mice always use "BusMouse" protocol
+ regardless of the brand of the mouse.
+
+ Some OSs may allow you to specify "Auto" as the protocol type
+ for the bus mouse.
+
+
+ PS/2 mouse
+ The "PS/2" protocol should always be tried first for the PS/2
+ mouse regardless of the brand of the mouse. Any PS/2 mouse
+ should work with this protocol type, although wheels and other
+ additional features are unavailable in the X server.
+
+ After verifying the mouse works with this protocol, you may
+ choose to specify one of "xxxPS/2" protocols so that extra
+ features are made available in the X server. However, support
+ for these PS/2 mice assumes certain behavior of the underlying
+ OS and may not always work as expected. Support for some PS/2
+ mouse models may be disabled all together for some OS platforms
+ for this reason.
+
+ Some OSs may allow you to specify "Auto" as the protocol type
+ for the PS/2 mouse and the X server will automatically adjust
+ itself.
+
+
+ Serial mouse
+ The server supports a wide range of mice, both old and new. If
+ your mouse is of a relatively new model, it may conform to the
+ PnP COM device specification and the X server may be able to
+ detect an appropriate protocol type for the mouse automatically.
+
+ Specify "Auto" as the protocol type and start the X server. If
+ the mouse is not a PnP mouse, or the X server cannot determine a
+ suitable protocol type, the server will print the following
+ error message and abort.
+
+
+ <mousename>: cannot determine the mouse protocol
+
+
+
+ If the X server generates the above error message, you need to
+ manually specify a protocol type for your mouse. Choose one from
+ the following list:
+
+
+ +o GlidePoint
+
+ +o IntelliMouse
+
+ +o Logitech
+
+ +o Microsoft
+
+ +o MMHittab
+
+ +o MMSeries
+
+ +o MouseMan
+
+ +o MouseSystems
+
+ +o ThinkingMouse
+
+ When you choose, keep in mind the following rule of thumb:
+
+
+ 1. "Logitech" protocol is for old serial mouse models from
+ Logitech. Modern Logitech mice use either "MouseMan" or
+ "Microsoft" protocol.
+
+ 2. Most 2-button serial mice support the "Microsoft" protocol.
+
+ 3. 3-button serial mice may work with the "Mousesystems"
+ protocol. If it doesn't, it may work instead with the
+ "Microsoft" protocol although the third (middle) button won't
+ function. 3-button serial mice may also work with the
+ "Mouseman" protocol under which the third button may function
+ as expected.
+
+ 4. 3-button serial mice may have a small switch at the bottom of
+ the mouse to choose between ``MS'' and ``PC'', or ``2'' and
+ ``3''. ``MS'' or ``2'' usually mean the "Microsoft"
+ protocol. ``PC'' or ``3'' will choose the "MouseSystems"
+ protocol.
+
+ 5. If the serial mouse has a roller or a wheel, it may be
+ compatible with the "IntelliMouse" protocol.
+
+ 6. If the serial mouse has a roller or a wheel and it doesn't
+ work with the "IntelliMouse" protocol, you have to use it as
+ a regular 2- or 3-button serial mouse.
+
+ If the "Auto" protocol is specified and the mouse seems working,
+ but you find that not all features of the mouse is available, that
+ is because the X server does not have native support for that model
+ of mouse and is using a ``compatible'' protocol according to PnP
+ information.
+
+ If you suspect this is the case with your mouse, please enter a
+ bugreport in bugzilla.freedesktop.org, using the xorg product.
+
+
+ USB mouse
+ If your mouse is connected to the USB port, it can either be
+ supported by the "Auto" protocol, or by an OS-specific protocol
+ (see below), or as a generic Human Interface Device by the "usb"
+ protocol.
+
+
+ Standardized protocols
+ Mouse device drivers in your OS may use the standardized
+ protocol regardless of the model or the class of the mouse. For
+ example, SVR4 systems may support "Xqueue" protocol. In FreeBSD
+ the system mouse device /dev/sysmouse uses the "SysMouse"
+ protocol. Please refer to the OS support section of this file
+ for more information.
+
+
+
+ 5. xorg.conf Options
+
+
+ The old Pointer section has been replaced by a more general
+ InputDevice section. The following is a minimal example of an
+ InputDevice section for a mouse:
+
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "Mouse 1"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "Auto"
+ EndSection
+ ______________________________________________________________________
+
+
+
+ The mouse driver supports the following config file options:
+
+
+ 5.1. Buttons
+
+ This option tells the X server the number of buttons on the mouse.
+ Currently there is no reliable way to automatically detect the correct
+ number. This option is the only means for the X server to obtain it.
+ The default value is three.
+
+ Note that if you intend to assign Z axis movement to button events
+ using the ZAxisMapping option below, you need to take account of those
+ buttons into N too.
+
+
+ Option "Buttons" "N"
+
+
+
+ 5.2. ZAxisMappping
+
+ This option maps the Z axis (wheel) motion to buttons or to another
+ axis.
+ Option "ZAxisMapping" "X"
+ Option "ZAxisMapping" "Y"
+ Option "ZAxisMapping" "N1 N2"
+ Option "ZAxisMapping" "N1 N2 N3 N4"
+
+
+
+ The first example will map the Z axis motion to the X axis motion.
+ Whenever the user moves the wheel/roller, its movement is reported as
+ the X axis motion. When the wheel/roller stays still, the real X axis
+ motion is reported as is. The third example will map negative Z axis
+ motion to the button N1 and positive Z axis motion to the button N2.
+ If this option is used and the buttons N1 or N2 actually exists in the
+ mouse, their actions won't be detected by the X server.
+
+ The last example is useful for the mouse with two wheels of which the
+ second wheel is used to generate horizontal scroll action, and the
+ mouse which has a knob or a stick which can detect the horizontal
+ force applied by the user. The motion of the second wheel will be
+ mapped to the buttons N3, for the negative direction, and N4, for the
+ positive direction. If the buttons N3 and N4 actually exist in this
+ mouse, their actions won't be detected by the X server.
+
+ NOTE #1: horizontal movement may not always be detected by the current
+ version of the X11R6.8 X servers, because there appears to be no
+ accepted standard as to how the horizontal direction is encoded in
+ mouse data.
+
+ NOTE #2: Some mice think left is the negative horizontal direction,
+ others may think otherwise. Moreover, there are some mice whose two
+ wheels are both mounted vertically, and the direction of the second
+ vertical wheel does not match the first one's.
+
+ You need to edit the xorg.conf file by hand to change this option if
+ the default value of "4 5 6 7" does not match the needs of your
+ configuration.
+
+
+ 5.3. Resolution
+
+ The following option will set the mouse device resolution to N counts
+ per inch, if possible:
+
+
+ Option "Resolution" "N"
+
+
+
+ Not all mice and OSs can support this option.
+
+
+ 5.4. Drag Lock Buttons
+
+ Some people find it difficult or inconvenient to hold a trackball
+ button down, while at the same time moving the ball. Drag lock buttons
+ simulate the holding down of another button. When a drag lock button
+ is first pressed, its target buttons is "locked" down until the
+ second time the lock button is released, or until the button itself is
+ pressed and released. This allows the starting of a drag, the movement
+ of the trackball, and the ending of the drag to be separate
+ operations.
+
+
+ Option "DragLockButtons" "W X Y Z"
+
+
+ This option consists of pairs of buttons. Each lock button number is
+ followed by the number of the button that it locks. In the above,
+ button number "W" is a drag lock button for button "X" and button
+ number "Y" is a drag lock button for button "Z".
+
+ It may not be desirable to use multiple buttons as drag locks.
+ Instead, a "master drag lock button" may be defined. A master drag
+ lock button acts as a "META" key. After a master lock button is
+ released, the next button pressed is "locked" and not released until
+ the second time the real button is released.
+
+
+ Option "DragLockButtons" "M"
+
+
+
+ Since button "M" is unpaired it is a master drag lock button.
+
+
+ 6. Mouse Gallery
+
+
+ In all of the examples below, it is assumed that /dev/mouse is a link
+ to the appropriate serial port or PS/2 mouse device.
+
+
+ 6.1. MS IntelliMouse (serial, PS/2)
+
+ This mouse has a wheel which also acts as the button 2 (middle
+ button). The wheel movement is recognized as the Z axis motion. This
+ behavior is not compatible with XFree86 versions prior to 3.3.2, but
+ is more consistent with the support for other mice with wheels or
+ rollers. If you want to make the wheel behave like before, you can
+ use the "ZAxisMapping" option as described above.
+
+ IntelliMouse supports the PnP COM device specification.
+
+ To use this mouse as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "IMPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the wheel won't work in this case):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.2. MS IntelliMouse Explorer (PS/2, USB)
+
+ This mouse has a wheel which also acts as the button 2 (middle
+ button). There are two side buttons; they are recognized as the
+ buttons 4 and 5. The wheel movement is recognized as the Z axis
+ motion.
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "ExplorerPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the wheel and the side buttons won't work in
+ this case):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ To use this mouse as the USB device and the OS supports the generic
+ HID protocol:
+
+ Option "Protocol" "usb"
+
+
+
+ To use this mouse as the USB device and the OS supports automatic
+ mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.3. Kensington Thinking Mouse and Kensington Expert Mouse (serial,
+ PS/2)
+
+ These mice have four buttons. The Kensington Expert Mouse is really a
+ trackball. Both Thinking mice support the PnP COM device
+ specification.
+
+ To use this mouse as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "ThinkingMouse"
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "ThinkingMousePS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the third and the fourth buttons act as though
+ they were the first and the second buttons):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.4. Genius NetScroll (PS/2)
+
+ This mouse has four buttons and a roller. The roller movement is
+ recognized as the Z axis motion.
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "NetScrollPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the roller and the fourth button won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.5. Genius NetMouse and NetMouse Pro (serial, PS/2)
+
+ These mice have a "magic button" which is used like a wheel or a
+ roller. The "magic button" action is recognized as the Z axis motion.
+ NetMouse Pro is identical to NetMouse except that it has the third
+ button on the left hand side.
+
+ NetMouse and NetMouse Pro support the PnP COM device specification.
+ When used as a serial mouse, they are compatible with MS IntelliMouse.
+
+ To use these mice as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "NetMousePS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the "magic button" and the third button won't
+ work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.6. Genius NetScroll Optical (PS/2, USB)
+
+ This mouse has a wheel which also acts as the button 2 (middle
+ button), and two side buttons which are recognized as the buttons 4
+ and 5. It is compatible with NetMouse and NetMouse Pro.
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "NetMousePS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the wheel and the side buttons won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ To use this mouse as the USB device and the OS supports the generic
+ HID protocol:
+
+ Option "Protocol" "usb"
+
+
+
+ To use this mouse as the USB device and the OS supports automatic
+ mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.7. ALPS GlidePoint (serial, PS/2)
+
+ The serial version of this pad device has been supported since XFree86
+ 3.2. `Tapping' action is interpreted as the fourth button press.
+ (IMHO, the fourth button of GlidePoint should always be mapped to the
+ first button in order to make this pad behave like the other pad
+ products.)
+
+ To use this pad as a serial device:
+
+ Option "Protocol" "GlidePoint"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "GlidePointPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization:
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.8. ASCII MieMouse (serial, PS/2)
+
+ This mouse appears to be OEM from Genius. Although its shape is quite
+ different, it works like Genius NetMouse Pro. This mouse has a "knob"
+ which is used like a wheel or a roller. The "knob" action is
+ recognized as the Z axis motion.
+
+ MieMouse supports the PnP COM device specification. When used as a
+ serial mouse, it is compatible with MS IntelliMouse.
+
+ To use this mouse as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+
+ Option "Protocol" "NetMousePS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the knob and the third button won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.9. Logitech MouseMan+ and FirstMouse+ (serial, PS/2)
+
+ MouseMan+ has two buttons on top, one side button and a roller.
+ FirstMouse+ has two buttons and a roller. The roller movement is
+ recognized as the Z axis motion. The roller also acts as the third
+ button. The side button is recognized as the fourth button.
+
+ MouseMan+ and FirstMouse+ support the PnP COM device specification.
+ They have MS IntelliMouse compatible mode when used as a serial mouse.
+
+ To use these mice as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "MouseManPlusPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the wheel and the fourth button won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.10. IBM ScrollPoint (PS/2)
+
+ ScrollPoint has a "stick" in between the two buttons. This "stick" is
+ the same as the stick-shaped pointing device often found on notebook
+ computers, on which you move the mouse cursor by pushing the stick.
+ The stick movement is recognized as the Z axis motion. You can push
+ the stick to right and left, as well as forward and backward. Give
+ four numbers to ZAxisMapping option to map movement along all these
+ four directions to button actions.
+
+ This mouse is compatible with Logitech MouseMan+. To use this mouse
+ as the PS/2 device and the OS supports PS/2 mouse initialization:
+
+ Option "Protocol" "MouseManPlusPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the stick won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 6.11. 8D ScrollMouse (serial, PS/2)
+
+ ScrollMouse, also known as GyroMouse, has a "stick" similar to IBM
+ ScrollPoint. The stick movement is recognized as the Z axis motion.
+ You can push the stick to right and left, as well as forward and
+ backward. Give four numbers to ZAxisMapping option to map movement
+ along all these four directions to button actions.
+
+ ScrollMouse supports the PnP COM device specification. When used as a
+ serial mouse, it is compatible with MS IntelliMouse.
+
+ To use this mouse as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "IMPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the stick won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+ Option "Protocol" "Auto"
+
+
+
+ 6.12. A4 Tech 4D mice (serial, PS/2, USB)
+
+ A4 Tech produces quit a number of mice with one or two wheels. Their
+ mice may have 2, 3, or 4 buttons. The wheels movement is recognized
+ as the Z axis motion. Give four numbers to ZAxisMapping option to map
+ movement of both wheels to button actions.
+
+ 4D mice support the PnP COM device specification. When used as a
+ serial mouse, it is compatible with MS IntelliMouse.
+
+ To use this mouse as a serial device:
+
+ Option "Protocol" "Auto"
+
+
+ or:
+
+ Option "Protocol" "IntelliMouse"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+ initialization:
+
+ Option "Protocol" "IMPS/2"
+
+
+
+ To use this mouse as the PS/2 device but the OS does not support PS/2
+ mouse initialization (the wheels won't work):
+
+ Option "Protocol" "PS/2"
+
+
+
+ To use this mouse as the PS/2 device and the OS supports automatic
+ PS/2 mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ To use this mouse as the USB device and the OS supports the generic
+ HID protocol:
+
+ Option "Protocol" "usb"
+
+
+
+ To use this mouse as the USB device and the OS supports automatic
+ mouse detection:
+
+ Option "Protocol" "Auto"
+
+
+
+ 7. Configuration Examples
+
+
+
+ This section shows some example InputDevice section for popular mice.
+ All the examples assume that the mouse is connected to the PS/2 mouse
+ port, and the OS supports the PS/2 mouse initialization. It is also
+ assumed that /dev/mouse is a link to the PS/2 mouse port.
+
+ Logitech MouseMan+ has 4 buttons and a wheel. The following example
+ makes the wheel movement available as the button 5 and 6.
+
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "MouseMan+"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "MouseManPlusPS/2"
+ Option "Buttons" "6"
+ Option "ZAxisMapping" "5 6"
+ EndSection
+ ______________________________________________________________________
+
+
+
+ You can change button number assignment using the xmodmap command
+ AFTER you start the X server with the above configuration. You may
+ not like to use the wheel as the button 2 and rather want the side
+ button (button 4) act like the button 2. You may also want to map the
+ wheel movement to the button 4 and 5. This can be done by the
+ following command:
+
+
+ xmodmap -e "pointer = 1 6 3 2 4 5"
+
+
+
+ After this command is run, the correspondence between the buttons and
+ button numbers will be as shown in the following table.
+
+
+ Physical Buttons Reported as:
+ ------------------------------------
+ 1 Left Button Button 1
+ 2 Wheel Button Button 6
+ 3 Right Button Button 3
+ 4 Side Button Button 2
+ 5 Wheel Negative Move Button 4
+ 6 Wheel Positive Move Button 5
+
+
+
+ For the MS IntelliMouse Explorer which as a wheel and 5 buttons, you
+ may have the following InputDevice section.
+
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "IntelliMouse Explorer"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "ExplorerPS/2"
+ Option "Buttons" "7"
+ Option "ZAxisMapping" "6 7"
+ EndSection
+ ______________________________________________________________________
+
+
+
+ The IntelliMouse Explorer has 5 buttons, thus, you should give "7" to
+ the Buttons option if you want to map the wheel movement to buttons (6
+ and 7). With this configuration, the correspondence between the
+ buttons and button numbers will be as follows:
+
+
+ Physical Buttons Reported as:
+ ------------------------------------
+ 1 Left Button Button 1
+ 2 Wheel Button Button 2
+ 3 Right Button Button 3
+ 4 Side Button 1 Button 4
+ 5 Side Button 2 Button 5
+ 6 Wheel Negative Move Button 6
+ 7 Wheel Positive Move Button 7
+
+
+
+ You can change button number assignment using xmodmap AFTER you
+ started the X server with the above configuration.
+
+
+ xmodmap -e "pointer = 1 2 3 4 7 5 6"
+
+
+
+ The above command will moves the side button 2 to the button 7 and
+ make the wheel movement reported as the button 5 and 6. See the table
+ below.
+
+
+ Physical Buttons Reported as:
+ ------------------------------------
+ 1 Left Button Button 1
+ 2 Wheel Button Button 2
+ 3 Right Button Button 3
+ 4 Side Button 1 Button 4
+ 5 Side Button 2 Button 7
+ 6 Wheel Negative Move Button 5
+ 7 Wheel Positive Move Button 6
+
+
+
+ For the A4 Tech WinEasy mouse which has two wheels and 3 buttons, you
+ may have the following InputDevice section.
+
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "WinEasy"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "IMPS/2"
+ Option "Buttons" "7"
+ Option "ZAxisMapping" "4 5 6 7"
+ EndSection
+ ______________________________________________________________________
+
+
+
+ The movement of the first wheel is mapped to the button 4 and 5. The
+ second wheel's movement will be reported as the buttons 6 and 7.
+
+ The Kensington Expert mouse is really a trackball. It has 4 buttons
+ arranged in a rectangle around the ball.
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "DLB"
+ Driver "mouse"
+ Option "Protocol" "ThinkingMousePS/2"
+ Option "Buttons" "3"
+ Option "Emulate3Buttons"
+ Option "Device" "/dev/mouse"
+ Option "DragLockButtons" "2 1 4 3"
+ EndSection
+ ______________________________________________________________________
+
+
+ In this example, button 2 is a drag lock button for button number 1,
+ and button 4 is a drag lock button for button 3. Since button 2 is
+ above button 1 and button 4 is above button 3 in the layout of this
+ trackball, this is reasonable.
+
+ Because button 2 is being used as a drag lock, it can not be used as
+ an ordinary button. However, it can be activated by using the
+ "Emulate3Buttons" feature. However, some people my be unable to press
+ two buttons at the same time. They may prefer the following
+ InputDevice section which defines button 4 as a master drag lock
+ button, and leaves button 2 free for ordinary use.
+
+ ______________________________________________________________________
+ Section "InputDevice"
+ Identifier "MasterDLB"
+ Driver "mouse"
+ Option "Protocol" "ThinkingMousePS/2"
+ Option "Buttons" "3"
+ Option "Device" "/dev/mouse"
+ Option "DragLockButtons" "4"
+ EndSection
+ ______________________________________________________________________
+
+
+
diff --git a/driver/xf86-input-mouse/README.sgml b/driver/xf86-input-mouse/README.sgml
new file mode 100644
index 000000000..37ccc2964
--- /dev/null
+++ b/driver/xf86-input-mouse/README.sgml
@@ -0,0 +1,1125 @@
+<!DOCTYPE linuxdoc PUBLIC "-//Xorg//DTD linuxdoc//EN" [
+<!ENTITY % defs SYSTEM "defs.ent"> %defs;
+]>
+
+<article>
+<title>Mouse Support in X11R&relvers;
+<author>Kazutaka Yokota
+<date>17 December 2002
+
+<ident>
+</ident>
+
+<toc>
+
+<sect>Introduction <p>
+
+This document describes mouse support in X.Org Foundation's X11R&relvers; server.
+
+Mouse configuration has often been mysterious task for
+novice users.
+However, once you learn several basics, it is straightforward
+to write the mouse <tt>"InputDevice"</tt>
+section in the <tt>xorg.conf</tt> file by hand.
+
+<sect>Supported Hardware <p>
+
+The X.Org Foundation X server supports four classes of mice:
+serial, bus and PS/2 mice, and additional mouse types supported by
+specific operating systems, such as USB mice.
+
+<descrip>
+<tag>Serial mouse</tag>
+The serial mouse has been the most popular pointing device for
+PCs.
+There have been numerous serial mouse models from a number of
+manufactures.
+Despite the wide range of variations, there have been relatively
+few protocols (data format) with which the serial mouse talks
+to the host computer.
+
+The modern serial mouse conforms to the PnP COM device specification
+so that the host computer can automatically detect the mouse
+and load an appropriate driver.
+The X server supports this specification and can detect
+popular PnP serial mouse models on most platforms.
+
+<tag>Bus mouse</tag>
+The bus mouse connects to a dedicated interface card in an expansion
+slot.
+Some video cards, notably those from ATI, and integrated I/O
+cards may also have a bus mouse connector.
+Some bus mice are known as `InPort mouse'.
+
+Note that some mouse manufactures have sold a package including a serial mouse
+and a serial interface card.
+Don't confuse this type of products with the genuine bus mouse.
+
+<tag>PS/2 mouse</tag>
+They are sometimes called `Mouse-port mouse'.
+The PS/2 mouse is becoming increasingly common and popular.
+
+The PS/2 mouse is an intelligent device and may have more than
+three buttons and a wheel or a roller.
+The PS/2 mouse is usually compatible with the original PS/2 mouse from IBM
+immediately after power up.
+The PS/2 mouse with additional features requires a specialized
+initialization procedure to enable these features.
+Without proper initialization, it behaves as though it were an ordinary
+two or three button mouse.
+
+<tag>USB mouse </tag>
+USB (Universal Serial Bus) ports are present on most modern
+computers. Several devices can be plugged into this bus, including
+mice and keyboards.
+
+The server includes support for USB mice on some systems.
+</descrip>
+
+Many mice nowadays can be used both as a serial mouse and as a PS/2 mouse.
+They has a logic to distinguish which interface it is connected to.
+However, the mouse which is not marketed as compatible with both
+serial and PS/2 mouse interface lacks this logic and cannot be
+used in such a way, even if you can find an appropriate
+adapter with which you can connect the PS/2 mouse to a serial port
+or visa versa.
+
+X11R&relvers; supports the mouse with a wheel, a roller or a knob.
+Its action is detected as the Z (third) axis motion of the mouse.
+As the X server or clients normally do not use the Z axis movement of the
+pointing device, a configuration option, <tt>"ZAxisMapping"</tt>,
+is provided to assign the Z axis movement to another axis or a pair
+of buttons (see below).
+
+<sect>OS Support for Mice <p>
+
+<sect1>Summary of Supported Mouse Protocol Types <p>
+<verb>
+ Protocol Types
+ serial PnP BusMouse PS/2 Extended PS/2
+OS platforms protocols serial protocol protocol protocols
+ "Auto" "BusMouse" "PS/2" "xxxPS/2" USB
+-------------------------------------------------------------------------
+BSD/OS Ok ? ? ? ? ?
+FreeBSD Ok Ok Ok Ok SP*1 SP*1
+FreeBSD(98) Ok ? Ok NA NA ?
+Interactive Unix Ok NA ?*1 ?*1 NA ?
+Linux Ok Ok Ok Ok Ok ?
+Linux/98 Ok ? Ok NA NA ?
+LynxOS Ok NA Ok Ok NA ?
+NetBSD Ok Ok Ok SP*1 SP*1 SP*1
+NetBSD/pc98 Ok ? Ok NA NA NA
+OpenBSD Ok Ok Ok Ok*1 Ok*1 Ok*1
+OS/2 SP*2 SP*2 SP*2 SP*2 SP*2 ?
+SCO Ok ? SP*1 SP*1 NA ?
+Solaris 2.x Ok NA*1 ?*1 Ok Ok SP*1
+SVR4 Ok NA*1 SP*1 SP*1 NA ?
+PANIX Ok ? SP*1 SP*1 NA ?
+
+Ok: support is available, NA: not available, ?: untested or unknown.
+SP: support is available in a different form
+
+*1 Refer to the following sections for details.
+*2 X11R&relvers;/OS2 will support any type of mouse that the OS supports,
+ whether it is serial, bus mouse, or PnP type.
+
+</verb>
+
+<sect1>BSD/OS <p>
+No testing has been done with BSD/OS.
+
+<sect1>FreeBSD <p>
+FreeBSD supports the <tt>"SysMouse"</tt> protocol which must be
+specified when the <tt>moused</tt> daemon is running in versions 2.2.1
+or later.
+
+When running the <tt>moused</tt>daemon, you must always specify the
+<tt>/dev/sysmouse</tt> device and the <tt>"SysMouse"</tt> protocol
+to the X server, regardless of the actual type of your mouse.
+
+FreeBSD versions 2.2.6 or later include the kernel-level
+support for extended PS/2 mouse protocols and there is no need to specify
+the exact protocol name to the X server.
+Instead specify the <tt>"PS/2"</tt> or <tt>"Auto"</tt> protocol and
+the X server will automatically make use of the kernel-level support.
+
+In fact, <tt>"Auto"</tt> protocol support is really efficient in these
+versions.
+You may always specify <tt>"Auto"</tt> to any mouse, serial,
+bus or PS/2, unless the mouse is an old serial model which doesn't
+support PnP.
+
+FreeBSD versions 2.2.5 or earlier do not support extended PS/2
+mouse protocols (<tt>"xxxPS/2"</tt>).
+Always specify the <tt>"PS/2"</tt> protocol for any PS/2 mouse
+in these versions regardless of the brand of the mouse.
+
+FreeBSD versions 3.1 or later have support for USB mice.
+Specify the <tt>"Auto"</tt> protocol for the <tt>/dev/ums0</tt> device.
+(If the <tt>moused</tt> daemon is running for the USB mouse,
+you must use <tt>/dev/sysmouse</tt> instead of <tt>/dev/ums0</tt>
+as explained above.) See the <em>ums(4)</em> manual page for details.
+
+<sect1>FreeBSD(98) <p>
+The PS/2 mouse is not supported.
+
+<sect1>Interactive Unix <p>
+The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is not
+supported for the moment.
+
+The bus mouse and PS/2 mouse should be supported by using the
+appropriate device drivers.
+Use <tt>/dev/mouse</tt> for the <tt>"BusMouse"</tt> protocol
+and <tt>/dev/kdmouse</tt> for the <tt>"PS/2"</tt> protocol.
+These protocols are untested but may work.
+Please send success/failure reports to
+<email>michael.rohleder@stadt-frankfurt.de</email>.
+
+<sect1>Linux <p>
+All protocol types should work.
+
+<sect1>Linux/98 <p>
+The PS/2 mouse is not supported.
+
+<sect1>LynxOS <p>
+The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is disabled in
+LynxOS, because of limited TTY device driver functionality.
+
+<sect1>NetBSD <p>
+NetBSD 1.3.x and former does not support extended PS/2 mouse protocols
+(<tt>"xxxPS/2"</tt>).
+The PS/2 mouse device driver <tt>/dev/pms</tt> emulates the bus mouse.
+Therefore, you should always specify the <tt>"BusMouse"</tt> protocol for
+any PS/2 mouse regardless of the brand of the mouse.
+<p>
+The <tt>"wsmouse"</tt> protocol introduced in NetBSD
+1.4 along with the wscons console driver is supported. You need to run binaries
+compiled on NetBSD 1.4 to have support
+for it though. Use <tt>"/dev/wsmouse0"</tt> for the device. Refer to the
+<em>wsmouse(4)</em> manual page for kernel configuration informations.
+<p>
+This driver also provides support for USB mice. See the
+<em>ums(4)</em> manual page for details.
+
+<sect1>NetBSD/pc98 <p>
+The PS/2 mouse is not supported.
+
+<sect1>OpenBSD <p>
+The raw PS/2 mouse device driver <tt>/dev/psm0</tt> uses the raw PS/2
+mouse protocol.
+
+OpenBSD 2.2 and earlier does not support extended PS/2 mouse protocols
+(<tt>"xxxPS/2"</tt>) . Therefore, you should specify the
+<tt>"PS/2"</tt> protocol for any PS/2 mouse regardless of the brand of
+the mouse.
+
+OpenBSD 2.3 and later support all extended PS/2 mouse protocols.
+You can select the <tt>"Auto"</tt> protocol for PnP PS/2
+mice or any specific extended (<tt>"xxxPS/2"</tt>) protocol
+for non PnP mice.
+
+There is also a cooked PS/2 mouse device driver <tt>/dev/pms0</tt>
+which emulates the bus mouse. Specify the <tt>"BusMouse"</tt>
+protocol for any PS/2 mouse regardless of the brand of the mouse when
+using this device.
+<p>
+XFree86 3.3.6 support USB mice on OpenBSD 2.6 and later though the
+generic Human Interface Device (hid) <tt>/dev/uhid*</tt>. Select the
+<tt>"usb"</tt> protocol and the <tt>/dev/uhid*</tt> instance
+corresponding to your mouse as the device name.
+
+<sect1>OS/2 <p>
+X11R&relvers;/OS2 always uses the native mouse driver of the operating system
+and will support any type of pointer that the OS supports, whether it is
+serial, bus mouse, or PnP type.
+If the mouse works under Presentation Manager,
+it will also work under X11R&relvers;/OS2.
+
+Always specify <tt>"OSMouse"</tt> as the protocol type.
+
+<sect1>SCO <p>
+The bus and PS/2 mouse are supported with the <tt>"OSMouse"</tt>
+protocol type.
+
+The <tt>"OSMouse"</tt> may also be used with the serial mouse.
+
+<sect1>Solaris <p>
+Testing has been done with Solaris 2.5.1, 2.6, 7, 8, 9 and 10.
+
+On Solaris 10 1/06 and later versions with "virtual mouse" support,
+all PS/2 and USB mice connected to the system can be accessed via
+the /dev/mouse device using the VUID protocol, including USB mice
+plugged in after the X server is started. On older releases or
+to address mice individually, specific devices and protocols may
+be used.
+
+Logitech and Microsoft bus mice
+have not been tested, but might work with the <tt>/dev/logi</tt> and
+<tt>/dev/msm</tt> devices.
+Standard 2 and 3 button PS/2 mice work with the <tt>"PS/2"</tt> protocol
+type and the <tt>/dev/kdmouse</tt> device.
+USB mice work with the <tt>"VUID"</tt> protocol type and the
+<tt>/dev/mouse</tt> device.
+The PnP serial mouse support via the <tt>"Auto"</tt> protocol has been tested
+and does not work. The <tt>"Auto"</tt> protocol can however detect PS/2 and
+USB mice correctly.
+
+Additional USB mice can be connected using the <tt>"VUID"</tt> protocol type
+and the appropriate <tt>"/dev/usb/hid"</tt> device with the <tt>Option "StreamsModule" "usbms"</tt> line included in the associated <tt>"InputDevice"</tt>
+section.
+
+<sect1>SVR4 <p>
+The bus and PS/2 mouse may be supported with the <tt>"Xqueue"</tt>
+protocol type.
+
+The <tt>"Xqueue"</tt> may also be used with the serial mouse.
+
+The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is not
+tested.
+
+<sect1>PANIX <p>
+The PC/AT version of PANIX supports the bus and PS/2 mouse with the
+<tt>"Xqueue"</tt> protocol type.
+The PC-98 version of PANIX supports the bus mouse with the
+<tt>"Xqueue"</tt> protocol type.
+
+<sect>Configuring Your Mouse <p>
+
+Before using the <tt>xorgconfig</tt> program
+to set up mouse configuration, you must identify the interface type,
+the device name and the protocol type of your mouse.
+Blindly trying every possible combination of mouse settings
+will lead you nowhere.
+
+The first thing you need to know is the interface type
+of the mouse you are going to use.
+It can be determined by looking at the connector of the mouse.
+The serial mouse has a D-Sub female 9- or 25-pin connector.
+The bus mice have either a D-Sub male 9-pin connector
+or a round DIN 9-pin connector.
+The PS/2 mouse is equipped with a small, round DIN 6-pin connector.
+USB mice have a thin rectangular connector.
+Some mice come with adapters with which the connector can
+be converted to another. If you are to use such an adapter,
+remember that the connector at the very end of the mouse/adapter pair is
+what matters.
+
+The next thing to decide is a device node to use for the given interface.
+For the bus and PS/2 mice, there is little choice;
+your OS most possibly offers just one device node each
+for the bus mouse and PS/2 mouse.
+There may be more than one serial port to which the serial
+mouse can be attached.
+
+The next step is to guess the appropriate protocol type for the mouse.
+The X server may be able to select a protocol type for the given mouse
+automatically in some cases.
+Otherwise, the user has to choose one manually.
+Follow the guidelines below.
+
+<descrip>
+<tag>Bus mouse</tag>
+The bus and InPort mice always use <tt>"BusMouse"</tt>
+protocol regardless of the brand of the mouse.
+
+Some OSs may allow you to specify <tt>"Auto"</tt> as the
+protocol type for the bus mouse.
+
+<tag>PS/2 mouse</tag>
+The <tt>"PS/2"</tt> protocol should always be tried first for the PS/2 mouse
+regardless of the brand of the mouse.
+Any PS/2 mouse should work with this protocol type, although
+wheels and other additional features are unavailable in the
+X server.
+
+After verifying the mouse works with this protocol,
+you may choose to specify one of <tt>"xxxPS/2"</tt> protocols so that
+extra features are made available in the X server.
+However, support for these PS/2 mice assumes certain behavior of
+the underlying OS and may not always work as expected.
+Support for some PS/2 mouse models may be disabled all together
+for some OS platforms for this reason.
+
+Some OSs may allow you to specify <tt>"Auto"</tt> as the
+protocol type for the PS/2 mouse and the X server will automatically
+adjust itself.
+
+<tag>Serial mouse</tag>
+The server supports a wide range of mice, both old and new.
+If your mouse is of a relatively new model, it may conform to the
+PnP COM device specification and the X server may be able to
+detect an appropriate protocol type for the mouse automatically.
+
+Specify <tt>"Auto"</tt> as the protocol type and start the X server.
+If the mouse is not a PnP mouse, or the X server cannot determine
+a suitable protocol type, the server will print the following
+error message and abort.
+
+<verb>
+<mousename>: cannot determine the mouse protocol
+</verb>
+
+If the X server generates the above error message, you need to
+manually specify a protocol type for your mouse.
+Choose one from the following list:
+
+<itemize>
+ <item><tt>GlidePoint</tt>
+ <item><tt>IntelliMouse</tt>
+ <item><tt>Logitech</tt>
+ <item><tt>Microsoft</tt>
+ <item><tt>MMHittab</tt>
+ <item><tt>MMSeries</tt>
+ <item><tt>MouseMan</tt>
+ <item><tt>MouseSystems</tt>
+ <item><tt>ThinkingMouse</tt>
+</itemize>
+
+When you choose, keep in mind the following rule of thumb:
+
+<enum>
+<item><tt>"Logitech"</tt> protocol is for old serial mouse models
+from Logitech.
+Modern Logitech mice use either <tt>"MouseMan"</tt> or <tt>"Microsoft"</tt>
+protocol.
+<item>Most 2-button serial mice support the <tt>"Microsoft"</tt> protocol.
+<item>3-button serial mice may work with the <tt>"Mousesystems"</tt>
+protocol. If it doesn't, it may work instead with the
+<tt>"Microsoft"</tt> protocol although the third (middle) button won't
+function.
+3-button serial mice may also work with the <tt>"Mouseman"</tt>
+protocol under which the third button may function as expected.
+<item>3-button serial mice may have a small switch at the bottom
+of the mouse to choose between ``MS'' and ``PC'', or ``2'' and ``3''.
+``MS'' or ``2'' usually mean the <tt>"Microsoft"</tt> protocol.
+``PC'' or ``3'' will choose the <tt>"MouseSystems"</tt> protocol.
+<item>If the serial mouse has a roller or a wheel, it may be compatible
+with the <tt>"IntelliMouse"</tt> protocol.
+<item>If the serial mouse has a roller or a wheel and it doesn't work
+with the <tt>"IntelliMouse"</tt> protocol, you have to use it
+as a regular 2- or 3-button serial mouse.
+</enum>
+
+If the <tt>"Auto"</tt> protocol is specified and the mouse seems to be working,
+but you find that not all features of the mouse are available, that is
+because the X server does not have native support for that model of mouse
+and is using a ``compatible'' protocol according to PnP information.
+
+If you suspect this is the case with your mouse, please enter a
+bug report at http://bugzilla.freedesktop.org, using the xorg product.
+
+<tag>USB mouse</tag>
+If your mouse is connected to the USB port, it can either be supported
+by the <tt>"Auto"</tt> protocol, or by an OS-specific protocol (see below),
+or as a generic Human Interface Device by the <tt>"usb"</tt> protocol.
+
+<tag>Standardized protocols</tag>
+Mouse device drivers in your OS may use the standardized protocol
+regardless of the model or the class of the mouse.
+For example, SVR4 systems may support <tt>"Xqueue"</tt> protocol.
+In FreeBSD the system mouse device <tt>/dev/sysmouse</tt>
+uses the <tt>"SysMouse"</tt> protocol.
+Please refer to the OS support section of this file for more information.
+
+</descrip>
+
+<sect>xorg.conf Options <p>
+
+The old <tt>Pointer</tt> section has been replaced by a more general
+<tt>InputDevice</tt> section. The following is a minimal example
+of an <tt>InputDevice</tt> section for a mouse:
+
+<code>
+Section "InputDevice"
+ Identifier "Mouse 1"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "Auto"
+EndSection
+</code>
+
+The <tt>mouse</tt> driver supports the following config file options:
+
+<sect1>Buttons <p>
+This option tells the X server the number of buttons on the mouse.
+Currently there is no reliable way to automatically detect the correct
+number.
+This option is the only means for the X server to obtain it.
+The default value is three.
+
+Note that if you intend to assign Z axis movement to button events
+using the <tt>ZAxisMapping</tt> option below, you need to take account
+of those buttons into <tt>N</tt> too.
+
+<verb>
+ Option "Buttons" "N"
+</verb>
+
+<sect1>ZAxisMapping <p>
+This option maps the Z axis (wheel) motion to buttons or to
+another axis.
+
+<verb>
+ Option "ZAxisMapping" "X"
+ Option "ZAxisMapping" "Y"
+ Option "ZAxisMapping" "N1 N2"
+ Option "ZAxisMapping" "N1 N2 N3 N4"
+</verb>
+
+The first example will map the Z axis motion to the X axis motion.
+Whenever the user moves the wheel/roller, its movement is reported as
+the X axis motion. When the wheel/roller stays still, the real X axis
+motion is reported as is. The third example will map negative Z axis
+motion to the button <tt>N1</tt> and positive Z axis motion to
+the button <tt>N2</tt>. If this option is used and the buttons <tt>N1</tt>
+or <tt>N2</tt> actually exists in the mouse,
+their actions won't be detected by the X server.
+
+The last example is useful for the mouse with two wheels of which
+the second wheel is used to generate horizontal scroll action,
+and the mouse which has a knob or a stick which can detect the horizontal
+force applied by the user.
+The motion of the second wheel will be mapped to the buttons <tt>N3</tt>,
+for the negative direction, and <tt>N4</tt>, for the positive direction.
+If the buttons <tt>N3</tt> and <tt>N4</tt> actually exist in this mouse,
+their actions won't be detected by the X server.
+
+NOTE #1: horizontal movement may not always be detected
+by the current version of the X11R&relvers; X servers,
+because there appears to be no accepted standard as to how the horizontal
+direction is encoded in mouse data.
+
+NOTE #2: Some mice think left is the negative horizontal direction,
+others may think otherwise.
+Moreover, there are some mice whose two wheels are both mounted vertically,
+and the direction of the second vertical wheel does not match the
+first one's.
+
+You need to edit the <tt>xorg.conf</tt> file by hand to change this option if
+the default value of "4 5 6 7" does not match the needs of your configuration.
+
+<sect1>Resolution <p>
+The following option will set the mouse device resolution to <tt>N</tt>
+counts per inch, if possible:
+
+<verb>
+ Option "Resolution" "N"
+</verb>
+
+Not all mice and OSs can support this option.
+
+<sect1>Drag Lock Buttons <p>
+Some people find it difficult or inconvenient to hold a trackball
+button down, while at the same time moving the ball. Drag lock buttons
+simulate the holding down of another button. When a drag lock button
+is first pressed, its target buttons is "locked" down until the
+second time the lock button is released, or until the button itself
+is pressed and released. This allows the starting of a drag, the movement
+of the trackball, and the ending of the drag to be separate operations.
+
+<verb>
+ Option "DragLockButtons" "W X Y Z"
+</verb>
+
+This option consists of pairs of buttons. Each lock button number
+is followed by the number of the button that it locks. In the above,
+button number "W" is a drag lock button for button "X" and button number
+"Y" is a drag lock button for button "Z".
+
+It may not be desirable to use multiple buttons as drag locks.
+Instead, a "master drag lock button" may be defined. A master drag
+lock button acts as a "META" key. After a master lock button is released,
+the next button pressed is "locked" and not released until the
+second time the real button is released.
+
+<verb>
+ Option "DragLockButtons" "M"
+</verb>
+
+Since button "M" is unpaired it is a master drag lock button.
+
+<sect>Mouse Gallery <p>
+
+In all of the examples below, it is assumed that <tt>/dev/mouse</tt> is
+a link to the appropriate serial port or PS/2 mouse device.
+
+<sect1>MS IntelliMouse (serial, PS/2) <p>
+This mouse has a wheel which also acts as the button 2 (middle button).
+The wheel movement is recognized as the Z axis motion.
+This behavior is not compatible with XFree86 versions prior to 3.3.2,
+but is more consistent with the support for other mice with
+wheels or rollers.
+If you want to make the wheel behave like before,
+you can use the <tt>"ZAxisMapping"</tt> option as described above.
+<p>
+IntelliMouse supports the PnP COM device specification.
+<p>
+To use this mouse as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "IMPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the wheel won't work in this case):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>MS IntelliMouse Explorer (PS/2, USB) <p>
+This mouse has a wheel which also acts as the button 2 (middle button).
+There are two side buttons; they are recognized as the buttons 4 and 5.
+The wheel movement is recognized as the Z axis motion.
+<p>
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "ExplorerPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the wheel and the side buttons won't work in this case):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+To use this mouse as the USB device and the OS supports the generic
+HID protocol:
+<verb>
+ Option "Protocol" "usb"
+</verb>
+
+To use this mouse as the USB device and the OS supports automatic
+mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>Kensington Thinking Mouse and Kensington Expert Mouse (serial, PS/2) <p>
+These mice have four buttons.
+The Kensington Expert Mouse is really a trackball.
+Both Thinking mice support the PnP COM device specification.
+<p>
+To use this mouse as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "ThinkingMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "ThinkingMousePS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the third and the fourth buttons act as though they
+were the first and the second buttons):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>Genius NetScroll (PS/2) <p>
+This mouse has four buttons and a roller. The roller movement is
+recognized as the Z axis motion.
+<p>
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "NetScrollPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the roller and the fourth button won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>Genius NetMouse and NetMouse Pro (serial, PS/2) <p>
+These mice have a "magic button" which is used like a wheel or a
+roller. The "magic button" action is recognized as the Z axis motion.
+NetMouse Pro is identical to NetMouse except that it has the third
+button on the left hand side.
+<p>
+NetMouse and NetMouse Pro support the PnP COM device specification.
+When used as a serial mouse, they are compatible with MS IntelliMouse.
+<p>
+To use these mice as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "NetMousePS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the "magic button" and the third button won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>Genius NetScroll Optical (PS/2, USB) <p>
+This mouse has a wheel which also acts as the button 2 (middle button),
+and two side buttons which are recognized as the buttons 4 and 5.
+It is compatible with NetMouse and NetMouse Pro.
+<p>
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "NetMousePS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the wheel and the side buttons won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+To use this mouse as the USB device and the OS supports the generic
+HID protocol:
+<verb>
+ Option "Protocol" "usb"
+</verb>
+
+To use this mouse as the USB device and the OS supports automatic
+mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>ALPS GlidePoint (serial, PS/2) <p>
+The serial version of this pad device has been supported since XFree86
+3.2. `Tapping' action is interpreted as the fourth button press.
+(IMHO, the fourth button of GlidePoint should always be mapped to the first
+button in order to make this pad behave like the other pad products.)
+<p>
+To use this pad as a serial device:
+<verb>
+ Option "Protocol" "GlidePoint"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "GlidePointPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>ASCII MieMouse (serial, PS/2) <p>
+This mouse appears to be OEM from Genius. Although its shape is
+quite different, it works like Genius NetMouse Pro. This mouse has a
+"knob" which is used like a wheel or a roller. The "knob" action is
+recognized as the Z axis motion.
+<p>
+MieMouse supports the PnP COM device specification. When used as a
+serial mouse, it is compatible with MS IntelliMouse.
+<p>
+To use this mouse as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "NetMousePS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the knob and the third button won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>Logitech MouseMan+ and FirstMouse+ (serial, PS/2) <p>
+MouseMan+ has two buttons on top, one side button and a roller.
+FirstMouse+ has two buttons and a roller. The roller movement is
+recognized as the Z axis motion. The roller also acts as the third
+button. The side button is recognized as the fourth button.
+<p>
+MouseMan+ and FirstMouse+ support the PnP COM device specification.
+They have MS IntelliMouse compatible mode when used as a serial mouse.
+<p>
+To use these mice as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "MouseManPlusPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the wheel and the fourth button won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>IBM ScrollPoint (PS/2) <p>
+ScrollPoint has a "stick" in between the two buttons.
+This "stick" is the same as the stick-shaped pointing device often
+found on notebook computers, on which you move the mouse cursor by
+pushing the stick.
+The stick movement is recognized as the Z axis motion.
+You can push the stick to right and left, as well as forward and
+backward. Give four numbers to <tt>ZAxisMapping</tt> option
+to map movement along all these four directions to button actions.
+<p>
+This mouse is compatible with Logitech MouseMan+.
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "MouseManPlusPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the stick won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>8D ScrollMouse (serial, PS/2) <p>
+ScrollMouse, also known as GyroMouse, has a "stick" similar to
+IBM ScrollPoint.
+The stick movement is recognized as the Z axis motion.
+You can push the stick to right and left, as well as forward and
+backward. Give four numbers to <tt>ZAxisMapping</tt> option
+to map movement along all these four directions to button actions.
+<p>
+ScrollMouse supports the PnP COM device specification. When used as a
+serial mouse, it is compatible with MS IntelliMouse.
+<p>
+To use this mouse as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "IMPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the stick won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect1>A4 Tech 4D mice (serial, PS/2, USB) <p>
+A4 Tech produces quit a number of mice with one or two wheels.
+Their mice may have 2, 3, or 4 buttons.
+The wheels movement is recognized as the Z axis motion.
+Give four numbers to <tt>ZAxisMapping</tt> option
+to map movement of both wheels to button actions.
+<p>
+4D mice support the PnP COM device specification. When used as a
+serial mouse, it is compatible with MS IntelliMouse.
+<p>
+To use this mouse as a serial device:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+or:
+<verb>
+ Option "Protocol" "IntelliMouse"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports PS/2 mouse
+initialization:
+<verb>
+ Option "Protocol" "IMPS/2"
+</verb>
+
+To use this mouse as the PS/2 device but the OS does not support PS/2 mouse
+initialization (the wheels won't work):
+<verb>
+ Option "Protocol" "PS/2"
+</verb>
+
+To use this mouse as the PS/2 device and the OS supports automatic
+PS/2 mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+To use this mouse as the USB device and the OS supports the generic
+HID protocol:
+<verb>
+ Option "Protocol" "usb"
+</verb>
+
+To use this mouse as the USB device and the OS supports automatic
+mouse detection:
+<verb>
+ Option "Protocol" "Auto"
+</verb>
+
+<sect>Configuration Examples <p>
+
+This section shows some example <tt>InputDevice</tt> section for
+popular mice. All the examples assume that the mouse is connected to
+the PS/2 mouse port, and the OS supports the PS/2 mouse initialization.
+It is also assumed that <tt>/dev/mouse</tt> is
+a link to the PS/2 mouse port.
+
+Logitech MouseMan+ has 4 buttons and a wheel. The following example
+makes the wheel movement available as the button 5 and 6.
+
+<code>
+Section "InputDevice"
+ Identifier "MouseMan+"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "MouseManPlusPS/2"
+ Option "Buttons" "6"
+ Option "ZAxisMapping" "5 6"
+EndSection
+</code>
+
+You can change button number assignment using the <tt>xmodmap</tt>
+command AFTER you start the X server with the above configuration.
+You may not like to use the wheel as the button 2 and rather want
+the side button (button 4) act like the button 2. You may also
+want to map the wheel movement to the button 4 and 5.
+This can be done by the following command:
+
+<verb>
+ xmodmap -e "pointer = 1 6 3 2 4 5"
+</verb>
+
+After this command is run, the correspondence between the buttons and
+button numbers will be as shown in the following table.
+
+<verb>
+Physical Buttons Reported as:
+------------------------------------
+1 Left Button Button 1
+2 Wheel Button Button 6
+3 Right Button Button 3
+4 Side Button Button 2
+5 Wheel Negative Move Button 4
+6 Wheel Positive Move Button 5
+</verb>
+
+Starting in the Xorg 6.9 release, you can also achieve this in your
+configuration file by adding this to the "InputDevice" section in xorg.conf:
+<verb>
+ Option "ButtonMapping" "1 6 3 2 4 5"
+</verb>
+
+
+For the MS IntelliMouse Explorer which as a wheel and 5 buttons,
+you may have the following <tt>InputDevice</tt> section.
+
+<code>
+Section "InputDevice"
+ Identifier "IntelliMouse Explorer"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "ExplorerPS/2"
+ Option "Buttons" "7"
+ Option "ZAxisMapping" "6 7"
+EndSection
+</code>
+
+The IntelliMouse Explorer has 5 buttons, thus, you should give "7"
+to the <tt>Buttons</tt> option if you want to map the wheel movement
+to buttons (6 and 7).
+With this configuration, the correspondence between the buttons and
+button numbers will be as follows:
+
+<verb>
+Physical Buttons Reported as:
+------------------------------------
+1 Left Button Button 1
+2 Wheel Button Button 2
+3 Right Button Button 3
+4 Side Button 1 Button 4
+5 Side Button 2 Button 5
+6 Wheel Negative Move Button 6
+7 Wheel Positive Move Button 7
+</verb>
+
+You can change button number assignment using <tt>xmodmap</tt>
+AFTER you started the X server with the above configuration.
+
+<verb>
+ xmodmap -e "pointer = 1 2 3 4 7 5 6"
+</verb>
+
+The above command will moves the side button 2 to the button 7 and
+make the wheel movement reported as the button 5 and 6. See
+the table below.
+
+<verb>
+Physical Buttons Reported as:
+------------------------------------
+1 Left Button Button 1
+2 Wheel Button Button 2
+3 Right Button Button 3
+4 Side Button 1 Button 4
+5 Side Button 2 Button 7
+6 Wheel Negative Move Button 5
+7 Wheel Positive Move Button 6
+</verb>
+
+For the A4 Tech WinEasy mouse which has two wheels and 3 buttons,
+you may have the following <tt>InputDevice</tt> section.
+
+<code>
+Section "InputDevice"
+ Identifier "WinEasy"
+ Driver "mouse"
+ Option "Device" "/dev/mouse"
+ Option "Protocol" "IMPS/2"
+ Option "Buttons" "7"
+ Option "ZAxisMapping" "4 5 6 7"
+EndSection
+</code>
+
+The movement of the first wheel is mapped to the button 4 and 5. The
+second wheel's movement will be reported as the buttons 6 and 7.
+
+The Kensington Expert mouse is really a trackball. It has 4 buttons
+arranged in a rectangle around the ball.
+
+<code>
+Section "InputDevice"
+ Identifier "DLB"
+ Driver "mouse"
+ Option "Protocol" "ThinkingMousePS/2"
+ Option "Buttons" "3"
+ Option "Emulate3Buttons"
+ Option "Device" "/dev/mouse"
+ Option "DragLockButtons" "2 1 4 3"
+EndSection
+</code>
+In this example, button 2 is a drag lock button for button
+number 1, and button 4 is a drag lock button for button 3.
+Since button 2 is above button 1 and button 4 is above button 3
+in the layout of this trackball, this is reasonable.
+
+Because button 2 is being used as a drag lock, it can not be
+used as an ordinary button. However, it can be activated by
+using the "Emulate3Buttons" feature. However, some people my
+be unable to press two buttons at the same time. They may
+prefer the following <tt>InputDevice</tt> section which
+defines button 4 as a master drag lock button, and leaves
+button 2 free for ordinary use.
+<code>
+Section "InputDevice"
+ Identifier "MasterDLB"
+ Driver "mouse"
+ Option "Protocol" "ThinkingMousePS/2"
+ Option "Buttons" "3"
+ Option "Device" "/dev/mouse"
+ Option "DragLockButtons" "4"
+EndSection
+</code>
+
+</article>
diff --git a/driver/xf86-input-mouse/aclocal.m4 b/driver/xf86-input-mouse/aclocal.m4
new file mode 100644
index 000000000..c578d51de
--- /dev/null
+++ b/driver/xf86-input-mouse/aclocal.m4
@@ -0,0 +1,7898 @@
+# generated automatically by aclocal 1.9.6 -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004,
+# 2005 Free Software Foundation, Inc.
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*-
+
+# serial 48 AC_PROG_LIBTOOL
+
+
+# AC_PROVIDE_IFELSE(MACRO-NAME, IF-PROVIDED, IF-NOT-PROVIDED)
+# -----------------------------------------------------------
+# If this macro is not defined by Autoconf, define it here.
+m4_ifdef([AC_PROVIDE_IFELSE],
+ [],
+ [m4_define([AC_PROVIDE_IFELSE],
+ [m4_ifdef([AC_PROVIDE_$1],
+ [$2], [$3])])])
+
+
+# AC_PROG_LIBTOOL
+# ---------------
+AC_DEFUN([AC_PROG_LIBTOOL],
+[AC_REQUIRE([_AC_PROG_LIBTOOL])dnl
+dnl If AC_PROG_CXX has already been expanded, run AC_LIBTOOL_CXX
+dnl immediately, otherwise, hook it in at the end of AC_PROG_CXX.
+ AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [AC_LIBTOOL_CXX],
+ [define([AC_PROG_CXX], defn([AC_PROG_CXX])[AC_LIBTOOL_CXX
+ ])])
+dnl And a similar setup for Fortran 77 support
+ AC_PROVIDE_IFELSE([AC_PROG_F77],
+ [AC_LIBTOOL_F77],
+ [define([AC_PROG_F77], defn([AC_PROG_F77])[AC_LIBTOOL_F77
+])])
+
+dnl Quote A][M_PROG_GCJ so that aclocal doesn't bring it in needlessly.
+dnl If either AC_PROG_GCJ or A][M_PROG_GCJ have already been expanded, run
+dnl AC_LIBTOOL_GCJ immediately, otherwise, hook it in at the end of both.
+ AC_PROVIDE_IFELSE([AC_PROG_GCJ],
+ [AC_LIBTOOL_GCJ],
+ [AC_PROVIDE_IFELSE([A][M_PROG_GCJ],
+ [AC_LIBTOOL_GCJ],
+ [AC_PROVIDE_IFELSE([LT_AC_PROG_GCJ],
+ [AC_LIBTOOL_GCJ],
+ [ifdef([AC_PROG_GCJ],
+ [define([AC_PROG_GCJ], defn([AC_PROG_GCJ])[AC_LIBTOOL_GCJ])])
+ ifdef([A][M_PROG_GCJ],
+ [define([A][M_PROG_GCJ], defn([A][M_PROG_GCJ])[AC_LIBTOOL_GCJ])])
+ ifdef([LT_AC_PROG_GCJ],
+ [define([LT_AC_PROG_GCJ],
+ defn([LT_AC_PROG_GCJ])[AC_LIBTOOL_GCJ])])])])
+])])# AC_PROG_LIBTOOL
+
+
+# _AC_PROG_LIBTOOL
+# ----------------
+AC_DEFUN([_AC_PROG_LIBTOOL],
+[AC_REQUIRE([AC_LIBTOOL_SETUP])dnl
+AC_BEFORE([$0],[AC_LIBTOOL_CXX])dnl
+AC_BEFORE([$0],[AC_LIBTOOL_F77])dnl
+AC_BEFORE([$0],[AC_LIBTOOL_GCJ])dnl
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ac_aux_dir/ltmain.sh"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+AC_SUBST(LIBTOOL)dnl
+
+# Prevent multiple expansion
+define([AC_PROG_LIBTOOL], [])
+])# _AC_PROG_LIBTOOL
+
+
+# AC_LIBTOOL_SETUP
+# ----------------
+AC_DEFUN([AC_LIBTOOL_SETUP],
+[AC_PREREQ(2.50)dnl
+AC_REQUIRE([AC_ENABLE_SHARED])dnl
+AC_REQUIRE([AC_ENABLE_STATIC])dnl
+AC_REQUIRE([AC_ENABLE_FAST_INSTALL])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_PROG_LD])dnl
+AC_REQUIRE([AC_PROG_LD_RELOAD_FLAG])dnl
+AC_REQUIRE([AC_PROG_NM])dnl
+
+AC_REQUIRE([AC_PROG_LN_S])dnl
+AC_REQUIRE([AC_DEPLIBS_CHECK_METHOD])dnl
+# Autoconf 2.13's AC_OBJEXT and AC_EXEEXT macros only works for C compilers!
+AC_REQUIRE([AC_OBJEXT])dnl
+AC_REQUIRE([AC_EXEEXT])dnl
+dnl
+
+AC_LIBTOOL_SYS_MAX_CMD_LEN
+AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE
+AC_LIBTOOL_OBJDIR
+
+AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl
+_LT_AC_PROG_ECHO_BACKSLASH
+
+case $host_os in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e 1s/^X//'
+[sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g']
+
+# Same as above, but do not quote variable references.
+[double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g']
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+
+# Constants:
+rm="rm -f"
+
+# Global variables:
+default_ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+ltmain="$ac_aux_dir/ltmain.sh"
+ofile="$default_ofile"
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+AC_CHECK_TOOL(AR, ar, false)
+AC_CHECK_TOOL(RANLIB, ranlib, :)
+AC_CHECK_TOOL(STRIP, strip, :)
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$AR" && AR=ar
+test -z "$AR_FLAGS" && AR_FLAGS=cru
+test -z "$AS" && AS=as
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+test -z "$LD" && LD=ld
+test -z "$LN_S" && LN_S="ln -s"
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+test -z "$NM" && NM=nm
+test -z "$SED" && SED=sed
+test -z "$OBJDUMP" && OBJDUMP=objdump
+test -z "$RANLIB" && RANLIB=:
+test -z "$STRIP" && STRIP=:
+test -z "$ac_objext" && ac_objext=o
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs$old_deplibs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+ case $host_os in
+ openbsd*)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$oldlib"
+ ;;
+ *)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$oldlib"
+ ;;
+ esac
+ old_archive_cmds="$old_archive_cmds~\$RANLIB \$oldlib"
+fi
+
+_LT_CC_BASENAME([$compiler])
+
+# Only perform the check for file, if the check method requires it
+case $deplibs_check_method in
+file_magic*)
+ if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+ AC_PATH_MAGIC
+ fi
+ ;;
+esac
+
+AC_PROVIDE_IFELSE([AC_LIBTOOL_DLOPEN], enable_dlopen=yes, enable_dlopen=no)
+AC_PROVIDE_IFELSE([AC_LIBTOOL_WIN32_DLL],
+enable_win32_dll=yes, enable_win32_dll=no)
+
+AC_ARG_ENABLE([libtool-lock],
+ [AC_HELP_STRING([--disable-libtool-lock],
+ [avoid locking (might break parallel builds)])])
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+AC_ARG_WITH([pic],
+ [AC_HELP_STRING([--with-pic],
+ [try to use only PIC/non-PIC objects @<:@default=use both@:>@])],
+ [pic_mode="$withval"],
+ [pic_mode=default])
+test -z "$pic_mode" && pic_mode=default
+
+# Use C for the default configuration in the libtool script
+tagname=
+AC_LIBTOOL_LANG_C_CONFIG
+_LT_AC_TAGCONFIG
+])# AC_LIBTOOL_SETUP
+
+
+# _LT_AC_SYS_COMPILER
+# -------------------
+AC_DEFUN([_LT_AC_SYS_COMPILER],
+[AC_REQUIRE([AC_PROG_CC])dnl
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+])# _LT_AC_SYS_COMPILER
+
+
+# _LT_CC_BASENAME(CC)
+# -------------------
+# Calculate cc_basename. Skip known compiler wrappers and cross-prefix.
+AC_DEFUN([_LT_CC_BASENAME],
+[for cc_temp in $1""; do
+ case $cc_temp in
+ compile | *[[\\/]]compile | ccache | *[[\\/]]ccache ) ;;
+ distcc | *[[\\/]]distcc | purify | *[[\\/]]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+])
+
+
+# _LT_COMPILER_BOILERPLATE
+# ------------------------
+# Check for compiler boilerplate output or warnings with
+# the simple compiler test code.
+AC_DEFUN([_LT_COMPILER_BOILERPLATE],
+[ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+])# _LT_COMPILER_BOILERPLATE
+
+
+# _LT_LINKER_BOILERPLATE
+# ----------------------
+# Check for linker boilerplate output or warnings with
+# the simple link test code.
+AC_DEFUN([_LT_LINKER_BOILERPLATE],
+[ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+])# _LT_LINKER_BOILERPLATE
+
+
+# _LT_AC_SYS_LIBPATH_AIX
+# ----------------------
+# Links a minimal program and checks the executable
+# for the system default hardcoded library path. In most cases,
+# this is /usr/lib:/lib, but when the MPI compilers are used
+# the location of the communication and MPI libs are included too.
+# If we don't find anything, use the default library path according
+# to the aix ld manual.
+AC_DEFUN([_LT_AC_SYS_LIBPATH_AIX],
+[AC_LINK_IFELSE(AC_LANG_PROGRAM,[
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi],[])
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+])# _LT_AC_SYS_LIBPATH_AIX
+
+
+# _LT_AC_SHELL_INIT(ARG)
+# ----------------------
+AC_DEFUN([_LT_AC_SHELL_INIT],
+[ifdef([AC_DIVERSION_NOTICE],
+ [AC_DIVERT_PUSH(AC_DIVERSION_NOTICE)],
+ [AC_DIVERT_PUSH(NOTICE)])
+$1
+AC_DIVERT_POP
+])# _LT_AC_SHELL_INIT
+
+
+# _LT_AC_PROG_ECHO_BACKSLASH
+# --------------------------
+# Add some code to the start of the generated configure script which
+# will find an echo command which doesn't interpret backslashes.
+AC_DEFUN([_LT_AC_PROG_ECHO_BACKSLASH],
+[_LT_AC_SHELL_INIT([
+# Check that we are running under the correct shell.
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+case X$ECHO in
+X*--fallback-echo)
+ # Remove one level of quotation (which was required for Make).
+ ECHO=`echo "$ECHO" | sed 's,\\\\\[$]\\[$]0,'[$]0','`
+ ;;
+esac
+
+echo=${ECHO-echo}
+if test "X[$]1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X[$]1" = X--fallback-echo; then
+ # Avoid inline document here, it may be left over
+ :
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t' ; then
+ # Yippee, $echo works!
+ :
+else
+ # Restart under the correct shell.
+ exec $SHELL "[$]0" --no-reexec ${1+"[$]@"}
+fi
+
+if test "X[$]1" = X--fallback-echo; then
+ # used as fallback echo
+ shift
+ cat <<EOF
+[$]*
+EOF
+ exit 0
+fi
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+if test -z "$ECHO"; then
+if test "X${echo_test_string+set}" != Xset; then
+# find a string as large as possible, as long as the shell can cope with it
+ for cmd in 'sed 50q "[$]0"' 'sed 20q "[$]0"' 'sed 10q "[$]0"' 'sed 2q "[$]0"' 'echo test'; do
+ # expected sizes: less than 2Kb, 1Kb, 512 bytes, 16 bytes, ...
+ if (echo_test_string=`eval $cmd`) 2>/dev/null &&
+ echo_test_string=`eval $cmd` &&
+ (test "X$echo_test_string" = "X$echo_test_string") 2>/dev/null
+ then
+ break
+ fi
+ done
+fi
+
+if test "X`($echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ :
+else
+ # The Solaris, AIX, and Digital Unix default echo programs unquote
+ # backslashes. This makes it impossible to quote backslashes using
+ # echo "$something" | sed 's/\\/\\\\/g'
+ #
+ # So, first we look for a working echo in the user's PATH.
+
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for dir in $PATH /usr/ucb; do
+ IFS="$lt_save_ifs"
+ if (test -f $dir/echo || test -f $dir/echo$ac_exeext) &&
+ test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($dir/echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ echo="$dir/echo"
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+
+ if test "X$echo" = Xecho; then
+ # We didn't find a better echo, so look for alternatives.
+ if test "X`(print -r '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`(print -r "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ # This shell has a builtin print -r that does the trick.
+ echo='print -r'
+ elif (test -f /bin/ksh || test -f /bin/ksh$ac_exeext) &&
+ test "X$CONFIG_SHELL" != X/bin/ksh; then
+ # If we have ksh, try running configure again with it.
+ ORIGINAL_CONFIG_SHELL=${CONFIG_SHELL-/bin/sh}
+ export ORIGINAL_CONFIG_SHELL
+ CONFIG_SHELL=/bin/ksh
+ export CONFIG_SHELL
+ exec $CONFIG_SHELL "[$]0" --no-reexec ${1+"[$]@"}
+ else
+ # Try using printf.
+ echo='printf %s\n'
+ if test "X`($echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ # Cool, printf works
+ :
+ elif echo_testing_string=`($ORIGINAL_CONFIG_SHELL "[$]0" --fallback-echo '\t') 2>/dev/null` &&
+ test "X$echo_testing_string" = 'X\t' &&
+ echo_testing_string=`($ORIGINAL_CONFIG_SHELL "[$]0" --fallback-echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ CONFIG_SHELL=$ORIGINAL_CONFIG_SHELL
+ export CONFIG_SHELL
+ SHELL="$CONFIG_SHELL"
+ export SHELL
+ echo="$CONFIG_SHELL [$]0 --fallback-echo"
+ elif echo_testing_string=`($CONFIG_SHELL "[$]0" --fallback-echo '\t') 2>/dev/null` &&
+ test "X$echo_testing_string" = 'X\t' &&
+ echo_testing_string=`($CONFIG_SHELL "[$]0" --fallback-echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ echo="$CONFIG_SHELL [$]0 --fallback-echo"
+ else
+ # maybe with a smaller string...
+ prev=:
+
+ for cmd in 'echo test' 'sed 2q "[$]0"' 'sed 10q "[$]0"' 'sed 20q "[$]0"' 'sed 50q "[$]0"'; do
+ if (test "X$echo_test_string" = "X`eval $cmd`") 2>/dev/null
+ then
+ break
+ fi
+ prev="$cmd"
+ done
+
+ if test "$prev" != 'sed 50q "[$]0"'; then
+ echo_test_string=`eval $prev`
+ export echo_test_string
+ exec ${ORIGINAL_CONFIG_SHELL-${CONFIG_SHELL-/bin/sh}} "[$]0" ${1+"[$]@"}
+ else
+ # Oops. We lost completely, so just stick with echo.
+ echo=echo
+ fi
+ fi
+ fi
+ fi
+fi
+fi
+
+# Copy echo and quote the copy suitably for passing to libtool from
+# the Makefile, instead of quoting the original, which is used later.
+ECHO=$echo
+if test "X$ECHO" = "X$CONFIG_SHELL [$]0 --fallback-echo"; then
+ ECHO="$CONFIG_SHELL \\\$\[$]0 --fallback-echo"
+fi
+
+AC_SUBST(ECHO)
+])])# _LT_AC_PROG_ECHO_BACKSLASH
+
+
+# _LT_AC_LOCK
+# -----------
+AC_DEFUN([_LT_AC_LOCK],
+[AC_ARG_ENABLE([libtool-lock],
+ [AC_HELP_STRING([--disable-libtool-lock],
+ [avoid locking (might break parallel builds)])])
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *ELF-32*)
+ HPUX_IA64_MODE="32"
+ ;;
+ *ELF-64*)
+ HPUX_IA64_MODE="64"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+*-*-irix6*)
+ # Find out which ABI we are using.
+ echo '[#]line __oline__ "configure"' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -melf32bsmip"
+ ;;
+ *N32*)
+ LD="${LD-ld} -melf32bmipn32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -melf64bmip"
+ ;;
+ esac
+ else
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ fi
+ rm -rf conftest*
+ ;;
+
+x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*|s390*-*linux*|sparc*-*linux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.o` in
+ *32-bit*)
+ case $host in
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_i386"
+ ;;
+ ppc64-*linux*|powerpc64-*linux*)
+ LD="${LD-ld} -m elf32ppclinux"
+ ;;
+ s390x-*linux*)
+ LD="${LD-ld} -m elf_s390"
+ ;;
+ sparc64-*linux*)
+ LD="${LD-ld} -m elf32_sparc"
+ ;;
+ esac
+ ;;
+ *64-bit*)
+ case $host in
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ ppc*-*linux*|powerpc*-*linux*)
+ LD="${LD-ld} -m elf64ppc"
+ ;;
+ s390*-*linux*)
+ LD="${LD-ld} -m elf64_s390"
+ ;;
+ sparc*-*linux*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -belf"
+ AC_CACHE_CHECK([whether the C compiler needs -belf], lt_cv_cc_needs_belf,
+ [AC_LANG_PUSH(C)
+ AC_TRY_LINK([],[],[lt_cv_cc_needs_belf=yes],[lt_cv_cc_needs_belf=no])
+ AC_LANG_POP])
+ if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+ # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+ CFLAGS="$SAVE_CFLAGS"
+ fi
+ ;;
+sparc*-*solaris*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.o` in
+ *64-bit*)
+ case $lt_cv_prog_gnu_ld in
+ yes*) LD="${LD-ld} -m elf64_sparc" ;;
+ *) LD="${LD-ld} -64" ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+AC_PROVIDE_IFELSE([AC_LIBTOOL_WIN32_DLL],
+[*-*-cygwin* | *-*-mingw* | *-*-pw32*)
+ AC_CHECK_TOOL(DLLTOOL, dlltool, false)
+ AC_CHECK_TOOL(AS, as, false)
+ AC_CHECK_TOOL(OBJDUMP, objdump, false)
+ ;;
+ ])
+esac
+
+need_locks="$enable_libtool_lock"
+
+])# _LT_AC_LOCK
+
+
+# AC_LIBTOOL_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+# [OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE])
+# ----------------------------------------------------------------
+# Check whether the given compiler option works
+AC_DEFUN([AC_LIBTOOL_COMPILER_OPTION],
+[AC_REQUIRE([LT_AC_PROG_SED])
+AC_CACHE_CHECK([$1], [$2],
+ [$2=no
+ ifelse([$4], , [ac_outfile=conftest.$ac_objext], [ac_outfile=$4])
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$3"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:__oline__: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ echo "$as_me:__oline__: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ $2=yes
+ fi
+ fi
+ $rm conftest*
+])
+
+if test x"[$]$2" = xyes; then
+ ifelse([$5], , :, [$5])
+else
+ ifelse([$6], , :, [$6])
+fi
+])# AC_LIBTOOL_COMPILER_OPTION
+
+
+# AC_LIBTOOL_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+# [ACTION-SUCCESS], [ACTION-FAILURE])
+# ------------------------------------------------------------
+# Check whether the given compiler option works
+AC_DEFUN([AC_LIBTOOL_LINKER_OPTION],
+[AC_CACHE_CHECK([$1], [$2],
+ [$2=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $3"
+ printf "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&AS_MESSAGE_LOG_FD
+ $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ $2=yes
+ fi
+ else
+ $2=yes
+ fi
+ fi
+ $rm conftest*
+ LDFLAGS="$save_LDFLAGS"
+])
+
+if test x"[$]$2" = xyes; then
+ ifelse([$4], , :, [$4])
+else
+ ifelse([$5], , :, [$5])
+fi
+])# AC_LIBTOOL_LINKER_OPTION
+
+
+# AC_LIBTOOL_SYS_MAX_CMD_LEN
+# --------------------------
+AC_DEFUN([AC_LIBTOOL_SYS_MAX_CMD_LEN],
+[# find the maximum length of command line arguments
+AC_MSG_CHECKING([the maximum length of command line arguments])
+AC_CACHE_VAL([lt_cv_sys_max_cmd_len], [dnl
+ i=0
+ teststring="ABCD"
+
+ case $build_os in
+ msdosdjgpp*)
+ # On DJGPP, this test can blow up pretty badly due to problems in libc
+ # (any single argument exceeding 2000 bytes causes a buffer overrun
+ # during glob expansion). Even if it were fixed, the result of this
+ # check would be larger than it should be.
+ lt_cv_sys_max_cmd_len=12288; # 12K is about right
+ ;;
+
+ gnu*)
+ # Under GNU Hurd, this test is not required because there is
+ # no limit to the length of command line arguments.
+ # Libtool will interpret -1 as no limit whatsoever
+ lt_cv_sys_max_cmd_len=-1;
+ ;;
+
+ cygwin* | mingw*)
+ # On Win9x/ME, this test blows up -- it succeeds, but takes
+ # about 5 minutes as the teststring grows exponentially.
+ # Worse, since 9x/ME are not pre-emptively multitasking,
+ # you end up with a "frozen" computer, even though with patience
+ # the test eventually succeeds (with a max line length of 256k).
+ # Instead, let's just punt: use the minimum linelength reported by
+ # all of the supported platforms: 8192 (on NT/2K/XP).
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ amigaos*)
+ # On AmigaOS with pdksh, this test takes hours, literally.
+ # So we just punt and use a minimum line length of 8192.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+ # This has been around since 386BSD, at least. Likely further.
+ if test -x /sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+ elif test -x /usr/sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+ else
+ lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs
+ fi
+ # And add a safety zone
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ ;;
+
+ interix*)
+ # We know the value 262144 and hardcode it with a safety zone (like BSD)
+ lt_cv_sys_max_cmd_len=196608
+ ;;
+
+ osf*)
+ # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+ # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+ # nice to cause kernel panics so lets avoid the loop below.
+ # First set a reasonable default.
+ lt_cv_sys_max_cmd_len=16384
+ #
+ if test -x /sbin/sysconfig; then
+ case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+ *1*) lt_cv_sys_max_cmd_len=-1 ;;
+ esac
+ fi
+ ;;
+ sco3.2v5*)
+ lt_cv_sys_max_cmd_len=102400
+ ;;
+ sysv5* | sco5v6* | sysv4.2uw2*)
+ kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+ if test -n "$kargmax"; then
+ lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[[ ]]//'`
+ else
+ lt_cv_sys_max_cmd_len=32768
+ fi
+ ;;
+ *)
+ # If test is not a shell built-in, we'll probably end up computing a
+ # maximum length that is only half of the actual maximum length, but
+ # we can't tell.
+ SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+ while (test "X"`$SHELL [$]0 --fallback-echo "X$teststring" 2>/dev/null` \
+ = "XX$teststring") >/dev/null 2>&1 &&
+ new_result=`expr "X$teststring" : ".*" 2>&1` &&
+ lt_cv_sys_max_cmd_len=$new_result &&
+ test $i != 17 # 1/2 MB should be enough
+ do
+ i=`expr $i + 1`
+ teststring=$teststring$teststring
+ done
+ teststring=
+ # Add a significant safety factor because C++ compilers can tack on massive
+ # amounts of additional arguments before passing them to the linker.
+ # It appears as though 1/2 is a usable value.
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+ ;;
+ esac
+])
+if test -n $lt_cv_sys_max_cmd_len ; then
+ AC_MSG_RESULT($lt_cv_sys_max_cmd_len)
+else
+ AC_MSG_RESULT(none)
+fi
+])# AC_LIBTOOL_SYS_MAX_CMD_LEN
+
+
+# _LT_AC_CHECK_DLFCN
+# ------------------
+AC_DEFUN([_LT_AC_CHECK_DLFCN],
+[AC_CHECK_HEADERS(dlfcn.h)dnl
+])# _LT_AC_CHECK_DLFCN
+
+
+# _LT_AC_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE,
+# ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING)
+# ---------------------------------------------------------------------
+AC_DEFUN([_LT_AC_TRY_DLOPEN_SELF],
+[AC_REQUIRE([_LT_AC_CHECK_DLFCN])dnl
+if test "$cross_compiling" = yes; then :
+ [$4]
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<EOF
+[#line __oline__ "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+#ifdef __cplusplus
+extern "C" void exit (int);
+#endif
+
+void fnord() { int i=42;}
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ exit (status);
+}]
+EOF
+ if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&AS_MESSAGE_LOG_FD 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) $1 ;;
+ x$lt_dlneed_uscore) $2 ;;
+ x$lt_dlunknown|x*) $3 ;;
+ esac
+ else :
+ # compilation failed
+ $3
+ fi
+fi
+rm -fr conftest*
+])# _LT_AC_TRY_DLOPEN_SELF
+
+
+# AC_LIBTOOL_DLOPEN_SELF
+# ----------------------
+AC_DEFUN([AC_LIBTOOL_DLOPEN_SELF],
+[AC_REQUIRE([_LT_AC_CHECK_DLFCN])dnl
+if test "x$enable_dlopen" != xyes; then
+ enable_dlopen=unknown
+ enable_dlopen_self=unknown
+ enable_dlopen_self_static=unknown
+else
+ lt_cv_dlopen=no
+ lt_cv_dlopen_libs=
+
+ case $host_os in
+ beos*)
+ lt_cv_dlopen="load_add_on"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ;;
+
+ mingw* | pw32*)
+ lt_cv_dlopen="LoadLibrary"
+ lt_cv_dlopen_libs=
+ ;;
+
+ cygwin*)
+ lt_cv_dlopen="dlopen"
+ lt_cv_dlopen_libs=
+ ;;
+
+ darwin*)
+ # if libdl is installed we need to link against it
+ AC_CHECK_LIB([dl], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],[
+ lt_cv_dlopen="dyld"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ])
+ ;;
+
+ *)
+ AC_CHECK_FUNC([shl_load],
+ [lt_cv_dlopen="shl_load"],
+ [AC_CHECK_LIB([dld], [shl_load],
+ [lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-dld"],
+ [AC_CHECK_FUNC([dlopen],
+ [lt_cv_dlopen="dlopen"],
+ [AC_CHECK_LIB([dl], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],
+ [AC_CHECK_LIB([svld], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"],
+ [AC_CHECK_LIB([dld], [dld_link],
+ [lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-dld"])
+ ])
+ ])
+ ])
+ ])
+ ])
+ ;;
+ esac
+
+ if test "x$lt_cv_dlopen" != xno; then
+ enable_dlopen=yes
+ else
+ enable_dlopen=no
+ fi
+
+ case $lt_cv_dlopen in
+ dlopen)
+ save_CPPFLAGS="$CPPFLAGS"
+ test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+ save_LDFLAGS="$LDFLAGS"
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+ save_LIBS="$LIBS"
+ LIBS="$lt_cv_dlopen_libs $LIBS"
+
+ AC_CACHE_CHECK([whether a program can dlopen itself],
+ lt_cv_dlopen_self, [dnl
+ _LT_AC_TRY_DLOPEN_SELF(
+ lt_cv_dlopen_self=yes, lt_cv_dlopen_self=yes,
+ lt_cv_dlopen_self=no, lt_cv_dlopen_self=cross)
+ ])
+
+ if test "x$lt_cv_dlopen_self" = xyes; then
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+ AC_CACHE_CHECK([whether a statically linked program can dlopen itself],
+ lt_cv_dlopen_self_static, [dnl
+ _LT_AC_TRY_DLOPEN_SELF(
+ lt_cv_dlopen_self_static=yes, lt_cv_dlopen_self_static=yes,
+ lt_cv_dlopen_self_static=no, lt_cv_dlopen_self_static=cross)
+ ])
+ fi
+
+ CPPFLAGS="$save_CPPFLAGS"
+ LDFLAGS="$save_LDFLAGS"
+ LIBS="$save_LIBS"
+ ;;
+ esac
+
+ case $lt_cv_dlopen_self in
+ yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+ *) enable_dlopen_self=unknown ;;
+ esac
+
+ case $lt_cv_dlopen_self_static in
+ yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+ *) enable_dlopen_self_static=unknown ;;
+ esac
+fi
+])# AC_LIBTOOL_DLOPEN_SELF
+
+
+# AC_LIBTOOL_PROG_CC_C_O([TAGNAME])
+# ---------------------------------
+# Check to see if options -c and -o are simultaneously supported by compiler
+AC_DEFUN([AC_LIBTOOL_PROG_CC_C_O],
+[AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl
+AC_CACHE_CHECK([if $compiler supports -c -o file.$ac_objext],
+ [_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)],
+ [_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=no
+ $rm -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:__oline__: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&AS_MESSAGE_LOG_FD
+ echo "$as_me:__oline__: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ _LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+ fi
+ fi
+ chmod u+w . 2>&AS_MESSAGE_LOG_FD
+ $rm conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files
+ $rm out/* && rmdir out
+ cd ..
+ rmdir conftest
+ $rm conftest*
+])
+])# AC_LIBTOOL_PROG_CC_C_O
+
+
+# AC_LIBTOOL_SYS_HARD_LINK_LOCKS([TAGNAME])
+# -----------------------------------------
+# Check to see if we can do hard links to lock some files if needed
+AC_DEFUN([AC_LIBTOOL_SYS_HARD_LINK_LOCKS],
+[AC_REQUIRE([_LT_AC_LOCK])dnl
+
+hard_links="nottested"
+if test "$_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ AC_MSG_CHECKING([if we can lock with hard links])
+ hard_links=yes
+ $rm conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ AC_MSG_RESULT([$hard_links])
+ if test "$hard_links" = no; then
+ AC_MSG_WARN([`$CC' does not support `-c -o', so `make -j' may be unsafe])
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+])# AC_LIBTOOL_SYS_HARD_LINK_LOCKS
+
+
+# AC_LIBTOOL_OBJDIR
+# -----------------
+AC_DEFUN([AC_LIBTOOL_OBJDIR],
+[AC_CACHE_CHECK([for objdir], [lt_cv_objdir],
+[rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ lt_cv_objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null])
+objdir=$lt_cv_objdir
+])# AC_LIBTOOL_OBJDIR
+
+
+# AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH([TAGNAME])
+# ----------------------------------------------
+# Check hardcoding attributes.
+AC_DEFUN([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH],
+[AC_MSG_CHECKING([how to hardcode library paths into programs])
+_LT_AC_TAGVAR(hardcode_action, $1)=
+if test -n "$_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)" || \
+ test -n "$_LT_AC_TAGVAR(runpath_var, $1)" || \
+ test "X$_LT_AC_TAGVAR(hardcode_automatic, $1)" = "Xyes" ; then
+
+ # We can hardcode non-existant directories.
+ if test "$_LT_AC_TAGVAR(hardcode_direct, $1)" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, $1)" != no &&
+ test "$_LT_AC_TAGVAR(hardcode_minus_L, $1)" != no; then
+ # Linking always hardcodes the temporary library directory.
+ _LT_AC_TAGVAR(hardcode_action, $1)=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ _LT_AC_TAGVAR(hardcode_action, $1)=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ _LT_AC_TAGVAR(hardcode_action, $1)=unsupported
+fi
+AC_MSG_RESULT([$_LT_AC_TAGVAR(hardcode_action, $1)])
+
+if test "$_LT_AC_TAGVAR(hardcode_action, $1)" = relink; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+])# AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH
+
+
+# AC_LIBTOOL_SYS_LIB_STRIP
+# ------------------------
+AC_DEFUN([AC_LIBTOOL_SYS_LIB_STRIP],
+[striplib=
+old_striplib=
+AC_MSG_CHECKING([whether stripping libraries is possible])
+if test -n "$STRIP" && $STRIP -V 2>&1 | grep "GNU strip" >/dev/null; then
+ test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+ test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+ AC_MSG_RESULT([yes])
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+ case $host_os in
+ darwin*)
+ if test -n "$STRIP" ; then
+ striplib="$STRIP -x"
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+fi
+ ;;
+ *)
+ AC_MSG_RESULT([no])
+ ;;
+ esac
+fi
+])# AC_LIBTOOL_SYS_LIB_STRIP
+
+
+# AC_LIBTOOL_SYS_DYNAMIC_LINKER
+# -----------------------------
+# PORTME Fill in your ld.so characteristics
+AC_DEFUN([AC_LIBTOOL_SYS_DYNAMIC_LINKER],
+[AC_MSG_CHECKING([dynamic linker characteristics])
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix4* | aix5*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[[01]] | aix4.[[01]].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([[^/]]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[[45]]*)
+ version_type=linux
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$host_os in
+ yes,cygwin* | yes,mingw* | yes,pw32*)
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $rm \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib"
+ ;;
+ mingw*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | [grep ';[c-zC-Z]:/' >/dev/null]; then
+ # It is most probably a Windows format PATH printed by
+ # mingw gcc, but we are running on Cygwin. Gcc prints its search
+ # path with ; separators, and with drive letters. We can handle the
+ # drive letters (cygwin fileutils understands them), so leave them,
+ # especially as we might pass files found there to a mingw objdump,
+ # which wouldn't understand a cygwinified path. Ahh.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ ;;
+
+ *)
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+ # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same.
+ if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"`
+ else
+ sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib'
+ fi
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd1*)
+ dynamic_linker=no
+ ;;
+
+kfreebsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[[123]]*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[[01]]* | freebsdelf3.[[01]]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[[2-9]]* | freebsdelf3.[[2-9]]* | \
+ freebsd4.[[0-5]] | freebsdelf4.[[0-5]] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ freebsd*) # from 4.6 on
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+interix3*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # find out which ABI we are using
+ libsuff=
+ case "$host_cpu" in
+ x86_64*|s390x*|powerpc64*)
+ echo '[#]line __oline__ "configure"' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *64-bit*)
+ libsuff=64
+ sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+ esac
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \[$]2)); skip = 1; } { if (!skip) print \[$]0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+knetbsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+nto-qnx*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[[89]] | openbsd2.[[89]].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+solaris*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ shlibpath_overrides_runpath=no
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ shlibpath_overrides_runpath=yes
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+AC_MSG_RESULT([$dynamic_linker])
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+])# AC_LIBTOOL_SYS_DYNAMIC_LINKER
+
+
+# _LT_AC_TAGCONFIG
+# ----------------
+AC_DEFUN([_LT_AC_TAGCONFIG],
+[AC_ARG_WITH([tags],
+ [AC_HELP_STRING([--with-tags@<:@=TAGS@:>@],
+ [include additional configurations @<:@automatic@:>@])],
+ [tagnames="$withval"])
+
+if test -f "$ltmain" && test -n "$tagnames"; then
+ if test ! -f "${ofile}"; then
+ AC_MSG_WARN([output file `$ofile' does not exist])
+ fi
+
+ if test -z "$LTCC"; then
+ eval "`$SHELL ${ofile} --config | grep '^LTCC='`"
+ if test -z "$LTCC"; then
+ AC_MSG_WARN([output file `$ofile' does not look like a libtool script])
+ else
+ AC_MSG_WARN([using `LTCC=$LTCC', extracted from `$ofile'])
+ fi
+ fi
+ if test -z "$LTCFLAGS"; then
+ eval "`$SHELL ${ofile} --config | grep '^LTCFLAGS='`"
+ fi
+
+ # Extract list of available tagged configurations in $ofile.
+ # Note that this assumes the entire list is on one line.
+ available_tags=`grep "^available_tags=" "${ofile}" | $SED -e 's/available_tags=\(.*$\)/\1/' -e 's/\"//g'`
+
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for tagname in $tagnames; do
+ IFS="$lt_save_ifs"
+ # Check whether tagname contains only valid characters
+ case `$echo "X$tagname" | $Xsed -e 's:[[-_ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890,/]]::g'` in
+ "") ;;
+ *) AC_MSG_ERROR([invalid tag name: $tagname])
+ ;;
+ esac
+
+ if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "${ofile}" > /dev/null
+ then
+ AC_MSG_ERROR([tag name \"$tagname\" already exists])
+ fi
+
+ # Update the list of available tags.
+ if test -n "$tagname"; then
+ echo appending configuration tag \"$tagname\" to $ofile
+
+ case $tagname in
+ CXX)
+ if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ AC_LIBTOOL_LANG_CXX_CONFIG
+ else
+ tagname=""
+ fi
+ ;;
+
+ F77)
+ if test -n "$F77" && test "X$F77" != "Xno"; then
+ AC_LIBTOOL_LANG_F77_CONFIG
+ else
+ tagname=""
+ fi
+ ;;
+
+ GCJ)
+ if test -n "$GCJ" && test "X$GCJ" != "Xno"; then
+ AC_LIBTOOL_LANG_GCJ_CONFIG
+ else
+ tagname=""
+ fi
+ ;;
+
+ RC)
+ AC_LIBTOOL_LANG_RC_CONFIG
+ ;;
+
+ *)
+ AC_MSG_ERROR([Unsupported tag name: $tagname])
+ ;;
+ esac
+
+ # Append the new tag name to the list of available tags.
+ if test -n "$tagname" ; then
+ available_tags="$available_tags $tagname"
+ fi
+ fi
+ done
+ IFS="$lt_save_ifs"
+
+ # Now substitute the updated list of available tags.
+ if eval "sed -e 's/^available_tags=.*\$/available_tags=\"$available_tags\"/' \"$ofile\" > \"${ofile}T\""; then
+ mv "${ofile}T" "$ofile"
+ chmod +x "$ofile"
+ else
+ rm -f "${ofile}T"
+ AC_MSG_ERROR([unable to update list of available tagged configurations.])
+ fi
+fi
+])# _LT_AC_TAGCONFIG
+
+
+# AC_LIBTOOL_DLOPEN
+# -----------------
+# enable checks for dlopen support
+AC_DEFUN([AC_LIBTOOL_DLOPEN],
+ [AC_BEFORE([$0],[AC_LIBTOOL_SETUP])
+])# AC_LIBTOOL_DLOPEN
+
+
+# AC_LIBTOOL_WIN32_DLL
+# --------------------
+# declare package support for building win32 DLLs
+AC_DEFUN([AC_LIBTOOL_WIN32_DLL],
+[AC_BEFORE([$0], [AC_LIBTOOL_SETUP])
+])# AC_LIBTOOL_WIN32_DLL
+
+
+# AC_ENABLE_SHARED([DEFAULT])
+# ---------------------------
+# implement the --enable-shared flag
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+AC_DEFUN([AC_ENABLE_SHARED],
+[define([AC_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE([shared],
+ [AC_HELP_STRING([--enable-shared@<:@=PKGS@:>@],
+ [build shared libraries @<:@default=]AC_ENABLE_SHARED_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_shared=yes ;;
+ no) enable_shared=no ;;
+ *)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_shared=]AC_ENABLE_SHARED_DEFAULT)
+])# AC_ENABLE_SHARED
+
+
+# AC_DISABLE_SHARED
+# -----------------
+# set the default shared flag to --disable-shared
+AC_DEFUN([AC_DISABLE_SHARED],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+AC_ENABLE_SHARED(no)
+])# AC_DISABLE_SHARED
+
+
+# AC_ENABLE_STATIC([DEFAULT])
+# ---------------------------
+# implement the --enable-static flag
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+AC_DEFUN([AC_ENABLE_STATIC],
+[define([AC_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE([static],
+ [AC_HELP_STRING([--enable-static@<:@=PKGS@:>@],
+ [build static libraries @<:@default=]AC_ENABLE_STATIC_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_static=yes ;;
+ no) enable_static=no ;;
+ *)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_static=]AC_ENABLE_STATIC_DEFAULT)
+])# AC_ENABLE_STATIC
+
+
+# AC_DISABLE_STATIC
+# -----------------
+# set the default static flag to --disable-static
+AC_DEFUN([AC_DISABLE_STATIC],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+AC_ENABLE_STATIC(no)
+])# AC_DISABLE_STATIC
+
+
+# AC_ENABLE_FAST_INSTALL([DEFAULT])
+# ---------------------------------
+# implement the --enable-fast-install flag
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+AC_DEFUN([AC_ENABLE_FAST_INSTALL],
+[define([AC_ENABLE_FAST_INSTALL_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE([fast-install],
+ [AC_HELP_STRING([--enable-fast-install@<:@=PKGS@:>@],
+ [optimize for fast installation @<:@default=]AC_ENABLE_FAST_INSTALL_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_fast_install=yes ;;
+ no) enable_fast_install=no ;;
+ *)
+ enable_fast_install=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_fast_install=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_fast_install=]AC_ENABLE_FAST_INSTALL_DEFAULT)
+])# AC_ENABLE_FAST_INSTALL
+
+
+# AC_DISABLE_FAST_INSTALL
+# -----------------------
+# set the default to --disable-fast-install
+AC_DEFUN([AC_DISABLE_FAST_INSTALL],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+AC_ENABLE_FAST_INSTALL(no)
+])# AC_DISABLE_FAST_INSTALL
+
+
+# AC_LIBTOOL_PICMODE([MODE])
+# --------------------------
+# implement the --with-pic flag
+# MODE is either `yes' or `no'. If omitted, it defaults to `both'.
+AC_DEFUN([AC_LIBTOOL_PICMODE],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+pic_mode=ifelse($#,1,$1,default)
+])# AC_LIBTOOL_PICMODE
+
+
+# AC_PROG_EGREP
+# -------------
+# This is predefined starting with Autoconf 2.54, so this conditional
+# definition can be removed once we require Autoconf 2.54 or later.
+m4_ifndef([AC_PROG_EGREP], [AC_DEFUN([AC_PROG_EGREP],
+[AC_CACHE_CHECK([for egrep], [ac_cv_prog_egrep],
+ [if echo a | (grep -E '(a|b)') >/dev/null 2>&1
+ then ac_cv_prog_egrep='grep -E'
+ else ac_cv_prog_egrep='egrep'
+ fi])
+ EGREP=$ac_cv_prog_egrep
+ AC_SUBST([EGREP])
+])])
+
+
+# AC_PATH_TOOL_PREFIX
+# -------------------
+# find a file program which can recognise shared library
+AC_DEFUN([AC_PATH_TOOL_PREFIX],
+[AC_REQUIRE([AC_PROG_EGREP])dnl
+AC_MSG_CHECKING([for $1])
+AC_CACHE_VAL(lt_cv_path_MAGIC_CMD,
+[case $MAGIC_CMD in
+[[\\/*] | ?:[\\/]*])
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+dnl $ac_dummy forces splitting on constant user-supplied paths.
+dnl POSIX.2 word splitting is done only on the output of word expansions,
+dnl not every word. This closes a longstanding sh security hole.
+ ac_dummy="ifelse([$2], , $PATH, [$2])"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/$1; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/$1"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac])
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ AC_MSG_RESULT($MAGIC_CMD)
+else
+ AC_MSG_RESULT(no)
+fi
+])# AC_PATH_TOOL_PREFIX
+
+
+# AC_PATH_MAGIC
+# -------------
+# find a file program which can recognise a shared library
+AC_DEFUN([AC_PATH_MAGIC],
+[AC_PATH_TOOL_PREFIX(${ac_tool_prefix}file, /usr/bin$PATH_SEPARATOR$PATH)
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+ if test -n "$ac_tool_prefix"; then
+ AC_PATH_TOOL_PREFIX(file, /usr/bin$PATH_SEPARATOR$PATH)
+ else
+ MAGIC_CMD=:
+ fi
+fi
+])# AC_PATH_MAGIC
+
+
+# AC_PROG_LD
+# ----------
+# find the pathname to the GNU or non-GNU linker
+AC_DEFUN([AC_PROG_LD],
+[AC_ARG_WITH([gnu-ld],
+ [AC_HELP_STRING([--with-gnu-ld],
+ [assume the C compiler uses GNU ld @<:@default=no@:>@])],
+ [test "$withval" = no || with_gnu_ld=yes],
+ [with_gnu_ld=no])
+AC_REQUIRE([LT_AC_PROG_SED])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ AC_MSG_CHECKING([for ld used by $CC])
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [[\\/]]* | ?:[[\\/]]*)
+ re_direlt='/[[^/]][[^/]]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'`
+ while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ AC_MSG_CHECKING([for GNU ld])
+else
+ AC_MSG_CHECKING([for non-GNU ld])
+fi
+AC_CACHE_VAL(lt_cv_path_LD,
+[if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+ *GNU* | *'with BFD'*)
+ test "$with_gnu_ld" != no && break
+ ;;
+ *)
+ test "$with_gnu_ld" != yes && break
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+else
+ lt_cv_path_LD="$LD" # Let the user override the test with a path.
+fi])
+LD="$lt_cv_path_LD"
+if test -n "$LD"; then
+ AC_MSG_RESULT($LD)
+else
+ AC_MSG_RESULT(no)
+fi
+test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH])
+AC_PROG_LD_GNU
+])# AC_PROG_LD
+
+
+# AC_PROG_LD_GNU
+# --------------
+AC_DEFUN([AC_PROG_LD_GNU],
+[AC_REQUIRE([AC_PROG_EGREP])dnl
+AC_CACHE_CHECK([if the linker ($LD) is GNU ld], lt_cv_prog_gnu_ld,
+[# I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+ lt_cv_prog_gnu_ld=yes
+ ;;
+*)
+ lt_cv_prog_gnu_ld=no
+ ;;
+esac])
+with_gnu_ld=$lt_cv_prog_gnu_ld
+])# AC_PROG_LD_GNU
+
+
+# AC_PROG_LD_RELOAD_FLAG
+# ----------------------
+# find reload flag for linker
+# -- PORTME Some linkers may need a different reload flag.
+AC_DEFUN([AC_PROG_LD_RELOAD_FLAG],
+[AC_CACHE_CHECK([for $LD option to reload object files],
+ lt_cv_ld_reload_flag,
+ [lt_cv_ld_reload_flag='-r'])
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+ darwin*)
+ if test "$GCC" = yes; then
+ reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs'
+ else
+ reload_cmds='$LD$reload_flag -o $output$reload_objs'
+ fi
+ ;;
+esac
+])# AC_PROG_LD_RELOAD_FLAG
+
+
+# AC_DEPLIBS_CHECK_METHOD
+# -----------------------
+# how to check for library dependencies
+# -- PORTME fill in with the dynamic library characteristics
+AC_DEFUN([AC_DEPLIBS_CHECK_METHOD],
+[AC_CACHE_CHECK([how to recognise dependent libraries],
+lt_cv_deplibs_check_method,
+[lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# `unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# which responds to the $file_magic_cmd with a given extended regex.
+# If you have `file' or equivalent on your system and you're not sure
+# whether `pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix4* | aix5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+beos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+bsdi[[45]]*)
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib)'
+ lt_cv_file_magic_cmd='/usr/bin/file -L'
+ lt_cv_file_magic_test_file=/shlib/libc.so
+ ;;
+
+cygwin*)
+ # func_win32_libid is a shell function defined in ltmain.sh
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ ;;
+
+mingw* | pw32*)
+ # Base MSYS/MinGW do not provide the 'file' command needed by
+ # func_win32_libid shell function, so use a weaker test based on 'objdump'.
+ lt_cv_deplibs_check_method='file_magic file format pei*-i386(.*architecture: i386)?'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ ;;
+
+darwin* | rhapsody*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+freebsd* | kfreebsd*-gnu | dragonfly*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then
+ case $host_cpu in
+ i*86 )
+ # Not sure whether the presence of OpenBSD here was a mistake.
+ # Let's accept both of them until this is cleared up.
+ lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[[3-9]]86 (compact )?demand paged shared library'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+ ;;
+ esac
+ else
+ lt_cv_deplibs_check_method=pass_all
+ fi
+ ;;
+
+gnu*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+hpux10.20* | hpux11*)
+ lt_cv_file_magic_cmd=/usr/bin/file
+ case $host_cpu in
+ ia64*)
+ lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|ELF-[[0-9]][[0-9]]) shared object file - IA64'
+ lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+ ;;
+ hppa*64*)
+ [lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - PA-RISC [0-9].[0-9]']
+ lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+ ;;
+ *)
+ lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|PA-RISC[[0-9]].[[0-9]]) shared library'
+ lt_cv_file_magic_test_file=/usr/lib/libc.sl
+ ;;
+ esac
+ ;;
+
+interix3*)
+ # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|\.a)$'
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $LD in
+ *-32|*"-32 ") libmagic=32-bit;;
+ *-n32|*"-n32 ") libmagic=N32;;
+ *-64|*"-64 ") libmagic=64-bit;;
+ *) libmagic=never-match;;
+ esac
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|_pic\.a)$'
+ fi
+ ;;
+
+newos6*)
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (executable|dynamic lib)'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=/usr/lib/libnls.so
+ ;;
+
+nto-qnx*)
+ lt_cv_deplibs_check_method=unknown
+ ;;
+
+openbsd*)
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|\.so|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+ fi
+ ;;
+
+osf3* | osf4* | osf5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+solaris*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv4 | sysv4.3*)
+ case $host_vendor in
+ motorola)
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib) M[[0-9]][[0-9]]* Version [[0-9]]'
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+ ;;
+ ncr)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ sequent)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB (shared object|dynamic lib )'
+ ;;
+ sni)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method="file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB dynamic lib"
+ lt_cv_file_magic_test_file=/lib/libc.so
+ ;;
+ siemens)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ pc)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ esac
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+esac
+])
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+])# AC_DEPLIBS_CHECK_METHOD
+
+
+# AC_PROG_NM
+# ----------
+# find the pathname to a BSD-compatible name lister
+AC_DEFUN([AC_PROG_NM],
+[AC_CACHE_CHECK([for BSD-compatible nm], lt_cv_path_NM,
+[if test -n "$NM"; then
+ # Let the user override the test.
+ lt_cv_path_NM="$NM"
+else
+ lt_nm_to_check="${ac_tool_prefix}nm"
+ if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+ lt_nm_to_check="$lt_nm_to_check nm"
+ fi
+ for lt_tmp_nm in $lt_nm_to_check; do
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ tmp_nm="$ac_dir/$lt_tmp_nm"
+ if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ # Tru64's nm complains that /dev/null is an invalid object file
+ case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+ */dev/null* | *'Invalid file or object type'*)
+ lt_cv_path_NM="$tmp_nm -B"
+ break
+ ;;
+ *)
+ case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+ */dev/null*)
+ lt_cv_path_NM="$tmp_nm -p"
+ break
+ ;;
+ *)
+ lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+ continue # so that we can try to find one that supports BSD flags
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+ done
+ test -z "$lt_cv_path_NM" && lt_cv_path_NM=nm
+fi])
+NM="$lt_cv_path_NM"
+])# AC_PROG_NM
+
+
+# AC_CHECK_LIBM
+# -------------
+# check for math library
+AC_DEFUN([AC_CHECK_LIBM],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+LIBM=
+case $host in
+*-*-beos* | *-*-cygwin* | *-*-pw32* | *-*-darwin*)
+ # These system don't have libm, or don't need it
+ ;;
+*-ncr-sysv4.3*)
+ AC_CHECK_LIB(mw, _mwvalidcheckl, LIBM="-lmw")
+ AC_CHECK_LIB(m, cos, LIBM="$LIBM -lm")
+ ;;
+*)
+ AC_CHECK_LIB(m, cos, LIBM="-lm")
+ ;;
+esac
+])# AC_CHECK_LIBM
+
+
+# AC_LIBLTDL_CONVENIENCE([DIRECTORY])
+# -----------------------------------
+# sets LIBLTDL to the link flags for the libltdl convenience library and
+# LTDLINCL to the include flags for the libltdl header and adds
+# --enable-ltdl-convenience to the configure arguments. Note that
+# AC_CONFIG_SUBDIRS is not called here. If DIRECTORY is not provided,
+# it is assumed to be `libltdl'. LIBLTDL will be prefixed with
+# '${top_builddir}/' and LTDLINCL will be prefixed with '${top_srcdir}/'
+# (note the single quotes!). If your package is not flat and you're not
+# using automake, define top_builddir and top_srcdir appropriately in
+# the Makefiles.
+AC_DEFUN([AC_LIBLTDL_CONVENIENCE],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+ case $enable_ltdl_convenience in
+ no) AC_MSG_ERROR([this package needs a convenience libltdl]) ;;
+ "") enable_ltdl_convenience=yes
+ ac_configure_args="$ac_configure_args --enable-ltdl-convenience" ;;
+ esac
+ LIBLTDL='${top_builddir}/'ifelse($#,1,[$1],['libltdl'])/libltdlc.la
+ LTDLINCL='-I${top_srcdir}/'ifelse($#,1,[$1],['libltdl'])
+ # For backwards non-gettext consistent compatibility...
+ INCLTDL="$LTDLINCL"
+])# AC_LIBLTDL_CONVENIENCE
+
+
+# AC_LIBLTDL_INSTALLABLE([DIRECTORY])
+# -----------------------------------
+# sets LIBLTDL to the link flags for the libltdl installable library and
+# LTDLINCL to the include flags for the libltdl header and adds
+# --enable-ltdl-install to the configure arguments. Note that
+# AC_CONFIG_SUBDIRS is not called here. If DIRECTORY is not provided,
+# and an installed libltdl is not found, it is assumed to be `libltdl'.
+# LIBLTDL will be prefixed with '${top_builddir}/'# and LTDLINCL with
+# '${top_srcdir}/' (note the single quotes!). If your package is not
+# flat and you're not using automake, define top_builddir and top_srcdir
+# appropriately in the Makefiles.
+# In the future, this macro may have to be called after AC_PROG_LIBTOOL.
+AC_DEFUN([AC_LIBLTDL_INSTALLABLE],
+[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl
+ AC_CHECK_LIB(ltdl, lt_dlinit,
+ [test x"$enable_ltdl_install" != xyes && enable_ltdl_install=no],
+ [if test x"$enable_ltdl_install" = xno; then
+ AC_MSG_WARN([libltdl not installed, but installation disabled])
+ else
+ enable_ltdl_install=yes
+ fi
+ ])
+ if test x"$enable_ltdl_install" = x"yes"; then
+ ac_configure_args="$ac_configure_args --enable-ltdl-install"
+ LIBLTDL='${top_builddir}/'ifelse($#,1,[$1],['libltdl'])/libltdl.la
+ LTDLINCL='-I${top_srcdir}/'ifelse($#,1,[$1],['libltdl'])
+ else
+ ac_configure_args="$ac_configure_args --enable-ltdl-install=no"
+ LIBLTDL="-lltdl"
+ LTDLINCL=
+ fi
+ # For backwards non-gettext consistent compatibility...
+ INCLTDL="$LTDLINCL"
+])# AC_LIBLTDL_INSTALLABLE
+
+
+# AC_LIBTOOL_CXX
+# --------------
+# enable support for C++ libraries
+AC_DEFUN([AC_LIBTOOL_CXX],
+[AC_REQUIRE([_LT_AC_LANG_CXX])
+])# AC_LIBTOOL_CXX
+
+
+# _LT_AC_LANG_CXX
+# ---------------
+AC_DEFUN([_LT_AC_LANG_CXX],
+[AC_REQUIRE([AC_PROG_CXX])
+AC_REQUIRE([_LT_AC_PROG_CXXCPP])
+_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}CXX])
+])# _LT_AC_LANG_CXX
+
+# _LT_AC_PROG_CXXCPP
+# ------------------
+AC_DEFUN([_LT_AC_PROG_CXXCPP],
+[
+AC_REQUIRE([AC_PROG_CXX])
+if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ AC_PROG_CXXCPP
+fi
+])# _LT_AC_PROG_CXXCPP
+
+# AC_LIBTOOL_F77
+# --------------
+# enable support for Fortran 77 libraries
+AC_DEFUN([AC_LIBTOOL_F77],
+[AC_REQUIRE([_LT_AC_LANG_F77])
+])# AC_LIBTOOL_F77
+
+
+# _LT_AC_LANG_F77
+# ---------------
+AC_DEFUN([_LT_AC_LANG_F77],
+[AC_REQUIRE([AC_PROG_F77])
+_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}F77])
+])# _LT_AC_LANG_F77
+
+
+# AC_LIBTOOL_GCJ
+# --------------
+# enable support for GCJ libraries
+AC_DEFUN([AC_LIBTOOL_GCJ],
+[AC_REQUIRE([_LT_AC_LANG_GCJ])
+])# AC_LIBTOOL_GCJ
+
+
+# _LT_AC_LANG_GCJ
+# ---------------
+AC_DEFUN([_LT_AC_LANG_GCJ],
+[AC_PROVIDE_IFELSE([AC_PROG_GCJ],[],
+ [AC_PROVIDE_IFELSE([A][M_PROG_GCJ],[],
+ [AC_PROVIDE_IFELSE([LT_AC_PROG_GCJ],[],
+ [ifdef([AC_PROG_GCJ],[AC_REQUIRE([AC_PROG_GCJ])],
+ [ifdef([A][M_PROG_GCJ],[AC_REQUIRE([A][M_PROG_GCJ])],
+ [AC_REQUIRE([A][C_PROG_GCJ_OR_A][M_PROG_GCJ])])])])])])
+_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}GCJ])
+])# _LT_AC_LANG_GCJ
+
+
+# AC_LIBTOOL_RC
+# -------------
+# enable support for Windows resource files
+AC_DEFUN([AC_LIBTOOL_RC],
+[AC_REQUIRE([LT_AC_PROG_RC])
+_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}RC])
+])# AC_LIBTOOL_RC
+
+
+# AC_LIBTOOL_LANG_C_CONFIG
+# ------------------------
+# Ensure that the configuration vars for the C compiler are
+# suitably defined. Those variables are subsequently used by
+# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'.
+AC_DEFUN([AC_LIBTOOL_LANG_C_CONFIG], [_LT_AC_LANG_C_CONFIG])
+AC_DEFUN([_LT_AC_LANG_C_CONFIG],
+[lt_save_CC="$CC"
+AC_LANG_PUSH(C)
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+_LT_AC_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}\n'
+
+_LT_AC_SYS_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+AC_LIBTOOL_PROG_COMPILER_NO_RTTI($1)
+AC_LIBTOOL_PROG_COMPILER_PIC($1)
+AC_LIBTOOL_PROG_CC_C_O($1)
+AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1)
+AC_LIBTOOL_PROG_LD_SHLIBS($1)
+AC_LIBTOOL_SYS_DYNAMIC_LINKER($1)
+AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1)
+AC_LIBTOOL_SYS_LIB_STRIP
+AC_LIBTOOL_DLOPEN_SELF
+
+# Report which library types will actually be built
+AC_MSG_CHECKING([if libtool supports shared libraries])
+AC_MSG_RESULT([$can_build_shared])
+
+AC_MSG_CHECKING([whether to build shared libraries])
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case $host_os in
+aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+
+aix4* | aix5*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+esac
+AC_MSG_RESULT([$enable_shared])
+
+AC_MSG_CHECKING([whether to build static libraries])
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+AC_MSG_RESULT([$enable_static])
+
+AC_LIBTOOL_CONFIG($1)
+
+AC_LANG_POP
+CC="$lt_save_CC"
+])# AC_LIBTOOL_LANG_C_CONFIG
+
+
+# AC_LIBTOOL_LANG_CXX_CONFIG
+# --------------------------
+# Ensure that the configuration vars for the C compiler are
+# suitably defined. Those variables are subsequently used by
+# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'.
+AC_DEFUN([AC_LIBTOOL_LANG_CXX_CONFIG], [_LT_AC_LANG_CXX_CONFIG(CXX)])
+AC_DEFUN([_LT_AC_LANG_CXX_CONFIG],
+[AC_LANG_PUSH(C++)
+AC_REQUIRE([AC_PROG_CXX])
+AC_REQUIRE([_LT_AC_PROG_CXXCPP])
+
+_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_AC_TAGVAR(allow_undefined_flag, $1)=
+_LT_AC_TAGVAR(always_export_symbols, $1)=no
+_LT_AC_TAGVAR(archive_expsym_cmds, $1)=
+_LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_AC_TAGVAR(hardcode_direct, $1)=no
+_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)=
+_LT_AC_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_AC_TAGVAR(hardcode_minus_L, $1)=no
+_LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+_LT_AC_TAGVAR(hardcode_automatic, $1)=no
+_LT_AC_TAGVAR(module_cmds, $1)=
+_LT_AC_TAGVAR(module_expsym_cmds, $1)=
+_LT_AC_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_AC_TAGVAR(no_undefined_flag, $1)=
+_LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Dependencies to place before and after the object being linked:
+_LT_AC_TAGVAR(predep_objects, $1)=
+_LT_AC_TAGVAR(postdep_objects, $1)=
+_LT_AC_TAGVAR(predeps, $1)=
+_LT_AC_TAGVAR(postdeps, $1)=
+_LT_AC_TAGVAR(compiler_lib_search_path, $1)=
+
+# Source file extension for C++ test sources.
+ac_ext=cpp
+
+# Object file extension for compiled C++ test sources.
+objext=o
+_LT_AC_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(int, char *[[]]) { return(0); }\n'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_AC_SYS_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_LD=$LD
+lt_save_GCC=$GCC
+GCC=$GXX
+lt_save_with_gnu_ld=$with_gnu_ld
+lt_save_path_LD=$lt_cv_path_LD
+if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then
+ lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx
+else
+ $as_unset lt_cv_prog_gnu_ld
+fi
+if test -n "${lt_cv_path_LDCXX+set}"; then
+ lt_cv_path_LD=$lt_cv_path_LDCXX
+else
+ $as_unset lt_cv_path_LD
+fi
+test -z "${LDCXX+set}" || LD=$LDCXX
+CC=${CXX-"c++"}
+compiler=$CC
+_LT_AC_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+
+# We don't want -fno-exception wen compiling C++ code, so set the
+# no_builtin_flag separately
+if test "$GXX" = yes; then
+ _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin'
+else
+ _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+fi
+
+if test "$GXX" = yes; then
+ # Set up default GNU C++ configuration
+
+ AC_PROG_LD
+
+ # Check if GNU C++ uses GNU ld as the underlying linker, since the
+ # archiving commands below assume that GNU ld is being used.
+ if test "$with_gnu_ld" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to
+ # investigate it a little bit more. (MM)
+ wlarc='${wl}'
+
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if eval "`$CC -print-prog-name=ld` --help 2>&1" | \
+ grep 'no-whole-archive' > /dev/null; then
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ else
+ with_gnu_ld=no
+ wlarc=
+
+ # A generic and very simple default shared library creation
+ # command for GNU C++ for the case where it uses the native
+ # linker, instead of GNU ld. If possible, this setting should
+ # overridden to take advantage of the native linker features on
+ # the platform it is being used on.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ fi
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+else
+ GXX=no
+ with_gnu_ld=no
+ wlarc=
+fi
+
+# PORTME: fill in a description of your system's C++ link characteristics
+AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+_LT_AC_TAGVAR(ld_shlibs, $1)=yes
+case $host_os in
+ aix3*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[[23]]|aix4.[[23]].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ case $ld_flag in
+ *-brtl*)
+ aix_use_runtimelinking=yes
+ break
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ _LT_AC_TAGVAR(archive_cmds, $1)=''
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+
+ if test "$GXX" = yes; then
+ case $host_os in aix4.[[012]]|aix4.[[012]].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ else
+ # We have old collect2
+ _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ _LT_AC_TAGVAR(always_export_symbols, $1)=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ _LT_AC_SYS_LIBPATH_AIX
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ _LT_AC_SYS_LIBPATH_AIX
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ chorus*)
+ case $cc_basename in
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+ # as there is no search path for DLLs.
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_AC_TAGVAR(always_export_symbols, $1)=no
+ _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[[012]])
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[[012]])
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_automatic, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=''
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+
+ if test "$GXX" = yes ; then
+ lt_int_apple_cc_single_mod=no
+ output_verbose_link_cmd='echo'
+ if $CC -dumpspecs 2>&1 | $EGREP 'single_module' >/dev/null ; then
+ lt_int_apple_cc_single_mod=yes
+ fi
+ if test "X$lt_int_apple_cc_single_mod" = Xyes ; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ fi
+ _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ if test "X$lt_int_apple_cc_single_mod" = Xyes ; then
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ fi
+ _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+ freebsd[[12]]*)
+ # C++ shared libraries reported to be fairly broken before switch to ELF
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ freebsd-elf*)
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ ;;
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF
+ # conventions
+ _LT_AC_TAGVAR(ld_shlibs, $1)=yes
+ ;;
+ gnu*)
+ ;;
+ hpux9*)
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aCC*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "[[-]]L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -shared -nostdlib -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+ hpux10*|hpux11*)
+ if test $with_gnu_ld = no; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='+b $libdir'
+ ;;
+ *)
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ ;;
+ esac
+ fi
+ case $host_cpu in
+ hppa*64*|ia64*)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+ *)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+ ;;
+ esac
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aCC*)
+ case $host_cpu in
+ hppa*64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test $with_gnu_ld = no; then
+ case $host_cpu in
+ hppa*64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ fi
+ else
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+ interix3*)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+ irix5* | irix6*)
+ case $cc_basename in
+ CC*)
+ # SGI C++
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ # Archives containing C++ object files must be created using
+ # "CC -ar", where "CC" is the IRIX C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -ar -WR,-u -o $oldlib $oldobjs'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` -o $lib'
+ fi
+ fi
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+ esac
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ ;;
+ linux*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | grep "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath,$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs'
+ ;;
+ icpc*)
+ # Intel C++
+ with_gnu_ld=yes
+ # version 8.0 and above of icpc choke on multiply defined symbols
+ # if we add $predep_objects and $postdep_objects, however 7.1 and
+ # earlier do not add the objects themselves.
+ case `$CC -V 2>&1` in
+ *"Version 7."*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ *) # Version 8.0 or newer
+ tmp_idyn=
+ case $host_cpu in
+ ia64*) tmp_idyn=' -i_dynamic';;
+ esac
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ esac
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ ;;
+ pgCC*)
+ # Portland Group C++ compiler
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ ;;
+ cxx*)
+ # Compaq C++
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols'
+
+ runpath_var=LD_RUN_PATH
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ esac
+ ;;
+ lynxos*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ m88k*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags'
+ wlarc=
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ fi
+ # Workaround some broken pre-1.5 toolchains
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"'
+ ;;
+ openbsd2*)
+ # C++ shared libraries are fairly broken
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ openbsd*)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ fi
+ output_verbose_link_cmd='echo'
+ ;;
+ osf3*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs'
+
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ cxx*)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && echo ${wl}-set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+ osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Archives containing C++ object files must be created using
+ # the KAI C++ compiler.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -o $oldlib $oldobjs'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ cxx*)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~
+ echo "-hidden">> $lib.exp~
+ $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname -Wl,-input -Wl,$lib.exp `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~
+ $rm $lib.exp'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+ psos*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ lcc*)
+ # Lucid
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ _LT_AC_TAGVAR(archive_cmds_need_lc,$1)=yes
+ _LT_AC_TAGVAR(no_undefined_flag, $1)=' -zdefs'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ case $host_os in
+ solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+ *)
+ # The C++ compiler is used as linker so we must use $wl
+ # flag to pass the commands to the underlying system
+ # linker. We must also pass each convience library through
+ # to the system linker between allextract/defaultextract.
+ # The C++ compiler will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract'
+ ;;
+ esac
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+
+ output_verbose_link_cmd='echo'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+
+ # The C++ compiler must be used to create the archive.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC $LDFLAGS -archive -o $oldlib $oldobjs'
+ ;;
+ *)
+ # GNU C++ compiler with Solaris linker
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-z ${wl}defs'
+ if $CC --version | grep -v '^2\.7' > /dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd="$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\""
+ else
+ # g++ 2.7 appears to require `-G' NOT `-shared' on this
+ # platform.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd="$CC -G $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\""
+ fi
+
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $wl$libdir'
+ fi
+ ;;
+ esac
+ ;;
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*)
+ _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ # For security reasons, it is highly recommended that you always
+ # use absolute paths for naming shared libraries, and exclude the
+ # DT_RUNPATH tag from executables and libraries. But doing so
+ # requires that you compile everything twice, which is a pain.
+ # So that behaviour is only enabled if SCOABSPATH is set to a
+ # non-empty value in the environment. Most likely only useful for
+ # creating official distributions of packages.
+ # This is a hack until libtool officially supports absolute path
+ # names for shared libraries.
+ _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+ vxworks*)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+esac
+AC_MSG_RESULT([$_LT_AC_TAGVAR(ld_shlibs, $1)])
+test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+_LT_AC_TAGVAR(GCC, $1)="$GXX"
+_LT_AC_TAGVAR(LD, $1)="$LD"
+
+AC_LIBTOOL_POSTDEP_PREDEP($1)
+AC_LIBTOOL_PROG_COMPILER_PIC($1)
+AC_LIBTOOL_PROG_CC_C_O($1)
+AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1)
+AC_LIBTOOL_PROG_LD_SHLIBS($1)
+AC_LIBTOOL_SYS_DYNAMIC_LINKER($1)
+AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1)
+
+AC_LIBTOOL_CONFIG($1)
+
+AC_LANG_POP
+CC=$lt_save_CC
+LDCXX=$LD
+LD=$lt_save_LD
+GCC=$lt_save_GCC
+with_gnu_ldcxx=$with_gnu_ld
+with_gnu_ld=$lt_save_with_gnu_ld
+lt_cv_path_LDCXX=$lt_cv_path_LD
+lt_cv_path_LD=$lt_save_path_LD
+lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld
+lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld
+])# AC_LIBTOOL_LANG_CXX_CONFIG
+
+# AC_LIBTOOL_POSTDEP_PREDEP([TAGNAME])
+# ------------------------------------
+# Figure out "hidden" library dependencies from verbose
+# compiler output when linking a shared library.
+# Parse the compiler output and extract the necessary
+# objects, libraries and library flags.
+AC_DEFUN([AC_LIBTOOL_POSTDEP_PREDEP],[
+dnl we can't use the lt_simple_compile_test_code here,
+dnl because it contains code intended for an executable,
+dnl not a library. It's possible we should let each
+dnl tag define a new lt_????_link_test_code variable,
+dnl but it's only used here...
+ifelse([$1],[],[cat > conftest.$ac_ext <<EOF
+int a;
+void foo (void) { a = 0; }
+EOF
+],[$1],[CXX],[cat > conftest.$ac_ext <<EOF
+class Foo
+{
+public:
+ Foo (void) { a = 0; }
+private:
+ int a;
+};
+EOF
+],[$1],[F77],[cat > conftest.$ac_ext <<EOF
+ subroutine foo
+ implicit none
+ integer*4 a
+ a=0
+ return
+ end
+EOF
+],[$1],[GCJ],[cat > conftest.$ac_ext <<EOF
+public class foo {
+ private int a;
+ public void bar (void) {
+ a = 0;
+ }
+};
+EOF
+])
+dnl Parse the compiler output and extract the necessary
+dnl objects, libraries and library flags.
+if AC_TRY_EVAL(ac_compile); then
+ # Parse the compiler output and extract the necessary
+ # objects, libraries and library flags.
+
+ # Sentinel used to keep track of whether or not we are before
+ # the conftest object file.
+ pre_test_object_deps_done=no
+
+ # The `*' in the case matches for architectures that use `case' in
+ # $output_verbose_cmd can trigger glob expansion during the loop
+ # eval without this substitution.
+ output_verbose_link_cmd=`$echo "X$output_verbose_link_cmd" | $Xsed -e "$no_glob_subst"`
+
+ for p in `eval $output_verbose_link_cmd`; do
+ case $p in
+
+ -L* | -R* | -l*)
+ # Some compilers place space between "-{L,R}" and the path.
+ # Remove the space.
+ if test $p = "-L" \
+ || test $p = "-R"; then
+ prev=$p
+ continue
+ else
+ prev=
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ case $p in
+ -L* | -R*)
+ # Internal compiler library paths should come after those
+ # provided the user. The postdeps already come after the
+ # user supplied libs so there is no need to process them.
+ if test -z "$_LT_AC_TAGVAR(compiler_lib_search_path, $1)"; then
+ _LT_AC_TAGVAR(compiler_lib_search_path, $1)="${prev}${p}"
+ else
+ _LT_AC_TAGVAR(compiler_lib_search_path, $1)="${_LT_AC_TAGVAR(compiler_lib_search_path, $1)} ${prev}${p}"
+ fi
+ ;;
+ # The "-l" case would never come before the object being
+ # linked, so don't bother handling this case.
+ esac
+ else
+ if test -z "$_LT_AC_TAGVAR(postdeps, $1)"; then
+ _LT_AC_TAGVAR(postdeps, $1)="${prev}${p}"
+ else
+ _LT_AC_TAGVAR(postdeps, $1)="${_LT_AC_TAGVAR(postdeps, $1)} ${prev}${p}"
+ fi
+ fi
+ ;;
+
+ *.$objext)
+ # This assumes that the test object file only shows up
+ # once in the compiler output.
+ if test "$p" = "conftest.$objext"; then
+ pre_test_object_deps_done=yes
+ continue
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ if test -z "$_LT_AC_TAGVAR(predep_objects, $1)"; then
+ _LT_AC_TAGVAR(predep_objects, $1)="$p"
+ else
+ _LT_AC_TAGVAR(predep_objects, $1)="$_LT_AC_TAGVAR(predep_objects, $1) $p"
+ fi
+ else
+ if test -z "$_LT_AC_TAGVAR(postdep_objects, $1)"; then
+ _LT_AC_TAGVAR(postdep_objects, $1)="$p"
+ else
+ _LT_AC_TAGVAR(postdep_objects, $1)="$_LT_AC_TAGVAR(postdep_objects, $1) $p"
+ fi
+ fi
+ ;;
+
+ *) ;; # Ignore the rest.
+
+ esac
+ done
+
+ # Clean up.
+ rm -f a.out a.exe
+else
+ echo "libtool.m4: error: problem compiling $1 test program"
+fi
+
+$rm -f confest.$objext
+
+# PORTME: override above test on systems where it is broken
+ifelse([$1],[CXX],
+[case $host_os in
+interix3*)
+ # Interix 3.5 installs completely hosed .la files for C++, so rather than
+ # hack all around it, let's just trust "g++" to DTRT.
+ _LT_AC_TAGVAR(predep_objects,$1)=
+ _LT_AC_TAGVAR(postdep_objects,$1)=
+ _LT_AC_TAGVAR(postdeps,$1)=
+ ;;
+
+solaris*)
+ case $cc_basename in
+ CC*)
+ # Adding this requires a known-good setup of shared libraries for
+ # Sun compiler versions before 5.6, else PIC objects from an old
+ # archive will be linked into the output, leading to subtle bugs.
+ _LT_AC_TAGVAR(postdeps,$1)='-lCstd -lCrun'
+ ;;
+ esac
+ ;;
+esac
+])
+
+case " $_LT_AC_TAGVAR(postdeps, $1) " in
+*" -lc "*) _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no ;;
+esac
+])# AC_LIBTOOL_POSTDEP_PREDEP
+
+# AC_LIBTOOL_LANG_F77_CONFIG
+# --------------------------
+# Ensure that the configuration vars for the C compiler are
+# suitably defined. Those variables are subsequently used by
+# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'.
+AC_DEFUN([AC_LIBTOOL_LANG_F77_CONFIG], [_LT_AC_LANG_F77_CONFIG(F77)])
+AC_DEFUN([_LT_AC_LANG_F77_CONFIG],
+[AC_REQUIRE([AC_PROG_F77])
+AC_LANG_PUSH(Fortran 77)
+
+_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_AC_TAGVAR(allow_undefined_flag, $1)=
+_LT_AC_TAGVAR(always_export_symbols, $1)=no
+_LT_AC_TAGVAR(archive_expsym_cmds, $1)=
+_LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_AC_TAGVAR(hardcode_direct, $1)=no
+_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)=
+_LT_AC_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_AC_TAGVAR(hardcode_minus_L, $1)=no
+_LT_AC_TAGVAR(hardcode_automatic, $1)=no
+_LT_AC_TAGVAR(module_cmds, $1)=
+_LT_AC_TAGVAR(module_expsym_cmds, $1)=
+_LT_AC_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_AC_TAGVAR(no_undefined_flag, $1)=
+_LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for f77 test sources.
+ac_ext=f
+
+# Object file extension for compiled f77 test sources.
+objext=o
+_LT_AC_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code=" subroutine t\n return\n end\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code=" program t\n end\n"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_AC_SYS_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${F77-"f77"}
+compiler=$CC
+_LT_AC_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+
+AC_MSG_CHECKING([if libtool supports shared libraries])
+AC_MSG_RESULT([$can_build_shared])
+
+AC_MSG_CHECKING([whether to build shared libraries])
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case $host_os in
+aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+aix4* | aix5*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+esac
+AC_MSG_RESULT([$enable_shared])
+
+AC_MSG_CHECKING([whether to build static libraries])
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+AC_MSG_RESULT([$enable_static])
+
+_LT_AC_TAGVAR(GCC, $1)="$G77"
+_LT_AC_TAGVAR(LD, $1)="$LD"
+
+AC_LIBTOOL_PROG_COMPILER_PIC($1)
+AC_LIBTOOL_PROG_CC_C_O($1)
+AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1)
+AC_LIBTOOL_PROG_LD_SHLIBS($1)
+AC_LIBTOOL_SYS_DYNAMIC_LINKER($1)
+AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1)
+
+AC_LIBTOOL_CONFIG($1)
+
+AC_LANG_POP
+CC="$lt_save_CC"
+])# AC_LIBTOOL_LANG_F77_CONFIG
+
+
+# AC_LIBTOOL_LANG_GCJ_CONFIG
+# --------------------------
+# Ensure that the configuration vars for the C compiler are
+# suitably defined. Those variables are subsequently used by
+# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'.
+AC_DEFUN([AC_LIBTOOL_LANG_GCJ_CONFIG], [_LT_AC_LANG_GCJ_CONFIG(GCJ)])
+AC_DEFUN([_LT_AC_LANG_GCJ_CONFIG],
+[AC_LANG_SAVE
+
+# Source file extension for Java test sources.
+ac_ext=java
+
+# Object file extension for compiled Java test sources.
+objext=o
+_LT_AC_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="class foo {}\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='public class conftest { public static void main(String[[]] argv) {}; }\n'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_AC_SYS_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${GCJ-"gcj"}
+compiler=$CC
+_LT_AC_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+
+# GCJ did not exist at the time GCC didn't implicitly link libc in.
+_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+
+_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+
+AC_LIBTOOL_PROG_COMPILER_NO_RTTI($1)
+AC_LIBTOOL_PROG_COMPILER_PIC($1)
+AC_LIBTOOL_PROG_CC_C_O($1)
+AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1)
+AC_LIBTOOL_PROG_LD_SHLIBS($1)
+AC_LIBTOOL_SYS_DYNAMIC_LINKER($1)
+AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1)
+
+AC_LIBTOOL_CONFIG($1)
+
+AC_LANG_RESTORE
+CC="$lt_save_CC"
+])# AC_LIBTOOL_LANG_GCJ_CONFIG
+
+
+# AC_LIBTOOL_LANG_RC_CONFIG
+# -------------------------
+# Ensure that the configuration vars for the Windows resource compiler are
+# suitably defined. Those variables are subsequently used by
+# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'.
+AC_DEFUN([AC_LIBTOOL_LANG_RC_CONFIG], [_LT_AC_LANG_RC_CONFIG(RC)])
+AC_DEFUN([_LT_AC_LANG_RC_CONFIG],
+[AC_LANG_SAVE
+
+# Source file extension for RC test sources.
+ac_ext=rc
+
+# Object file extension for compiled RC test sources.
+objext=o
+_LT_AC_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }\n'
+
+# Code to be used in simple link tests
+lt_simple_link_test_code="$lt_simple_compile_test_code"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_AC_SYS_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${RC-"windres"}
+compiler=$CC
+_LT_AC_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+
+AC_LIBTOOL_CONFIG($1)
+
+AC_LANG_RESTORE
+CC="$lt_save_CC"
+])# AC_LIBTOOL_LANG_RC_CONFIG
+
+
+# AC_LIBTOOL_CONFIG([TAGNAME])
+# ----------------------------
+# If TAGNAME is not passed, then create an initial libtool script
+# with a default configuration from the untagged config vars. Otherwise
+# add code to config.status for appending the configuration named by
+# TAGNAME from the matching tagged config vars.
+AC_DEFUN([AC_LIBTOOL_CONFIG],
+[# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ _LT_AC_TAGVAR(compiler, $1) \
+ _LT_AC_TAGVAR(CC, $1) \
+ _LT_AC_TAGVAR(LD, $1) \
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1) \
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1) \
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1) \
+ _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) \
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1) \
+ _LT_AC_TAGVAR(thread_safe_flag_spec, $1) \
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1) \
+ _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1) \
+ _LT_AC_TAGVAR(old_archive_cmds, $1) \
+ _LT_AC_TAGVAR(old_archive_from_new_cmds, $1) \
+ _LT_AC_TAGVAR(predep_objects, $1) \
+ _LT_AC_TAGVAR(postdep_objects, $1) \
+ _LT_AC_TAGVAR(predeps, $1) \
+ _LT_AC_TAGVAR(postdeps, $1) \
+ _LT_AC_TAGVAR(compiler_lib_search_path, $1) \
+ _LT_AC_TAGVAR(archive_cmds, $1) \
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1) \
+ _LT_AC_TAGVAR(postinstall_cmds, $1) \
+ _LT_AC_TAGVAR(postuninstall_cmds, $1) \
+ _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1) \
+ _LT_AC_TAGVAR(allow_undefined_flag, $1) \
+ _LT_AC_TAGVAR(no_undefined_flag, $1) \
+ _LT_AC_TAGVAR(export_symbols_cmds, $1) \
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) \
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1) \
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1) \
+ _LT_AC_TAGVAR(hardcode_automatic, $1) \
+ _LT_AC_TAGVAR(module_cmds, $1) \
+ _LT_AC_TAGVAR(module_expsym_cmds, $1) \
+ _LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1) \
+ _LT_AC_TAGVAR(exclude_expsyms, $1) \
+ _LT_AC_TAGVAR(include_expsyms, $1); do
+
+ case $var in
+ _LT_AC_TAGVAR(old_archive_cmds, $1) | \
+ _LT_AC_TAGVAR(old_archive_from_new_cmds, $1) | \
+ _LT_AC_TAGVAR(archive_cmds, $1) | \
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1) | \
+ _LT_AC_TAGVAR(module_cmds, $1) | \
+ _LT_AC_TAGVAR(module_expsym_cmds, $1) | \
+ _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1) | \
+ _LT_AC_TAGVAR(export_symbols_cmds, $1) | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\[$]0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\[$]0 --fallback-echo"[$]/[$]0 --fallback-echo"/'`
+ ;;
+ esac
+
+ifelse([$1], [],
+ [cfgfile="${ofile}T"
+ trap "$rm \"$cfgfile\"; exit 1" 1 2 15
+ $rm -f "$cfgfile"
+ AC_MSG_NOTICE([creating $ofile])],
+ [cfgfile="$ofile"])
+
+ cat <<__EOF__ >> "$cfgfile"
+ifelse([$1], [],
+[#! $SHELL
+
+# `$echo "$cfgfile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $PROGRAM (GNU $PACKAGE $VERSION$TIMESTAMP)
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001
+# Free Software Foundation, Inc.
+#
+# This file is part of GNU Libtool:
+# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="$SED -e 1s/^X//"
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+# The names of the tagged configurations supported by this script.
+available_tags=
+
+# ### BEGIN LIBTOOL CONFIG],
+[# ### BEGIN LIBTOOL TAG CONFIG: $tagname])
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$_LT_AC_TAGVAR(archive_cmds_need_lc, $1)
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_[]_LT_AC_TAGVAR(compiler, $1)
+
+# Is the compiler the GNU C compiler?
+with_gcc=$_LT_AC_TAGVAR(GCC, $1)
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_[]_LT_AC_TAGVAR(LD, $1)
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_wl, $1)
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_[]_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_static, $1)
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_[]_LT_AC_TAGVAR(export_dynamic_flag_spec, $1)
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_[]_LT_AC_TAGVAR(whole_archive_flag_spec, $1)
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_[]_LT_AC_TAGVAR(thread_safe_flag_spec, $1)
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_cmds, $1)
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_from_new_cmds, $1)
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1)
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_[]_LT_AC_TAGVAR(archive_cmds, $1)
+archive_expsym_cmds=$lt_[]_LT_AC_TAGVAR(archive_expsym_cmds, $1)
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_[]_LT_AC_TAGVAR(module_cmds, $1)
+module_expsym_cmds=$lt_[]_LT_AC_TAGVAR(module_expsym_cmds, $1)
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_[]_LT_AC_TAGVAR(predep_objects, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_[]_LT_AC_TAGVAR(postdep_objects, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_[]_LT_AC_TAGVAR(predeps, $1)
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_[]_LT_AC_TAGVAR(postdeps, $1)
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_[]_LT_AC_TAGVAR(compiler_lib_search_path, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_[]_LT_AC_TAGVAR(allow_undefined_flag, $1)
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_[]_LT_AC_TAGVAR(no_undefined_flag, $1)
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$_LT_AC_TAGVAR(hardcode_action, $1)
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_separator, $1)
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$_LT_AC_TAGVAR(hardcode_direct, $1)
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$_LT_AC_TAGVAR(hardcode_minus_L, $1)
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$_LT_AC_TAGVAR(hardcode_shlibpath_var, $1)
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$_LT_AC_TAGVAR(hardcode_automatic, $1)
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$_LT_AC_TAGVAR(link_all_deplibs, $1)
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$_LT_AC_TAGVAR(fix_srcfile_path, $1)"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$_LT_AC_TAGVAR(always_export_symbols, $1)
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_[]_LT_AC_TAGVAR(export_symbols_cmds, $1)
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_[]_LT_AC_TAGVAR(exclude_expsyms, $1)
+
+# Symbols that must always be exported.
+include_expsyms=$lt_[]_LT_AC_TAGVAR(include_expsyms, $1)
+
+ifelse([$1],[],
+[# ### END LIBTOOL CONFIG],
+[# ### END LIBTOOL TAG CONFIG: $tagname])
+
+__EOF__
+
+ifelse([$1],[], [
+ case $host_os in
+ aix3*)
+ cat <<\EOF >> "$cfgfile"
+
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+EOF
+ ;;
+ esac
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" || (rm -f "$cfgfile"; exit 1)
+
+ mv -f "$cfgfile" "$ofile" || \
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+])
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+])# AC_LIBTOOL_CONFIG
+
+
+# AC_LIBTOOL_PROG_COMPILER_NO_RTTI([TAGNAME])
+# -------------------------------------------
+AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_NO_RTTI],
+[AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl
+
+_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+
+if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin'
+
+ AC_LIBTOOL_COMPILER_OPTION([if $compiler supports -fno-rtti -fno-exceptions],
+ lt_cv_prog_compiler_rtti_exceptions,
+ [-fno-rtti -fno-exceptions], [],
+ [_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)="$_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) -fno-rtti -fno-exceptions"])
+fi
+])# AC_LIBTOOL_PROG_COMPILER_NO_RTTI
+
+
+# AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE
+# ---------------------------------
+AC_DEFUN([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE],
+[AC_REQUIRE([AC_CANONICAL_HOST])
+AC_REQUIRE([AC_PROG_NM])
+AC_REQUIRE([AC_OBJEXT])
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+AC_MSG_CHECKING([command to parse $NM output from $compiler object])
+AC_CACHE_VAL([lt_cv_sys_global_symbol_pipe],
+[
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[[BCDEGRST]]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([[_A-Za-z]][[_A-Za-z0-9]]*\)'
+
+# Transform an extracted symbol line into a proper C declaration
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^. .* \(.*\)$/extern int \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+ symcode='[[BCDT]]'
+ ;;
+cygwin* | mingw* | pw32*)
+ symcode='[[ABCDGISTW]]'
+ ;;
+hpux*) # Its linker distinguishes data from code symbols
+ if test "$host_cpu" = ia64; then
+ symcode='[[ABCDEGRST]]'
+ fi
+ lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+ lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+ ;;
+linux*)
+ if test "$host_cpu" = ia64; then
+ symcode='[[ABCDGIRSTW]]'
+ lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+ lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+ fi
+ ;;
+irix* | nonstopux*)
+ symcode='[[BCDEGRST]]'
+ ;;
+osf*)
+ symcode='[[BCDEGQRST]]'
+ ;;
+solaris*)
+ symcode='[[BDRT]]'
+ ;;
+sco3.2v5*)
+ symcode='[[DT]]'
+ ;;
+sysv4.2uw2*)
+ symcode='[[DT]]'
+ ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+ symcode='[[ABDT]]'
+ ;;
+sysv4)
+ symcode='[[DFNSTU]]'
+ ;;
+esac
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+ opt_cr=`echo 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+ symcode='[[ABCDGIRSTW]]' ;;
+esac
+
+# Try without a prefix undercore, then with it.
+for ac_symprfx in "" "_"; do
+
+ # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+ symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+ # Write the raw and C identifiers.
+ lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[[ ]]\($symcode$symcode*\)[[ ]][[ ]]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+
+ # Check to see that the pipe works correctly.
+ pipe_works=no
+
+ rm -f conftest*
+ cat > conftest.$ac_ext <<EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+EOF
+
+ if AC_TRY_EVAL(ac_compile); then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if AC_TRY_EVAL(NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist) && test -s "$nlist"; then
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ else
+ rm -f "$nlist"T
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if grep ' nm_test_var$' "$nlist" >/dev/null; then
+ if grep ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<EOF > conftest.$ac_ext
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+EOF
+ # Now generate the symbol file.
+ eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | grep -v main >> conftest.$ac_ext'
+
+ cat <<EOF >> conftest.$ac_ext
+#if defined (__STDC__) && __STDC__
+# define lt_ptr_t void *
+#else
+# define lt_ptr_t char *
+# define const
+#endif
+
+/* The mapping between symbol names and symbols. */
+const struct {
+ const char *name;
+ lt_ptr_t address;
+}
+lt_preloaded_symbols[[]] =
+{
+EOF
+ $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (lt_ptr_t) \&\2},/" < "$nlist" | grep -v main >> conftest.$ac_ext
+ cat <<\EOF >> conftest.$ac_ext
+ {0, (lt_ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif
+EOF
+ # Now try linking the two files.
+ mv conftest.$ac_objext conftstm.$ac_objext
+ lt_save_LIBS="$LIBS"
+ lt_save_CFLAGS="$CFLAGS"
+ LIBS="conftstm.$ac_objext"
+ CFLAGS="$CFLAGS$_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)"
+ if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext}; then
+ pipe_works=yes
+ fi
+ LIBS="$lt_save_LIBS"
+ CFLAGS="$lt_save_CFLAGS"
+ else
+ echo "cannot find nm_test_func in $nlist" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "cannot run $lt_cv_sys_global_symbol_pipe" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "$progname: failed program was:" >&AS_MESSAGE_LOG_FD
+ cat conftest.$ac_ext >&5
+ fi
+ rm -f conftest* conftst*
+
+ # Do not use the global_symbol_pipe unless it works.
+ if test "$pipe_works" = yes; then
+ break
+ else
+ lt_cv_sys_global_symbol_pipe=
+ fi
+done
+])
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+ lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+ AC_MSG_RESULT(failed)
+else
+ AC_MSG_RESULT(ok)
+fi
+]) # AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE
+
+
+# AC_LIBTOOL_PROG_COMPILER_PIC([TAGNAME])
+# ---------------------------------------
+AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_PIC],
+[_LT_AC_TAGVAR(lt_prog_compiler_wl, $1)=
+_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+_LT_AC_TAGVAR(lt_prog_compiler_static, $1)=
+
+AC_MSG_CHECKING([for $compiler option to produce PIC])
+ ifelse([$1],[CXX],[
+ # C++ specific cases for pic, static, wl, etc.
+ if test "$GXX" = yes; then
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+ mingw* | os2* | pw32*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'
+ ;;
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+ ;;
+ *djgpp*)
+ # DJGPP does not support shared libraries at all
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+ ;;
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+ fi
+ ;;
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ else
+ case $host_os in
+ aix4* | aix5*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ else
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ chorus*)
+ case $cc_basename in
+ cxch68*)
+ # Green Hills C++ Compiler
+ # _LT_AC_TAGVAR(lt_prog_compiler_static, $1)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a"
+ ;;
+ esac
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-qnocommon'
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ ;;
+ esac
+ ;;
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ # FreeBSD uses GNU C++
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ case $cc_basename in
+ CC*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ if test "$host_cpu" != ia64; then
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ fi
+ ;;
+ aCC*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ ;;
+ esac
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ interix*)
+ # This is c89, which is MS Visual C++ (no shared libs)
+ # Anyone wants to do a port?
+ ;;
+ irix5* | irix6* | nonstopux*)
+ case $cc_basename in
+ CC*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ # CC pic flag -KPIC is the default.
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ linux*)
+ case $cc_basename in
+ KCC*)
+ # KAI C++ Compiler
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ icpc* | ecpc*)
+ # Intel C++
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ pgCC*)
+ # Portland Group C++ compiler.
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ cxx*)
+ # Compaq C++
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ lynxos*)
+ ;;
+ m88k*)
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-W c,exportall'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ netbsd*)
+ ;;
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ cxx*)
+ # Digital/Compaq C++
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ psos*)
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ lcc*)
+ # Lucid
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ case $cc_basename in
+ CC*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ esac
+ ;;
+ vxworks*)
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+ esac
+ fi
+],
+[
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+ ;;
+
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+ ;;
+
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ enable_shared=no
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+ fi
+ ;;
+
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ ;;
+
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ else
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-qnocommon'
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ ;;
+ esac
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # PIC (with -KPIC) is the default.
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+
+ newsos6)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ linux*)
+ case $cc_basename in
+ icc* | ecc*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ ccc*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # All Alpha code is PIC.
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ esac
+ ;;
+
+ osf3* | osf4* | osf5*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # All OSF/1 code is PIC.
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+
+ solaris*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ';;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-Kconform_pic'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ unicos*)
+ _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+
+ uts4*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+ esac
+ fi
+])
+AC_MSG_RESULT([$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)])
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)"; then
+ AC_LIBTOOL_COMPILER_OPTION([if $compiler PIC flag $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) works],
+ _LT_AC_TAGVAR(lt_prog_compiler_pic_works, $1),
+ [$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)ifelse([$1],[],[ -DPIC],[ifelse([$1],[CXX],[ -DPIC],[])])], [],
+ [case $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) in
+ "" | " "*) ;;
+ *) _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=" $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)" ;;
+ esac],
+ [_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no])
+fi
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=
+ ;;
+ *)
+ _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)="$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)ifelse([$1],[],[ -DPIC],[ifelse([$1],[CXX],[ -DPIC],[])])"
+ ;;
+esac
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$_LT_AC_TAGVAR(lt_prog_compiler_wl, $1) eval lt_tmp_static_flag=\"$_LT_AC_TAGVAR(lt_prog_compiler_static, $1)\"
+AC_LIBTOOL_LINKER_OPTION([if $compiler static flag $lt_tmp_static_flag works],
+ _LT_AC_TAGVAR(lt_prog_compiler_static_works, $1),
+ $lt_tmp_static_flag,
+ [],
+ [_LT_AC_TAGVAR(lt_prog_compiler_static, $1)=])
+])
+
+
+# AC_LIBTOOL_PROG_LD_SHLIBS([TAGNAME])
+# ------------------------------------
+# See if the linker supports building shared libraries.
+AC_DEFUN([AC_LIBTOOL_PROG_LD_SHLIBS],
+[AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+ifelse([$1],[CXX],[
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ case $host_os in
+ aix4* | aix5*)
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols'
+ else
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols'
+ fi
+ ;;
+ pw32*)
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)="$ltdll_cmds"
+ ;;
+ cygwin* | mingw*)
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]] /s/.* \([[^ ]]*\)/\1 DATA/;/^.* __nm__/s/^.* __nm__\([[^ ]]*\) [[^ ]]*/\1 DATA/;/^I /d;/^[[AITW]] /s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ *)
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ esac
+],[
+ runpath_var=
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=
+ _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+ _LT_AC_TAGVAR(archive_cmds, $1)=
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)=
+ _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)=
+ _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1)=
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+ _LT_AC_TAGVAR(thread_safe_flag_spec, $1)=
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)=
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=unknown
+ _LT_AC_TAGVAR(hardcode_automatic, $1)=no
+ _LT_AC_TAGVAR(module_cmds, $1)=
+ _LT_AC_TAGVAR(module_expsym_cmds, $1)=
+ _LT_AC_TAGVAR(always_export_symbols, $1)=no
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ _LT_AC_TAGVAR(include_expsyms, $1)=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ _LT_AC_TAGVAR(exclude_expsyms, $1)="_GLOBAL_OFFSET_TABLE_"
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ extract_expsyms_cmds=
+ # Just being paranoid about ensuring that cc_basename is set.
+ _LT_CC_BASENAME([$compiler])
+ case $host_os in
+ cygwin* | mingw* | pw32*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ _LT_AC_TAGVAR(ld_shlibs, $1)=yes
+ if test "$with_gnu_ld" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>/dev/null` in
+ *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix3* | aix4* | aix5*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ cat <<EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.9.1, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to modify your PATH
+*** so that a non-GNU linker is found, and then restart.
+
+EOF
+ fi
+ ;;
+
+ amigaos*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+
+ # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+ # that the semantics of dynamic libraries on AmigaOS, at least up
+ # to version 4, is to share data among multiple programs linked
+ # with the same dynamic library. Since this doesn't match the
+ # behavior of shared libraries on other platforms, we can't use
+ # them.
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+ # as there is no search path for DLLs.
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_AC_TAGVAR(always_export_symbols, $1)=no
+ _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]] /s/.* \([[^ ]]*\)/\1 DATA/'\'' | $SED -e '\''/^[[AITW]] /s/.* //'\'' | sort | uniq > $export_symbols'
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ interix3*)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ linux*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ tmp_addflag=
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ esac
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test $supports_anon_versioning = yes; then
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ $echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ cat <<EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+EOF
+ elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.1[[0-5]].*)
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+
+ if test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no; then
+ runpath_var=
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_AC_TAGVAR(always_export_symbols, $1)=yes
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported
+ fi
+ ;;
+
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols'
+ else
+ _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[[23]]|aix4.[[23]].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ _LT_AC_TAGVAR(archive_cmds, $1)=''
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[[012]]|aix4.[[012]].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ else
+ # We have old collect2
+ _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ _LT_AC_TAGVAR(always_export_symbols, $1)=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ _LT_AC_SYS_LIBPATH_AIX
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ _LT_AC_SYS_LIBPATH_AIX
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ # see comment about different semantics on the GNU ld section
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ bsdi[[45]]*)
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)='true'
+ # FIXME: Should let the user specify the lib program.
+ _LT_AC_TAGVAR(old_archive_cmds, $1)='lib /OUT:$oldlib$oldobjs$old_deplibs'
+ _LT_AC_TAGVAR(fix_srcfile_path, $1)='`cygpath -w "$srcfile"`'
+ _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ ;;
+
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[[012]])
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[[012]])
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_automatic, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)=''
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ if test "$GCC" = yes ; then
+ output_verbose_link_cmd='echo'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ freebsd1*)
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='+b $libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+ *)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='-rpath $libdir'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ newsos6)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ openbsd*)
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ else
+ case $host_os in
+ openbsd[[01]].* | openbsd2.[[0-7]] | openbsd2.[[0-7]].*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ ;;
+ *)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ ;;
+
+ os2*)
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_AC_TAGVAR(archive_cmds, $1)='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ else
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~
+ $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=:
+ ;;
+
+ solaris*)
+ _LT_AC_TAGVAR(no_undefined_flag, $1)=' -z text'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp'
+ else
+ wlarc=''
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ case $host_os in
+ solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+ *)
+ # The compiler driver will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl, iff we do not link with $LD.
+ # Luckily, gcc supports the same syntax we need for Sun Studio.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ case $wlarc in
+ '')
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract' ;;
+ *)
+ _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;;
+ esac ;;
+ esac
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes
+ _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(reload_cmds, $1)='$CC -r -o $output$reload_objs'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no
+ ;;
+ motorola)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_direct, $1)=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ sysv4.3*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ _LT_AC_TAGVAR(ld_shlibs, $1)=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7*)
+ _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_AC_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ *)
+ _LT_AC_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ fi
+])
+AC_MSG_RESULT([$_LT_AC_TAGVAR(ld_shlibs, $1)])
+test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$_LT_AC_TAGVAR(archive_cmds_need_lc, $1)" in
+x|xyes)
+ # Assume -lc should be added
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $_LT_AC_TAGVAR(archive_cmds, $1) in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ AC_MSG_CHECKING([whether -lc should be explicitly linked in])
+ $rm conftest*
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if AC_TRY_EVAL(ac_compile) 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$_LT_AC_TAGVAR(lt_prog_compiler_wl, $1)
+ pic_flag=$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$_LT_AC_TAGVAR(allow_undefined_flag, $1)
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=
+ if AC_TRY_EVAL(_LT_AC_TAGVAR(archive_cmds, $1) 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1)
+ then
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no
+ else
+ _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes
+ fi
+ _LT_AC_TAGVAR(allow_undefined_flag, $1)=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $rm conftest*
+ AC_MSG_RESULT([$_LT_AC_TAGVAR(archive_cmds_need_lc, $1)])
+ ;;
+ esac
+ fi
+ ;;
+esac
+])# AC_LIBTOOL_PROG_LD_SHLIBS
+
+
+# _LT_AC_FILE_LTDLL_C
+# -------------------
+# Be careful that the start marker always follows a newline.
+AC_DEFUN([_LT_AC_FILE_LTDLL_C], [
+# /* ltdll.c starts here */
+# #define WIN32_LEAN_AND_MEAN
+# #include <windows.h>
+# #undef WIN32_LEAN_AND_MEAN
+# #include <stdio.h>
+#
+# #ifndef __CYGWIN__
+# # ifdef __CYGWIN32__
+# # define __CYGWIN__ __CYGWIN32__
+# # endif
+# #endif
+#
+# #ifdef __cplusplus
+# extern "C" {
+# #endif
+# BOOL APIENTRY DllMain (HINSTANCE hInst, DWORD reason, LPVOID reserved);
+# #ifdef __cplusplus
+# }
+# #endif
+#
+# #ifdef __CYGWIN__
+# #include <cygwin/cygwin_dll.h>
+# DECLARE_CYGWIN_DLL( DllMain );
+# #endif
+# HINSTANCE __hDllInstance_base;
+#
+# BOOL APIENTRY
+# DllMain (HINSTANCE hInst, DWORD reason, LPVOID reserved)
+# {
+# __hDllInstance_base = hInst;
+# return TRUE;
+# }
+# /* ltdll.c ends here */
+])# _LT_AC_FILE_LTDLL_C
+
+
+# _LT_AC_TAGVAR(VARNAME, [TAGNAME])
+# ---------------------------------
+AC_DEFUN([_LT_AC_TAGVAR], [ifelse([$2], [], [$1], [$1_$2])])
+
+
+# old names
+AC_DEFUN([AM_PROG_LIBTOOL], [AC_PROG_LIBTOOL])
+AC_DEFUN([AM_ENABLE_SHARED], [AC_ENABLE_SHARED($@)])
+AC_DEFUN([AM_ENABLE_STATIC], [AC_ENABLE_STATIC($@)])
+AC_DEFUN([AM_DISABLE_SHARED], [AC_DISABLE_SHARED($@)])
+AC_DEFUN([AM_DISABLE_STATIC], [AC_DISABLE_STATIC($@)])
+AC_DEFUN([AM_PROG_LD], [AC_PROG_LD])
+AC_DEFUN([AM_PROG_NM], [AC_PROG_NM])
+
+# This is just to silence aclocal about the macro not being used
+ifelse([AC_DISABLE_FAST_INSTALL])
+
+AC_DEFUN([LT_AC_PROG_GCJ],
+[AC_CHECK_TOOL(GCJ, gcj, no)
+ test "x${GCJFLAGS+set}" = xset || GCJFLAGS="-g -O2"
+ AC_SUBST(GCJFLAGS)
+])
+
+AC_DEFUN([LT_AC_PROG_RC],
+[AC_CHECK_TOOL(RC, windres, no)
+])
+
+# NOTE: This macro has been submitted for inclusion into #
+# GNU Autoconf as AC_PROG_SED. When it is available in #
+# a released version of Autoconf we should remove this #
+# macro and use it instead. #
+# LT_AC_PROG_SED
+# --------------
+# Check for a fully-functional sed program, that truncates
+# as few characters as possible. Prefer GNU sed if found.
+AC_DEFUN([LT_AC_PROG_SED],
+[AC_MSG_CHECKING([for a sed that does not truncate output])
+AC_CACHE_VAL(lt_cv_path_SED,
+[# Loop through the user's path and test for sed and gsed.
+# Then use that list of sed's as ones to test for truncation.
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for lt_ac_prog in sed gsed; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then
+ lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext"
+ fi
+ done
+ done
+done
+IFS=$as_save_IFS
+lt_ac_max=0
+lt_ac_count=0
+# Add /usr/xpg4/bin/sed as it is typically found on Solaris
+# along with /bin/sed that truncates output.
+for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do
+ test ! -f $lt_ac_sed && continue
+ cat /dev/null > conftest.in
+ lt_ac_count=0
+ echo $ECHO_N "0123456789$ECHO_C" >conftest.in
+ # Check for GNU sed and select it if it is found.
+ if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then
+ lt_cv_path_SED=$lt_ac_sed
+ break
+ fi
+ while true; do
+ cat conftest.in conftest.in >conftest.tmp
+ mv conftest.tmp conftest.in
+ cp conftest.in conftest.nl
+ echo >>conftest.nl
+ $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break
+ cmp -s conftest.out conftest.nl || break
+ # 10000 chars as input seems more than enough
+ test $lt_ac_count -gt 10 && break
+ lt_ac_count=`expr $lt_ac_count + 1`
+ if test $lt_ac_count -gt $lt_ac_max; then
+ lt_ac_max=$lt_ac_count
+ lt_cv_path_SED=$lt_ac_sed
+ fi
+ done
+done
+])
+SED=$lt_cv_path_SED
+AC_SUBST([SED])
+AC_MSG_RESULT([$SED])
+])
+
+# pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*-
+#
+# Copyright © 2004 Scott James Remnant <scott@netsplit.com>.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# PKG_PROG_PKG_CONFIG([MIN-VERSION])
+# ----------------------------------
+AC_DEFUN([PKG_PROG_PKG_CONFIG],
+[m4_pattern_forbid([^_?PKG_[A-Z_]+$])
+m4_pattern_allow([^PKG_CONFIG(_PATH)?$])
+AC_ARG_VAR([PKG_CONFIG], [path to pkg-config utility])dnl
+if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then
+ AC_PATH_TOOL([PKG_CONFIG], [pkg-config])
+fi
+if test -n "$PKG_CONFIG"; then
+ _pkg_min_version=m4_default([$1], [0.9.0])
+ AC_MSG_CHECKING([pkg-config is at least version $_pkg_min_version])
+ if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ PKG_CONFIG=""
+ fi
+
+fi[]dnl
+])# PKG_PROG_PKG_CONFIG
+
+# PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND])
+#
+# Check to see whether a particular set of modules exists. Similar
+# to PKG_CHECK_MODULES(), but does not set variables or print errors.
+#
+#
+# Similar to PKG_CHECK_MODULES, make sure that the first instance of
+# this or PKG_CHECK_MODULES is called, or make sure to call
+# PKG_CHECK_EXISTS manually
+# --------------------------------------------------------------
+AC_DEFUN([PKG_CHECK_EXISTS],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+if test -n "$PKG_CONFIG" && \
+ AC_RUN_LOG([$PKG_CONFIG --exists --print-errors "$1"]); then
+ m4_ifval([$2], [$2], [:])
+m4_ifvaln([$3], [else
+ $3])dnl
+fi])
+
+
+# _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES])
+# ---------------------------------------------
+m4_define([_PKG_CONFIG],
+[if test -n "$PKG_CONFIG"; then
+ if test -n "$$1"; then
+ pkg_cv_[]$1="$$1"
+ else
+ PKG_CHECK_EXISTS([$3],
+ [pkg_cv_[]$1=`$PKG_CONFIG --[]$2 "$3" 2>/dev/null`],
+ [pkg_failed=yes])
+ fi
+else
+ pkg_failed=untried
+fi[]dnl
+])# _PKG_CONFIG
+
+# _PKG_SHORT_ERRORS_SUPPORTED
+# -----------------------------
+AC_DEFUN([_PKG_SHORT_ERRORS_SUPPORTED],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])
+if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then
+ _pkg_short_errors_supported=yes
+else
+ _pkg_short_errors_supported=no
+fi[]dnl
+])# _PKG_SHORT_ERRORS_SUPPORTED
+
+
+# PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND],
+# [ACTION-IF-NOT-FOUND])
+#
+#
+# Note that if there is a possibility the first call to
+# PKG_CHECK_MODULES might not happen, you should be sure to include an
+# explicit call to PKG_PROG_PKG_CONFIG in your configure.ac
+#
+#
+# --------------------------------------------------------------
+AC_DEFUN([PKG_CHECK_MODULES],
+[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl
+AC_ARG_VAR([$1][_CFLAGS], [C compiler flags for $1, overriding pkg-config])dnl
+AC_ARG_VAR([$1][_LIBS], [linker flags for $1, overriding pkg-config])dnl
+
+pkg_failed=no
+AC_MSG_CHECKING([for $1])
+
+_PKG_CONFIG([$1][_CFLAGS], [cflags], [$2])
+_PKG_CONFIG([$1][_LIBS], [libs], [$2])
+
+m4_define([_PKG_TEXT], [Alternatively, you may set the environment variables $1[]_CFLAGS
+and $1[]_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.])
+
+if test $pkg_failed = yes; then
+ _PKG_SHORT_ERRORS_SUPPORTED
+ if test $_pkg_short_errors_supported = yes; then
+ $1[]_PKG_ERRORS=`$PKG_CONFIG --short-errors --errors-to-stdout --print-errors "$2"`
+ else
+ $1[]_PKG_ERRORS=`$PKG_CONFIG --errors-to-stdout --print-errors "$2"`
+ fi
+ # Put the nasty error message in config.log where it belongs
+ echo "$$1[]_PKG_ERRORS" >&AS_MESSAGE_LOG_FD
+
+ ifelse([$4], , [AC_MSG_ERROR(dnl
+[Package requirements ($2) were not met:
+
+$$1_PKG_ERRORS
+
+Consider adjusting the PKG_CONFIG_PATH environment variable if you
+installed software in a non-standard prefix.
+
+_PKG_TEXT
+])],
+ [AC_MSG_RESULT([no])
+ $4])
+elif test $pkg_failed = untried; then
+ ifelse([$4], , [AC_MSG_FAILURE(dnl
+[The pkg-config script could not be found or is too old. Make sure it
+is in your PATH or set the PKG_CONFIG environment variable to the full
+path to pkg-config.
+
+_PKG_TEXT
+
+To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>.])],
+ [$4])
+else
+ $1[]_CFLAGS=$pkg_cv_[]$1[]_CFLAGS
+ $1[]_LIBS=$pkg_cv_[]$1[]_LIBS
+ AC_MSG_RESULT([yes])
+ ifelse([$3], , :, [$3])
+fi[]dnl
+])# PKG_CHECK_MODULES
+
+dnl
+dnl Copyright 2005-2006 Sun Microsystems, Inc. All rights reserved.
+dnl
+dnl Permission is hereby granted, free of charge, to any person obtaining a
+dnl copy of this software and associated documentation files (the
+dnl "Software"), to deal in the Software without restriction, including
+dnl without limitation the rights to use, copy, modify, merge, publish,
+dnl distribute, and/or sell copies of the Software, and to permit persons
+dnl to whom the Software is furnished to do so, provided that the above
+dnl copyright notice(s) and this permission notice appear in all copies of
+dnl the Software and that both the above copyright notice(s) and this
+dnl permission notice appear in supporting documentation.
+dnl
+dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT
+dnl OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR
+dnl HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL
+dnl INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING
+dnl FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT,
+dnl NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION
+dnl WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+dnl
+dnl Except as contained in this notice, the name of a copyright holder
+dnl shall not be used in advertising or otherwise to promote the sale, use
+dnl or other dealings in this Software without prior written authorization
+dnl of the copyright holder.
+
+# XORG_MACROS_VERSION(required-version)
+# -------------------------------------
+# Minimum version: 1.1.0
+#
+# If you're using a macro added in Version 1.1 or newer, include this in
+# your configure.ac with the minimum required version, such as:
+# XORG_MACROS_VERSION(1.1)
+#
+# To force at least a version with this macro defined, also add:
+# m4_ifndef([XORG_MACROS_VERSION], [AC_FATAL([must install xorg-macros 1.1 or later before running autoconf/autogen])])
+#
+#
+# See the "minimum version" comment for each macro you use to see what
+# version you require.
+AC_DEFUN([XORG_MACROS_VERSION],[
+ [XORG_MACROS_needed_version=$1
+ XORG_MACROS_needed_major=`echo $XORG_MACROS_needed_version | sed 's/\..*$//'`
+ XORG_MACROS_needed_minor=`echo $XORG_MACROS_needed_version | sed -e 's/^[0-9]*\.//' -e 's/\..*$//'`]
+ AC_MSG_CHECKING([if xorg-macros used to generate configure is at least ${XORG_MACROS_needed_major}.${XORG_MACROS_needed_minor}])
+ [XORG_MACROS_version=1.1.1
+ XORG_MACROS_major=`echo $XORG_MACROS_version | sed 's/\..*$//'`
+ XORG_MACROS_minor=`echo $XORG_MACROS_version | sed -e 's/^[0-9]*\.//' -e 's/\..*$//'`]
+ if test $XORG_MACROS_major -ne $XORG_MACROS_needed_major ; then
+ AC_MSG_ERROR([configure built with incompatible version of xorg-macros.m4 - requires version ${XORG_MACROS_major}.x])
+ fi
+ if test $XORG_MACROS_minor -lt $XORG_MACROS_needed_minor ; then
+ AC_MSG_ERROR([configure built with too old of a version of xorg-macros.m4 - requires version ${XORG_MACROS_major}.${XORG_MACROS_minor}.0 or newer])
+ fi
+ AC_MSG_RESULT([yes, $XORG_MACROS_version])
+]) # XORG_MACROS_VERSION
+
+# XORG_PROG_RAWCPP()
+# ------------------
+# Minimum version: 1.0.0
+#
+# Find cpp program and necessary flags for use in pre-processing text files
+# such as man pages and config files
+AC_DEFUN([XORG_PROG_RAWCPP],[
+AC_REQUIRE([AC_PROG_CPP])
+AC_PATH_PROGS(RAWCPP, [cpp], [${CPP}],
+ [$PATH:/bin:/usr/bin:/usr/lib:/usr/libexec:/usr/ccs/lib:/usr/ccs/lbin:/lib])
+
+# Check for flag to avoid builtin definitions - assumes unix is predefined,
+# which is not the best choice for supporting other OS'es, but covers most
+# of the ones we need for now.
+AC_MSG_CHECKING([if $RAWCPP requires -undef])
+AC_LANG_CONFTEST([Does cpp redefine unix ?])
+if test `${RAWCPP} < conftest.$ac_ext | grep -c 'unix'` -eq 1 ; then
+ AC_MSG_RESULT([no])
+else
+ if test `${RAWCPP} -undef < conftest.$ac_ext | grep -c 'unix'` -eq 1 ; then
+ RAWCPPFLAGS=-undef
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_ERROR([${RAWCPP} defines unix with or without -undef. I don't know what to do.])
+ fi
+fi
+rm -f conftest.$ac_ext
+
+AC_MSG_CHECKING([if $RAWCPP requires -traditional])
+AC_LANG_CONFTEST([Does cpp preserve "whitespace"?])
+if test `${RAWCPP} < conftest.$ac_ext | grep -c 'preserve \"'` -eq 1 ; then
+ AC_MSG_RESULT([no])
+else
+ if test `${RAWCPP} -traditional < conftest.$ac_ext | grep -c 'preserve \"'` -eq 1 ; then
+ RAWCPPFLAGS="${RAWCPPFLAGS} -traditional"
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_ERROR([${RAWCPP} does not preserve whitespace with or without -traditional. I don't know what to do.])
+ fi
+fi
+rm -f conftest.$ac_ext
+AC_SUBST(RAWCPPFLAGS)
+]) # XORG_PROG_RAWCPP
+
+# XORG_MANPAGE_SECTIONS()
+# -----------------------
+# Minimum version: 1.0.0
+#
+# Determine which sections man pages go in for the different man page types
+# on this OS - replaces *ManSuffix settings in old Imake *.cf per-os files.
+# Not sure if there's any better way than just hardcoding by OS name.
+# Override default settings by setting environment variables
+
+AC_DEFUN([XORG_MANPAGE_SECTIONS],[
+AC_REQUIRE([AC_CANONICAL_HOST])
+
+if test x$APP_MAN_SUFFIX = x ; then
+ APP_MAN_SUFFIX=1
+fi
+if test x$APP_MAN_DIR = x ; then
+ APP_MAN_DIR='$(mandir)/man$(APP_MAN_SUFFIX)'
+fi
+
+if test x$LIB_MAN_SUFFIX = x ; then
+ LIB_MAN_SUFFIX=3
+fi
+if test x$LIB_MAN_DIR = x ; then
+ LIB_MAN_DIR='$(mandir)/man$(LIB_MAN_SUFFIX)'
+fi
+
+if test x$FILE_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) FILE_MAN_SUFFIX=4 ;;
+ *) FILE_MAN_SUFFIX=5 ;;
+ esac
+fi
+if test x$FILE_MAN_DIR = x ; then
+ FILE_MAN_DIR='$(mandir)/man$(FILE_MAN_SUFFIX)'
+fi
+
+if test x$MISC_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) MISC_MAN_SUFFIX=5 ;;
+ *) MISC_MAN_SUFFIX=7 ;;
+ esac
+fi
+if test x$MISC_MAN_DIR = x ; then
+ MISC_MAN_DIR='$(mandir)/man$(MISC_MAN_SUFFIX)'
+fi
+
+if test x$DRIVER_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) DRIVER_MAN_SUFFIX=7 ;;
+ *) DRIVER_MAN_SUFFIX=4 ;;
+ esac
+fi
+if test x$DRIVER_MAN_DIR = x ; then
+ DRIVER_MAN_DIR='$(mandir)/man$(DRIVER_MAN_SUFFIX)'
+fi
+
+if test x$ADMIN_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) ADMIN_MAN_SUFFIX=1m ;;
+ *) ADMIN_MAN_SUFFIX=8 ;;
+ esac
+fi
+if test x$ADMIN_MAN_DIR = x ; then
+ ADMIN_MAN_DIR='$(mandir)/man$(ADMIN_MAN_SUFFIX)'
+fi
+
+
+AC_SUBST([APP_MAN_SUFFIX])
+AC_SUBST([LIB_MAN_SUFFIX])
+AC_SUBST([FILE_MAN_SUFFIX])
+AC_SUBST([MISC_MAN_SUFFIX])
+AC_SUBST([DRIVER_MAN_SUFFIX])
+AC_SUBST([ADMIN_MAN_SUFFIX])
+AC_SUBST([APP_MAN_DIR])
+AC_SUBST([LIB_MAN_DIR])
+AC_SUBST([FILE_MAN_DIR])
+AC_SUBST([MISC_MAN_DIR])
+AC_SUBST([DRIVER_MAN_DIR])
+AC_SUBST([ADMIN_MAN_DIR])
+]) # XORG_MANPAGE_SECTIONS
+
+# XORG_CHECK_LINUXDOC
+# -------------------
+# Minimum version: 1.0.0
+#
+# Defines the variable MAKE_TEXT if the necessary tools and
+# files are found. $(MAKE_TEXT) blah.sgml will then produce blah.txt.
+# Whether or not the necessary tools and files are found can be checked
+# with the AM_CONDITIONAL "BUILD_LINUXDOC"
+AC_DEFUN([XORG_CHECK_LINUXDOC],[
+AC_CHECK_FILE(
+ [$prefix/share/X11/sgml/defs.ent],
+ [DEFS_ENT_PATH=$prefix/share/X11/sgml],
+ [DEFS_ENT_PATH=]
+)
+
+AC_PATH_PROG(LINUXDOC, linuxdoc)
+AC_PATH_PROG(PS2PDF, ps2pdf)
+
+AC_MSG_CHECKING([Whether to build documentation])
+
+if test x$DEFS_ENT_PATH != x && test x$LINUXDOC != x ; then
+ BUILDDOC=yes
+else
+ BUILDDOC=no
+fi
+
+AM_CONDITIONAL(BUILD_LINUXDOC, [test x$BUILDDOC = xyes])
+
+AC_MSG_RESULT([$BUILDDOC])
+
+AC_MSG_CHECKING([Whether to build pdf documentation])
+
+if test x$PS2PDF != x ; then
+ BUILDPDFDOC=yes
+else
+ BUILDPDFDOC=no
+fi
+
+AM_CONDITIONAL(BUILD_PDFDOC, [test x$BUILDPDFDOC = xyes])
+
+AC_MSG_RESULT([$BUILDPDFDOC])
+
+MAKE_TEXT="SGML_SEARCH_PATH=$DEFS_ENT_PATH GROFF_NO_SGR=y $LINUXDOC -B txt"
+MAKE_PS="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B latex --papersize=letter --output=ps"
+MAKE_PDF="$PS2PDF"
+MAKE_HTML="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B html --split=0"
+
+AC_SUBST(MAKE_TEXT)
+AC_SUBST(MAKE_PS)
+AC_SUBST(MAKE_PDF)
+AC_SUBST(MAKE_HTML)
+]) # XORG_CHECK_LINUXDOC
+
+# XORG_CHECK_MALLOC_ZERO
+# ----------------------
+# Minimum version: 1.0.0
+#
+# Defines {MALLOC,XMALLOC,XTMALLOC}_ZERO_CFLAGS appropriately if
+# malloc(0) returns NULL. Packages should add one of these cflags to
+# their AM_CFLAGS (or other appropriate *_CFLAGS) to use them.
+AC_DEFUN([XORG_CHECK_MALLOC_ZERO],[
+AC_ARG_ENABLE(malloc0returnsnull,
+ AC_HELP_STRING([--enable-malloc0returnsnull],
+ [malloc(0) returns NULL (default: auto)]),
+ [MALLOC_ZERO_RETURNS_NULL=$enableval],
+ [MALLOC_ZERO_RETURNS_NULL=auto])
+
+AC_MSG_CHECKING([whether malloc(0) returns NULL])
+if test "x$MALLOC_ZERO_RETURNS_NULL" = xauto; then
+ AC_RUN_IFELSE([
+char *malloc();
+char *realloc();
+char *calloc();
+main() {
+ char *m0, *r0, *c0, *p;
+ m0 = malloc(0);
+ p = malloc(10);
+ r0 = realloc(p,0);
+ c0 = calloc(0);
+ exit(m0 == 0 || r0 == 0 || c0 == 0 ? 0 : 1);
+}],
+ [MALLOC_ZERO_RETURNS_NULL=yes],
+ [MALLOC_ZERO_RETURNS_NULL=no])
+fi
+AC_MSG_RESULT([$MALLOC_ZERO_RETURNS_NULL])
+
+if test "x$MALLOC_ZERO_RETURNS_NULL" = xyes; then
+ MALLOC_ZERO_CFLAGS="-DMALLOC_0_RETURNS_NULL"
+ XMALLOC_ZERO_CFLAGS=$MALLOC_ZERO_CFLAGS
+ XTMALLOC_ZERO_CFLAGS="$MALLOC_ZERO_CFLAGS -DXTMALLOC_BC"
+else
+ MALLOC_ZERO_CFLAGS=""
+ XMALLOC_ZERO_CFLAGS=""
+ XTMALLOC_ZERO_CFLAGS=""
+fi
+
+AC_SUBST([MALLOC_ZERO_CFLAGS])
+AC_SUBST([XMALLOC_ZERO_CFLAGS])
+AC_SUBST([XTMALLOC_ZERO_CFLAGS])
+]) # XORG_CHECK_MALLOC_ZERO
+
+# XORG_WITH_LINT()
+# ----------------
+# Minimum version: 1.1.0
+#
+# Sets up flags for source checkers such as lint and sparse if --with-lint
+# is specified. (Use --with-lint=sparse for sparse.)
+# Sets $LINT to name of source checker passed with --with-lint (default: lint)
+# Sets $LINT_FLAGS to flags to pass to source checker
+# Sets LINT automake conditional if enabled (default: disabled)
+#
+AC_DEFUN([XORG_WITH_LINT],[
+
+# Allow checking code with lint, sparse, etc.
+AC_ARG_WITH(lint, [AC_HELP_STRING([--with-lint],
+ [Use a lint-style source code checker (default: disabled)])],
+ [use_lint=$withval], [use_lint=no])
+if test "x$use_lint" = "xyes" ; then
+ LINT="lint"
+else
+ LINT="$use_lint"
+fi
+if test "x$LINT_FLAGS" = "x" -a "x$LINT" != "xno" ; then
+ case $LINT in
+ lint|*/lint)
+ case $host_os in
+ solaris*)
+ LINT_FLAGS="-u -b -h -erroff=E_INDISTING_FROM_TRUNC2"
+ ;;
+ esac
+ ;;
+ esac
+fi
+
+AC_SUBST(LINT)
+AC_SUBST(LINT_FLAGS)
+AM_CONDITIONAL(LINT, [test x$LINT != xno])
+
+]) # XORG_WITH_LINT
+
+# XORG_LINT_LIBRARY(LIBNAME)
+# --------------------------
+# Minimum version: 1.1.0
+#
+# Sets up flags for building lint libraries for checking programs that call
+# functions in the library.
+# Disabled by default, enable with --enable-lint-library
+# Sets:
+# @LINTLIB@ - name of lint library file to make
+# MAKE_LINT_LIB - automake conditional
+#
+
+AC_DEFUN([XORG_LINT_LIBRARY],[
+AC_REQUIRE([XORG_WITH_LINT])
+# Build lint "library" for more indepth checks of programs calling this library
+AC_ARG_ENABLE(lint-library, [AC_HELP_STRING([--enable-lint-library],
+ [Create lint library (default: disabled)])],
+ [make_lint_lib=$enableval], [make_lint_lib=no])
+if test "x$make_lint_lib" != "xno" ; then
+ if test "x$LINT" = "xno" ; then
+ AC_MSG_ERROR([Cannot make lint library without --with-lint])
+ fi
+ if test "x$make_lint_lib" = "xyes" ; then
+ LINTLIB=llib-l$1.ln
+ else
+ LINTLIB=$make_lint_lib
+ fi
+fi
+AC_SUBST(LINTLIB)
+AM_CONDITIONAL(MAKE_LINT_LIB, [test x$make_lint_lib != xno])
+
+]) # XORG_LINT_LIBRARY
+
+dnl Copyright 2005 Red Hat, Inc
+dnl
+dnl Permission to use, copy, modify, distribute, and sell this software and its
+dnl documentation for any purpose is hereby granted without fee, provided that
+dnl the above copyright notice appear in all copies and that both that
+dnl copyright notice and this permission notice appear in supporting
+dnl documentation.
+dnl
+dnl The above copyright notice and this permission notice shall be included
+dnl in all copies or substantial portions of the Software.
+dnl
+dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+dnl IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+dnl OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+dnl ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+dnl OTHER DEALINGS IN THE SOFTWARE.
+dnl
+dnl Except as contained in this notice, the name of the copyright holders shall
+dnl not be used in advertising or otherwise to promote the sale, use or
+dnl other dealings in this Software without prior written authorization
+dnl from the copyright holders.
+dnl
+
+# XORG_DRIVER_CHECK_EXT()
+# --------------------------
+# Checks for the $1 define in xorg-server.h (from the sdk). If it
+# is defined, then add $1 to $REQUIRED_MODULES.
+
+AC_DEFUN([XORG_DRIVER_CHECK_EXT],[
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`"
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM([[
+#include "xorg-server.h"
+#if !defined $1
+#error $1 not defined
+#endif
+ ]])],
+ [_EXT_CHECK=yes],
+ [_EXT_CHECK=no])
+ CFLAGS="$SAVE_CFLAGS"
+ AC_MSG_CHECKING([if $1 is defined])
+ AC_MSG_RESULT([$_EXT_CHECK])
+ if test "$_EXT_CHECK" != no; then
+ REQUIRED_MODULES="$REQUIRED_MODULES $2"
+ fi
+])
+
+dnl Copyright 2005 Red Hat, Inc
+dnl
+dnl Permission to use, copy, modify, distribute, and sell this software and its
+dnl documentation for any purpose is hereby granted without fee, provided that
+dnl the above copyright notice appear in all copies and that both that
+dnl copyright notice and this permission notice appear in supporting
+dnl documentation.
+dnl
+dnl The above copyright notice and this permission notice shall be included
+dnl in all copies or substantial portions of the Software.
+dnl
+dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+dnl IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+dnl OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+dnl ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+dnl OTHER DEALINGS IN THE SOFTWARE.
+dnl
+dnl Except as contained in this notice, the name of the copyright holders shall
+dnl not be used in advertising or otherwise to promote the sale, use or
+dnl other dealings in this Software without prior written authorization
+dnl from the copyright holders.
+dnl
+
+# XORG_RELEASE_VERSION
+# --------------------
+# Adds --with/without-release-string and changes the PACKAGE and
+# PACKAGE_TARNAME to use "$PACKAGE{_TARNAME}-$RELEASE_VERSION". If
+# no option is given, PACKAGE and PACKAGE_TARNAME are unchanged.
+
+AC_DEFUN([XORG_RELEASE_VERSION],[
+ AC_ARG_WITH(release-version,
+ AC_HELP_STRING([--with-release-version=STRING],
+ [Use release version string in package name]),
+ [RELEASE_VERSION="$withval"],
+ [RELEASE_VERSION=""])
+ if test "x$RELEASE_VERSION" != "x"; then
+ PACKAGE="$PACKAGE-$RELEASE_VERSION"
+ PACKAGE_TARNAME="$PACKAGE_TARNAME-$RELEASE_VERSION"
+ AC_MSG_NOTICE([Building with package name set to $PACKAGE])
+ fi
+])
+
+# Copyright (C) 2002, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+AC_DEFUN([AM_AUTOMAKE_VERSION], [am__api_version="1.9"])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION so it can be traced.
+# This function is AC_REQUIREd by AC_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+ [AM_AUTOMAKE_VERSION([1.9.6])])
+
+# AM_AUX_DIR_EXPAND -*- Autoconf -*-
+
+# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to `$srcdir/foo'. In other projects, it is set to
+# `$srcdir', `$srcdir/..', or `$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory. The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run. This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+# fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+# fails if $ac_aux_dir is absolute,
+# fails when called from a subdirectory in a VPATH build with
+# a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir. In an in-source build this is usually
+# harmless because $srcdir is `.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir. That would be:
+# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+# MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH. The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[dnl Rely on autoconf to set up CDPATH properly.
+AC_PREREQ([2.50])dnl
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+])
+
+# AM_CONDITIONAL -*- Autoconf -*-
+
+# Copyright (C) 1997, 2000, 2001, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 7
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ(2.52)dnl
+ ifelse([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])],
+ [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])
+AC_SUBST([$1_FALSE])
+if $2; then
+ $1_TRUE=
+ $1_FALSE='#'
+else
+ $1_TRUE='#'
+ $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+ AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 8
+
+# There are a few dirty hacks below to avoid letting `AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery. Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "GCJ", or "OBJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+ifelse([$1], CC, [depcc="$CC" am_compiler_list=],
+ [$1], CXX, [depcc="$CXX" am_compiler_list=],
+ [$1], OBJC, [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+ [$1], GCJ, [depcc="$GCJ" am_compiler_list='gcc3 gcc'],
+ [depcc="$$1" am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+ [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named `D' -- because `-MD' means `put the output
+ # in D'.
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_$1_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+ fi
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+ # Solaris 8's {/usr,}/bin/sh.
+ touch sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ case $depmode in
+ nosideeffect)
+ # after this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ none) break ;;
+ esac
+ # We check with `-c' and `-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle `-M -o', and we need to detect this.
+ if depmode=$depmode \
+ source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_$1_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE(dependency-tracking,
+[ --disable-dependency-tracking speeds up one-time build
+ --enable-dependency-tracking do not reject slow dependency extractors])
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])
+])
+
+# Generate code to set up dependency tracking. -*- Autoconf -*-
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+#serial 3
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[for mf in $CONFIG_FILES; do
+ # Strip MF so we end up with the name of the file.
+ mf=`echo "$mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile or not.
+ # We used to match only the files named `Makefile.in', but
+ # some people rename them; so instead we look at the file content.
+ # Grep'ing the first line is not enough: some people post-process
+ # each Makefile.in and add a new line on top of each file to say so.
+ # So let's grep whole file.
+ if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then
+ dirpart=`AS_DIRNAME("$mf")`
+ else
+ continue
+ fi
+ # Extract the definition of DEPDIR, am__include, and am__quote
+ # from the Makefile without running `make'.
+ DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+ test -z "$DEPDIR" && continue
+ am__include=`sed -n 's/^am__include = //p' < "$mf"`
+ test -z "am__include" && continue
+ am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+ # When using ansi2knr, U may be empty or an underscore; expand it
+ U=`sed -n 's/^U = //p' < "$mf"`
+ # Find all dependency output files, they are included files with
+ # $(DEPDIR) in their names. We invoke sed twice because it is the
+ # simplest approach to changing $(DEPDIR) to its actual value in the
+ # expansion.
+ for file in `sed -n "
+ s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+ sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do
+ # Make sure the directory exists.
+ test -f "$dirpart/$file" && continue
+ fdir=`AS_DIRNAME(["$file"])`
+ AS_MKDIR_P([$dirpart/$fdir])
+ # echo "creating $dirpart/$file"
+ echo '# dummy' > "$dirpart/$file"
+ done
+done
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking
+# is enabled. FIXME. This creates each `.P' file that we will
+# need in order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+ [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+ [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
+])
+
+# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 8
+
+# AM_CONFIG_HEADER is obsolete. It has been replaced by AC_CONFIG_HEADERS.
+AU_DEFUN([AM_CONFIG_HEADER], [AC_CONFIG_HEADERS($@)])
+
+# Do all the work for Automake. -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 12
+
+# This macro actually does too much. Some checks are only needed if
+# your package does certain things. But this isn't really a big deal.
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out. PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition. After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.58])dnl
+dnl Autoconf wants to disallow AM_ names. We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+# test to see if srcdir already configured
+if test "`cd $srcdir && pwd`" != "`pwd`" &&
+ test -f $srcdir/config.status; then
+ AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE", [Name of package])
+ AC_DEFINE_UNQUOTED(VERSION, "$VERSION", [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG(ACLOCAL, aclocal-${am__api_version})
+AM_MISSING_PROG(AUTOCONF, autoconf)
+AM_MISSING_PROG(AUTOMAKE, automake-${am__api_version})
+AM_MISSING_PROG(AUTOHEADER, autoheader)
+AM_MISSING_PROG(MAKEINFO, makeinfo)
+AM_PROG_INSTALL_SH
+AM_PROG_INSTALL_STRIP
+AC_REQUIRE([AM_PROG_MKDIR_P])dnl
+# We need awk for the "check" target. The system "awk" is bad on
+# some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+ [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+ [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+ [_AM_DEPENDENCIES(CC)],
+ [define([AC_PROG_CC],
+ defn([AC_PROG_CC])[_AM_DEPENDENCIES(CC)])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [_AM_DEPENDENCIES(CXX)],
+ [define([AC_PROG_CXX],
+ defn([AC_PROG_CXX])[_AM_DEPENDENCIES(CXX)])])dnl
+])
+])
+
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated. The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $1 | $1:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $1" >`AS_DIRNAME([$1])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+install_sh=${install_sh-"$am_aux_dir/install-sh"}
+AC_SUBST(install_sh)])
+
+# Copyright (C) 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot. For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Add --enable-maintainer-mode option to configure. -*- Autoconf -*-
+# From Jim Meyering
+
+# Copyright (C) 1996, 1998, 2000, 2001, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+AC_DEFUN([AM_MAINTAINER_MODE],
+[AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles])
+ dnl maintainer-mode is disabled by default
+ AC_ARG_ENABLE(maintainer-mode,
+[ --enable-maintainer-mode enable make rules and dependencies not useful
+ (and sometimes confusing) to the casual installer],
+ USE_MAINTAINER_MODE=$enableval,
+ USE_MAINTAINER_MODE=no)
+ AC_MSG_RESULT([$USE_MAINTAINER_MODE])
+ AM_CONDITIONAL(MAINTAINER_MODE, [test $USE_MAINTAINER_MODE = yes])
+ MAINT=$MAINTAINER_MODE_TRUE
+ AC_SUBST(MAINT)dnl
+]
+)
+
+AU_DEFUN([jm_MAINTAINER_MODE], [AM_MAINTAINER_MODE])
+
+# Check to see how 'make' treats includes. -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 3
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check to see how make treats includes.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+ @echo done
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+AC_MSG_CHECKING([for style of include used by $am_make])
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# We grep out `Entering directory' and `Leaving directory'
+# messages which can occur if `w' ends up in MAKEFLAGS.
+# In particular we don't look at `^make:' because GNU make might
+# be invoked under some other name (usually "gmake"), in which
+# case it prints its new name instead of `make'.
+if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then
+ am__include=include
+ am__quote=
+ _am_result=GNU
+fi
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+ echo '.include "confinc"' > confmf
+ if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then
+ am__include=.include
+ am__quote="\""
+ _am_result=BSD
+ fi
+fi
+AC_SUBST([am__include])
+AC_SUBST([am__quote])
+AC_MSG_RESULT([$_am_result])
+rm -f confinc confmf
+])
+
+# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*-
+
+# Copyright (C) 1997, 1999, 2000, 2001, 2003, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it supports --run.
+# If it does, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing"
+# Use eval to expand $SHELL
+if eval "$MISSING --run true"; then
+ am_missing_run="$MISSING --run "
+else
+ am_missing_run=
+ AC_MSG_WARN([`missing' script is too old or missing])
+fi
+])
+
+# Copyright (C) 2003, 2004, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_MKDIR_P
+# ---------------
+# Check whether `mkdir -p' is supported, fallback to mkinstalldirs otherwise.
+#
+# Automake 1.8 used `mkdir -m 0755 -p --' to ensure that directories
+# created by `make install' are always world readable, even if the
+# installer happens to have an overly restrictive umask (e.g. 077).
+# This was a mistake. There are at least two reasons why we must not
+# use `-m 0755':
+# - it causes special bits like SGID to be ignored,
+# - it may be too restrictive (some setups expect 775 directories).
+#
+# Do not use -m 0755 and let people choose whatever they expect by
+# setting umask.
+#
+# We cannot accept any implementation of `mkdir' that recognizes `-p'.
+# Some implementations (such as Solaris 8's) are not thread-safe: if a
+# parallel make tries to run `mkdir -p a/b' and `mkdir -p a/c'
+# concurrently, both version can detect that a/ is missing, but only
+# one can create it and the other will error out. Consequently we
+# restrict ourselves to GNU make (using the --version option ensures
+# this.)
+AC_DEFUN([AM_PROG_MKDIR_P],
+[if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then
+ # We used to keeping the `.' as first argument, in order to
+ # allow $(mkdir_p) to be used without argument. As in
+ # $(mkdir_p) $(somedir)
+ # where $(somedir) is conditionally defined. However this is wrong
+ # for two reasons:
+ # 1. if the package is installed by a user who cannot write `.'
+ # make install will fail,
+ # 2. the above comment should most certainly read
+ # $(mkdir_p) $(DESTDIR)$(somedir)
+ # so it does not work when $(somedir) is undefined and
+ # $(DESTDIR) is not.
+ # To support the latter case, we have to write
+ # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir),
+ # so the `.' trick is pointless.
+ mkdir_p='mkdir -p --'
+else
+ # On NextStep and OpenStep, the `mkdir' command does not
+ # recognize any option. It will interpret all options as
+ # directories to create, and then abort because `.' already
+ # exists.
+ for d in ./-p ./--version;
+ do
+ test -d $d && rmdir $d
+ done
+ # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists.
+ if test -f "$ac_aux_dir/mkinstalldirs"; then
+ mkdir_p='$(mkinstalldirs)'
+ else
+ mkdir_p='$(install_sh) -d'
+ fi
+fi
+AC_SUBST([mkdir_p])])
+
+# Helper functions for option handling. -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 3
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# ------------------------------
+# Set option NAME. Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), 1)])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ----------------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[AC_FOREACH([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Check to make sure that the build environment is sane. -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Just in case
+sleep 1
+echo timestamp > conftest.file
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null`
+ if test "$[*]" = "X"; then
+ # -L didn't work.
+ set X `ls -t $srcdir/configure conftest.file`
+ fi
+ rm -f conftest.file
+ if test "$[*]" != "X $srcdir/configure conftest.file" \
+ && test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken
+alias in your environment])
+ fi
+
+ test "$[2]" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT(yes)])
+
+# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor `install' (even GNU) is that you can't
+# specify the program used to strip binaries. This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in `make install-strip', and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using `strip' when the user
+# run `make install-strip'. However `strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the `STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be `maybe'.
+if test "$cross_compiling" != no; then
+ AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Check how to create a tarball. -*- Autoconf -*-
+
+# Copyright (C) 2004, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of `v7', `ustar', or `pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+# tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+# $(am__untar) < result.tar
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility.
+AM_MISSING_PROG([AMTAR], [tar])
+m4_if([$1], [v7],
+ [am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'],
+ [m4_case([$1], [ustar],, [pax],,
+ [m4_fatal([Unknown tar format])])
+AC_MSG_CHECKING([how to create a $1 tar archive])
+# Loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+_am_tools=${am_cv_prog_tar_$1-$_am_tools}
+# Do not fold the above two line into one, because Tru64 sh and
+# Solaris sh will not grok spaces in the rhs of `-'.
+for _am_tool in $_am_tools
+do
+ case $_am_tool in
+ gnutar)
+ for _am_tar in tar gnutar gtar;
+ do
+ AM_RUN_LOG([$_am_tar --version]) && break
+ done
+ am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+ am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+ am__untar="$_am_tar -xf -"
+ ;;
+ plaintar)
+ # Must skip GNU tar: if it does not support --format= it doesn't create
+ # ustar tarball either.
+ (tar --version) >/dev/null 2>&1 && continue
+ am__tar='tar chf - "$$tardir"'
+ am__tar_='tar chf - "$tardir"'
+ am__untar='tar xf -'
+ ;;
+ pax)
+ am__tar='pax -L -x $1 -w "$$tardir"'
+ am__tar_='pax -L -x $1 -w "$tardir"'
+ am__untar='pax -r'
+ ;;
+ cpio)
+ am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+ am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+ am__untar='cpio -i -H $1 -d'
+ ;;
+ none)
+ am__tar=false
+ am__tar_=false
+ am__untar=false
+ ;;
+ esac
+
+ # If the value was cached, stop now. We just wanted to have am__tar
+ # and am__untar set.
+ test -n "${am_cv_prog_tar_$1}" && break
+
+ # tar/untar a dummy directory, and stop if the command works
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ echo GrepMe > conftest.dir/file
+ AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+ rm -rf conftest.dir
+ if test -s conftest.tar; then
+ AM_RUN_LOG([$am__untar <conftest.tar])
+ grep GrepMe conftest.dir/file >/dev/null 2>&1 && break
+ fi
+done
+rm -rf conftest.dir
+
+AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+
diff --git a/driver/xf86-input-mouse/config.guess b/driver/xf86-input-mouse/config.guess
new file mode 100644
index 000000000..2fc3acce2
--- /dev/null
+++ b/driver/xf86-input-mouse/config.guess
@@ -0,0 +1,1411 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+# 2000, 2001, 2002, 2003 Free Software Foundation, Inc.
+
+timestamp='2003-06-17'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Per Bothner <per@bothner.com>.
+# Please send patches to <config-patches@gnu.org>. Submit a context
+# diff and a properly formatted ChangeLog entry.
+#
+# This script attempts to guess a canonical system name similar to
+# config.sub. If it succeeds, it prints the system name on stdout, and
+# exits with 0. Otherwise, it exits with 1.
+#
+# The plan is that this can be called by configure scripts if you
+# don't specify an explicit build system type.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION]
+
+Output the configuration name of the system \`$me' is run on.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.guess ($timestamp)
+
+Originally written by Per Bothner.
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001
+Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit 0 ;;
+ --version | -v )
+ echo "$version" ; exit 0 ;;
+ --help | --h* | -h )
+ echo "$usage"; exit 0 ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help" >&2
+ exit 1 ;;
+ * )
+ break ;;
+ esac
+done
+
+if test $# != 0; then
+ echo "$me: too many arguments$help" >&2
+ exit 1
+fi
+
+trap 'exit 1' 1 2 15
+
+# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
+# compiler to aid in system detection is discouraged as it requires
+# temporary files to be created and, as you can see below, it is a
+# headache to deal with in a portable fashion.
+
+# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still
+# use `HOST_CC' if defined, but it is deprecated.
+
+# Portable tmp directory creation inspired by the Autoconf team.
+
+set_cc_for_build='
+trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
+trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
+: ${TMPDIR=/tmp} ;
+ { tmp=`(umask 077 && mktemp -d -q "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
+dummy=$tmp/dummy ;
+tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
+case $CC_FOR_BUILD,$HOST_CC,$CC in
+ ,,) echo "int x;" > $dummy.c ;
+ for c in cc gcc c89 c99 ; do
+ if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
+ CC_FOR_BUILD="$c"; break ;
+ fi ;
+ done ;
+ if test x"$CC_FOR_BUILD" = x ; then
+ CC_FOR_BUILD=no_compiler_found ;
+ fi
+ ;;
+ ,,*) CC_FOR_BUILD=$CC ;;
+ ,*,*) CC_FOR_BUILD=$HOST_CC ;;
+esac ;'
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 1994-08-24)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+ PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+## for Red Hat Linux
+if test -f /etc/redhat-release ; then
+ VENDOR=redhat ;
+else
+ VENDOR= ;
+fi
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+ *:NetBSD:*:*)
+ # NetBSD (nbsd) targets should (where applicable) match one or
+ # more of the tupples: *-*-netbsdelf*, *-*-netbsdaout*,
+ # *-*-netbsdecoff* and *-*-netbsd*. For targets that recently
+ # switched to ELF, *-*-netbsd* would select the old
+ # object file format. This provides both forward
+ # compatibility and a consistent mechanism for selecting the
+ # object file format.
+ #
+ # Note: NetBSD doesn't particularly care about the vendor
+ # portion of the name. We always set it to "unknown".
+ sysctl="sysctl -n hw.machine_arch"
+ UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
+ /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
+ case "${UNAME_MACHINE_ARCH}" in
+ armeb) machine=armeb-unknown ;;
+ arm*) machine=arm-unknown ;;
+ sh3el) machine=shl-unknown ;;
+ sh3eb) machine=sh-unknown ;;
+ *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+ esac
+ # The Operating System including object format, if it has switched
+ # to ELF recently, or will in the future.
+ case "${UNAME_MACHINE_ARCH}" in
+ arm*|i386|m68k|ns32k|sh3*|sparc|vax)
+ eval $set_cc_for_build
+ if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep __ELF__ >/dev/null
+ then
+ # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout).
+ # Return netbsd for either. FIX?
+ os=netbsd
+ else
+ os=netbsdelf
+ fi
+ ;;
+ *)
+ os=netbsd
+ ;;
+ esac
+ # The OS release
+ # Debian GNU/NetBSD machines have a different userland, and
+ # thus, need a distinct triplet. However, they do not need
+ # kernel version information, so it can be replaced with a
+ # suitable tag, in the style of linux-gnu.
+ case "${UNAME_VERSION}" in
+ Debian*)
+ release='-gnu'
+ ;;
+ *)
+ release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ ;;
+ esac
+ # Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
+ # contains redundant information, the shorter form:
+ # CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
+ echo "${machine}-${os}${release}"
+ exit 0 ;;
+ amiga:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ arc:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ hp300:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mac68k:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ macppc:OpenBSD:*:*)
+ echo powerpc-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mvme68k:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mvme88k:OpenBSD:*:*)
+ echo m88k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mvmeppc:OpenBSD:*:*)
+ echo powerpc-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ pmax:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ sgi:OpenBSD:*:*)
+ echo mipseb-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ sun3:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ wgrisc:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ *:OpenBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ alpha:OSF1:*:*)
+ if test $UNAME_RELEASE = "V4.0"; then
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+ fi
+ # According to Compaq, /usr/sbin/psrinfo has been available on
+ # OSF/1 and Tru64 systems produced since 1995. I hope that
+ # covers most systems running today. This code pipes the CPU
+ # types through head -n 1, so we only detect the type of CPU 0.
+ ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^ The alpha \(.*\) processor.*$/\1/p' | head -n 1`
+ case "$ALPHA_CPU_TYPE" in
+ "EV4 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "EV4.5 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "LCA4 (21066/21068)")
+ UNAME_MACHINE="alpha" ;;
+ "EV5 (21164)")
+ UNAME_MACHINE="alphaev5" ;;
+ "EV5.6 (21164A)")
+ UNAME_MACHINE="alphaev56" ;;
+ "EV5.6 (21164PC)")
+ UNAME_MACHINE="alphapca56" ;;
+ "EV5.7 (21164PC)")
+ UNAME_MACHINE="alphapca57" ;;
+ "EV6 (21264)")
+ UNAME_MACHINE="alphaev6" ;;
+ "EV6.7 (21264A)")
+ UNAME_MACHINE="alphaev67" ;;
+ "EV6.8CB (21264C)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8AL (21264B)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8CX (21264D)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.9A (21264/EV69A)")
+ UNAME_MACHINE="alphaev69" ;;
+ "EV7 (21364)")
+ UNAME_MACHINE="alphaev7" ;;
+ "EV7.9 (21364A)")
+ UNAME_MACHINE="alphaev79" ;;
+ esac
+ # A Vn.n version is a released version.
+ # A Tn.n version is a released field test version.
+ # A Xn.n version is an unreleased experimental baselevel.
+ # 1.2 uses "1.2" for uname -r.
+ echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ exit 0 ;;
+ Alpha*:OpenVMS:*:*)
+ echo alpha-hp-vms
+ exit 0 ;;
+ Alpha\ *:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # Should we change UNAME_MACHINE based on the output of uname instead
+ # of the specific Alpha model?
+ echo alpha-pc-interix
+ exit 0 ;;
+ 21064:Windows_NT:50:3)
+ echo alpha-dec-winnt3.5
+ exit 0 ;;
+ Amiga*:UNIX_System_V:4.0:*)
+ echo m68k-unknown-sysv4
+ exit 0;;
+ *:[Aa]miga[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-unknown-amigaos
+ exit 0 ;;
+ *:[Mm]orph[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-unknown-morphos
+ exit 0 ;;
+ *:OS/390:*:*)
+ echo i370-ibm-openedition
+ exit 0 ;;
+ arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+ echo arm-acorn-riscix${UNAME_RELEASE}
+ exit 0;;
+ SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*)
+ echo hppa1.1-hitachi-hiuxmpp
+ exit 0;;
+ Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*)
+ # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+ if test "`(/bin/universe) 2>/dev/null`" = att ; then
+ echo pyramid-pyramid-sysv3
+ else
+ echo pyramid-pyramid-bsd
+ fi
+ exit 0 ;;
+ NILE*:*:*:dcosx)
+ echo pyramid-pyramid-svr4
+ exit 0 ;;
+ DRS?6000:unix:4.0:6*)
+ echo sparc-icl-nx6
+ exit 0 ;;
+ DRS?6000:UNIX_SV:4.2*:7*)
+ case `/usr/bin/uname -p` in
+ sparc) echo sparc-icl-nx7 && exit 0 ;;
+ esac ;;
+ sun4H:SunOS:5.*:*)
+ echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+ echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ i86pc:SunOS:5.*:*)
+ echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ sun4*:SunOS:6*:*)
+ # According to config.sub, this is the proper way to canonicalize
+ # SunOS6. Hard to guess exactly what SunOS6 will be like, but
+ # it's likely to be more like Solaris than SunOS4.
+ echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ sun4*:SunOS:*:*)
+ case "`/usr/bin/arch -k`" in
+ Series*|S4*)
+ UNAME_RELEASE=`uname -v`
+ ;;
+ esac
+ # Japanese Language versions have a version number like `4.1.3-JL'.
+ echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+ exit 0 ;;
+ sun3*:SunOS:*:*)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ exit 0 ;;
+ sun*:*:4.2BSD:*)
+ UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+ test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+ case "`/bin/arch`" in
+ sun3)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ ;;
+ sun4)
+ echo sparc-sun-sunos${UNAME_RELEASE}
+ ;;
+ esac
+ exit 0 ;;
+ aushp:SunOS:*:*)
+ echo sparc-auspex-sunos${UNAME_RELEASE}
+ exit 0 ;;
+ # The situation for MiNT is a little confusing. The machine name
+ # can be virtually everything (everything which is not
+ # "atarist" or "atariste" at least should have a processor
+ # > m68000). The system name ranges from "MiNT" over "FreeMiNT"
+ # to the lowercase version "mint" (or "freemint"). Finally
+ # the system name "TOS" denotes a system which is actually not
+ # MiNT. But MiNT is downward compatible to TOS, so this should
+ # be no problem.
+ atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit 0 ;;
+ atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit 0 ;;
+ *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit 0 ;;
+ milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
+ echo m68k-milan-mint${UNAME_RELEASE}
+ exit 0 ;;
+ hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
+ echo m68k-hades-mint${UNAME_RELEASE}
+ exit 0 ;;
+ *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
+ echo m68k-unknown-mint${UNAME_RELEASE}
+ exit 0 ;;
+ powerpc:machten:*:*)
+ echo powerpc-apple-machten${UNAME_RELEASE}
+ exit 0 ;;
+ RISC*:Mach:*:*)
+ echo mips-dec-mach_bsd4.3
+ exit 0 ;;
+ RISC*:ULTRIX:*:*)
+ echo mips-dec-ultrix${UNAME_RELEASE}
+ exit 0 ;;
+ VAX*:ULTRIX*:*:*)
+ echo vax-dec-ultrix${UNAME_RELEASE}
+ exit 0 ;;
+ 2020:CLIX:*:* | 2430:CLIX:*:*)
+ echo clipper-intergraph-clix${UNAME_RELEASE}
+ exit 0 ;;
+ mips:*:*:UMIPS | mips:*:*:RISCos)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+#ifdef __cplusplus
+#include <stdio.h> /* for printf() prototype */
+ int main (int argc, char *argv[]) {
+#else
+ int main (argc, argv) int argc; char *argv[]; {
+#endif
+ #if defined (host_mips) && defined (MIPSEB)
+ #if defined (SYSTYPE_SYSV)
+ printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_SVR4)
+ printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+ printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+ #endif
+ #endif
+ exit (-1);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c \
+ && $dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \
+ && exit 0
+ echo mips-mips-riscos${UNAME_RELEASE}
+ exit 0 ;;
+ Motorola:PowerMAX_OS:*:*)
+ echo powerpc-motorola-powermax
+ exit 0 ;;
+ Motorola:*:4.3:PL8-*)
+ echo powerpc-harris-powermax
+ exit 0 ;;
+ Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*)
+ echo powerpc-harris-powermax
+ exit 0 ;;
+ Night_Hawk:Power_UNIX:*:*)
+ echo powerpc-harris-powerunix
+ exit 0 ;;
+ m88k:CX/UX:7*:*)
+ echo m88k-harris-cxux7
+ exit 0 ;;
+ m88k:*:4*:R4*)
+ echo m88k-motorola-sysv4
+ exit 0 ;;
+ m88k:*:3*:R3*)
+ echo m88k-motorola-sysv3
+ exit 0 ;;
+ AViiON:dgux:*:*)
+ # DG/UX returns AViiON for all architectures
+ UNAME_PROCESSOR=`/usr/bin/uname -p`
+ if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+ then
+ if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
+ [ ${TARGET_BINARY_INTERFACE}x = x ]
+ then
+ echo m88k-dg-dgux${UNAME_RELEASE}
+ else
+ echo m88k-dg-dguxbcs${UNAME_RELEASE}
+ fi
+ else
+ echo i586-dg-dgux${UNAME_RELEASE}
+ fi
+ exit 0 ;;
+ M88*:DolphinOS:*:*) # DolphinOS (SVR3)
+ echo m88k-dolphin-sysv3
+ exit 0 ;;
+ M88*:*:R3*:*)
+ # Delta 88k system running SVR3
+ echo m88k-motorola-sysv3
+ exit 0 ;;
+ XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+ echo m88k-tektronix-sysv3
+ exit 0 ;;
+ Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+ echo m68k-tektronix-bsd
+ exit 0 ;;
+ *:IRIX*:*:*)
+ echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+ exit 0 ;;
+ ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+ echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id
+ exit 0 ;; # Note that: echo "'`uname -s`'" gives 'AIX '
+ i*86:AIX:*:*)
+ echo i386-ibm-aix
+ exit 0 ;;
+ ia64:AIX:*:*)
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+ exit 0 ;;
+ *:AIX:2:3)
+ if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <sys/systemcfg.h>
+
+ main()
+ {
+ if (!__power_pc())
+ exit(1);
+ puts("powerpc-ibm-aix3.2.5");
+ exit(0);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c && $dummy && exit 0
+ echo rs6000-ibm-aix3.2.5
+ elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+ echo rs6000-ibm-aix3.2.4
+ else
+ echo rs6000-ibm-aix3.2
+ fi
+ exit 0 ;;
+ *:AIX:*:[45])
+ IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
+ if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+ IBM_ARCH=rs6000
+ else
+ IBM_ARCH=powerpc
+ fi
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+ exit 0 ;;
+ *:AIX:*:*)
+ echo rs6000-ibm-aix
+ exit 0 ;;
+ ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+ echo romp-ibm-bsd4.4
+ exit 0 ;;
+ ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC BSD and
+ echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to
+ exit 0 ;; # report: romp-ibm BSD 4.3
+ *:BOSX:*:*)
+ echo rs6000-bull-bosx
+ exit 0 ;;
+ DPX/2?00:B.O.S.:*:*)
+ echo m68k-bull-sysv3
+ exit 0 ;;
+ 9000/[34]??:4.3bsd:1.*:*)
+ echo m68k-hp-bsd
+ exit 0 ;;
+ hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+ echo m68k-hp-bsd4.4
+ exit 0 ;;
+ 9000/[34678]??:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ case "${UNAME_MACHINE}" in
+ 9000/31? ) HP_ARCH=m68000 ;;
+ 9000/[34]?? ) HP_ARCH=m68k ;;
+ 9000/[678][0-9][0-9])
+ if [ -x /usr/bin/getconf ]; then
+ sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
+ sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
+ case "${sc_cpu_version}" in
+ 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
+ 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+ 532) # CPU_PA_RISC2_0
+ case "${sc_kernel_bits}" in
+ 32) HP_ARCH="hppa2.0n" ;;
+ 64) HP_ARCH="hppa2.0w" ;;
+ '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20
+ esac ;;
+ esac
+ fi
+ if [ "${HP_ARCH}" = "" ]; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+
+ #define _HPUX_SOURCE
+ #include <stdlib.h>
+ #include <unistd.h>
+
+ int main ()
+ {
+ #if defined(_SC_KERNEL_BITS)
+ long bits = sysconf(_SC_KERNEL_BITS);
+ #endif
+ long cpu = sysconf (_SC_CPU_VERSION);
+
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1"); break;
+ case CPU_PA_RISC2_0:
+ #if defined(_SC_KERNEL_BITS)
+ switch (bits)
+ {
+ case 64: puts ("hppa2.0w"); break;
+ case 32: puts ("hppa2.0n"); break;
+ default: puts ("hppa2.0"); break;
+ } break;
+ #else /* !defined(_SC_KERNEL_BITS) */
+ puts ("hppa2.0"); break;
+ #endif
+ default: puts ("hppa1.0"); break;
+ }
+ exit (0);
+ }
+EOF
+ (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+ test -z "$HP_ARCH" && HP_ARCH=hppa
+ fi ;;
+ esac
+ if [ ${HP_ARCH} = "hppa2.0w" ]
+ then
+ # avoid double evaluation of $set_cc_for_build
+ test -n "$CC_FOR_BUILD" || eval $set_cc_for_build
+ if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E -) | grep __LP64__ >/dev/null
+ then
+ HP_ARCH="hppa2.0w"
+ else
+ HP_ARCH="hppa64"
+ fi
+ fi
+ echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+ exit 0 ;;
+ ia64:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ echo ia64-hp-hpux${HPUX_REV}
+ exit 0 ;;
+ 3050*:HI-UX:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <unistd.h>
+ int
+ main ()
+ {
+ long cpu = sysconf (_SC_CPU_VERSION);
+ /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+ true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct
+ results, however. */
+ if (CPU_IS_PA_RISC (cpu))
+ {
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+ default: puts ("hppa-hitachi-hiuxwe2"); break;
+ }
+ }
+ else if (CPU_IS_HP_MC68K (cpu))
+ puts ("m68k-hitachi-hiuxwe2");
+ else puts ("unknown-hitachi-hiuxwe2");
+ exit (0);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c && $dummy && exit 0
+ echo unknown-hitachi-hiuxwe2
+ exit 0 ;;
+ 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+ echo hppa1.1-hp-bsd
+ exit 0 ;;
+ 9000/8??:4.3bsd:*:*)
+ echo hppa1.0-hp-bsd
+ exit 0 ;;
+ *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
+ echo hppa1.0-hp-mpeix
+ exit 0 ;;
+ hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+ echo hppa1.1-hp-osf
+ exit 0 ;;
+ hp8??:OSF1:*:*)
+ echo hppa1.0-hp-osf
+ exit 0 ;;
+ i*86:OSF1:*:*)
+ if [ -x /usr/sbin/sysversion ] ; then
+ echo ${UNAME_MACHINE}-unknown-osf1mk
+ else
+ echo ${UNAME_MACHINE}-unknown-osf1
+ fi
+ exit 0 ;;
+ parisc*:Lites*:*:*)
+ echo hppa1.1-hp-lites
+ exit 0 ;;
+ C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+ echo c1-convex-bsd
+ exit 0 ;;
+ C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit 0 ;;
+ C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+ echo c34-convex-bsd
+ exit 0 ;;
+ C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+ echo c38-convex-bsd
+ exit 0 ;;
+ C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+ echo c4-convex-bsd
+ exit 0 ;;
+ CRAY*Y-MP:*:*:*)
+ echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ CRAY*[A-Z]90:*:*:*)
+ echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+ | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+ -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
+ -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ CRAY*TS:*:*:*)
+ echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ CRAY*T3E:*:*:*)
+ echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ CRAY*SV1:*:*:*)
+ echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ *:UNICOS/mp:*:*)
+ echo nv1-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit 0 ;;
+ F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
+ FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+ echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit 0 ;;
+ i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
+ echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+ exit 0 ;;
+ sparc*:BSD/OS:*:*)
+ echo sparc-unknown-bsdi${UNAME_RELEASE}
+ exit 0 ;;
+ *:BSD/OS:*:*)
+ echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE}
+ exit 0 ;;
+ *:FreeBSD:*:*|*:GNU/FreeBSD:*:*)
+ # Determine whether the default compiler uses glibc.
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <features.h>
+ #if __GLIBC__ >= 2
+ LIBC=gnu
+ #else
+ LIBC=
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^LIBC=`
+ echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`${LIBC:+-$LIBC}
+ exit 0 ;;
+ i*:CYGWIN*:*)
+ echo ${UNAME_MACHINE}-pc-cygwin
+ exit 0 ;;
+ i*:MINGW*:*)
+ echo ${UNAME_MACHINE}-pc-mingw32
+ exit 0 ;;
+ i*:PW*:*)
+ echo ${UNAME_MACHINE}-pc-pw32
+ exit 0 ;;
+ x86:Interix*:[34]*)
+ echo i586-pc-interix${UNAME_RELEASE}|sed -e 's/\..*//'
+ exit 0 ;;
+ [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
+ echo i${UNAME_MACHINE}-pc-mks
+ exit 0 ;;
+ i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
+ # UNAME_MACHINE based on the output of uname instead of i386?
+ echo i586-pc-interix
+ exit 0 ;;
+ i*:UWIN*:*)
+ echo ${UNAME_MACHINE}-pc-uwin
+ exit 0 ;;
+ p*:CYGWIN*:*)
+ echo powerpcle-unknown-cygwin
+ exit 0 ;;
+ prep*:SunOS:5.*:*)
+ echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ *:GNU:*:*)
+ echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+ exit 0 ;;
+ i*86:Minix:*:*)
+ echo ${UNAME_MACHINE}-pc-minix
+ exit 0 ;;
+ arm*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit 0 ;;
+ cris:Linux:*:*)
+ echo cris-axis-linux-gnu
+ exit 0 ;;
+ ia64:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR:-unknown}-linux-gnu
+ exit 0 ;;
+ m68*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit 0 ;;
+ mips:Linux:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #undef CPU
+ #undef mips
+ #undef mipsel
+ #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+ CPU=mipsel
+ #else
+ #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+ CPU=mips
+ #else
+ CPU=
+ #endif
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^CPU=`
+ test x"${CPU}" != x && echo "${CPU}-unknown-linux-gnu" && exit 0
+ ;;
+ mips64:Linux:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #undef CPU
+ #undef mips64
+ #undef mips64el
+ #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+ CPU=mips64el
+ #else
+ #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+ CPU=mips64
+ #else
+ CPU=
+ #endif
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^CPU=`
+ test x"${CPU}" != x && echo "${CPU}-unknown-linux-gnu" && exit 0
+ ;;
+ ppc:Linux:*:*)
+ echo powerpc-${VENDOR:-unknown}-linux-gnu
+ exit 0 ;;
+ ppc64:Linux:*:*)
+ echo powerpc64-${VENDOR:-unknown}-linux-gnu
+ exit 0 ;;
+ alpha:Linux:*:*)
+ case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+ EV5) UNAME_MACHINE=alphaev5 ;;
+ EV56) UNAME_MACHINE=alphaev56 ;;
+ PCA56) UNAME_MACHINE=alphapca56 ;;
+ PCA57) UNAME_MACHINE=alphapca56 ;;
+ EV6) UNAME_MACHINE=alphaev6 ;;
+ EV67) UNAME_MACHINE=alphaev67 ;;
+ EV68*) UNAME_MACHINE=alphaev68 ;;
+ esac
+ objdump --private-headers /bin/sh | grep ld.so.1 >/dev/null
+ if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi
+ echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC}
+ exit 0 ;;
+ parisc:Linux:*:* | hppa:Linux:*:*)
+ # Look for CPU level
+ case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
+ PA7*) echo hppa1.1-unknown-linux-gnu ;;
+ PA8*) echo hppa2.0-unknown-linux-gnu ;;
+ *) echo hppa-unknown-linux-gnu ;;
+ esac
+ exit 0 ;;
+ parisc64:Linux:*:* | hppa64:Linux:*:*)
+ echo hppa64-unknown-linux-gnu
+ exit 0 ;;
+ s390:Linux:*:* | s390x:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR:-ibm}-linux-gnu
+ exit 0 ;;
+ sh64*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit 0 ;;
+ sh*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit 0 ;;
+ sparc:Linux:*:* | sparc64:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit 0 ;;
+ x86_64:Linux:*:*)
+ echo x86_64-${VENDOR:-unknown}-linux-gnu
+ exit 0 ;;
+ i*86:Linux:*:*)
+ # The BFD linker knows what the default object file format is, so
+ # first see if it will tell us. cd to the root directory to prevent
+ # problems with other programs or directories called `ld' in the path.
+ # Set LC_ALL=C to ensure ld outputs messages in English.
+ ld_supported_targets=`cd /; LC_ALL=C ld --help 2>&1 \
+ | sed -ne '/supported targets:/!d
+ s/[ ][ ]*/ /g
+ s/.*supported targets: *//
+ s/ .*//
+ p'`
+ case "$ld_supported_targets" in
+ elf32-i386)
+ TENTATIVE="${UNAME_MACHINE}-pc-linux-gnu"
+ ;;
+ a.out-i386-linux)
+ echo "${UNAME_MACHINE}-pc-linux-gnuaout"
+ exit 0 ;;
+ coff-i386)
+ echo "${UNAME_MACHINE}-pc-linux-gnucoff"
+ exit 0 ;;
+ "")
+ # Either a pre-BFD a.out linker (linux-gnuoldld) or
+ # one that does not give us useful --help.
+ echo "${UNAME_MACHINE}-pc-linux-gnuoldld"
+ exit 0 ;;
+ esac
+ # Determine whether the default compiler is a.out or elf
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <features.h>
+ #ifdef __ELF__
+ # ifdef __GLIBC__
+ # if __GLIBC__ >= 2
+ LIBC=gnu
+ # else
+ LIBC=gnulibc1
+ # endif
+ # else
+ LIBC=gnulibc1
+ # endif
+ #else
+ #ifdef __INTEL_COMPILER
+ LIBC=gnu
+ #else
+ LIBC=gnuaout
+ #endif
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^LIBC=`
+ test x"${LIBC}" != x && echo "${UNAME_MACHINE}-${VENDOR:-pc}-linux-${LIBC}" && exit 0
+ test x"${TENTATIVE}" != x && echo "${TENTATIVE}" && exit 0
+ ;;
+ i*86:DYNIX/ptx:4*:*)
+ # ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
+ # earlier versions are messed up and put the nodename in both
+ # sysname and nodename.
+ echo i386-sequent-sysv4
+ exit 0 ;;
+ i*86:UNIX_SV:4.2MP:2.*)
+ # Unixware is an offshoot of SVR4, but it has its own version
+ # number series starting with 2...
+ # I am not positive that other SVR4 systems won't match this,
+ # I just have to hope. -- rms.
+ # Use sysv4.2uw... so that sysv4* matches it.
+ echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+ exit 0 ;;
+ i*86:OS/2:*:*)
+ # If we were able to find `uname', then EMX Unix compatibility
+ # is probably installed.
+ echo ${UNAME_MACHINE}-pc-os2-emx
+ exit 0 ;;
+ i*86:XTS-300:*:STOP)
+ echo ${UNAME_MACHINE}-unknown-stop
+ exit 0 ;;
+ i*86:atheos:*:*)
+ echo ${UNAME_MACHINE}-unknown-atheos
+ exit 0 ;;
+ i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.0*:*)
+ echo i386-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ i*86:*DOS:*:*)
+ echo ${UNAME_MACHINE}-pc-msdosdjgpp
+ exit 0 ;;
+ i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
+ UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+ if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+ echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+ else
+ echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+ fi
+ exit 0 ;;
+ i*86:*:5:[78]*)
+ case `/bin/uname -X | grep "^Machine"` in
+ *486*) UNAME_MACHINE=i486 ;;
+ *Pentium) UNAME_MACHINE=i586 ;;
+ *Pent*|*Celeron) UNAME_MACHINE=i686 ;;
+ esac
+ echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+ exit 0 ;;
+ i*86:*:3.2:*)
+ if test -f /usr/options/cb.name; then
+ UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+ echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+ elif /bin/uname -X 2>/dev/null >/dev/null ; then
+ UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
+ (/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
+ (/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \
+ && UNAME_MACHINE=i586
+ (/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \
+ && UNAME_MACHINE=i686
+ (/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
+ && UNAME_MACHINE=i686
+ echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+ else
+ echo ${UNAME_MACHINE}-pc-sysv32
+ fi
+ exit 0 ;;
+ pc:*:*:*)
+ # Left here for compatibility:
+ # uname -m prints for DJGPP always 'pc', but it prints nothing about
+ # the processor, so we play safe by assuming i386.
+ echo i386-pc-msdosdjgpp
+ exit 0 ;;
+ Intel:Mach:3*:*)
+ echo i386-pc-mach3
+ exit 0 ;;
+ paragon:*:*:*)
+ echo i860-intel-osf1
+ exit 0 ;;
+ i860:*:4.*:*) # i860-SVR4
+ if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+ echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+ else # Add other i860-SVR4 vendors below as they are discovered.
+ echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4
+ fi
+ exit 0 ;;
+ mini*:CTIX:SYS*5:*)
+ # "miniframe"
+ echo m68010-convergent-sysv
+ exit 0 ;;
+ mc68k:UNIX:SYSTEM5:3.51m)
+ echo m68k-convergent-sysv
+ exit 0 ;;
+ M680?0:D-NIX:5.3:*)
+ echo m68k-diab-dnix
+ exit 0 ;;
+ M68*:*:R3V[567]*:*)
+ test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;;
+ 3[34]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0)
+ OS_REL=''
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && echo i486-ncr-sysv4.3${OS_REL} && exit 0
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;;
+ 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && echo i486-ncr-sysv4 && exit 0 ;;
+ m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
+ echo m68k-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ mc68030:UNIX_System_V:4.*:*)
+ echo m68k-atari-sysv4
+ exit 0 ;;
+ TSUNAMI:LynxOS:2.*:*)
+ echo sparc-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ rs6000:LynxOS:2.*:*)
+ echo rs6000-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.0*:*)
+ echo powerpc-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ SM[BE]S:UNIX_SV:*:*)
+ echo mips-dde-sysv${UNAME_RELEASE}
+ exit 0 ;;
+ RM*:ReliantUNIX-*:*:*)
+ echo mips-sni-sysv4
+ exit 0 ;;
+ RM*:SINIX-*:*:*)
+ echo mips-sni-sysv4
+ exit 0 ;;
+ *:SINIX-*:*:*)
+ if uname -p 2>/dev/null >/dev/null ; then
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ echo ${UNAME_MACHINE}-sni-sysv4
+ else
+ echo ns32k-sni-sysv
+ fi
+ exit 0 ;;
+ PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+ # says <Richard.M.Bartel@ccMail.Census.GOV>
+ echo i586-unisys-sysv4
+ exit 0 ;;
+ *:UNIX_System_V:4*:FTX*)
+ # From Gerald Hewes <hewes@openmarket.com>.
+ # How about differentiating between stratus architectures? -djm
+ echo hppa1.1-stratus-sysv4
+ exit 0 ;;
+ *:*:*:FTX*)
+ # From seanf@swdc.stratus.com.
+ echo i860-stratus-sysv4
+ exit 0 ;;
+ *:VOS:*:*)
+ # From Paul.Green@stratus.com.
+ echo hppa1.1-stratus-vos
+ exit 0 ;;
+ mc68*:A/UX:*:*)
+ echo m68k-apple-aux${UNAME_RELEASE}
+ exit 0 ;;
+ news*:NEWS-OS:6*:*)
+ echo mips-sony-newsos6
+ exit 0 ;;
+ R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
+ if [ -d /usr/nec ]; then
+ echo mips-nec-sysv${UNAME_RELEASE}
+ else
+ echo mips-unknown-sysv${UNAME_RELEASE}
+ fi
+ exit 0 ;;
+ BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only.
+ echo powerpc-be-beos
+ exit 0 ;;
+ BeMac:BeOS:*:*) # BeOS running on Mac or Mac clone, PPC only.
+ echo powerpc-apple-beos
+ exit 0 ;;
+ BePC:BeOS:*:*) # BeOS running on Intel PC compatible.
+ echo i586-pc-beos
+ exit 0 ;;
+ SX-4:SUPER-UX:*:*)
+ echo sx4-nec-superux${UNAME_RELEASE}
+ exit 0 ;;
+ SX-5:SUPER-UX:*:*)
+ echo sx5-nec-superux${UNAME_RELEASE}
+ exit 0 ;;
+ SX-6:SUPER-UX:*:*)
+ echo sx6-nec-superux${UNAME_RELEASE}
+ exit 0 ;;
+ Power*:Rhapsody:*:*)
+ echo powerpc-apple-rhapsody${UNAME_RELEASE}
+ exit 0 ;;
+ *:Rhapsody:*:*)
+ echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+ exit 0 ;;
+ *:Darwin:*:*)
+ case `uname -p` in
+ *86) UNAME_PROCESSOR=i686 ;;
+ powerpc) UNAME_PROCESSOR=powerpc ;;
+ esac
+ echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+ exit 0 ;;
+ *:procnto*:*:* | *:QNX:[0123456789]*:*)
+ UNAME_PROCESSOR=`uname -p`
+ if test "$UNAME_PROCESSOR" = "x86"; then
+ UNAME_PROCESSOR=i386
+ UNAME_MACHINE=pc
+ fi
+ echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+ exit 0 ;;
+ *:QNX:*:4*)
+ echo i386-pc-qnx
+ exit 0 ;;
+ NSR-[DGKLNPTVW]:NONSTOP_KERNEL:*:*)
+ echo nsr-tandem-nsk${UNAME_RELEASE}
+ exit 0 ;;
+ *:NonStop-UX:*:*)
+ echo mips-compaq-nonstopux
+ exit 0 ;;
+ BS2000:POSIX*:*:*)
+ echo bs2000-siemens-sysv
+ exit 0 ;;
+ DS/*:UNIX_System_V:*:*)
+ echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+ exit 0 ;;
+ *:Plan9:*:*)
+ # "uname -m" is not consistent, so use $cputype instead. 386
+ # is converted to i386 for consistency with other x86
+ # operating systems.
+ if test "$cputype" = "386"; then
+ UNAME_MACHINE=i386
+ else
+ UNAME_MACHINE="$cputype"
+ fi
+ echo ${UNAME_MACHINE}-unknown-plan9
+ exit 0 ;;
+ *:TOPS-10:*:*)
+ echo pdp10-unknown-tops10
+ exit 0 ;;
+ *:TENEX:*:*)
+ echo pdp10-unknown-tenex
+ exit 0 ;;
+ KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*)
+ echo pdp10-dec-tops20
+ exit 0 ;;
+ XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*)
+ echo pdp10-xkl-tops20
+ exit 0 ;;
+ *:TOPS-20:*:*)
+ echo pdp10-unknown-tops20
+ exit 0 ;;
+ *:ITS:*:*)
+ echo pdp10-unknown-its
+ exit 0 ;;
+ SEI:*:*:SEIUX)
+ echo mips-sei-seiux${UNAME_RELEASE}
+ exit 0 ;;
+esac
+
+#echo '(No uname command or uname output not recognized.)' 1>&2
+#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2
+
+eval $set_cc_for_build
+cat >$dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+ /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed,
+ I don't know.... */
+ printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+ printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+ "4"
+#else
+ ""
+#endif
+ ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+ printf ("arm-acorn-riscix"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+ printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+ int version;
+ version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+ if (version < 4)
+ printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+ else
+ printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+ exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+ printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+ printf ("ns32k-encore-mach\n"); exit (0);
+#else
+ printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+ printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+ printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+ printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+ struct utsname un;
+
+ uname(&un);
+
+ if (strncmp(un.version, "V2", 2) == 0) {
+ printf ("i386-sequent-ptx2\n"); exit (0);
+ }
+ if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+ printf ("i386-sequent-ptx1\n"); exit (0);
+ }
+ printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+# if !defined (ultrix)
+# include <sys/param.h>
+# if defined (BSD)
+# if BSD == 43
+ printf ("vax-dec-bsd4.3\n"); exit (0);
+# else
+# if BSD == 199006
+ printf ("vax-dec-bsd4.3reno\n"); exit (0);
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# endif
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# else
+ printf ("vax-dec-ultrix\n"); exit (0);
+# endif
+#endif
+
+#if defined (alliant) && defined (i860)
+ printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+ exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && $dummy && exit 0
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+ case `getsysinfo -f cpu_type` in
+ c1*)
+ echo c1-convex-bsd
+ exit 0 ;;
+ c2*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit 0 ;;
+ c34*)
+ echo c34-convex-bsd
+ exit 0 ;;
+ c38*)
+ echo c38-convex-bsd
+ exit 0 ;;
+ c4*)
+ echo c4-convex-bsd
+ exit 0 ;;
+ esac
+fi
+
+cat >&2 <<EOF
+$0: unable to guess system type
+
+This script, last modified $timestamp, has failed to recognize
+the operating system you are using. It is advised that you
+download the most up to date version of the config scripts from
+
+ ftp://ftp.gnu.org/pub/gnu/config/
+
+If the version you run ($0) is already up to date, please
+send the following data and any information you think might be
+pertinent to <config-patches@gnu.org> in order to provide the needed
+information to handle your system.
+
+config.guess timestamp = $timestamp
+
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null`
+
+hostinfo = `(hostinfo) 2>/dev/null`
+/bin/universe = `(/bin/universe) 2>/dev/null`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null`
+/bin/arch = `(/bin/arch) 2>/dev/null`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
+
+UNAME_MACHINE = ${UNAME_MACHINE}
+UNAME_RELEASE = ${UNAME_RELEASE}
+UNAME_SYSTEM = ${UNAME_SYSTEM}
+UNAME_VERSION = ${UNAME_VERSION}
+EOF
+
+exit 1
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/driver/xf86-input-mouse/config.h.in b/driver/xf86-input-mouse/config.h.in
new file mode 100644
index 000000000..db6ccf22e
--- /dev/null
+++ b/driver/xf86-input-mouse/config.h.in
@@ -0,0 +1,57 @@
+/* config.h.in. Generated from configure.ac by autoheader. */
+
+#include "xorg-server.h"
+
+/* Define to 1 if you have the <dlfcn.h> header file. */
+#undef HAVE_DLFCN_H
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Name of package */
+#undef PACKAGE
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Version number of package */
+#undef VERSION
diff --git a/driver/xf86-input-mouse/config.sub b/driver/xf86-input-mouse/config.sub
new file mode 100644
index 000000000..6b2ff9f6a
--- /dev/null
+++ b/driver/xf86-input-mouse/config.sub
@@ -0,0 +1,1500 @@
+#! /bin/sh
+# Configuration validation subroutine script.
+# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+# 2000, 2001, 2002, 2003 Free Software Foundation, Inc.
+
+timestamp='2003-06-18'
+
+# This file is (in principle) common to ALL GNU software.
+# The presence of a machine in this file suggests that SOME GNU software
+# can handle that machine. It does not imply ALL GNU software can.
+#
+# This file is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330,
+# Boston, MA 02111-1307, USA.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Please send patches to <config-patches@gnu.org>. Submit a context
+# diff and a properly formatted ChangeLog entry.
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support. The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS
+ $0 [OPTION] ALIAS
+
+Canonicalize a configuration name.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001
+Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit 0 ;;
+ --version | -v )
+ echo "$version" ; exit 0 ;;
+ --help | --h* | -h )
+ echo "$usage"; exit 0 ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help"
+ exit 1 ;;
+
+ *local*)
+ # First pass through any local machine types.
+ echo $1
+ exit 0;;
+
+ * )
+ break ;;
+ esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+ exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+ exit 1;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+ nto-qnx* | linux-gnu* | freebsd*-gnu* | netbsd*-gnu* | storm-chaos* | os2-emx* | rtmk-nova*)
+ os=-$maybe_os
+ basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+ ;;
+ *)
+ basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+ if [ $basic_machine != $1 ]
+ then os=`echo $1 | sed 's/.*-/-/'`
+ else os=; fi
+ ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work. We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+ -sun*os*)
+ # Prevent following clause from handling this invalid input.
+ ;;
+ -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+ -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+ -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+ -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+ -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+ -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+ -apple | -axis)
+ os=
+ basic_machine=$1
+ ;;
+ -sim | -cisco | -oki | -wec | -winbond)
+ os=
+ basic_machine=$1
+ ;;
+ -scout)
+ ;;
+ -wrs)
+ os=-vxworks
+ basic_machine=$1
+ ;;
+ -chorusos*)
+ os=-chorusos
+ basic_machine=$1
+ ;;
+ -chorusrdb)
+ os=-chorusrdb
+ basic_machine=$1
+ ;;
+ -hiux*)
+ os=-hiuxwe2
+ ;;
+ -sco5)
+ os=-sco3.2v5
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco4)
+ os=-sco3.2v4
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2.[4-9]*)
+ os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2v[4-9]*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco*)
+ os=-sco3.2v2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -udk*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -isc)
+ os=-isc2.2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -clix*)
+ basic_machine=clipper-intergraph
+ ;;
+ -isc*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -lynx*)
+ os=-lynxos
+ ;;
+ -ptx*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+ ;;
+ -windowsnt*)
+ os=`echo $os | sed -e 's/windowsnt/winnt/'`
+ ;;
+ -psos*)
+ os=-psos
+ ;;
+ -mint | -mint[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+ # Recognize the basic CPU types without company name.
+ # Some are omitted here because they have special meanings below.
+ 1750a | 580 \
+ | a29k \
+ | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
+ | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
+ | arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr \
+ | c4x | clipper \
+ | d10v | d30v | dlx | dsp16xx \
+ | fr30 | frv \
+ | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
+ | i370 | i860 | i960 | ia64 \
+ | ip2k \
+ | m32r | m68000 | m68k | m88k | mcore \
+ | mips | mipsbe | mipseb | mipsel | mipsle \
+ | mips16 \
+ | mips64 | mips64el \
+ | mips64vr | mips64vrel \
+ | mips64orion | mips64orionel \
+ | mips64vr4100 | mips64vr4100el \
+ | mips64vr4300 | mips64vr4300el \
+ | mips64vr5000 | mips64vr5000el \
+ | mipsisa32 | mipsisa32el \
+ | mipsisa32r2 | mipsisa32r2el \
+ | mipsisa64 | mipsisa64el \
+ | mipsisa64sb1 | mipsisa64sb1el \
+ | mipsisa64sr71k | mipsisa64sr71kel \
+ | mipstx39 | mipstx39el \
+ | mn10200 | mn10300 \
+ | msp430 \
+ | ns16k | ns32k \
+ | openrisc | or32 \
+ | pdp10 | pdp11 | pj | pjl \
+ | powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \
+ | pyramid \
+ | s390 | s390x \
+ | sh | sh[1234] | sh[23]e | sh[34]eb | shbe | shle | sh[1234]le | sh3ele \
+ | sh64 | sh64le \
+ | sparc | sparc64 | sparc86x | sparclet | sparclite | sparcv8 | sparcv9 | sparcv9b \
+ | strongarm \
+ | tahoe | thumb | tic4x | tic80 | tron \
+ | v850 | v850e \
+ | we32k \
+ | x86 | xscale | xstormy16 | xtensa \
+ | z8k)
+ basic_machine=$basic_machine-unknown
+ ;;
+ m6811 | m68hc11 | m6812 | m68hc12)
+ # Motorola 68HC11/12.
+ basic_machine=$basic_machine-unknown
+ os=-none
+ ;;
+ m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
+ ;;
+
+ # We use `pc' rather than `unknown'
+ # because (1) that's what they normally are, and
+ # (2) the word "unknown" tends to confuse beginning users.
+ i*86 | x86_64)
+ basic_machine=$basic_machine-pc
+ ;;
+ # Object if more than one company name word.
+ *-*-*)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+ # Recognize the basic CPU types with company name.
+ 580-* \
+ | a29k-* \
+ | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
+ | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
+ | alphapca5[67]-* | alpha64pca5[67]-* | arc-* \
+ | arm-* | armbe-* | armle-* | armeb-* | armv*-* \
+ | avr-* \
+ | bs2000-* \
+ | c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \
+ | clipper-* | cydra-* \
+ | d10v-* | d30v-* | dlx-* \
+ | elxsi-* \
+ | f30[01]-* | f700-* | fr30-* | frv-* | fx80-* \
+ | h8300-* | h8500-* \
+ | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
+ | i*86-* | i860-* | i960-* | ia64-* \
+ | ip2k-* \
+ | m32r-* \
+ | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
+ | m88110-* | m88k-* | mcore-* \
+ | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
+ | mips16-* \
+ | mips64-* | mips64el-* \
+ | mips64vr-* | mips64vrel-* \
+ | mips64orion-* | mips64orionel-* \
+ | mips64vr4100-* | mips64vr4100el-* \
+ | mips64vr4300-* | mips64vr4300el-* \
+ | mips64vr5000-* | mips64vr5000el-* \
+ | mipsisa32-* | mipsisa32el-* \
+ | mipsisa32r2-* | mipsisa32r2el-* \
+ | mipsisa64-* | mipsisa64el-* \
+ | mipsisa64sb1-* | mipsisa64sb1el-* \
+ | mipsisa64sr71k-* | mipsisa64sr71kel-* \
+ | mipstx39-* | mipstx39el-* \
+ | msp430-* \
+ | none-* | np1-* | nv1-* | ns16k-* | ns32k-* \
+ | orion-* \
+ | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
+ | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \
+ | pyramid-* \
+ | romp-* | rs6000-* \
+ | s390-* | s390x-* \
+ | sh-* | sh[1234]-* | sh[23]e-* | sh[34]eb-* | shbe-* \
+ | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
+ | sparc-* | sparc64-* | sparc86x-* | sparclet-* | sparclite-* \
+ | sparcv8-* | sparcv9-* | sparcv9b-* | strongarm-* | sv1-* | sx?-* \
+ | tahoe-* | thumb-* \
+ | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \
+ | tron-* \
+ | v850-* | v850e-* | vax-* \
+ | we32k-* \
+ | x86-* | x86_64-* | xps100-* | xscale-* | xstormy16-* \
+ | xtensa-* \
+ | ymp-* \
+ | z8k-*)
+ ;;
+ # Recognize the various machine names and aliases which stand
+ # for a CPU type and a company and sometimes even an OS.
+ 386bsd)
+ basic_machine=i386-unknown
+ os=-bsd
+ ;;
+ 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+ basic_machine=m68000-att
+ ;;
+ 3b*)
+ basic_machine=we32k-att
+ ;;
+ a29khif)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ adobe68k)
+ basic_machine=m68010-adobe
+ os=-scout
+ ;;
+ alliant | fx80)
+ basic_machine=fx80-alliant
+ ;;
+ altos | altos3068)
+ basic_machine=m68k-altos
+ ;;
+ am29k)
+ basic_machine=a29k-none
+ os=-bsd
+ ;;
+ amd64)
+ basic_machine=x86_64-pc
+ ;;
+ amdahl)
+ basic_machine=580-amdahl
+ os=-sysv
+ ;;
+ amiga | amiga-*)
+ basic_machine=m68k-unknown
+ ;;
+ amigaos | amigados)
+ basic_machine=m68k-unknown
+ os=-amigaos
+ ;;
+ amigaunix | amix)
+ basic_machine=m68k-unknown
+ os=-sysv4
+ ;;
+ apollo68)
+ basic_machine=m68k-apollo
+ os=-sysv
+ ;;
+ apollo68bsd)
+ basic_machine=m68k-apollo
+ os=-bsd
+ ;;
+ aux)
+ basic_machine=m68k-apple
+ os=-aux
+ ;;
+ balance)
+ basic_machine=ns32k-sequent
+ os=-dynix
+ ;;
+ c90)
+ basic_machine=c90-cray
+ os=-unicos
+ ;;
+ convex-c1)
+ basic_machine=c1-convex
+ os=-bsd
+ ;;
+ convex-c2)
+ basic_machine=c2-convex
+ os=-bsd
+ ;;
+ convex-c32)
+ basic_machine=c32-convex
+ os=-bsd
+ ;;
+ convex-c34)
+ basic_machine=c34-convex
+ os=-bsd
+ ;;
+ convex-c38)
+ basic_machine=c38-convex
+ os=-bsd
+ ;;
+ cray | j90)
+ basic_machine=j90-cray
+ os=-unicos
+ ;;
+ crds | unos)
+ basic_machine=m68k-crds
+ ;;
+ cris | cris-* | etrax*)
+ basic_machine=cris-axis
+ ;;
+ da30 | da30-*)
+ basic_machine=m68k-da30
+ ;;
+ decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+ basic_machine=mips-dec
+ ;;
+ decsystem10* | dec10*)
+ basic_machine=pdp10-dec
+ os=-tops10
+ ;;
+ decsystem20* | dec20*)
+ basic_machine=pdp10-dec
+ os=-tops20
+ ;;
+ delta | 3300 | motorola-3300 | motorola-delta \
+ | 3300-motorola | delta-motorola)
+ basic_machine=m68k-motorola
+ ;;
+ delta88)
+ basic_machine=m88k-motorola
+ os=-sysv3
+ ;;
+ dpx20 | dpx20-*)
+ basic_machine=rs6000-bull
+ os=-bosx
+ ;;
+ dpx2* | dpx2*-bull)
+ basic_machine=m68k-bull
+ os=-sysv3
+ ;;
+ ebmon29k)
+ basic_machine=a29k-amd
+ os=-ebmon
+ ;;
+ elxsi)
+ basic_machine=elxsi-elxsi
+ os=-bsd
+ ;;
+ encore | umax | mmax)
+ basic_machine=ns32k-encore
+ ;;
+ es1800 | OSE68k | ose68k | ose | OSE)
+ basic_machine=m68k-ericsson
+ os=-ose
+ ;;
+ fx2800)
+ basic_machine=i860-alliant
+ ;;
+ genix)
+ basic_machine=ns32k-ns
+ ;;
+ gmicro)
+ basic_machine=tron-gmicro
+ os=-sysv
+ ;;
+ go32)
+ basic_machine=i386-pc
+ os=-go32
+ ;;
+ h3050r* | hiux*)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ h8300hms)
+ basic_machine=h8300-hitachi
+ os=-hms
+ ;;
+ h8300xray)
+ basic_machine=h8300-hitachi
+ os=-xray
+ ;;
+ h8500hms)
+ basic_machine=h8500-hitachi
+ os=-hms
+ ;;
+ harris)
+ basic_machine=m88k-harris
+ os=-sysv3
+ ;;
+ hp300-*)
+ basic_machine=m68k-hp
+ ;;
+ hp300bsd)
+ basic_machine=m68k-hp
+ os=-bsd
+ ;;
+ hp300hpux)
+ basic_machine=m68k-hp
+ os=-hpux
+ ;;
+ hp3k9[0-9][0-9] | hp9[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k2[0-9][0-9] | hp9k31[0-9])
+ basic_machine=m68000-hp
+ ;;
+ hp9k3[2-9][0-9])
+ basic_machine=m68k-hp
+ ;;
+ hp9k6[0-9][0-9] | hp6[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k7[0-79][0-9] | hp7[0-79][0-9])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k78[0-9] | hp78[0-9])
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][13679] | hp8[0-9][13679])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][0-9] | hp8[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hppa-next)
+ os=-nextstep3
+ ;;
+ hppaosf)
+ basic_machine=hppa1.1-hp
+ os=-osf
+ ;;
+ hppro)
+ basic_machine=hppa1.1-hp
+ os=-proelf
+ ;;
+ i370-ibm* | ibm*)
+ basic_machine=i370-ibm
+ ;;
+# I'm not sure what "Sysv32" means. Should this be sysv3.2?
+ i*86v32)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv32
+ ;;
+ i*86v4*)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv4
+ ;;
+ i*86v)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv
+ ;;
+ i*86sol2)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-solaris2
+ ;;
+ i386mach)
+ basic_machine=i386-mach
+ os=-mach
+ ;;
+ i386-vsta | vsta)
+ basic_machine=i386-unknown
+ os=-vsta
+ ;;
+ iris | iris4d)
+ basic_machine=mips-sgi
+ case $os in
+ -irix*)
+ ;;
+ *)
+ os=-irix4
+ ;;
+ esac
+ ;;
+ isi68 | isi)
+ basic_machine=m68k-isi
+ os=-sysv
+ ;;
+ m88k-omron*)
+ basic_machine=m88k-omron
+ ;;
+ magnum | m3230)
+ basic_machine=mips-mips
+ os=-sysv
+ ;;
+ merlin)
+ basic_machine=ns32k-utek
+ os=-sysv
+ ;;
+ mingw32)
+ basic_machine=i386-pc
+ os=-mingw32
+ ;;
+ miniframe)
+ basic_machine=m68000-convergent
+ ;;
+ *mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+ mips3*-*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+ ;;
+ mips3*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+ ;;
+ mmix*)
+ basic_machine=mmix-knuth
+ os=-mmixware
+ ;;
+ monitor)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ morphos)
+ basic_machine=powerpc-unknown
+ os=-morphos
+ ;;
+ msdos)
+ basic_machine=i386-pc
+ os=-msdos
+ ;;
+ mvs)
+ basic_machine=i370-ibm
+ os=-mvs
+ ;;
+ ncr3000)
+ basic_machine=i486-ncr
+ os=-sysv4
+ ;;
+ netbsd386)
+ basic_machine=i386-unknown
+ os=-netbsd
+ ;;
+ netwinder)
+ basic_machine=armv4l-rebel
+ os=-linux
+ ;;
+ news | news700 | news800 | news900)
+ basic_machine=m68k-sony
+ os=-newsos
+ ;;
+ news1000)
+ basic_machine=m68030-sony
+ os=-newsos
+ ;;
+ news-3600 | risc-news)
+ basic_machine=mips-sony
+ os=-newsos
+ ;;
+ necv70)
+ basic_machine=v70-nec
+ os=-sysv
+ ;;
+ next | m*-next )
+ basic_machine=m68k-next
+ case $os in
+ -nextstep* )
+ ;;
+ -ns2*)
+ os=-nextstep2
+ ;;
+ *)
+ os=-nextstep3
+ ;;
+ esac
+ ;;
+ nh3000)
+ basic_machine=m68k-harris
+ os=-cxux
+ ;;
+ nh[45]000)
+ basic_machine=m88k-harris
+ os=-cxux
+ ;;
+ nindy960)
+ basic_machine=i960-intel
+ os=-nindy
+ ;;
+ mon960)
+ basic_machine=i960-intel
+ os=-mon960
+ ;;
+ nonstopux)
+ basic_machine=mips-compaq
+ os=-nonstopux
+ ;;
+ np1)
+ basic_machine=np1-gould
+ ;;
+ nv1)
+ basic_machine=nv1-cray
+ os=-unicosmp
+ ;;
+ nsr-tandem)
+ basic_machine=nsr-tandem
+ ;;
+ op50n-* | op60c-*)
+ basic_machine=hppa1.1-oki
+ os=-proelf
+ ;;
+ or32 | or32-*)
+ basic_machine=or32-unknown
+ os=-coff
+ ;;
+ OSE68000 | ose68000)
+ basic_machine=m68000-ericsson
+ os=-ose
+ ;;
+ os68k)
+ basic_machine=m68k-none
+ os=-os68k
+ ;;
+ pa-hitachi)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ paragon)
+ basic_machine=i860-intel
+ os=-osf
+ ;;
+ pbd)
+ basic_machine=sparc-tti
+ ;;
+ pbb)
+ basic_machine=m68k-tti
+ ;;
+ pc532 | pc532-*)
+ basic_machine=ns32k-pc532
+ ;;
+ pentium | p5 | k5 | k6 | nexgen | viac3)
+ basic_machine=i586-pc
+ ;;
+ pentiumpro | p6 | 6x86 | athlon | athlon_*)
+ basic_machine=i686-pc
+ ;;
+ pentiumii | pentium2 | pentiumiii | pentium3)
+ basic_machine=i686-pc
+ ;;
+ pentium4)
+ basic_machine=i786-pc
+ ;;
+ pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
+ basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumpro-* | p6-* | 6x86-* | athlon-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentium4-*)
+ basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pn)
+ basic_machine=pn-gould
+ ;;
+ power) basic_machine=power-ibm
+ ;;
+ ppc) basic_machine=powerpc-unknown
+ ;;
+ ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppcle | powerpclittle | ppc-le | powerpc-little)
+ basic_machine=powerpcle-unknown
+ ;;
+ ppcle-* | powerpclittle-*)
+ basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64) basic_machine=powerpc64-unknown
+ ;;
+ ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64le | powerpc64little | ppc64-le | powerpc64-little)
+ basic_machine=powerpc64le-unknown
+ ;;
+ ppc64le-* | powerpc64little-*)
+ basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ps2)
+ basic_machine=i386-ibm
+ ;;
+ pw32)
+ basic_machine=i586-unknown
+ os=-pw32
+ ;;
+ rom68k)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ rm[46]00)
+ basic_machine=mips-siemens
+ ;;
+ rtpc | rtpc-*)
+ basic_machine=romp-ibm
+ ;;
+ sa29200)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ sb1)
+ basic_machine=mipsisa64sb1-unknown
+ ;;
+ sb1el)
+ basic_machine=mipsisa64sb1el-unknown
+ ;;
+ sei)
+ basic_machine=mips-sei
+ os=-seiux
+ ;;
+ sequent)
+ basic_machine=i386-sequent
+ ;;
+ sh)
+ basic_machine=sh-hitachi
+ os=-hms
+ ;;
+ sh64)
+ basic_machine=sh64-unknown
+ ;;
+ sparclite-wrs | simso-wrs)
+ basic_machine=sparclite-wrs
+ os=-vxworks
+ ;;
+ sps7)
+ basic_machine=m68k-bull
+ os=-sysv2
+ ;;
+ spur)
+ basic_machine=spur-unknown
+ ;;
+ st2000)
+ basic_machine=m68k-tandem
+ ;;
+ stratus)
+ basic_machine=i860-stratus
+ os=-sysv4
+ ;;
+ sun2)
+ basic_machine=m68000-sun
+ ;;
+ sun2os3)
+ basic_machine=m68000-sun
+ os=-sunos3
+ ;;
+ sun2os4)
+ basic_machine=m68000-sun
+ os=-sunos4
+ ;;
+ sun3os3)
+ basic_machine=m68k-sun
+ os=-sunos3
+ ;;
+ sun3os4)
+ basic_machine=m68k-sun
+ os=-sunos4
+ ;;
+ sun4os3)
+ basic_machine=sparc-sun
+ os=-sunos3
+ ;;
+ sun4os4)
+ basic_machine=sparc-sun
+ os=-sunos4
+ ;;
+ sun4sol2)
+ basic_machine=sparc-sun
+ os=-solaris2
+ ;;
+ sun3 | sun3-*)
+ basic_machine=m68k-sun
+ ;;
+ sun4)
+ basic_machine=sparc-sun
+ ;;
+ sun386 | sun386i | roadrunner)
+ basic_machine=i386-sun
+ ;;
+ sv1)
+ basic_machine=sv1-cray
+ os=-unicos
+ ;;
+ symmetry)
+ basic_machine=i386-sequent
+ os=-dynix
+ ;;
+ t3e)
+ basic_machine=alphaev5-cray
+ os=-unicos
+ ;;
+ t90)
+ basic_machine=t90-cray
+ os=-unicos
+ ;;
+ tic54x | c54x*)
+ basic_machine=tic54x-unknown
+ os=-coff
+ ;;
+ tic55x | c55x*)
+ basic_machine=tic55x-unknown
+ os=-coff
+ ;;
+ tic6x | c6x*)
+ basic_machine=tic6x-unknown
+ os=-coff
+ ;;
+ tx39)
+ basic_machine=mipstx39-unknown
+ ;;
+ tx39el)
+ basic_machine=mipstx39el-unknown
+ ;;
+ toad1)
+ basic_machine=pdp10-xkl
+ os=-tops20
+ ;;
+ tower | tower-32)
+ basic_machine=m68k-ncr
+ ;;
+ udi29k)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ ultra3)
+ basic_machine=a29k-nyu
+ os=-sym1
+ ;;
+ v810 | necv810)
+ basic_machine=v810-nec
+ os=-none
+ ;;
+ vaxv)
+ basic_machine=vax-dec
+ os=-sysv
+ ;;
+ vms)
+ basic_machine=vax-dec
+ os=-vms
+ ;;
+ vpp*|vx|vx-*)
+ basic_machine=f301-fujitsu
+ ;;
+ vxworks960)
+ basic_machine=i960-wrs
+ os=-vxworks
+ ;;
+ vxworks68)
+ basic_machine=m68k-wrs
+ os=-vxworks
+ ;;
+ vxworks29k)
+ basic_machine=a29k-wrs
+ os=-vxworks
+ ;;
+ w65*)
+ basic_machine=w65-wdc
+ os=-none
+ ;;
+ w89k-*)
+ basic_machine=hppa1.1-winbond
+ os=-proelf
+ ;;
+ xps | xps100)
+ basic_machine=xps100-honeywell
+ ;;
+ ymp)
+ basic_machine=ymp-cray
+ os=-unicos
+ ;;
+ z8k-*-coff)
+ basic_machine=z8k-unknown
+ os=-sim
+ ;;
+ none)
+ basic_machine=none-none
+ os=-none
+ ;;
+
+# Here we handle the default manufacturer of certain CPU types. It is in
+# some cases the only manufacturer, in others, it is the most popular.
+ w89k)
+ basic_machine=hppa1.1-winbond
+ ;;
+ op50n)
+ basic_machine=hppa1.1-oki
+ ;;
+ op60c)
+ basic_machine=hppa1.1-oki
+ ;;
+ romp)
+ basic_machine=romp-ibm
+ ;;
+ rs6000)
+ basic_machine=rs6000-ibm
+ ;;
+ vax)
+ basic_machine=vax-dec
+ ;;
+ pdp10)
+ # there are many clones, so DEC is not a safe bet
+ basic_machine=pdp10-unknown
+ ;;
+ pdp11)
+ basic_machine=pdp11-dec
+ ;;
+ we32k)
+ basic_machine=we32k-att
+ ;;
+ sh3 | sh4 | sh[34]eb | sh[1234]le | sh[23]ele)
+ basic_machine=sh-unknown
+ ;;
+ sh64)
+ basic_machine=sh64-unknown
+ ;;
+ sparc | sparcv8 | sparcv9 | sparcv9b)
+ basic_machine=sparc-sun
+ ;;
+ cydra)
+ basic_machine=cydra-cydrome
+ ;;
+ orion)
+ basic_machine=orion-highlevel
+ ;;
+ orion105)
+ basic_machine=clipper-highlevel
+ ;;
+ mac | mpw | mac-mpw)
+ basic_machine=m68k-apple
+ ;;
+ pmac | pmac-mpw)
+ basic_machine=powerpc-apple
+ ;;
+ *-unknown)
+ # Make sure to match an already-canonicalized machine name.
+ ;;
+ *)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+ *-digital*)
+ basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+ ;;
+ *-commodore*)
+ basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+ ;;
+ *)
+ ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+ # First match some system type aliases
+ # that might get confused with valid system types.
+ # -solaris* is a basic system type, with this one exception.
+ -solaris1 | -solaris1.*)
+ os=`echo $os | sed -e 's|solaris1|sunos4|'`
+ ;;
+ -solaris)
+ os=-solaris2
+ ;;
+ -svr4*)
+ os=-sysv4
+ ;;
+ -unixware*)
+ os=-sysv4.2uw
+ ;;
+ -gnu/linux*)
+ os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+ ;;
+ # First accept the basic system types.
+ # The portable systems comes first.
+ # Each alternative MUST END IN A *, to match a version number.
+ # -sysv* is not here because it comes later, after sysvr4.
+ -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+ | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\
+ | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \
+ | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+ | -aos* \
+ | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+ | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+ | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \
+ | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+ | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+ | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+ | -chorusos* | -chorusrdb* \
+ | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+ | -mingw32* | -linux-gnu* | -uxpv* | -beos* | -mpeix* | -udk* \
+ | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
+ | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
+ | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
+ | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
+ | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
+ | -powermax* | -dnix* | -nx6 | -nx7 | -sei*)
+ # Remember, each alternative MUST END IN *, to match a version number.
+ ;;
+ -qnx*)
+ case $basic_machine in
+ x86-* | i*86-*)
+ ;;
+ *)
+ os=-nto$os
+ ;;
+ esac
+ ;;
+ -nto-qnx*)
+ ;;
+ -nto*)
+ os=`echo $os | sed -e 's|nto|nto-qnx|'`
+ ;;
+ -sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
+ | -windows* | -osx | -abug | -netware* | -os9* | -beos* \
+ | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
+ ;;
+ -mac*)
+ os=`echo $os | sed -e 's|mac|macos|'`
+ ;;
+ -linux*)
+ os=`echo $os | sed -e 's|linux|linux-gnu|'`
+ ;;
+ -sunos5*)
+ os=`echo $os | sed -e 's|sunos5|solaris2|'`
+ ;;
+ -sunos6*)
+ os=`echo $os | sed -e 's|sunos6|solaris3|'`
+ ;;
+ -opened*)
+ os=-openedition
+ ;;
+ -wince*)
+ os=-wince
+ ;;
+ -osfrose*)
+ os=-osfrose
+ ;;
+ -osf*)
+ os=-osf
+ ;;
+ -utek*)
+ os=-bsd
+ ;;
+ -dynix*)
+ os=-bsd
+ ;;
+ -acis*)
+ os=-aos
+ ;;
+ -atheos*)
+ os=-atheos
+ ;;
+ -386bsd)
+ os=-bsd
+ ;;
+ -ctix* | -uts*)
+ os=-sysv
+ ;;
+ -nova*)
+ os=-rtmk-nova
+ ;;
+ -ns2 )
+ os=-nextstep2
+ ;;
+ -nsk*)
+ os=-nsk
+ ;;
+ # Preserve the version number of sinix5.
+ -sinix5.*)
+ os=`echo $os | sed -e 's|sinix|sysv|'`
+ ;;
+ -sinix*)
+ os=-sysv4
+ ;;
+ -triton*)
+ os=-sysv3
+ ;;
+ -oss*)
+ os=-sysv3
+ ;;
+ -svr4)
+ os=-sysv4
+ ;;
+ -svr3)
+ os=-sysv3
+ ;;
+ -sysvr4)
+ os=-sysv4
+ ;;
+ # This must come after -sysvr4.
+ -sysv*)
+ ;;
+ -ose*)
+ os=-ose
+ ;;
+ -es1800*)
+ os=-ose
+ ;;
+ -xenix)
+ os=-xenix
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ os=-mint
+ ;;
+ -aros*)
+ os=-aros
+ ;;
+ -kaos*)
+ os=-kaos
+ ;;
+ -none)
+ ;;
+ *)
+ # Get rid of the `-' at the beginning of $os.
+ os=`echo $os | sed 's/[^-]*-//'`
+ echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system. Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+ *-acorn)
+ os=-riscix1.2
+ ;;
+ arm*-rebel)
+ os=-linux
+ ;;
+ arm*-semi)
+ os=-aout
+ ;;
+ c4x-* | tic4x-*)
+ os=-coff
+ ;;
+ # This must come before the *-dec entry.
+ pdp10-*)
+ os=-tops20
+ ;;
+ pdp11-*)
+ os=-none
+ ;;
+ *-dec | vax-*)
+ os=-ultrix4.2
+ ;;
+ m68*-apollo)
+ os=-domain
+ ;;
+ i386-sun)
+ os=-sunos4.0.2
+ ;;
+ m68000-sun)
+ os=-sunos3
+ # This also exists in the configure program, but was not the
+ # default.
+ # os=-sunos4
+ ;;
+ m68*-cisco)
+ os=-aout
+ ;;
+ mips*-cisco)
+ os=-elf
+ ;;
+ mips*-*)
+ os=-elf
+ ;;
+ or32-*)
+ os=-coff
+ ;;
+ *-tti) # must be before sparc entry or we get the wrong os.
+ os=-sysv3
+ ;;
+ sparc-* | *-sun)
+ os=-sunos4.1.1
+ ;;
+ *-be)
+ os=-beos
+ ;;
+ *-ibm)
+ os=-aix
+ ;;
+ *-wec)
+ os=-proelf
+ ;;
+ *-winbond)
+ os=-proelf
+ ;;
+ *-oki)
+ os=-proelf
+ ;;
+ *-hp)
+ os=-hpux
+ ;;
+ *-hitachi)
+ os=-hiux
+ ;;
+ i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+ os=-sysv
+ ;;
+ *-cbm)
+ os=-amigaos
+ ;;
+ *-dg)
+ os=-dgux
+ ;;
+ *-dolphin)
+ os=-sysv3
+ ;;
+ m68k-ccur)
+ os=-rtu
+ ;;
+ m88k-omron*)
+ os=-luna
+ ;;
+ *-next )
+ os=-nextstep
+ ;;
+ *-sequent)
+ os=-ptx
+ ;;
+ *-crds)
+ os=-unos
+ ;;
+ *-ns)
+ os=-genix
+ ;;
+ i370-*)
+ os=-mvs
+ ;;
+ *-next)
+ os=-nextstep3
+ ;;
+ *-gould)
+ os=-sysv
+ ;;
+ *-highlevel)
+ os=-bsd
+ ;;
+ *-encore)
+ os=-bsd
+ ;;
+ *-sgi)
+ os=-irix
+ ;;
+ *-siemens)
+ os=-sysv4
+ ;;
+ *-masscomp)
+ os=-rtu
+ ;;
+ f30[01]-fujitsu | f700-fujitsu)
+ os=-uxpv
+ ;;
+ *-rom68k)
+ os=-coff
+ ;;
+ *-*bug)
+ os=-coff
+ ;;
+ *-apple)
+ os=-macos
+ ;;
+ *-atari*)
+ os=-mint
+ ;;
+ *)
+ os=-none
+ ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer. We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+ *-unknown)
+ case $os in
+ -riscix*)
+ vendor=acorn
+ ;;
+ -sunos*)
+ vendor=sun
+ ;;
+ -aix*)
+ vendor=ibm
+ ;;
+ -beos*)
+ vendor=be
+ ;;
+ -hpux*)
+ vendor=hp
+ ;;
+ -mpeix*)
+ vendor=hp
+ ;;
+ -hiux*)
+ vendor=hitachi
+ ;;
+ -unos*)
+ vendor=crds
+ ;;
+ -dgux*)
+ vendor=dg
+ ;;
+ -luna*)
+ vendor=omron
+ ;;
+ -genix*)
+ vendor=ns
+ ;;
+ -mvs* | -opened*)
+ vendor=ibm
+ ;;
+ -ptx*)
+ vendor=sequent
+ ;;
+ -vxsim* | -vxworks* | -windiss*)
+ vendor=wrs
+ ;;
+ -aux*)
+ vendor=apple
+ ;;
+ -hms*)
+ vendor=hitachi
+ ;;
+ -mpw* | -macos*)
+ vendor=apple
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ vendor=atari
+ ;;
+ -vos*)
+ vendor=stratus
+ ;;
+ esac
+ basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+ ;;
+esac
+
+echo $basic_machine$os
+exit 0
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/driver/xf86-input-mouse/configure b/driver/xf86-input-mouse/configure
new file mode 100644
index 000000000..db629882d
--- /dev/null
+++ b/driver/xf86-input-mouse/configure
@@ -0,0 +1,21799 @@
+#! /bin/sh
+# Guess values for system-dependent variables and create Makefiles.
+# Generated by GNU Autoconf 2.59 for xf86-input-mouse 1.1.2.
+#
+# Report bugs to <https://bugs.freedesktop.org/enter_bug.cgi?product=xorg>.
+#
+# Copyright (C) 2003 Free Software Foundation, Inc.
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+## --------------------- ##
+## M4sh Initialization. ##
+## --------------------- ##
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then
+ set -o posix
+fi
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# Support unset when possible.
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+ as_unset=unset
+else
+ as_unset=false
+fi
+
+
+# Work around bugs in pre-3.0 UWIN ksh.
+$as_unset ENV MAIL MAILPATH
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+for as_var in \
+ LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \
+ LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \
+ LC_TELEPHONE LC_TIME
+do
+ if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then
+ eval $as_var=C; export $as_var
+ else
+ $as_unset $as_var
+ fi
+done
+
+# Required to use basename.
+if expr a : '\(a\)' >/dev/null 2>&1; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+
+# Name of the executable.
+as_me=`$as_basename "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)$' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; }
+ /^X\/\(\/\/\)$/{ s//\1/; q; }
+ /^X\/\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+
+
+# PATH needs CR, and LINENO needs CR and PATH.
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ echo "#! /bin/sh" >conf$$.sh
+ echo "exit 0" >>conf$$.sh
+ chmod +x conf$$.sh
+ if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then
+ PATH_SEPARATOR=';'
+ else
+ PATH_SEPARATOR=:
+ fi
+ rm -f conf$$.sh
+fi
+
+
+ as_lineno_1=$LINENO
+ as_lineno_2=$LINENO
+ as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null`
+ test "x$as_lineno_1" != "x$as_lineno_2" &&
+ test "x$as_lineno_3" = "x$as_lineno_2" || {
+ # Find who we are. Look in the path if we contain no path at all
+ # relative or not.
+ case $0 in
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+done
+
+ ;;
+ esac
+ # We did not find ourselves, most probably we were run as `sh COMMAND'
+ # in which case we are not to be found in the path.
+ if test "x$as_myself" = x; then
+ as_myself=$0
+ fi
+ if test ! -f "$as_myself"; then
+ { echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2
+ { (exit 1); exit 1; }; }
+ fi
+ case $CONFIG_SHELL in
+ '')
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for as_base in sh bash ksh sh5; do
+ case $as_dir in
+ /*)
+ if ("$as_dir/$as_base" -c '
+ as_lineno_1=$LINENO
+ as_lineno_2=$LINENO
+ as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null`
+ test "x$as_lineno_1" != "x$as_lineno_2" &&
+ test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then
+ $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; }
+ $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; }
+ CONFIG_SHELL=$as_dir/$as_base
+ export CONFIG_SHELL
+ exec "$CONFIG_SHELL" "$0" ${1+"$@"}
+ fi;;
+ esac
+ done
+done
+;;
+ esac
+
+ # Create $as_me.lineno as a copy of $as_myself, but with $LINENO
+ # uniformly replaced by the line number. The first 'sed' inserts a
+ # line-number line before each line; the second 'sed' does the real
+ # work. The second script uses 'N' to pair each line-number line
+ # with the numbered line, and appends trailing '-' during
+ # substitution so that $LINENO is not a special case at line end.
+ # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the
+ # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-)
+ sed '=' <$as_myself |
+ sed '
+ N
+ s,$,-,
+ : loop
+ s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3,
+ t loop
+ s,-$,,
+ s,^['$as_cr_digits']*\n,,
+ ' >$as_me.lineno &&
+ chmod +x $as_me.lineno ||
+ { echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2
+ { (exit 1); exit 1; }; }
+
+ # Don't try to exec as it changes $[0], causing all sort of problems
+ # (the dirname of $[0] is not the place where we might find the
+ # original and so on. Autoconf is especially sensible to this).
+ . ./$as_me.lineno
+ # Exit status is that of the last command.
+ exit
+}
+
+
+case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in
+ *c*,-n*) ECHO_N= ECHO_C='
+' ECHO_T=' ' ;;
+ *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;;
+ *) ECHO_N= ECHO_C='\c' ECHO_T= ;;
+esac
+
+if expr a : '\(a\)' >/dev/null 2>&1; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+rm -f conf$$ conf$$.exe conf$$.file
+echo >conf$$.file
+if ln -s conf$$.file conf$$ 2>/dev/null; then
+ # We could just check for DJGPP; but this test a) works b) is more generic
+ # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04).
+ if test -f conf$$.exe; then
+ # Don't use ln at all; we don't have any links
+ as_ln_s='cp -p'
+ else
+ as_ln_s='ln -s'
+ fi
+elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+else
+ as_ln_s='cp -p'
+fi
+rm -f conf$$ conf$$.exe conf$$.file
+
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p=:
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+as_executable_p="test -f"
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+# IFS
+# We need space, tab and new line, in precisely that order.
+as_nl='
+'
+IFS=" $as_nl"
+
+# CDPATH.
+$as_unset CDPATH
+
+
+
+# Check that we are running under the correct shell.
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+case X$ECHO in
+X*--fallback-echo)
+ # Remove one level of quotation (which was required for Make).
+ ECHO=`echo "$ECHO" | sed 's,\\\\\$\\$0,'$0','`
+ ;;
+esac
+
+echo=${ECHO-echo}
+if test "X$1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X$1" = X--fallback-echo; then
+ # Avoid inline document here, it may be left over
+ :
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t' ; then
+ # Yippee, $echo works!
+ :
+else
+ # Restart under the correct shell.
+ exec $SHELL "$0" --no-reexec ${1+"$@"}
+fi
+
+if test "X$1" = X--fallback-echo; then
+ # used as fallback echo
+ shift
+ cat <<EOF
+$*
+EOF
+ exit 0
+fi
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+if test -z "$ECHO"; then
+if test "X${echo_test_string+set}" != Xset; then
+# find a string as large as possible, as long as the shell can cope with it
+ for cmd in 'sed 50q "$0"' 'sed 20q "$0"' 'sed 10q "$0"' 'sed 2q "$0"' 'echo test'; do
+ # expected sizes: less than 2Kb, 1Kb, 512 bytes, 16 bytes, ...
+ if (echo_test_string=`eval $cmd`) 2>/dev/null &&
+ echo_test_string=`eval $cmd` &&
+ (test "X$echo_test_string" = "X$echo_test_string") 2>/dev/null
+ then
+ break
+ fi
+ done
+fi
+
+if test "X`($echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ :
+else
+ # The Solaris, AIX, and Digital Unix default echo programs unquote
+ # backslashes. This makes it impossible to quote backslashes using
+ # echo "$something" | sed 's/\\/\\\\/g'
+ #
+ # So, first we look for a working echo in the user's PATH.
+
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for dir in $PATH /usr/ucb; do
+ IFS="$lt_save_ifs"
+ if (test -f $dir/echo || test -f $dir/echo$ac_exeext) &&
+ test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($dir/echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ echo="$dir/echo"
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+
+ if test "X$echo" = Xecho; then
+ # We didn't find a better echo, so look for alternatives.
+ if test "X`(print -r '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`(print -r "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ # This shell has a builtin print -r that does the trick.
+ echo='print -r'
+ elif (test -f /bin/ksh || test -f /bin/ksh$ac_exeext) &&
+ test "X$CONFIG_SHELL" != X/bin/ksh; then
+ # If we have ksh, try running configure again with it.
+ ORIGINAL_CONFIG_SHELL=${CONFIG_SHELL-/bin/sh}
+ export ORIGINAL_CONFIG_SHELL
+ CONFIG_SHELL=/bin/ksh
+ export CONFIG_SHELL
+ exec $CONFIG_SHELL "$0" --no-reexec ${1+"$@"}
+ else
+ # Try using printf.
+ echo='printf %s\n'
+ if test "X`($echo '\t') 2>/dev/null`" = 'X\t' &&
+ echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ # Cool, printf works
+ :
+ elif echo_testing_string=`($ORIGINAL_CONFIG_SHELL "$0" --fallback-echo '\t') 2>/dev/null` &&
+ test "X$echo_testing_string" = 'X\t' &&
+ echo_testing_string=`($ORIGINAL_CONFIG_SHELL "$0" --fallback-echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ CONFIG_SHELL=$ORIGINAL_CONFIG_SHELL
+ export CONFIG_SHELL
+ SHELL="$CONFIG_SHELL"
+ export SHELL
+ echo="$CONFIG_SHELL $0 --fallback-echo"
+ elif echo_testing_string=`($CONFIG_SHELL "$0" --fallback-echo '\t') 2>/dev/null` &&
+ test "X$echo_testing_string" = 'X\t' &&
+ echo_testing_string=`($CONFIG_SHELL "$0" --fallback-echo "$echo_test_string") 2>/dev/null` &&
+ test "X$echo_testing_string" = "X$echo_test_string"; then
+ echo="$CONFIG_SHELL $0 --fallback-echo"
+ else
+ # maybe with a smaller string...
+ prev=:
+
+ for cmd in 'echo test' 'sed 2q "$0"' 'sed 10q "$0"' 'sed 20q "$0"' 'sed 50q "$0"'; do
+ if (test "X$echo_test_string" = "X`eval $cmd`") 2>/dev/null
+ then
+ break
+ fi
+ prev="$cmd"
+ done
+
+ if test "$prev" != 'sed 50q "$0"'; then
+ echo_test_string=`eval $prev`
+ export echo_test_string
+ exec ${ORIGINAL_CONFIG_SHELL-${CONFIG_SHELL-/bin/sh}} "$0" ${1+"$@"}
+ else
+ # Oops. We lost completely, so just stick with echo.
+ echo=echo
+ fi
+ fi
+ fi
+ fi
+fi
+fi
+
+# Copy echo and quote the copy suitably for passing to libtool from
+# the Makefile, instead of quoting the original, which is used later.
+ECHO=$echo
+if test "X$ECHO" = "X$CONFIG_SHELL $0 --fallback-echo"; then
+ ECHO="$CONFIG_SHELL \\\$\$0 --fallback-echo"
+fi
+
+
+
+
+tagnames=${tagnames+${tagnames},}CXX
+
+tagnames=${tagnames+${tagnames},}F77
+
+# Name of the host.
+# hostname on some systems (SVR3.2, Linux) returns a bogus exit status,
+# so uname gets run too.
+ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q`
+
+exec 6>&1
+
+#
+# Initializations.
+#
+ac_default_prefix=/usr/local
+ac_config_libobj_dir=.
+cross_compiling=no
+subdirs=
+MFLAGS=
+MAKEFLAGS=
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+# Maximum number of lines to put in a shell here document.
+# This variable seems obsolete. It should probably be removed, and
+# only ac_max_sed_lines should be used.
+: ${ac_max_here_lines=38}
+
+# Identity of this package.
+PACKAGE_NAME='xf86-input-mouse'
+PACKAGE_TARNAME='xf86-input-mouse'
+PACKAGE_VERSION='1.1.2'
+PACKAGE_STRING='xf86-input-mouse 1.1.2'
+PACKAGE_BUGREPORT='https://bugs.freedesktop.org/enter_bug.cgi?product=xorg'
+
+ac_unique_file="Makefile.am"
+# Factoring default headers for most tests.
+ac_includes_default="\
+#include <stdio.h>
+#if HAVE_SYS_TYPES_H
+# include <sys/types.h>
+#endif
+#if HAVE_SYS_STAT_H
+# include <sys/stat.h>
+#endif
+#if STDC_HEADERS
+# include <stdlib.h>
+# include <stddef.h>
+#else
+# if HAVE_STDLIB_H
+# include <stdlib.h>
+# endif
+#endif
+#if HAVE_STRING_H
+# if !STDC_HEADERS && HAVE_MEMORY_H
+# include <memory.h>
+# endif
+# include <string.h>
+#endif
+#if HAVE_STRINGS_H
+# include <strings.h>
+#endif
+#if HAVE_INTTYPES_H
+# include <inttypes.h>
+#else
+# if HAVE_STDINT_H
+# include <stdint.h>
+# endif
+#endif
+#if HAVE_UNISTD_H
+# include <unistd.h>
+#endif"
+
+ac_subst_vars='SHELL PATH_SEPARATOR PACKAGE_NAME PACKAGE_TARNAME PACKAGE_VERSION PACKAGE_STRING PACKAGE_BUGREPORT exec_prefix prefix program_transform_name bindir sbindir libexecdir datadir sysconfdir sharedstatedir localstatedir libdir includedir oldincludedir infodir mandir build_alias host_alias target_alias DEFS ECHO_C ECHO_N ECHO_T LIBS INSTALL_PROGRAM INSTALL_SCRIPT INSTALL_DATA CYGPATH_W PACKAGE VERSION ACLOCAL AUTOCONF AUTOMAKE AUTOHEADER MAKEINFO install_sh STRIP ac_ct_STRIP INSTALL_STRIP_PROGRAM mkdir_p AWK SET_MAKE am__leading_dot AMTAR am__tar am__untar MAINTAINER_MODE_TRUE MAINTAINER_MODE_FALSE MAINT DRIVER_NAME build build_cpu build_vendor build_os host host_cpu host_vendor host_os CC CFLAGS LDFLAGS CPPFLAGS ac_ct_CC EXEEXT OBJEXT DEPDIR am__include am__quote AMDEP_TRUE AMDEP_FALSE AMDEPBACKSLASH CCDEPMODE am__fastdepCC_TRUE am__fastdepCC_FALSE SED EGREP LN_S ECHO AR ac_ct_AR RANLIB ac_ct_RANLIB CPP CXX CXXFLAGS ac_ct_CXX CXXDEPMODE am__fastdepCXX_TRUE am__fastdepCXX_FALSE CXXCPP F77 FFLAGS ac_ct_F77 LIBTOOL inputdir PKG_CONFIG ac_pt_PKG_CONFIG XORG_CFLAGS XORG_LIBS APP_MAN_SUFFIX LIB_MAN_SUFFIX FILE_MAN_SUFFIX MISC_MAN_SUFFIX DRIVER_MAN_SUFFIX ADMIN_MAN_SUFFIX APP_MAN_DIR LIB_MAN_DIR FILE_MAN_DIR MISC_MAN_DIR DRIVER_MAN_DIR ADMIN_MAN_DIR LINUXDOC PS2PDF BUILD_LINUXDOC_TRUE BUILD_LINUXDOC_FALSE BUILD_PDFDOC_TRUE BUILD_PDFDOC_FALSE MAKE_TEXT MAKE_PS MAKE_PDF MAKE_HTML LIBOBJS LTLIBOBJS'
+ac_subst_files=''
+
+# Initialize some variables set by options.
+ac_init_help=
+ac_init_version=false
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+cache_file=/dev/null
+exec_prefix=NONE
+no_create=
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Installation directory options.
+# These are left unexpanded so users can "make install exec_prefix=/foo"
+# and all the variables that are supposed to be based on exec_prefix
+# by default will actually change.
+# Use braces instead of parens because sh, perl, etc. also accept them.
+bindir='${exec_prefix}/bin'
+sbindir='${exec_prefix}/sbin'
+libexecdir='${exec_prefix}/libexec'
+datadir='${prefix}/share'
+sysconfdir='${prefix}/etc'
+sharedstatedir='${prefix}/com'
+localstatedir='${prefix}/var'
+libdir='${exec_prefix}/lib'
+includedir='${prefix}/include'
+oldincludedir='/usr/include'
+infodir='${prefix}/info'
+mandir='${prefix}/man'
+
+ac_prev=
+for ac_option
+do
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval "$ac_prev=\$ac_option"
+ ac_prev=
+ continue
+ fi
+
+ ac_optarg=`expr "x$ac_option" : 'x[^=]*=\(.*\)'`
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case $ac_option in
+
+ -bindir | --bindir | --bindi | --bind | --bin | --bi)
+ ac_prev=bindir ;;
+ -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*)
+ bindir=$ac_optarg ;;
+
+ -build | --build | --buil | --bui | --bu)
+ ac_prev=build_alias ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=*)
+ build_alias=$ac_optarg ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file=$ac_optarg ;;
+
+ --config-cache | -C)
+ cache_file=config.cache ;;
+
+ -datadir | --datadir | --datadi | --datad | --data | --dat | --da)
+ ac_prev=datadir ;;
+ -datadir=* | --datadir=* | --datadi=* | --datad=* | --data=* | --dat=* \
+ | --da=*)
+ datadir=$ac_optarg ;;
+
+ -disable-* | --disable-*)
+ ac_feature=`expr "x$ac_option" : 'x-*disable-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null &&
+ { echo "$as_me: error: invalid feature name: $ac_feature" >&2
+ { (exit 1); exit 1; }; }
+ ac_feature=`echo $ac_feature | sed 's/-/_/g'`
+ eval "enable_$ac_feature=no" ;;
+
+ -enable-* | --enable-*)
+ ac_feature=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null &&
+ { echo "$as_me: error: invalid feature name: $ac_feature" >&2
+ { (exit 1); exit 1; }; }
+ ac_feature=`echo $ac_feature | sed 's/-/_/g'`
+ case $ac_option in
+ *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "enable_$ac_feature='$ac_optarg'" ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix=$ac_optarg ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he | -h)
+ ac_init_help=long ;;
+ -help=r* | --help=r* | --hel=r* | --he=r* | -hr*)
+ ac_init_help=recursive ;;
+ -help=s* | --help=s* | --hel=s* | --he=s* | -hs*)
+ ac_init_help=short ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host_alias ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host_alias=$ac_optarg ;;
+
+ -includedir | --includedir | --includedi | --included | --include \
+ | --includ | --inclu | --incl | --inc)
+ ac_prev=includedir ;;
+ -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \
+ | --includ=* | --inclu=* | --incl=* | --inc=*)
+ includedir=$ac_optarg ;;
+
+ -infodir | --infodir | --infodi | --infod | --info | --inf)
+ ac_prev=infodir ;;
+ -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*)
+ infodir=$ac_optarg ;;
+
+ -libdir | --libdir | --libdi | --libd)
+ ac_prev=libdir ;;
+ -libdir=* | --libdir=* | --libdi=* | --libd=*)
+ libdir=$ac_optarg ;;
+
+ -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \
+ | --libexe | --libex | --libe)
+ ac_prev=libexecdir ;;
+ -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \
+ | --libexe=* | --libex=* | --libe=*)
+ libexecdir=$ac_optarg ;;
+
+ -localstatedir | --localstatedir | --localstatedi | --localstated \
+ | --localstate | --localstat | --localsta | --localst \
+ | --locals | --local | --loca | --loc | --lo)
+ ac_prev=localstatedir ;;
+ -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \
+ | --localstate=* | --localstat=* | --localsta=* | --localst=* \
+ | --locals=* | --local=* | --loca=* | --loc=* | --lo=*)
+ localstatedir=$ac_optarg ;;
+
+ -mandir | --mandir | --mandi | --mand | --man | --ma | --m)
+ ac_prev=mandir ;;
+ -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*)
+ mandir=$ac_optarg ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c | -n)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \
+ | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \
+ | --oldin | --oldi | --old | --ol | --o)
+ ac_prev=oldincludedir ;;
+ -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \
+ | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \
+ | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*)
+ oldincludedir=$ac_optarg ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix=$ac_optarg ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix=$ac_optarg ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix=$ac_optarg ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name=$ac_optarg ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb)
+ ac_prev=sbindir ;;
+ -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \
+ | --sbi=* | --sb=*)
+ sbindir=$ac_optarg ;;
+
+ -sharedstatedir | --sharedstatedir | --sharedstatedi \
+ | --sharedstated | --sharedstate | --sharedstat | --sharedsta \
+ | --sharedst | --shareds | --shared | --share | --shar \
+ | --sha | --sh)
+ ac_prev=sharedstatedir ;;
+ -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \
+ | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \
+ | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \
+ | --sha=* | --sh=*)
+ sharedstatedir=$ac_optarg ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site=$ac_optarg ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir=$ac_optarg ;;
+
+ -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \
+ | --syscon | --sysco | --sysc | --sys | --sy)
+ ac_prev=sysconfdir ;;
+ -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \
+ | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*)
+ sysconfdir=$ac_optarg ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target_alias ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target_alias=$ac_optarg ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers | -V)
+ ac_init_version=: ;;
+
+ -with-* | --with-*)
+ ac_package=`expr "x$ac_option" : 'x-*with-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null &&
+ { echo "$as_me: error: invalid package name: $ac_package" >&2
+ { (exit 1); exit 1; }; }
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ case $ac_option in
+ *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "with_$ac_package='$ac_optarg'" ;;
+
+ -without-* | --without-*)
+ ac_package=`expr "x$ac_option" : 'x-*without-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null &&
+ { echo "$as_me: error: invalid package name: $ac_package" >&2
+ { (exit 1); exit 1; }; }
+ ac_package=`echo $ac_package | sed 's/-/_/g'`
+ eval "with_$ac_package=no" ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes=$ac_optarg ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries=$ac_optarg ;;
+
+ -*) { echo "$as_me: error: unrecognized option: $ac_option
+Try \`$0 --help' for more information." >&2
+ { (exit 1); exit 1; }; }
+ ;;
+
+ *=*)
+ ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_envvar" : ".*[^_$as_cr_alnum]" >/dev/null &&
+ { echo "$as_me: error: invalid variable name: $ac_envvar" >&2
+ { (exit 1); exit 1; }; }
+ ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`
+ eval "$ac_envvar='$ac_optarg'"
+ export $ac_envvar ;;
+
+ *)
+ # FIXME: should be removed in autoconf 3.0.
+ echo "$as_me: WARNING: you should use --build, --host, --target" >&2
+ expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null &&
+ echo "$as_me: WARNING: invalid host type: $ac_option" >&2
+ : ${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option}
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ ac_option=--`echo $ac_prev | sed 's/_/-/g'`
+ { echo "$as_me: error: missing argument to $ac_option" >&2
+ { (exit 1); exit 1; }; }
+fi
+
+# Be sure to have absolute paths.
+for ac_var in exec_prefix prefix
+do
+ eval ac_val=$`echo $ac_var`
+ case $ac_val in
+ [\\/$]* | ?:[\\/]* | NONE | '' ) ;;
+ *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2
+ { (exit 1); exit 1; }; };;
+ esac
+done
+
+# Be sure to have absolute paths.
+for ac_var in bindir sbindir libexecdir datadir sysconfdir sharedstatedir \
+ localstatedir libdir includedir oldincludedir infodir mandir
+do
+ eval ac_val=$`echo $ac_var`
+ case $ac_val in
+ [\\/$]* | ?:[\\/]* ) ;;
+ *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2
+ { (exit 1); exit 1; }; };;
+ esac
+done
+
+# There might be people who depend on the old broken behavior: `$host'
+# used to hold the argument of --host etc.
+# FIXME: To remove some day.
+build=$build_alias
+host=$host_alias
+target=$target_alias
+
+# FIXME: To remove some day.
+if test "x$host_alias" != x; then
+ if test "x$build_alias" = x; then
+ cross_compiling=maybe
+ echo "$as_me: WARNING: If you wanted to set the --build type, don't use --host.
+ If a cross compiler is detected then cross compile mode will be used." >&2
+ elif test "x$build_alias" != "x$host_alias"; then
+ cross_compiling=yes
+ fi
+fi
+
+ac_tool_prefix=
+test -n "$host_alias" && ac_tool_prefix=$host_alias-
+
+test "$silent" = yes && exec 6>/dev/null
+
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then its parent.
+ ac_confdir=`(dirname "$0") 2>/dev/null ||
+$as_expr X"$0" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$0" : 'X\(//\)[^/]' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$0" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ srcdir=$ac_confdir
+ if test ! -r $srcdir/$ac_unique_file; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r $srcdir/$ac_unique_file; then
+ if test "$ac_srcdir_defaulted" = yes; then
+ { echo "$as_me: error: cannot find sources ($ac_unique_file) in $ac_confdir or .." >&2
+ { (exit 1); exit 1; }; }
+ else
+ { echo "$as_me: error: cannot find sources ($ac_unique_file) in $srcdir" >&2
+ { (exit 1); exit 1; }; }
+ fi
+fi
+(cd $srcdir && test -r ./$ac_unique_file) 2>/dev/null ||
+ { echo "$as_me: error: sources are in $srcdir, but \`cd $srcdir' does not work" >&2
+ { (exit 1); exit 1; }; }
+srcdir=`echo "$srcdir" | sed 's%\([^\\/]\)[\\/]*$%\1%'`
+ac_env_build_alias_set=${build_alias+set}
+ac_env_build_alias_value=$build_alias
+ac_cv_env_build_alias_set=${build_alias+set}
+ac_cv_env_build_alias_value=$build_alias
+ac_env_host_alias_set=${host_alias+set}
+ac_env_host_alias_value=$host_alias
+ac_cv_env_host_alias_set=${host_alias+set}
+ac_cv_env_host_alias_value=$host_alias
+ac_env_target_alias_set=${target_alias+set}
+ac_env_target_alias_value=$target_alias
+ac_cv_env_target_alias_set=${target_alias+set}
+ac_cv_env_target_alias_value=$target_alias
+ac_env_CC_set=${CC+set}
+ac_env_CC_value=$CC
+ac_cv_env_CC_set=${CC+set}
+ac_cv_env_CC_value=$CC
+ac_env_CFLAGS_set=${CFLAGS+set}
+ac_env_CFLAGS_value=$CFLAGS
+ac_cv_env_CFLAGS_set=${CFLAGS+set}
+ac_cv_env_CFLAGS_value=$CFLAGS
+ac_env_LDFLAGS_set=${LDFLAGS+set}
+ac_env_LDFLAGS_value=$LDFLAGS
+ac_cv_env_LDFLAGS_set=${LDFLAGS+set}
+ac_cv_env_LDFLAGS_value=$LDFLAGS
+ac_env_CPPFLAGS_set=${CPPFLAGS+set}
+ac_env_CPPFLAGS_value=$CPPFLAGS
+ac_cv_env_CPPFLAGS_set=${CPPFLAGS+set}
+ac_cv_env_CPPFLAGS_value=$CPPFLAGS
+ac_env_CPP_set=${CPP+set}
+ac_env_CPP_value=$CPP
+ac_cv_env_CPP_set=${CPP+set}
+ac_cv_env_CPP_value=$CPP
+ac_env_CXX_set=${CXX+set}
+ac_env_CXX_value=$CXX
+ac_cv_env_CXX_set=${CXX+set}
+ac_cv_env_CXX_value=$CXX
+ac_env_CXXFLAGS_set=${CXXFLAGS+set}
+ac_env_CXXFLAGS_value=$CXXFLAGS
+ac_cv_env_CXXFLAGS_set=${CXXFLAGS+set}
+ac_cv_env_CXXFLAGS_value=$CXXFLAGS
+ac_env_CXXCPP_set=${CXXCPP+set}
+ac_env_CXXCPP_value=$CXXCPP
+ac_cv_env_CXXCPP_set=${CXXCPP+set}
+ac_cv_env_CXXCPP_value=$CXXCPP
+ac_env_F77_set=${F77+set}
+ac_env_F77_value=$F77
+ac_cv_env_F77_set=${F77+set}
+ac_cv_env_F77_value=$F77
+ac_env_FFLAGS_set=${FFLAGS+set}
+ac_env_FFLAGS_value=$FFLAGS
+ac_cv_env_FFLAGS_set=${FFLAGS+set}
+ac_cv_env_FFLAGS_value=$FFLAGS
+ac_env_PKG_CONFIG_set=${PKG_CONFIG+set}
+ac_env_PKG_CONFIG_value=$PKG_CONFIG
+ac_cv_env_PKG_CONFIG_set=${PKG_CONFIG+set}
+ac_cv_env_PKG_CONFIG_value=$PKG_CONFIG
+ac_env_XORG_CFLAGS_set=${XORG_CFLAGS+set}
+ac_env_XORG_CFLAGS_value=$XORG_CFLAGS
+ac_cv_env_XORG_CFLAGS_set=${XORG_CFLAGS+set}
+ac_cv_env_XORG_CFLAGS_value=$XORG_CFLAGS
+ac_env_XORG_LIBS_set=${XORG_LIBS+set}
+ac_env_XORG_LIBS_value=$XORG_LIBS
+ac_cv_env_XORG_LIBS_set=${XORG_LIBS+set}
+ac_cv_env_XORG_LIBS_value=$XORG_LIBS
+
+#
+# Report the --help message.
+#
+if test "$ac_init_help" = "long"; then
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat <<_ACEOF
+\`configure' configures xf86-input-mouse 1.1.2 to adapt to many kinds of systems.
+
+Usage: $0 [OPTION]... [VAR=VALUE]...
+
+To assign environment variables (e.g., CC, CFLAGS...), specify them as
+VAR=VALUE. See below for descriptions of some of the useful variables.
+
+Defaults for the options are specified in brackets.
+
+Configuration:
+ -h, --help display this help and exit
+ --help=short display options specific to this package
+ --help=recursive display the short help of all the included packages
+ -V, --version display version information and exit
+ -q, --quiet, --silent do not print \`checking...' messages
+ --cache-file=FILE cache test results in FILE [disabled]
+ -C, --config-cache alias for \`--cache-file=config.cache'
+ -n, --no-create do not create output files
+ --srcdir=DIR find the sources in DIR [configure dir or \`..']
+
+_ACEOF
+
+ cat <<_ACEOF
+Installation directories:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX
+ [PREFIX]
+
+By default, \`make install' will install all the files in
+\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify
+an installation prefix other than \`$ac_default_prefix' using \`--prefix',
+for instance \`--prefix=\$HOME'.
+
+For better control, use the options below.
+
+Fine tuning of the installation directories:
+ --bindir=DIR user executables [EPREFIX/bin]
+ --sbindir=DIR system admin executables [EPREFIX/sbin]
+ --libexecdir=DIR program executables [EPREFIX/libexec]
+ --datadir=DIR read-only architecture-independent data [PREFIX/share]
+ --sysconfdir=DIR read-only single-machine data [PREFIX/etc]
+ --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com]
+ --localstatedir=DIR modifiable single-machine data [PREFIX/var]
+ --libdir=DIR object code libraries [EPREFIX/lib]
+ --includedir=DIR C header files [PREFIX/include]
+ --oldincludedir=DIR C header files for non-gcc [/usr/include]
+ --infodir=DIR info documentation [PREFIX/info]
+ --mandir=DIR man documentation [PREFIX/man]
+_ACEOF
+
+ cat <<\_ACEOF
+
+Program names:
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM run sed PROGRAM on installed program names
+
+System types:
+ --build=BUILD configure for building on BUILD [guessed]
+ --host=HOST cross-compile to build programs to run on HOST [BUILD]
+_ACEOF
+fi
+
+if test -n "$ac_init_help"; then
+ case $ac_init_help in
+ short | recursive ) echo "Configuration of xf86-input-mouse 1.1.2:";;
+ esac
+ cat <<\_ACEOF
+
+Optional Features:
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --enable-maintainer-mode enable make rules and dependencies not useful
+ (and sometimes confusing) to the casual installer
+ --enable-static[=PKGS]
+ build static libraries [default=no]
+ --enable-shared[=PKGS]
+ build shared libraries [default=yes]
+ --enable-fast-install[=PKGS]
+ optimize for fast installation [default=yes]
+ --disable-dependency-tracking speeds up one-time build
+ --enable-dependency-tracking do not reject slow dependency extractors
+ --disable-libtool-lock avoid locking (might break parallel builds)
+
+Optional Packages:
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --with-gnu-ld assume the C compiler uses GNU ld [default=no]
+ --with-pic try to use only PIC/non-PIC objects [default=use
+ both]
+ --with-tags[=TAGS]
+ include additional configurations [automatic]
+ --with-xorg-module-dir=DIR
+ Default xorg module directory
+ [default=$libdir/xorg/modules]
+ --with-release-version=STRING
+ Use release version string in package name
+
+Some influential environment variables:
+ CC C compiler command
+ CFLAGS C compiler flags
+ LDFLAGS linker flags, e.g. -L<lib dir> if you have libraries in a
+ nonstandard directory <lib dir>
+ CPPFLAGS C/C++ preprocessor flags, e.g. -I<include dir> if you have
+ headers in a nonstandard directory <include dir>
+ CPP C preprocessor
+ CXX C++ compiler command
+ CXXFLAGS C++ compiler flags
+ CXXCPP C++ preprocessor
+ F77 Fortran 77 compiler command
+ FFLAGS Fortran 77 compiler flags
+ PKG_CONFIG path to pkg-config utility
+ XORG_CFLAGS C compiler flags for XORG, overriding pkg-config
+ XORG_LIBS linker flags for XORG, overriding pkg-config
+
+Use these variables to override the choices made by `configure' or to help
+it to find libraries and programs with nonstandard names/locations.
+
+Report bugs to <https://bugs.freedesktop.org/enter_bug.cgi?product=xorg>.
+_ACEOF
+fi
+
+if test "$ac_init_help" = "recursive"; then
+ # If there are subdirs, report their specific --help.
+ ac_popdir=`pwd`
+ for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue
+ test -d $ac_dir || continue
+ ac_builddir=.
+
+if test "$ac_dir" != .; then
+ ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'`
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'`
+else
+ ac_dir_suffix= ac_top_builddir=
+fi
+
+case $srcdir in
+ .) # No --srcdir option. We are building in place.
+ ac_srcdir=.
+ if test -z "$ac_top_builddir"; then
+ ac_top_srcdir=.
+ else
+ ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'`
+ fi ;;
+ [\\/]* | ?:[\\/]* ) # Absolute path.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir ;;
+ *) # Relative path.
+ ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_builddir$srcdir ;;
+esac
+
+# Do not use `cd foo && pwd` to compute absolute paths, because
+# the directories may not exist.
+case `pwd` in
+.) ac_abs_builddir="$ac_dir";;
+*)
+ case "$ac_dir" in
+ .) ac_abs_builddir=`pwd`;;
+ [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";;
+ *) ac_abs_builddir=`pwd`/"$ac_dir";;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_builddir=${ac_top_builddir}.;;
+*)
+ case ${ac_top_builddir}. in
+ .) ac_abs_top_builddir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;;
+ *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_srcdir=$ac_srcdir;;
+*)
+ case $ac_srcdir in
+ .) ac_abs_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;;
+ *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_srcdir=$ac_top_srcdir;;
+*)
+ case $ac_top_srcdir in
+ .) ac_abs_top_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;;
+ *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;;
+ esac;;
+esac
+
+ cd $ac_dir
+ # Check for guested configure; otherwise get Cygnus style configure.
+ if test -f $ac_srcdir/configure.gnu; then
+ echo
+ $SHELL $ac_srcdir/configure.gnu --help=recursive
+ elif test -f $ac_srcdir/configure; then
+ echo
+ $SHELL $ac_srcdir/configure --help=recursive
+ elif test -f $ac_srcdir/configure.ac ||
+ test -f $ac_srcdir/configure.in; then
+ echo
+ $ac_configure --help
+ else
+ echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2
+ fi
+ cd $ac_popdir
+ done
+fi
+
+test -n "$ac_init_help" && exit 0
+if $ac_init_version; then
+ cat <<\_ACEOF
+xf86-input-mouse configure 1.1.2
+generated by GNU Autoconf 2.59
+
+Copyright (C) 2003 Free Software Foundation, Inc.
+This configure script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it.
+_ACEOF
+ exit 0
+fi
+exec 5>config.log
+cat >&5 <<_ACEOF
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+
+It was created by xf86-input-mouse $as_me 1.1.2, which was
+generated by GNU Autoconf 2.59. Invocation command line was
+
+ $ $0 $@
+
+_ACEOF
+{
+cat <<_ASUNAME
+## --------- ##
+## Platform. ##
+## --------- ##
+
+hostname = `(hostname || uname -n) 2>/dev/null | sed 1q`
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown`
+
+/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown`
+hostinfo = `(hostinfo) 2>/dev/null || echo unknown`
+/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown`
+/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown`
+
+_ASUNAME
+
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ echo "PATH: $as_dir"
+done
+
+} >&5
+
+cat >&5 <<_ACEOF
+
+
+## ----------- ##
+## Core tests. ##
+## ----------- ##
+
+_ACEOF
+
+
+# Keep a trace of the command line.
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Strip out --silent because we don't want to record it for future runs.
+# Also quote any args containing shell meta-characters.
+# Make two passes to allow for proper duplicate-argument suppression.
+ac_configure_args=
+ac_configure_args0=
+ac_configure_args1=
+ac_sep=
+ac_must_keep_next=false
+for ac_pass in 1 2
+do
+ for ac_arg
+ do
+ case $ac_arg in
+ -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ continue ;;
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*)
+ ac_arg=`echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ esac
+ case $ac_pass in
+ 1) ac_configure_args0="$ac_configure_args0 '$ac_arg'" ;;
+ 2)
+ ac_configure_args1="$ac_configure_args1 '$ac_arg'"
+ if test $ac_must_keep_next = true; then
+ ac_must_keep_next=false # Got value, back to normal.
+ else
+ case $ac_arg in
+ *=* | --config-cache | -C | -disable-* | --disable-* \
+ | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \
+ | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \
+ | -with-* | --with-* | -without-* | --without-* | --x)
+ case "$ac_configure_args0 " in
+ "$ac_configure_args1"*" '$ac_arg' "* ) continue ;;
+ esac
+ ;;
+ -* ) ac_must_keep_next=true ;;
+ esac
+ fi
+ ac_configure_args="$ac_configure_args$ac_sep'$ac_arg'"
+ # Get rid of the leading space.
+ ac_sep=" "
+ ;;
+ esac
+ done
+done
+$as_unset ac_configure_args0 || test "${ac_configure_args0+set}" != set || { ac_configure_args0=; export ac_configure_args0; }
+$as_unset ac_configure_args1 || test "${ac_configure_args1+set}" != set || { ac_configure_args1=; export ac_configure_args1; }
+
+# When interrupted or exit'd, cleanup temporary files, and complete
+# config.log. We remove comments because anyway the quotes in there
+# would cause problems or look ugly.
+# WARNING: Be sure not to use single quotes in there, as some shells,
+# such as our DU 5.0 friend, will then `close' the trap.
+trap 'exit_status=$?
+ # Save into config.log some information that might help in debugging.
+ {
+ echo
+
+ cat <<\_ASBOX
+## ---------------- ##
+## Cache variables. ##
+## ---------------- ##
+_ASBOX
+ echo
+ # The following way of writing the cache mishandles newlines in values,
+{
+ (set) 2>&1 |
+ case `(ac_space='"'"' '"'"'; set | grep ac_space) 2>&1` in
+ *ac_space=\ *)
+ sed -n \
+ "s/'"'"'/'"'"'\\\\'"'"''"'"'/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='"'"'\\2'"'"'/p"
+ ;;
+ *)
+ sed -n \
+ "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p"
+ ;;
+ esac;
+}
+ echo
+
+ cat <<\_ASBOX
+## ----------------- ##
+## Output variables. ##
+## ----------------- ##
+_ASBOX
+ echo
+ for ac_var in $ac_subst_vars
+ do
+ eval ac_val=$`echo $ac_var`
+ echo "$ac_var='"'"'$ac_val'"'"'"
+ done | sort
+ echo
+
+ if test -n "$ac_subst_files"; then
+ cat <<\_ASBOX
+## ------------- ##
+## Output files. ##
+## ------------- ##
+_ASBOX
+ echo
+ for ac_var in $ac_subst_files
+ do
+ eval ac_val=$`echo $ac_var`
+ echo "$ac_var='"'"'$ac_val'"'"'"
+ done | sort
+ echo
+ fi
+
+ if test -s confdefs.h; then
+ cat <<\_ASBOX
+## ----------- ##
+## confdefs.h. ##
+## ----------- ##
+_ASBOX
+ echo
+ sed "/^$/d" confdefs.h | sort
+ echo
+ fi
+ test "$ac_signal" != 0 &&
+ echo "$as_me: caught signal $ac_signal"
+ echo "$as_me: exit $exit_status"
+ } >&5
+ rm -f core *.core &&
+ rm -rf conftest* confdefs* conf$$* $ac_clean_files &&
+ exit $exit_status
+ ' 0
+for ac_signal in 1 2 13 15; do
+ trap 'ac_signal='$ac_signal'; { (exit 1); exit 1; }' $ac_signal
+done
+ac_signal=0
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -rf conftest* confdefs.h
+# AIX cpp loses on an empty file, so make sure it contains at least a newline.
+echo >confdefs.h
+
+# Predefined preprocessor variables.
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_NAME "$PACKAGE_NAME"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_TARNAME "$PACKAGE_TARNAME"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_VERSION "$PACKAGE_VERSION"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_STRING "$PACKAGE_STRING"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT"
+_ACEOF
+
+
+# Let the site file select an alternate cache file if it wants to.
+# Prefer explicitly selected file to automatically selected ones.
+if test -z "$CONFIG_SITE"; then
+ if test "x$prefix" != xNONE; then
+ CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site"
+ else
+ CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site"
+ fi
+fi
+for ac_site_file in $CONFIG_SITE; do
+ if test -r "$ac_site_file"; then
+ { echo "$as_me:$LINENO: loading site script $ac_site_file" >&5
+echo "$as_me: loading site script $ac_site_file" >&6;}
+ sed 's/^/| /' "$ac_site_file" >&5
+ . "$ac_site_file"
+ fi
+done
+
+if test -r "$cache_file"; then
+ # Some versions of bash will fail to source /dev/null (special
+ # files actually), so we avoid doing that.
+ if test -f "$cache_file"; then
+ { echo "$as_me:$LINENO: loading cache $cache_file" >&5
+echo "$as_me: loading cache $cache_file" >&6;}
+ case $cache_file in
+ [\\/]* | ?:[\\/]* ) . $cache_file;;
+ *) . ./$cache_file;;
+ esac
+ fi
+else
+ { echo "$as_me:$LINENO: creating cache $cache_file" >&5
+echo "$as_me: creating cache $cache_file" >&6;}
+ >$cache_file
+fi
+
+# Check that the precious variables saved in the cache have kept the same
+# value.
+ac_cache_corrupted=false
+for ac_var in `(set) 2>&1 |
+ sed -n 's/^ac_env_\([a-zA-Z_0-9]*\)_set=.*/\1/p'`; do
+ eval ac_old_set=\$ac_cv_env_${ac_var}_set
+ eval ac_new_set=\$ac_env_${ac_var}_set
+ eval ac_old_val="\$ac_cv_env_${ac_var}_value"
+ eval ac_new_val="\$ac_env_${ac_var}_value"
+ case $ac_old_set,$ac_new_set in
+ set,)
+ { echo "$as_me:$LINENO: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5
+echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,set)
+ { echo "$as_me:$LINENO: error: \`$ac_var' was not set in the previous run" >&5
+echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,);;
+ *)
+ if test "x$ac_old_val" != "x$ac_new_val"; then
+ { echo "$as_me:$LINENO: error: \`$ac_var' has changed since the previous run:" >&5
+echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;}
+ { echo "$as_me:$LINENO: former value: $ac_old_val" >&5
+echo "$as_me: former value: $ac_old_val" >&2;}
+ { echo "$as_me:$LINENO: current value: $ac_new_val" >&5
+echo "$as_me: current value: $ac_new_val" >&2;}
+ ac_cache_corrupted=:
+ fi;;
+ esac
+ # Pass precious variables to config.status.
+ if test "$ac_new_set" = set; then
+ case $ac_new_val in
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*)
+ ac_arg=$ac_var=`echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;;
+ *) ac_arg=$ac_var=$ac_new_val ;;
+ esac
+ case " $ac_configure_args " in
+ *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy.
+ *) ac_configure_args="$ac_configure_args '$ac_arg'" ;;
+ esac
+ fi
+done
+if $ac_cache_corrupted; then
+ { echo "$as_me:$LINENO: error: changes in the environment can compromise the build" >&5
+echo "$as_me: error: changes in the environment can compromise the build" >&2;}
+ { { echo "$as_me:$LINENO: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&5
+echo "$as_me: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ac_aux_dir=
+for ac_dir in . $srcdir/.; do
+ if test -f $ac_dir/install-sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install-sh -c"
+ break
+ elif test -f $ac_dir/install.sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install.sh -c"
+ break
+ elif test -f $ac_dir/shtool; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/shtool install -c"
+ break
+ fi
+done
+if test -z "$ac_aux_dir"; then
+ { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in . $srcdir/." >&5
+echo "$as_me: error: cannot find install-sh or install.sh in . $srcdir/." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+ac_config_guess="$SHELL $ac_aux_dir/config.guess"
+ac_config_sub="$SHELL $ac_aux_dir/config.sub"
+ac_configure="$SHELL $ac_aux_dir/configure" # This should be Cygnus configure.
+
+am__api_version="1.9"
+# Find a good install program. We prefer a C program (faster),
+# so one script is as good as another. But avoid the broken or
+# incompatible versions:
+# SysV /etc/install, /usr/sbin/install
+# SunOS /usr/etc/install
+# IRIX /sbin/install
+# AIX /bin/install
+# AmigaOS /C/install, which installs bootblocks on floppy discs
+# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag
+# AFS /usr/afsws/bin/install, which mishandles nonexistent args
+# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff"
+# OS/2's system install, which has a completely different semantic
+# ./install, which can be erroneously created by make from ./install.sh.
+echo "$as_me:$LINENO: checking for a BSD-compatible install" >&5
+echo $ECHO_N "checking for a BSD-compatible install... $ECHO_C" >&6
+if test -z "$INSTALL"; then
+if test "${ac_cv_path_install+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ # Account for people who put trailing slashes in PATH elements.
+case $as_dir/ in
+ ./ | .// | /cC/* | \
+ /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \
+ ?:\\/os2\\/install\\/* | ?:\\/OS2\\/INSTALL\\/* | \
+ /usr/ucb/* ) ;;
+ *)
+ # OSF1 and SCO ODT 3.0 have their own names for install.
+ # Don't use installbsd from OSF since it installs stuff as root
+ # by default.
+ for ac_prog in ginstall scoinst install; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then
+ if test $ac_prog = install &&
+ grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # AIX install. It has an incompatible calling convention.
+ :
+ elif test $ac_prog = install &&
+ grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # program-specific install script used by HP pwplus--don't use.
+ :
+ else
+ ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c"
+ break 3
+ fi
+ fi
+ done
+ done
+ ;;
+esac
+done
+
+
+fi
+ if test "${ac_cv_path_install+set}" = set; then
+ INSTALL=$ac_cv_path_install
+ else
+ # As a last resort, use the slow shell script. We don't cache a
+ # path for INSTALL within a source directory, because that will
+ # break other packages using the cache if that directory is
+ # removed, or if the path is relative.
+ INSTALL=$ac_install_sh
+ fi
+fi
+echo "$as_me:$LINENO: result: $INSTALL" >&5
+echo "${ECHO_T}$INSTALL" >&6
+
+# Use test -z because SunOS4 sh mishandles braces in ${var-val}.
+# It thinks the first close brace ends the variable substitution.
+test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}'
+
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}'
+
+test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644'
+
+echo "$as_me:$LINENO: checking whether build environment is sane" >&5
+echo $ECHO_N "checking whether build environment is sane... $ECHO_C" >&6
+# Just in case
+sleep 1
+echo timestamp > conftest.file
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null`
+ if test "$*" = "X"; then
+ # -L didn't work.
+ set X `ls -t $srcdir/configure conftest.file`
+ fi
+ rm -f conftest.file
+ if test "$*" != "X $srcdir/configure conftest.file" \
+ && test "$*" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ { { echo "$as_me:$LINENO: error: ls -t appears to fail. Make sure there is not a broken
+alias in your environment" >&5
+echo "$as_me: error: ls -t appears to fail. Make sure there is not a broken
+alias in your environment" >&2;}
+ { (exit 1); exit 1; }; }
+ fi
+
+ test "$2" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ { { echo "$as_me:$LINENO: error: newly created file is older than distributed files!
+Check your system clock" >&5
+echo "$as_me: error: newly created file is older than distributed files!
+Check your system clock" >&2;}
+ { (exit 1); exit 1; }; }
+fi
+echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+test "$program_prefix" != NONE &&
+ program_transform_name="s,^,$program_prefix,;$program_transform_name"
+# Use a double $ so make ignores it.
+test "$program_suffix" != NONE &&
+ program_transform_name="s,\$,$program_suffix,;$program_transform_name"
+# Double any \ or $. echo might interpret backslashes.
+# By default was `s,x,x', remove it if useless.
+cat <<\_ACEOF >conftest.sed
+s/[\\$]/&&/g;s/;s,x,x,$//
+_ACEOF
+program_transform_name=`echo $program_transform_name | sed -f conftest.sed`
+rm conftest.sed
+
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+
+test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing"
+# Use eval to expand $SHELL
+if eval "$MISSING --run true"; then
+ am_missing_run="$MISSING --run "
+else
+ am_missing_run=
+ { echo "$as_me:$LINENO: WARNING: \`missing' script is too old or missing" >&5
+echo "$as_me: WARNING: \`missing' script is too old or missing" >&2;}
+fi
+
+if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then
+ # We used to keeping the `.' as first argument, in order to
+ # allow $(mkdir_p) to be used without argument. As in
+ # $(mkdir_p) $(somedir)
+ # where $(somedir) is conditionally defined. However this is wrong
+ # for two reasons:
+ # 1. if the package is installed by a user who cannot write `.'
+ # make install will fail,
+ # 2. the above comment should most certainly read
+ # $(mkdir_p) $(DESTDIR)$(somedir)
+ # so it does not work when $(somedir) is undefined and
+ # $(DESTDIR) is not.
+ # To support the latter case, we have to write
+ # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir),
+ # so the `.' trick is pointless.
+ mkdir_p='mkdir -p --'
+else
+ # On NextStep and OpenStep, the `mkdir' command does not
+ # recognize any option. It will interpret all options as
+ # directories to create, and then abort because `.' already
+ # exists.
+ for d in ./-p ./--version;
+ do
+ test -d $d && rmdir $d
+ done
+ # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists.
+ if test -f "$ac_aux_dir/mkinstalldirs"; then
+ mkdir_p='$(mkinstalldirs)'
+ else
+ mkdir_p='$(install_sh) -d'
+ fi
+fi
+
+for ac_prog in gawk mawk nawk awk
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_AWK+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$AWK"; then
+ ac_cv_prog_AWK="$AWK" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AWK="$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+AWK=$ac_cv_prog_AWK
+if test -n "$AWK"; then
+ echo "$as_me:$LINENO: result: $AWK" >&5
+echo "${ECHO_T}$AWK" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$AWK" && break
+done
+
+echo "$as_me:$LINENO: checking whether ${MAKE-make} sets \$(MAKE)" >&5
+echo $ECHO_N "checking whether ${MAKE-make} sets \$(MAKE)... $ECHO_C" >&6
+set dummy ${MAKE-make}; ac_make=`echo "$2" | sed 'y,:./+-,___p_,'`
+if eval "test \"\${ac_cv_prog_make_${ac_make}_set+set}\" = set"; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.make <<\_ACEOF
+all:
+ @echo 'ac_maketemp="$(MAKE)"'
+_ACEOF
+# GNU make sometimes prints "make[1]: Entering...", which would confuse us.
+eval `${MAKE-make} -f conftest.make 2>/dev/null | grep temp=`
+if test -n "$ac_maketemp"; then
+ eval ac_cv_prog_make_${ac_make}_set=yes
+else
+ eval ac_cv_prog_make_${ac_make}_set=no
+fi
+rm -f conftest.make
+fi
+if eval "test \"`echo '$ac_cv_prog_make_'${ac_make}_set`\" = yes"; then
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+ SET_MAKE=
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+ SET_MAKE="MAKE=${MAKE-make}"
+fi
+
+rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+
+# test to see if srcdir already configured
+if test "`cd $srcdir && pwd`" != "`pwd`" &&
+ test -f $srcdir/config.status; then
+ { { echo "$as_me:$LINENO: error: source directory already configured; run \"make distclean\" there first" >&5
+echo "$as_me: error: source directory already configured; run \"make distclean\" there first" >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+
+
+# Define the identity of the package.
+ PACKAGE='xf86-input-mouse'
+ VERSION='1.1.2'
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE "$PACKAGE"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define VERSION "$VERSION"
+_ACEOF
+
+# Some tools Automake needs.
+
+ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"}
+
+
+AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"}
+
+
+AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"}
+
+
+AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"}
+
+
+MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"}
+
+install_sh=${install_sh-"$am_aux_dir/install-sh"}
+
+# Installed binaries are usually stripped using `strip' when the user
+# run `make install-strip'. However `strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the `STRIP' environment variable to overrule this program.
+if test "$cross_compiling" != no; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_STRIP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ echo "$as_me:$LINENO: result: $STRIP" >&5
+echo "${ECHO_T}$STRIP" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":"
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5
+echo "${ECHO_T}$ac_ct_STRIP" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ STRIP=$ac_ct_STRIP
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+fi
+INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s"
+
+# We need awk for the "check" target. The system "awk" is bad on
+# some platforms.
+# Always define AMTAR for backward compatibility.
+
+AMTAR=${AMTAR-"${am_missing_run}tar"}
+
+am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'
+
+
+
+
+
+
+echo "$as_me:$LINENO: checking whether to enable maintainer-specific portions of Makefiles" >&5
+echo $ECHO_N "checking whether to enable maintainer-specific portions of Makefiles... $ECHO_C" >&6
+ # Check whether --enable-maintainer-mode or --disable-maintainer-mode was given.
+if test "${enable_maintainer_mode+set}" = set; then
+ enableval="$enable_maintainer_mode"
+ USE_MAINTAINER_MODE=$enableval
+else
+ USE_MAINTAINER_MODE=no
+fi;
+ echo "$as_me:$LINENO: result: $USE_MAINTAINER_MODE" >&5
+echo "${ECHO_T}$USE_MAINTAINER_MODE" >&6
+
+
+if test $USE_MAINTAINER_MODE = yes; then
+ MAINTAINER_MODE_TRUE=
+ MAINTAINER_MODE_FALSE='#'
+else
+ MAINTAINER_MODE_TRUE='#'
+ MAINTAINER_MODE_FALSE=
+fi
+
+ MAINT=$MAINTAINER_MODE_TRUE
+
+
+
+DRIVER_NAME=mouse
+
+
+ ac_config_headers="$ac_config_headers config.h"
+
+
+# Checks for programs.
+# Check whether --enable-static or --disable-static was given.
+if test "${enable_static+set}" = set; then
+ enableval="$enable_static"
+ p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_static=yes ;;
+ no) enable_static=no ;;
+ *)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_static=no
+fi;
+
+
+# Check whether --enable-shared or --disable-shared was given.
+if test "${enable_shared+set}" = set; then
+ enableval="$enable_shared"
+ p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_shared=yes ;;
+ no) enable_shared=no ;;
+ *)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_shared=yes
+fi;
+
+# Check whether --enable-fast-install or --disable-fast-install was given.
+if test "${enable_fast_install+set}" = set; then
+ enableval="$enable_fast_install"
+ p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_fast_install=yes ;;
+ no) enable_fast_install=no ;;
+ *)
+ enable_fast_install=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_fast_install=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_fast_install=yes
+fi;
+
+# Make sure we can run config.sub.
+$ac_config_sub sun4 >/dev/null 2>&1 ||
+ { { echo "$as_me:$LINENO: error: cannot run $ac_config_sub" >&5
+echo "$as_me: error: cannot run $ac_config_sub" >&2;}
+ { (exit 1); exit 1; }; }
+
+echo "$as_me:$LINENO: checking build system type" >&5
+echo $ECHO_N "checking build system type... $ECHO_C" >&6
+if test "${ac_cv_build+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_cv_build_alias=$build_alias
+test -z "$ac_cv_build_alias" &&
+ ac_cv_build_alias=`$ac_config_guess`
+test -z "$ac_cv_build_alias" &&
+ { { echo "$as_me:$LINENO: error: cannot guess build type; you must specify one" >&5
+echo "$as_me: error: cannot guess build type; you must specify one" >&2;}
+ { (exit 1); exit 1; }; }
+ac_cv_build=`$ac_config_sub $ac_cv_build_alias` ||
+ { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_build_alias failed" >&5
+echo "$as_me: error: $ac_config_sub $ac_cv_build_alias failed" >&2;}
+ { (exit 1); exit 1; }; }
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_build" >&5
+echo "${ECHO_T}$ac_cv_build" >&6
+build=$ac_cv_build
+build_cpu=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+build_vendor=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+build_os=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+
+echo "$as_me:$LINENO: checking host system type" >&5
+echo $ECHO_N "checking host system type... $ECHO_C" >&6
+if test "${ac_cv_host+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_cv_host_alias=$host_alias
+test -z "$ac_cv_host_alias" &&
+ ac_cv_host_alias=$ac_cv_build_alias
+ac_cv_host=`$ac_config_sub $ac_cv_host_alias` ||
+ { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_host_alias failed" >&5
+echo "$as_me: error: $ac_config_sub $ac_cv_host_alias failed" >&2;}
+ { (exit 1); exit 1; }; }
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_host" >&5
+echo "${ECHO_T}$ac_cv_host" >&6
+host=$ac_cv_host
+host_cpu=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+host_vendor=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+host_os=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+
+DEPDIR="${am__leading_dot}deps"
+
+ ac_config_commands="$ac_config_commands depfiles"
+
+
+am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+ @echo done
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+echo "$as_me:$LINENO: checking for style of include used by $am_make" >&5
+echo $ECHO_N "checking for style of include used by $am_make... $ECHO_C" >&6
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# We grep out `Entering directory' and `Leaving directory'
+# messages which can occur if `w' ends up in MAKEFLAGS.
+# In particular we don't look at `^make:' because GNU make might
+# be invoked under some other name (usually "gmake"), in which
+# case it prints its new name instead of `make'.
+if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then
+ am__include=include
+ am__quote=
+ _am_result=GNU
+fi
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+ echo '.include "confinc"' > confmf
+ if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then
+ am__include=.include
+ am__quote="\""
+ _am_result=BSD
+ fi
+fi
+
+
+echo "$as_me:$LINENO: result: $_am_result" >&5
+echo "${ECHO_T}$_am_result" >&6
+rm -f confinc confmf
+
+# Check whether --enable-dependency-tracking or --disable-dependency-tracking was given.
+if test "${enable_dependency_tracking+set}" = set; then
+ enableval="$enable_dependency_tracking"
+
+fi;
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+fi
+
+
+if test "x$enable_dependency_tracking" != xno; then
+ AMDEP_TRUE=
+ AMDEP_FALSE='#'
+else
+ AMDEP_TRUE='#'
+ AMDEP_FALSE=
+fi
+
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}gcc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}gcc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "gcc", so it can be a program name with args.
+set dummy gcc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="gcc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ CC=$ac_ct_CC
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ CC=$ac_ct_CC
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+fi
+if test -z "$CC"; then
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+ ac_prog_rejected=no
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then
+ ac_prog_rejected=yes
+ continue
+ fi
+ ac_cv_prog_CC="cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+if test $ac_prog_rejected = yes; then
+ # We found a bogon in the path, so make sure we never use it.
+ set dummy $ac_cv_prog_CC
+ shift
+ if test $# != 0; then
+ # We chose a different compiler from the bogus one.
+ # However, it has the same basename, so the bogon will be chosen
+ # first if we set CC to just the basename; use the full file name.
+ shift
+ ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@"
+ fi
+fi
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in cl
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="$ac_tool_prefix$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$CC" && break
+ done
+fi
+if test -z "$CC"; then
+ ac_ct_CC=$CC
+ for ac_prog in cl
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$ac_ct_CC" && break
+done
+
+ CC=$ac_ct_CC
+fi
+
+fi
+
+
+test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH
+See \`config.log' for more details." >&5
+echo "$as_me: error: no acceptable C compiler found in \$PATH
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+
+# Provide some information about the compiler.
+echo "$as_me:$LINENO:" \
+ "checking for C compiler version" >&5
+ac_compiler=`set X $ac_compile; echo $2`
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5
+ (eval $ac_compiler --version </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5
+ (eval $ac_compiler -v </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5
+ (eval $ac_compiler -V </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files a.out a.exe b.out"
+# Try to create an executable without -o first, disregard a.out.
+# It will help us diagnose broken compilers, and finding out an intuition
+# of exeext.
+echo "$as_me:$LINENO: checking for C compiler default output file name" >&5
+echo $ECHO_N "checking for C compiler default output file name... $ECHO_C" >&6
+ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'`
+if { (eval echo "$as_me:$LINENO: \"$ac_link_default\"") >&5
+ (eval $ac_link_default) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ # Find the output, starting from the most likely. This scheme is
+# not robust to junk in `.', hence go to wildcards (a.*) only as a last
+# resort.
+
+# Be careful to initialize this variable, since it used to be cached.
+# Otherwise an old cache value of `no' led to `EXEEXT = no' in a Makefile.
+ac_cv_exeext=
+# b.out is created by i960 compilers.
+for ac_file in a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out
+do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj )
+ ;;
+ conftest.$ac_ext )
+ # This is the source file.
+ ;;
+ [ab].out )
+ # We found the default executable, but exeext='' is most
+ # certainly right.
+ break;;
+ *.* )
+ ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ # FIXME: I believe we export ac_cv_exeext for Libtool,
+ # but it would be cool to find out if it's true. Does anybody
+ # maintain Libtool? --akim.
+ export ac_cv_exeext
+ break;;
+ * )
+ break;;
+ esac
+done
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { echo "$as_me:$LINENO: error: C compiler cannot create executables
+See \`config.log' for more details." >&5
+echo "$as_me: error: C compiler cannot create executables
+See \`config.log' for more details." >&2;}
+ { (exit 77); exit 77; }; }
+fi
+
+ac_exeext=$ac_cv_exeext
+echo "$as_me:$LINENO: result: $ac_file" >&5
+echo "${ECHO_T}$ac_file" >&6
+
+# Check the compiler produces executables we can run. If not, either
+# the compiler is broken, or we cross compile.
+echo "$as_me:$LINENO: checking whether the C compiler works" >&5
+echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6
+# FIXME: These cross compiler hacks should be removed for Autoconf 3.0
+# If not cross compiling, check that we can run a simple program.
+if test "$cross_compiling" != yes; then
+ if { ac_try='./$ac_file'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ cross_compiling=no
+ else
+ if test "$cross_compiling" = maybe; then
+ cross_compiling=yes
+ else
+ { { echo "$as_me:$LINENO: error: cannot run C compiled programs.
+If you meant to cross compile, use \`--host'.
+See \`config.log' for more details." >&5
+echo "$as_me: error: cannot run C compiled programs.
+If you meant to cross compile, use \`--host'.
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+ fi
+ fi
+fi
+echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+
+rm -f a.out a.exe conftest$ac_cv_exeext b.out
+ac_clean_files=$ac_clean_files_save
+# Check the compiler produces executables we can run. If not, either
+# the compiler is broken, or we cross compile.
+echo "$as_me:$LINENO: checking whether we are cross compiling" >&5
+echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6
+echo "$as_me:$LINENO: result: $cross_compiling" >&5
+echo "${ECHO_T}$cross_compiling" >&6
+
+echo "$as_me:$LINENO: checking for suffix of executables" >&5
+echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ # If both `conftest.exe' and `conftest' are `present' (well, observable)
+# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will
+# work properly (i.e., refer to `conftest.exe'), while it won't with
+# `rm'.
+for ac_file in conftest.exe conftest conftest.*; do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) ;;
+ *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ export ac_cv_exeext
+ break;;
+ * ) break;;
+ esac
+done
+else
+ { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link
+See \`config.log' for more details." >&5
+echo "$as_me: error: cannot compute suffix of executables: cannot compile and link
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+rm -f conftest$ac_cv_exeext
+echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5
+echo "${ECHO_T}$ac_cv_exeext" >&6
+
+rm -f conftest.$ac_ext
+EXEEXT=$ac_cv_exeext
+ac_exeext=$EXEEXT
+echo "$as_me:$LINENO: checking for suffix of object files" >&5
+echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6
+if test "${ac_cv_objext+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.o conftest.obj
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ for ac_file in `(ls conftest.o conftest.obj; ls conftest.*) 2>/dev/null`; do
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg ) ;;
+ *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'`
+ break;;
+ esac
+done
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile
+See \`config.log' for more details." >&5
+echo "$as_me: error: cannot compute suffix of object files: cannot compile
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+rm -f conftest.$ac_cv_objext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_objext" >&5
+echo "${ECHO_T}$ac_cv_objext" >&6
+OBJEXT=$ac_cv_objext
+ac_objext=$OBJEXT
+echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5
+echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6
+if test "${ac_cv_c_compiler_gnu+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_compiler_gnu=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_compiler_gnu=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_c_compiler_gnu=$ac_compiler_gnu
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5
+echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6
+GCC=`test $ac_compiler_gnu = yes && echo yes`
+ac_test_CFLAGS=${CFLAGS+set}
+ac_save_CFLAGS=$CFLAGS
+CFLAGS="-g"
+echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5
+echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6
+if test "${ac_cv_prog_cc_g+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_cc_g=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_prog_cc_g=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5
+echo "${ECHO_T}$ac_cv_prog_cc_g" >&6
+if test "$ac_test_CFLAGS" = set; then
+ CFLAGS=$ac_save_CFLAGS
+elif test $ac_cv_prog_cc_g = yes; then
+ if test "$GCC" = yes; then
+ CFLAGS="-g -O2"
+ else
+ CFLAGS="-g"
+ fi
+else
+ if test "$GCC" = yes; then
+ CFLAGS="-O2"
+ else
+ CFLAGS=
+ fi
+fi
+echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5
+echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6
+if test "${ac_cv_prog_cc_stdc+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_cv_prog_cc_stdc=no
+ac_save_CC=$CC
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdarg.h>
+#include <stdio.h>
+#include <sys/types.h>
+#include <sys/stat.h>
+/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */
+struct buf { int x; };
+FILE * (*rcsopen) (struct buf *, struct stat *, int);
+static char *e (p, i)
+ char **p;
+ int i;
+{
+ return p[i];
+}
+static char *f (char * (*g) (char **, int), char **p, ...)
+{
+ char *s;
+ va_list v;
+ va_start (v,p);
+ s = g (p, va_arg (v,int));
+ va_end (v);
+ return s;
+}
+
+/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has
+ function prototypes and stuff, but not '\xHH' hex character constants.
+ These don't provoke an error unfortunately, instead are silently treated
+ as 'x'. The following induces an error, until -std1 is added to get
+ proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an
+ array size at least. It's necessary to write '\x00'==0 to get something
+ that's true only with -std1. */
+int osf4_cc_array ['\x00' == 0 ? 1 : -1];
+
+int test (int i, double x);
+struct s1 {int (*f) (int a);};
+struct s2 {int (*f) (double a);};
+int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int);
+int argc;
+char **argv;
+int
+main ()
+{
+return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1];
+ ;
+ return 0;
+}
+_ACEOF
+# Don't try gcc -ansi; that turns off useful extensions and
+# breaks some systems' header files.
+# AIX -qlanglvl=ansi
+# Ultrix and OSF/1 -std1
+# HP-UX 10.20 and later -Ae
+# HP-UX older versions -Aa -D_HPUX_SOURCE
+# SVR4 -Xc -D__EXTENSIONS__
+for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__"
+do
+ CC="$ac_save_CC $ac_arg"
+ rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_cc_stdc=$ac_arg
+break
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext
+done
+rm -f conftest.$ac_ext conftest.$ac_objext
+CC=$ac_save_CC
+
+fi
+
+case "x$ac_cv_prog_cc_stdc" in
+ x|xno)
+ echo "$as_me:$LINENO: result: none needed" >&5
+echo "${ECHO_T}none needed" >&6 ;;
+ *)
+ echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5
+echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6
+ CC="$CC $ac_cv_prog_cc_stdc" ;;
+esac
+
+# Some people use a C++ compiler to compile C. Since we use `exit',
+# in C++ we need to declare it. In case someone uses the same compiler
+# for both compiling C and C++ we need to have the C++ compiler decide
+# the declaration of exit, since it's the most demanding environment.
+cat >conftest.$ac_ext <<_ACEOF
+#ifndef __cplusplus
+ choke me
+#endif
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ for ac_declaration in \
+ '' \
+ 'extern "C" void std::exit (int) throw (); using std::exit;' \
+ 'extern "C" void std::exit (int); using std::exit;' \
+ 'extern "C" void exit (int) throw ();' \
+ 'extern "C" void exit (int);' \
+ 'void exit (int);'
+do
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+#include <stdlib.h>
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+continue
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ break
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+done
+rm -f conftest*
+if test -n "$ac_declaration"; then
+ echo '#ifdef __cplusplus' >>confdefs.h
+ echo $ac_declaration >>confdefs.h
+ echo '#endif' >>confdefs.h
+fi
+
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+depcc="$CC" am_compiler_list=
+
+echo "$as_me:$LINENO: checking dependency style of $depcc" >&5
+echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6
+if test "${am_cv_CC_dependencies_compiler_type+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named `D' -- because `-MD' means `put the output
+ # in D'.
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CC_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+ # Solaris 8's {/usr,}/bin/sh.
+ touch sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ case $depmode in
+ nosideeffect)
+ # after this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ none) break ;;
+ esac
+ # We check with `-c' and `-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle `-M -o', and we need to detect this.
+ if depmode=$depmode \
+ source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CC_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CC_dependencies_compiler_type=none
+fi
+
+fi
+echo "$as_me:$LINENO: result: $am_cv_CC_dependencies_compiler_type" >&5
+echo "${ECHO_T}$am_cv_CC_dependencies_compiler_type" >&6
+CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type
+
+
+
+if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then
+ am__fastdepCC_TRUE=
+ am__fastdepCC_FALSE='#'
+else
+ am__fastdepCC_TRUE='#'
+ am__fastdepCC_FALSE=
+fi
+
+
+echo "$as_me:$LINENO: checking for a sed that does not truncate output" >&5
+echo $ECHO_N "checking for a sed that does not truncate output... $ECHO_C" >&6
+if test "${lt_cv_path_SED+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ # Loop through the user's path and test for sed and gsed.
+# Then use that list of sed's as ones to test for truncation.
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for lt_ac_prog in sed gsed; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then
+ lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext"
+ fi
+ done
+ done
+done
+IFS=$as_save_IFS
+lt_ac_max=0
+lt_ac_count=0
+# Add /usr/xpg4/bin/sed as it is typically found on Solaris
+# along with /bin/sed that truncates output.
+for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do
+ test ! -f $lt_ac_sed && continue
+ cat /dev/null > conftest.in
+ lt_ac_count=0
+ echo $ECHO_N "0123456789$ECHO_C" >conftest.in
+ # Check for GNU sed and select it if it is found.
+ if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then
+ lt_cv_path_SED=$lt_ac_sed
+ break
+ fi
+ while true; do
+ cat conftest.in conftest.in >conftest.tmp
+ mv conftest.tmp conftest.in
+ cp conftest.in conftest.nl
+ echo >>conftest.nl
+ $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break
+ cmp -s conftest.out conftest.nl || break
+ # 10000 chars as input seems more than enough
+ test $lt_ac_count -gt 10 && break
+ lt_ac_count=`expr $lt_ac_count + 1`
+ if test $lt_ac_count -gt $lt_ac_max; then
+ lt_ac_max=$lt_ac_count
+ lt_cv_path_SED=$lt_ac_sed
+ fi
+ done
+done
+
+fi
+
+SED=$lt_cv_path_SED
+
+echo "$as_me:$LINENO: result: $SED" >&5
+echo "${ECHO_T}$SED" >&6
+
+echo "$as_me:$LINENO: checking for egrep" >&5
+echo $ECHO_N "checking for egrep... $ECHO_C" >&6
+if test "${ac_cv_prog_egrep+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if echo a | (grep -E '(a|b)') >/dev/null 2>&1
+ then ac_cv_prog_egrep='grep -E'
+ else ac_cv_prog_egrep='egrep'
+ fi
+fi
+echo "$as_me:$LINENO: result: $ac_cv_prog_egrep" >&5
+echo "${ECHO_T}$ac_cv_prog_egrep" >&6
+ EGREP=$ac_cv_prog_egrep
+
+
+
+# Check whether --with-gnu-ld or --without-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then
+ withval="$with_gnu_ld"
+ test "$withval" = no || with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi;
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ echo "$as_me:$LINENO: checking for ld used by $CC" >&5
+echo $ECHO_N "checking for ld used by $CC... $ECHO_C" >&6
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [\\/]* | ?:[\\/]*)
+ re_direlt='/[^/][^/]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'`
+ while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ echo "$as_me:$LINENO: checking for GNU ld" >&5
+echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6
+else
+ echo "$as_me:$LINENO: checking for non-GNU ld" >&5
+echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6
+fi
+if test "${lt_cv_path_LD+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+ *GNU* | *'with BFD'*)
+ test "$with_gnu_ld" != no && break
+ ;;
+ *)
+ test "$with_gnu_ld" != yes && break
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+else
+ lt_cv_path_LD="$LD" # Let the user override the test with a path.
+fi
+fi
+
+LD="$lt_cv_path_LD"
+if test -n "$LD"; then
+ echo "$as_me:$LINENO: result: $LD" >&5
+echo "${ECHO_T}$LD" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5
+echo "$as_me: error: no acceptable ld found in \$PATH" >&2;}
+ { (exit 1); exit 1; }; }
+echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5
+echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6
+if test "${lt_cv_prog_gnu_ld+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+ lt_cv_prog_gnu_ld=yes
+ ;;
+*)
+ lt_cv_prog_gnu_ld=no
+ ;;
+esac
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_gnu_ld" >&5
+echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+echo "$as_me:$LINENO: checking for $LD option to reload object files" >&5
+echo $ECHO_N "checking for $LD option to reload object files... $ECHO_C" >&6
+if test "${lt_cv_ld_reload_flag+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_ld_reload_flag='-r'
+fi
+echo "$as_me:$LINENO: result: $lt_cv_ld_reload_flag" >&5
+echo "${ECHO_T}$lt_cv_ld_reload_flag" >&6
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+ darwin*)
+ if test "$GCC" = yes; then
+ reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs'
+ else
+ reload_cmds='$LD$reload_flag -o $output$reload_objs'
+ fi
+ ;;
+esac
+
+echo "$as_me:$LINENO: checking for BSD-compatible nm" >&5
+echo $ECHO_N "checking for BSD-compatible nm... $ECHO_C" >&6
+if test "${lt_cv_path_NM+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$NM"; then
+ # Let the user override the test.
+ lt_cv_path_NM="$NM"
+else
+ lt_nm_to_check="${ac_tool_prefix}nm"
+ if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+ lt_nm_to_check="$lt_nm_to_check nm"
+ fi
+ for lt_tmp_nm in $lt_nm_to_check; do
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ tmp_nm="$ac_dir/$lt_tmp_nm"
+ if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ # Tru64's nm complains that /dev/null is an invalid object file
+ case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+ */dev/null* | *'Invalid file or object type'*)
+ lt_cv_path_NM="$tmp_nm -B"
+ break
+ ;;
+ *)
+ case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+ */dev/null*)
+ lt_cv_path_NM="$tmp_nm -p"
+ break
+ ;;
+ *)
+ lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+ continue # so that we can try to find one that supports BSD flags
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+ done
+ test -z "$lt_cv_path_NM" && lt_cv_path_NM=nm
+fi
+fi
+echo "$as_me:$LINENO: result: $lt_cv_path_NM" >&5
+echo "${ECHO_T}$lt_cv_path_NM" >&6
+NM="$lt_cv_path_NM"
+
+echo "$as_me:$LINENO: checking whether ln -s works" >&5
+echo $ECHO_N "checking whether ln -s works... $ECHO_C" >&6
+LN_S=$as_ln_s
+if test "$LN_S" = "ln -s"; then
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+else
+ echo "$as_me:$LINENO: result: no, using $LN_S" >&5
+echo "${ECHO_T}no, using $LN_S" >&6
+fi
+
+echo "$as_me:$LINENO: checking how to recognise dependent libraries" >&5
+echo $ECHO_N "checking how to recognise dependent libraries... $ECHO_C" >&6
+if test "${lt_cv_deplibs_check_method+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# `unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# which responds to the $file_magic_cmd with a given extended regex.
+# If you have `file' or equivalent on your system and you're not sure
+# whether `pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix4* | aix5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+beos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+bsdi[45]*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)'
+ lt_cv_file_magic_cmd='/usr/bin/file -L'
+ lt_cv_file_magic_test_file=/shlib/libc.so
+ ;;
+
+cygwin*)
+ # func_win32_libid is a shell function defined in ltmain.sh
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ ;;
+
+mingw* | pw32*)
+ # Base MSYS/MinGW do not provide the 'file' command needed by
+ # func_win32_libid shell function, so use a weaker test based on 'objdump'.
+ lt_cv_deplibs_check_method='file_magic file format pei*-i386(.*architecture: i386)?'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ ;;
+
+darwin* | rhapsody*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+freebsd* | kfreebsd*-gnu | dragonfly*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then
+ case $host_cpu in
+ i*86 )
+ # Not sure whether the presence of OpenBSD here was a mistake.
+ # Let's accept both of them until this is cleared up.
+ lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+ ;;
+ esac
+ else
+ lt_cv_deplibs_check_method=pass_all
+ fi
+ ;;
+
+gnu*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+hpux10.20* | hpux11*)
+ lt_cv_file_magic_cmd=/usr/bin/file
+ case $host_cpu in
+ ia64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64'
+ lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+ ;;
+ hppa*64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - PA-RISC [0-9].[0-9]'
+ lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+ ;;
+ *)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9].[0-9]) shared library'
+ lt_cv_file_magic_test_file=/usr/lib/libc.sl
+ ;;
+ esac
+ ;;
+
+interix3*)
+ # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$'
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $LD in
+ *-32|*"-32 ") libmagic=32-bit;;
+ *-n32|*"-n32 ") libmagic=N32;;
+ *-64|*"-64 ") libmagic=64-bit;;
+ *) libmagic=never-match;;
+ esac
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$'
+ fi
+ ;;
+
+newos6*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=/usr/lib/libnls.so
+ ;;
+
+nto-qnx*)
+ lt_cv_deplibs_check_method=unknown
+ ;;
+
+openbsd*)
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ fi
+ ;;
+
+osf3* | osf4* | osf5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+solaris*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv4 | sysv4.3*)
+ case $host_vendor in
+ motorola)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]'
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+ ;;
+ ncr)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ sequent)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )'
+ ;;
+ sni)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib"
+ lt_cv_file_magic_test_file=/lib/libc.so
+ ;;
+ siemens)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ pc)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ esac
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+esac
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_deplibs_check_method" >&5
+echo "${ECHO_T}$lt_cv_deplibs_check_method" >&6
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# Check whether --enable-libtool-lock or --disable-libtool-lock was given.
+if test "${enable_libtool_lock+set}" = set; then
+ enableval="$enable_libtool_lock"
+
+fi;
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *ELF-32*)
+ HPUX_IA64_MODE="32"
+ ;;
+ *ELF-64*)
+ HPUX_IA64_MODE="64"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+*-*-irix6*)
+ # Find out which ABI we are using.
+ echo '#line 3733 "configure"' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -melf32bsmip"
+ ;;
+ *N32*)
+ LD="${LD-ld} -melf32bmipn32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -melf64bmip"
+ ;;
+ esac
+ else
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ fi
+ rm -rf conftest*
+ ;;
+
+x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*|s390*-*linux*|sparc*-*linux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.o` in
+ *32-bit*)
+ case $host in
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_i386"
+ ;;
+ ppc64-*linux*|powerpc64-*linux*)
+ LD="${LD-ld} -m elf32ppclinux"
+ ;;
+ s390x-*linux*)
+ LD="${LD-ld} -m elf_s390"
+ ;;
+ sparc64-*linux*)
+ LD="${LD-ld} -m elf32_sparc"
+ ;;
+ esac
+ ;;
+ *64-bit*)
+ case $host in
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ ppc*-*linux*|powerpc*-*linux*)
+ LD="${LD-ld} -m elf64ppc"
+ ;;
+ s390*-*linux*)
+ LD="${LD-ld} -m elf64_s390"
+ ;;
+ sparc*-*linux*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -belf"
+ echo "$as_me:$LINENO: checking whether the C compiler needs -belf" >&5
+echo $ECHO_N "checking whether the C compiler needs -belf... $ECHO_C" >&6
+if test "${lt_cv_cc_needs_belf+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ lt_cv_cc_needs_belf=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+lt_cv_cc_needs_belf=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_cc_needs_belf" >&5
+echo "${ECHO_T}$lt_cv_cc_needs_belf" >&6
+ if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+ # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+ CFLAGS="$SAVE_CFLAGS"
+ fi
+ ;;
+sparc*-*solaris*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.o` in
+ *64-bit*)
+ case $lt_cv_prog_gnu_ld in
+ yes*) LD="${LD-ld} -m elf64_sparc" ;;
+ *) LD="${LD-ld} -64" ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+
+esac
+
+need_locks="$enable_libtool_lock"
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5
+echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+ CPP=
+fi
+if test -z "$CPP"; then
+ if test "${ac_cv_prog_CPP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ # Double quotes because CPP needs to be expanded
+ for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp"
+ do
+ ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_c_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_c_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether non-existent headers
+ # can be detected and how.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_c_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_c_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ # Broken: success on invalid input.
+continue
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then
+ break
+fi
+
+ done
+ ac_cv_prog_CPP=$CPP
+
+fi
+ CPP=$ac_cv_prog_CPP
+else
+ ac_cv_prog_CPP=$CPP
+fi
+echo "$as_me:$LINENO: result: $CPP" >&5
+echo "${ECHO_T}$CPP" >&6
+ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_c_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_c_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether non-existent headers
+ # can be detected and how.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_c_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_c_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ # Broken: success on invalid input.
+continue
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then
+ :
+else
+ { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check
+See \`config.log' for more details." >&5
+echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+echo "$as_me:$LINENO: checking for ANSI C header files" >&5
+echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6
+if test "${ac_cv_header_stdc+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_header_stdc=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_header_stdc=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then
+ :
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then
+ :
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then
+ :
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ctype.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ exit(2);
+ exit (0);
+}
+_ACEOF
+rm -f conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && { ac_try='./conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ :
+else
+ echo "$as_me: program exited with status $ac_status" >&5
+echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+( exit $ac_status )
+ac_cv_header_stdc=no
+fi
+rm -f core *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext
+fi
+fi
+fi
+echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5
+echo "${ECHO_T}$ac_cv_header_stdc" >&6
+if test $ac_cv_header_stdc = yes; then
+
+cat >>confdefs.h <<\_ACEOF
+#define STDC_HEADERS 1
+_ACEOF
+
+fi
+
+# On IRIX 5.3, sys/types and inttypes.h are conflicting.
+
+
+
+
+
+
+
+
+
+for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \
+ inttypes.h stdint.h unistd.h
+do
+as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh`
+echo "$as_me:$LINENO: checking for $ac_header" >&5
+echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6
+if eval "test \"\${$as_ac_Header+set}\" = set"; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_includes_default
+
+#include <$ac_header>
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ eval "$as_ac_Header=yes"
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+eval "$as_ac_Header=no"
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5
+echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6
+if test `eval echo '${'$as_ac_Header'}'` = yes; then
+ cat >>confdefs.h <<_ACEOF
+#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+
+for ac_header in dlfcn.h
+do
+as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh`
+if eval "test \"\${$as_ac_Header+set}\" = set"; then
+ echo "$as_me:$LINENO: checking for $ac_header" >&5
+echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6
+if eval "test \"\${$as_ac_Header+set}\" = set"; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+fi
+echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5
+echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6
+else
+ # Is the header compilable?
+echo "$as_me:$LINENO: checking $ac_header usability" >&5
+echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_includes_default
+#include <$ac_header>
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_header_compiler=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_header_compiler=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+echo "$as_me:$LINENO: result: $ac_header_compiler" >&5
+echo "${ECHO_T}$ac_header_compiler" >&6
+
+# Is the header present?
+echo "$as_me:$LINENO: checking $ac_header presence" >&5
+echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <$ac_header>
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_c_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_c_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ ac_header_preproc=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_header_preproc=no
+fi
+rm -f conftest.err conftest.$ac_ext
+echo "$as_me:$LINENO: result: $ac_header_preproc" >&5
+echo "${ECHO_T}$ac_header_preproc" >&6
+
+# So? What about this header?
+case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in
+ yes:no: )
+ { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5
+echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the compiler's result" >&5
+echo "$as_me: WARNING: $ac_header: proceeding with the compiler's result" >&2;}
+ ac_header_preproc=yes
+ ;;
+ no:yes:* )
+ { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5
+echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5
+echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: see the Autoconf documentation" >&5
+echo "$as_me: WARNING: $ac_header: see the Autoconf documentation" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&5
+echo "$as_me: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5
+echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;}
+ { echo "$as_me:$LINENO: WARNING: $ac_header: in the future, the compiler will take precedence" >&5
+echo "$as_me: WARNING: $ac_header: in the future, the compiler will take precedence" >&2;}
+ (
+ cat <<\_ASBOX
+## ---------------------------------------------------------------------- ##
+## Report this to https://bugs.freedesktop.org/enter_bug.cgi?product=xorg ##
+## ---------------------------------------------------------------------- ##
+_ASBOX
+ ) |
+ sed "s/^/$as_me: WARNING: /" >&2
+ ;;
+esac
+echo "$as_me:$LINENO: checking for $ac_header" >&5
+echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6
+if eval "test \"\${$as_ac_Header+set}\" = set"; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ eval "$as_ac_Header=\$ac_header_preproc"
+fi
+echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5
+echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6
+
+fi
+if test `eval echo '${'$as_ac_Header'}'` = yes; then
+ cat >>confdefs.h <<_ACEOF
+#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+ac_ext=cc
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ for ac_prog in $CCC g++ c++ gpp aCC CC cxx cc++ cl FCC KCC RCC xlC_r xlC
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CXX+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CXX"; then
+ ac_cv_prog_CXX="$CXX" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CXX="$ac_tool_prefix$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CXX=$ac_cv_prog_CXX
+if test -n "$CXX"; then
+ echo "$as_me:$LINENO: result: $CXX" >&5
+echo "${ECHO_T}$CXX" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$CXX" && break
+ done
+fi
+if test -z "$CXX"; then
+ ac_ct_CXX=$CXX
+ for ac_prog in $CCC g++ c++ gpp aCC CC cxx cc++ cl FCC KCC RCC xlC_r xlC
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CXX+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CXX"; then
+ ac_cv_prog_ac_ct_CXX="$ac_ct_CXX" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CXX="$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CXX=$ac_cv_prog_ac_ct_CXX
+if test -n "$ac_ct_CXX"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CXX" >&5
+echo "${ECHO_T}$ac_ct_CXX" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$ac_ct_CXX" && break
+done
+test -n "$ac_ct_CXX" || ac_ct_CXX="g++"
+
+ CXX=$ac_ct_CXX
+fi
+
+
+# Provide some information about the compiler.
+echo "$as_me:$LINENO:" \
+ "checking for C++ compiler version" >&5
+ac_compiler=`set X $ac_compile; echo $2`
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5
+ (eval $ac_compiler --version </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5
+ (eval $ac_compiler -v </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5
+ (eval $ac_compiler -V </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+
+echo "$as_me:$LINENO: checking whether we are using the GNU C++ compiler" >&5
+echo $ECHO_N "checking whether we are using the GNU C++ compiler... $ECHO_C" >&6
+if test "${ac_cv_cxx_compiler_gnu+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_compiler_gnu=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_compiler_gnu=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_cxx_compiler_gnu=$ac_compiler_gnu
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_cxx_compiler_gnu" >&5
+echo "${ECHO_T}$ac_cv_cxx_compiler_gnu" >&6
+GXX=`test $ac_compiler_gnu = yes && echo yes`
+ac_test_CXXFLAGS=${CXXFLAGS+set}
+ac_save_CXXFLAGS=$CXXFLAGS
+CXXFLAGS="-g"
+echo "$as_me:$LINENO: checking whether $CXX accepts -g" >&5
+echo $ECHO_N "checking whether $CXX accepts -g... $ECHO_C" >&6
+if test "${ac_cv_prog_cxx_g+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_cxx_g=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_prog_cxx_g=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_prog_cxx_g" >&5
+echo "${ECHO_T}$ac_cv_prog_cxx_g" >&6
+if test "$ac_test_CXXFLAGS" = set; then
+ CXXFLAGS=$ac_save_CXXFLAGS
+elif test $ac_cv_prog_cxx_g = yes; then
+ if test "$GXX" = yes; then
+ CXXFLAGS="-g -O2"
+ else
+ CXXFLAGS="-g"
+ fi
+else
+ if test "$GXX" = yes; then
+ CXXFLAGS="-O2"
+ else
+ CXXFLAGS=
+ fi
+fi
+for ac_declaration in \
+ '' \
+ 'extern "C" void std::exit (int) throw (); using std::exit;' \
+ 'extern "C" void std::exit (int); using std::exit;' \
+ 'extern "C" void exit (int) throw ();' \
+ 'extern "C" void exit (int);' \
+ 'void exit (int);'
+do
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+#include <stdlib.h>
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+continue
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ break
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+done
+rm -f conftest*
+if test -n "$ac_declaration"; then
+ echo '#ifdef __cplusplus' >>confdefs.h
+ echo $ac_declaration >>confdefs.h
+ echo '#endif' >>confdefs.h
+fi
+
+ac_ext=cc
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+
+depcc="$CXX" am_compiler_list=
+
+echo "$as_me:$LINENO: checking dependency style of $depcc" >&5
+echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6
+if test "${am_cv_CXX_dependencies_compiler_type+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named `D' -- because `-MD' means `put the output
+ # in D'.
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CXX_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+ # Solaris 8's {/usr,}/bin/sh.
+ touch sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ case $depmode in
+ nosideeffect)
+ # after this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ none) break ;;
+ esac
+ # We check with `-c' and `-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle `-M -o', and we need to detect this.
+ if depmode=$depmode \
+ source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CXX_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CXX_dependencies_compiler_type=none
+fi
+
+fi
+echo "$as_me:$LINENO: result: $am_cv_CXX_dependencies_compiler_type" >&5
+echo "${ECHO_T}$am_cv_CXX_dependencies_compiler_type" >&6
+CXXDEPMODE=depmode=$am_cv_CXX_dependencies_compiler_type
+
+
+
+if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CXX_dependencies_compiler_type" = gcc3; then
+ am__fastdepCXX_TRUE=
+ am__fastdepCXX_FALSE='#'
+else
+ am__fastdepCXX_TRUE='#'
+ am__fastdepCXX_FALSE=
+fi
+
+
+
+
+if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ ac_ext=cc
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+echo "$as_me:$LINENO: checking how to run the C++ preprocessor" >&5
+echo $ECHO_N "checking how to run the C++ preprocessor... $ECHO_C" >&6
+if test -z "$CXXCPP"; then
+ if test "${ac_cv_prog_CXXCPP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ # Double quotes because CXXCPP needs to be expanded
+ for CXXCPP in "$CXX -E" "/lib/cpp"
+ do
+ ac_preproc_ok=false
+for ac_cxx_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_cxx_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether non-existent headers
+ # can be detected and how.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_cxx_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ # Broken: success on invalid input.
+continue
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then
+ break
+fi
+
+ done
+ ac_cv_prog_CXXCPP=$CXXCPP
+
+fi
+ CXXCPP=$ac_cv_prog_CXXCPP
+else
+ ac_cv_prog_CXXCPP=$CXXCPP
+fi
+echo "$as_me:$LINENO: result: $CXXCPP" >&5
+echo "${ECHO_T}$CXXCPP" >&6
+ac_preproc_ok=false
+for ac_cxx_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ # <limits.h> exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+ Syntax error
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_cxx_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether non-existent headers
+ # can be detected and how.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ac_nonexistent.h>
+_ACEOF
+if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5
+ (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } >/dev/null; then
+ if test -s conftest.err; then
+ ac_cpp_err=$ac_cxx_preproc_warn_flag
+ ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag
+ else
+ ac_cpp_err=
+ fi
+else
+ ac_cpp_err=yes
+fi
+if test -z "$ac_cpp_err"; then
+ # Broken: success on invalid input.
+continue
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then
+ :
+else
+ { { echo "$as_me:$LINENO: error: C++ preprocessor \"$CXXCPP\" fails sanity check
+See \`config.log' for more details." >&5
+echo "$as_me: error: C++ preprocessor \"$CXXCPP\" fails sanity check
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+ac_ext=cc
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+
+fi
+
+
+ac_ext=f
+ac_compile='$F77 -c $FFLAGS conftest.$ac_ext >&5'
+ac_link='$F77 -o conftest$ac_exeext $FFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_f77_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ for ac_prog in g77 f77 xlf frt pgf77 fort77 fl32 af77 f90 xlf90 pgf90 epcf90 f95 fort xlf95 ifc efc pgf95 lf95 gfortran
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_F77+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$F77"; then
+ ac_cv_prog_F77="$F77" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_F77="$ac_tool_prefix$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+F77=$ac_cv_prog_F77
+if test -n "$F77"; then
+ echo "$as_me:$LINENO: result: $F77" >&5
+echo "${ECHO_T}$F77" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$F77" && break
+ done
+fi
+if test -z "$F77"; then
+ ac_ct_F77=$F77
+ for ac_prog in g77 f77 xlf frt pgf77 fort77 fl32 af77 f90 xlf90 pgf90 epcf90 f95 fort xlf95 ifc efc pgf95 lf95 gfortran
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_F77+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_F77"; then
+ ac_cv_prog_ac_ct_F77="$ac_ct_F77" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_F77="$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_F77=$ac_cv_prog_ac_ct_F77
+if test -n "$ac_ct_F77"; then
+ echo "$as_me:$LINENO: result: $ac_ct_F77" >&5
+echo "${ECHO_T}$ac_ct_F77" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$ac_ct_F77" && break
+done
+
+ F77=$ac_ct_F77
+fi
+
+
+# Provide some information about the compiler.
+echo "$as_me:5332:" \
+ "checking for Fortran 77 compiler version" >&5
+ac_compiler=`set X $ac_compile; echo $2`
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5
+ (eval $ac_compiler --version </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5
+ (eval $ac_compiler -v </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5
+ (eval $ac_compiler -V </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+rm -f a.out
+
+# If we don't use `.F' as extension, the preprocessor is not run on the
+# input file. (Note that this only needs to work for GNU compilers.)
+ac_save_ext=$ac_ext
+ac_ext=F
+echo "$as_me:$LINENO: checking whether we are using the GNU Fortran 77 compiler" >&5
+echo $ECHO_N "checking whether we are using the GNU Fortran 77 compiler... $ECHO_C" >&6
+if test "${ac_cv_f77_compiler_gnu+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+ program main
+#ifndef __GNUC__
+ choke me
+#endif
+
+ end
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_f77_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_compiler_gnu=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_compiler_gnu=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_f77_compiler_gnu=$ac_compiler_gnu
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_f77_compiler_gnu" >&5
+echo "${ECHO_T}$ac_cv_f77_compiler_gnu" >&6
+ac_ext=$ac_save_ext
+ac_test_FFLAGS=${FFLAGS+set}
+ac_save_FFLAGS=$FFLAGS
+FFLAGS=
+echo "$as_me:$LINENO: checking whether $F77 accepts -g" >&5
+echo $ECHO_N "checking whether $F77 accepts -g... $ECHO_C" >&6
+if test "${ac_cv_prog_f77_g+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ FFLAGS=-g
+cat >conftest.$ac_ext <<_ACEOF
+ program main
+
+ end
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_f77_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_f77_g=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_prog_f77_g=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_prog_f77_g" >&5
+echo "${ECHO_T}$ac_cv_prog_f77_g" >&6
+if test "$ac_test_FFLAGS" = set; then
+ FFLAGS=$ac_save_FFLAGS
+elif test $ac_cv_prog_f77_g = yes; then
+ if test "x$ac_cv_f77_compiler_gnu" = xyes; then
+ FFLAGS="-g -O2"
+ else
+ FFLAGS="-g"
+ fi
+else
+ if test "x$ac_cv_f77_compiler_gnu" = xyes; then
+ FFLAGS="-O2"
+ else
+ FFLAGS=
+ fi
+fi
+
+G77=`test $ac_compiler_gnu = yes && echo yes`
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+# Autoconf 2.13's AC_OBJEXT and AC_EXEEXT macros only works for C compilers!
+
+# find the maximum length of command line arguments
+echo "$as_me:$LINENO: checking the maximum length of command line arguments" >&5
+echo $ECHO_N "checking the maximum length of command line arguments... $ECHO_C" >&6
+if test "${lt_cv_sys_max_cmd_len+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ i=0
+ teststring="ABCD"
+
+ case $build_os in
+ msdosdjgpp*)
+ # On DJGPP, this test can blow up pretty badly due to problems in libc
+ # (any single argument exceeding 2000 bytes causes a buffer overrun
+ # during glob expansion). Even if it were fixed, the result of this
+ # check would be larger than it should be.
+ lt_cv_sys_max_cmd_len=12288; # 12K is about right
+ ;;
+
+ gnu*)
+ # Under GNU Hurd, this test is not required because there is
+ # no limit to the length of command line arguments.
+ # Libtool will interpret -1 as no limit whatsoever
+ lt_cv_sys_max_cmd_len=-1;
+ ;;
+
+ cygwin* | mingw*)
+ # On Win9x/ME, this test blows up -- it succeeds, but takes
+ # about 5 minutes as the teststring grows exponentially.
+ # Worse, since 9x/ME are not pre-emptively multitasking,
+ # you end up with a "frozen" computer, even though with patience
+ # the test eventually succeeds (with a max line length of 256k).
+ # Instead, let's just punt: use the minimum linelength reported by
+ # all of the supported platforms: 8192 (on NT/2K/XP).
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ amigaos*)
+ # On AmigaOS with pdksh, this test takes hours, literally.
+ # So we just punt and use a minimum line length of 8192.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+ # This has been around since 386BSD, at least. Likely further.
+ if test -x /sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+ elif test -x /usr/sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+ else
+ lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs
+ fi
+ # And add a safety zone
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ ;;
+
+ interix*)
+ # We know the value 262144 and hardcode it with a safety zone (like BSD)
+ lt_cv_sys_max_cmd_len=196608
+ ;;
+
+ osf*)
+ # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+ # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+ # nice to cause kernel panics so lets avoid the loop below.
+ # First set a reasonable default.
+ lt_cv_sys_max_cmd_len=16384
+ #
+ if test -x /sbin/sysconfig; then
+ case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+ *1*) lt_cv_sys_max_cmd_len=-1 ;;
+ esac
+ fi
+ ;;
+ sco3.2v5*)
+ lt_cv_sys_max_cmd_len=102400
+ ;;
+ sysv5* | sco5v6* | sysv4.2uw2*)
+ kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+ if test -n "$kargmax"; then
+ lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'`
+ else
+ lt_cv_sys_max_cmd_len=32768
+ fi
+ ;;
+ *)
+ # If test is not a shell built-in, we'll probably end up computing a
+ # maximum length that is only half of the actual maximum length, but
+ # we can't tell.
+ SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+ while (test "X"`$SHELL $0 --fallback-echo "X$teststring" 2>/dev/null` \
+ = "XX$teststring") >/dev/null 2>&1 &&
+ new_result=`expr "X$teststring" : ".*" 2>&1` &&
+ lt_cv_sys_max_cmd_len=$new_result &&
+ test $i != 17 # 1/2 MB should be enough
+ do
+ i=`expr $i + 1`
+ teststring=$teststring$teststring
+ done
+ teststring=
+ # Add a significant safety factor because C++ compilers can tack on massive
+ # amounts of additional arguments before passing them to the linker.
+ # It appears as though 1/2 is a usable value.
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+ ;;
+ esac
+
+fi
+
+if test -n $lt_cv_sys_max_cmd_len ; then
+ echo "$as_me:$LINENO: result: $lt_cv_sys_max_cmd_len" >&5
+echo "${ECHO_T}$lt_cv_sys_max_cmd_len" >&6
+else
+ echo "$as_me:$LINENO: result: none" >&5
+echo "${ECHO_T}none" >&6
+fi
+
+
+
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+echo "$as_me:$LINENO: checking command to parse $NM output from $compiler object" >&5
+echo $ECHO_N "checking command to parse $NM output from $compiler object... $ECHO_C" >&6
+if test "${lt_cv_sys_global_symbol_pipe+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRST]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Transform an extracted symbol line into a proper C declaration
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^. .* \(.*\)$/extern int \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+ symcode='[BCDT]'
+ ;;
+cygwin* | mingw* | pw32*)
+ symcode='[ABCDGISTW]'
+ ;;
+hpux*) # Its linker distinguishes data from code symbols
+ if test "$host_cpu" = ia64; then
+ symcode='[ABCDEGRST]'
+ fi
+ lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+ lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+ ;;
+linux*)
+ if test "$host_cpu" = ia64; then
+ symcode='[ABCDGIRSTW]'
+ lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+ lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'"
+ fi
+ ;;
+irix* | nonstopux*)
+ symcode='[BCDEGRST]'
+ ;;
+osf*)
+ symcode='[BCDEGQRST]'
+ ;;
+solaris*)
+ symcode='[BDRT]'
+ ;;
+sco3.2v5*)
+ symcode='[DT]'
+ ;;
+sysv4.2uw2*)
+ symcode='[DT]'
+ ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+ symcode='[ABDT]'
+ ;;
+sysv4)
+ symcode='[DFNSTU]'
+ ;;
+esac
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+ opt_cr=`echo 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+ symcode='[ABCDGIRSTW]' ;;
+esac
+
+# Try without a prefix undercore, then with it.
+for ac_symprfx in "" "_"; do
+
+ # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+ symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+ # Write the raw and C identifiers.
+ lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+
+ # Check to see that the pipe works correctly.
+ pipe_works=no
+
+ rm -f conftest*
+ cat > conftest.$ac_ext <<EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+EOF
+
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if { (eval echo "$as_me:$LINENO: \"$NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist\"") >&5
+ (eval $NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && test -s "$nlist"; then
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ else
+ rm -f "$nlist"T
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if grep ' nm_test_var$' "$nlist" >/dev/null; then
+ if grep ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<EOF > conftest.$ac_ext
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+EOF
+ # Now generate the symbol file.
+ eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | grep -v main >> conftest.$ac_ext'
+
+ cat <<EOF >> conftest.$ac_ext
+#if defined (__STDC__) && __STDC__
+# define lt_ptr_t void *
+#else
+# define lt_ptr_t char *
+# define const
+#endif
+
+/* The mapping between symbol names and symbols. */
+const struct {
+ const char *name;
+ lt_ptr_t address;
+}
+lt_preloaded_symbols[] =
+{
+EOF
+ $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (lt_ptr_t) \&\2},/" < "$nlist" | grep -v main >> conftest.$ac_ext
+ cat <<\EOF >> conftest.$ac_ext
+ {0, (lt_ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif
+EOF
+ # Now try linking the two files.
+ mv conftest.$ac_objext conftstm.$ac_objext
+ lt_save_LIBS="$LIBS"
+ lt_save_CFLAGS="$CFLAGS"
+ LIBS="conftstm.$ac_objext"
+ CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag"
+ if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && test -s conftest${ac_exeext}; then
+ pipe_works=yes
+ fi
+ LIBS="$lt_save_LIBS"
+ CFLAGS="$lt_save_CFLAGS"
+ else
+ echo "cannot find nm_test_func in $nlist" >&5
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&5
+ fi
+ else
+ echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5
+ fi
+ else
+ echo "$progname: failed program was:" >&5
+ cat conftest.$ac_ext >&5
+ fi
+ rm -f conftest* conftst*
+
+ # Do not use the global_symbol_pipe unless it works.
+ if test "$pipe_works" = yes; then
+ break
+ else
+ lt_cv_sys_global_symbol_pipe=
+ fi
+done
+
+fi
+
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+ lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+ echo "$as_me:$LINENO: result: failed" >&5
+echo "${ECHO_T}failed" >&6
+else
+ echo "$as_me:$LINENO: result: ok" >&5
+echo "${ECHO_T}ok" >&6
+fi
+
+echo "$as_me:$LINENO: checking for objdir" >&5
+echo $ECHO_N "checking for objdir... $ECHO_C" >&6
+if test "${lt_cv_objdir+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ lt_cv_objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+fi
+echo "$as_me:$LINENO: result: $lt_cv_objdir" >&5
+echo "${ECHO_T}$lt_cv_objdir" >&6
+objdir=$lt_cv_objdir
+
+
+
+
+
+case $host_os in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e 1s/^X//'
+sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+
+# Constants:
+rm="rm -f"
+
+# Global variables:
+default_ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+ltmain="$ac_aux_dir/ltmain.sh"
+ofile="$default_ofile"
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}ar", so it can be a program name with args.
+set dummy ${ac_tool_prefix}ar; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_AR+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$AR"; then
+ ac_cv_prog_AR="$AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AR="${ac_tool_prefix}ar"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+AR=$ac_cv_prog_AR
+if test -n "$AR"; then
+ echo "$as_me:$LINENO: result: $AR" >&5
+echo "${ECHO_T}$AR" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_AR"; then
+ ac_ct_AR=$AR
+ # Extract the first word of "ar", so it can be a program name with args.
+set dummy ar; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_AR+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_AR"; then
+ ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_AR="ar"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ test -z "$ac_cv_prog_ac_ct_AR" && ac_cv_prog_ac_ct_AR="false"
+fi
+fi
+ac_ct_AR=$ac_cv_prog_ac_ct_AR
+if test -n "$ac_ct_AR"; then
+ echo "$as_me:$LINENO: result: $ac_ct_AR" >&5
+echo "${ECHO_T}$ac_ct_AR" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ AR=$ac_ct_AR
+else
+ AR="$ac_cv_prog_AR"
+fi
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args.
+set dummy ${ac_tool_prefix}ranlib; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_RANLIB+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$RANLIB"; then
+ ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+RANLIB=$ac_cv_prog_RANLIB
+if test -n "$RANLIB"; then
+ echo "$as_me:$LINENO: result: $RANLIB" >&5
+echo "${ECHO_T}$RANLIB" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_RANLIB"; then
+ ac_ct_RANLIB=$RANLIB
+ # Extract the first word of "ranlib", so it can be a program name with args.
+set dummy ranlib; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_RANLIB+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_RANLIB"; then
+ ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_RANLIB="ranlib"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ test -z "$ac_cv_prog_ac_ct_RANLIB" && ac_cv_prog_ac_ct_RANLIB=":"
+fi
+fi
+ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB
+if test -n "$ac_ct_RANLIB"; then
+ echo "$as_me:$LINENO: result: $ac_ct_RANLIB" >&5
+echo "${ECHO_T}$ac_ct_RANLIB" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ RANLIB=$ac_ct_RANLIB
+else
+ RANLIB="$ac_cv_prog_RANLIB"
+fi
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_STRIP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ echo "$as_me:$LINENO: result: $STRIP" >&5
+echo "${ECHO_T}$STRIP" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":"
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5
+echo "${ECHO_T}$ac_ct_STRIP" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ STRIP=$ac_ct_STRIP
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$AR" && AR=ar
+test -z "$AR_FLAGS" && AR_FLAGS=cru
+test -z "$AS" && AS=as
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+test -z "$LD" && LD=ld
+test -z "$LN_S" && LN_S="ln -s"
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+test -z "$NM" && NM=nm
+test -z "$SED" && SED=sed
+test -z "$OBJDUMP" && OBJDUMP=objdump
+test -z "$RANLIB" && RANLIB=:
+test -z "$STRIP" && STRIP=:
+test -z "$ac_objext" && ac_objext=o
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs$old_deplibs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+ case $host_os in
+ openbsd*)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$oldlib"
+ ;;
+ *)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$oldlib"
+ ;;
+ esac
+ old_archive_cmds="$old_archive_cmds~\$RANLIB \$oldlib"
+fi
+
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+
+# Only perform the check for file, if the check method requires it
+case $deplibs_check_method in
+file_magic*)
+ if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+ echo "$as_me:$LINENO: checking for ${ac_tool_prefix}file" >&5
+echo $ECHO_N "checking for ${ac_tool_prefix}file... $ECHO_C" >&6
+if test "${lt_cv_path_MAGIC_CMD+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/${ac_tool_prefix}file; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5
+echo "${ECHO_T}$MAGIC_CMD" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+ if test -n "$ac_tool_prefix"; then
+ echo "$as_me:$LINENO: checking for file" >&5
+echo $ECHO_N "checking for file... $ECHO_C" >&6
+if test "${lt_cv_path_MAGIC_CMD+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/file; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5
+echo "${ECHO_T}$MAGIC_CMD" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ else
+ MAGIC_CMD=:
+ fi
+fi
+
+ fi
+ ;;
+esac
+
+enable_dlopen=no
+enable_win32_dll=no
+
+# Check whether --enable-libtool-lock or --disable-libtool-lock was given.
+if test "${enable_libtool_lock+set}" = set; then
+ enableval="$enable_libtool_lock"
+
+fi;
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+
+# Check whether --with-pic or --without-pic was given.
+if test "${with_pic+set}" = set; then
+ withval="$with_pic"
+ pic_mode="$withval"
+else
+ pic_mode=default
+fi;
+test -z "$pic_mode" && pic_mode=default
+
+# Use C for the default configuration in the libtool script
+tagname=
+lt_save_CC="$CC"
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+objext=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}\n'
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+
+
+
+lt_prog_compiler_no_builtin_flag=
+
+if test "$GCC" = yes; then
+ lt_prog_compiler_no_builtin_flag=' -fno-builtin'
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -fno-rtti -fno-exceptions" >&5
+echo $ECHO_N "checking if $compiler supports -fno-rtti -fno-exceptions... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_rtti_exceptions+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_rtti_exceptions=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="-fno-rtti -fno-exceptions"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:6395: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:6399: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_rtti_exceptions=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_rtti_exceptions" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_rtti_exceptions" >&6
+
+if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then
+ lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions"
+else
+ :
+fi
+
+fi
+
+lt_prog_compiler_wl=
+lt_prog_compiler_pic=
+lt_prog_compiler_static=
+
+echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5
+echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6
+
+ if test "$GCC" = yes; then
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_static='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4'
+ ;;
+
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic='-fno-common'
+ ;;
+
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ lt_prog_compiler_can_build_shared=no
+ enable_shared=no
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic=-Kconform_pic
+ fi
+ ;;
+
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+ ;;
+
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ lt_prog_compiler_wl='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ else
+ lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ lt_prog_compiler_pic='-qnocommon'
+ lt_prog_compiler_wl='-Wl,'
+ ;;
+ esac
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ lt_prog_compiler_static='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC (with -KPIC) is the default.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ newsos6)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ linux*)
+ case $cc_basename in
+ icc* | ecc*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fpic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ ccc*)
+ lt_prog_compiler_wl='-Wl,'
+ # All Alpha code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+ esac
+ ;;
+
+ osf3* | osf4* | osf5*)
+ lt_prog_compiler_wl='-Wl,'
+ # All OSF/1 code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ solaris*)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95*)
+ lt_prog_compiler_wl='-Qoption ld ';;
+ *)
+ lt_prog_compiler_wl='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ lt_prog_compiler_wl='-Qoption ld '
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ lt_prog_compiler_pic='-Kconform_pic'
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ unicos*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_can_build_shared=no
+ ;;
+
+ uts4*)
+ lt_prog_compiler_pic='-pic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ *)
+ lt_prog_compiler_can_build_shared=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic" >&6
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic"; then
+
+echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5
+echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic works... $ECHO_C" >&6
+if test "${lt_prog_compiler_pic_works+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_pic_works=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic -DPIC"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:6663: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:6667: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_pic_works=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_works" >&6
+
+if test x"$lt_prog_compiler_pic_works" = xyes; then
+ case $lt_prog_compiler_pic in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;;
+ esac
+else
+ lt_prog_compiler_pic=
+ lt_prog_compiler_can_build_shared=no
+fi
+
+fi
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic=
+ ;;
+ *)
+ lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC"
+ ;;
+esac
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\"
+echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6
+if test "${lt_prog_compiler_static_works+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_static_works=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ printf "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_static_works=yes
+ fi
+ else
+ lt_prog_compiler_static_works=yes
+ fi
+ fi
+ $rm conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works" >&5
+echo "${ECHO_T}$lt_prog_compiler_static_works" >&6
+
+if test x"$lt_prog_compiler_static_works" = xyes; then
+ :
+else
+ lt_prog_compiler_static=
+fi
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5
+echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_c_o+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_c_o=no
+ $rm -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:6767: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:6771: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $rm conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files
+ $rm out/* && rmdir out
+ cd ..
+ rmdir conftest
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_c_o" >&6
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ echo "$as_me:$LINENO: checking if we can lock with hard links" >&5
+echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6
+ hard_links=yes
+ $rm conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ echo "$as_me:$LINENO: result: $hard_links" >&5
+echo "${ECHO_T}$hard_links" >&6
+ if test "$hard_links" = no; then
+ { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6
+
+ runpath_var=
+ allow_undefined_flag=
+ enable_shared_with_static_runtimes=no
+ archive_cmds=
+ archive_expsym_cmds=
+ old_archive_From_new_cmds=
+ old_archive_from_expsyms_cmds=
+ export_dynamic_flag_spec=
+ whole_archive_flag_spec=
+ thread_safe_flag_spec=
+ hardcode_libdir_flag_spec=
+ hardcode_libdir_flag_spec_ld=
+ hardcode_libdir_separator=
+ hardcode_direct=no
+ hardcode_minus_L=no
+ hardcode_shlibpath_var=unsupported
+ link_all_deplibs=unknown
+ hardcode_automatic=no
+ module_cmds=
+ module_expsym_cmds=
+ always_export_symbols=no
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ include_expsyms=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ exclude_expsyms="_GLOBAL_OFFSET_TABLE_"
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ extract_expsyms_cmds=
+ # Just being paranoid about ensuring that cc_basename is set.
+ for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+ case $host_os in
+ cygwin* | mingw* | pw32*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ ld_shlibs=yes
+ if test "$with_gnu_ld" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>/dev/null` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix3* | aix4* | aix5*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ ld_shlibs=no
+ cat <<EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.9.1, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to modify your PATH
+*** so that a non-GNU linker is found, and then restart.
+
+EOF
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+
+ # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+ # that the semantics of dynamic libraries on AmigaOS, at least up
+ # to version 4, is to share data among multiple programs linked
+ # with the same dynamic library. Since this doesn't match the
+ # behavior of shared libraries on other platforms, we can't use
+ # them.
+ ld_shlibs=no
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec='-L$libdir'
+ allow_undefined_flag=unsupported
+ always_export_symbols=no
+ enable_shared_with_static_runtimes=yes
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols'
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ interix3*)
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ linux*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ tmp_addflag=
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers
+ whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ esac
+ archive_cmds='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test $supports_anon_versioning = yes; then
+ archive_expsym_cmds='$echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ $echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+ ld_shlibs=no
+ cat <<EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+EOF
+ elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+
+ if test "$ld_shlibs" = no; then
+ runpath_var=
+ hardcode_libdir_flag_spec=
+ export_dynamic_flag_spec=
+ whole_archive_flag_spec=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ allow_undefined_flag=unsupported
+ always_export_symbols=yes
+ archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct=unsupported
+ fi
+ ;;
+
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds=''
+ hardcode_direct=yes
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ hardcode_direct=yes
+ else
+ # We have old collect2
+ hardcode_direct=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L=yes
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_libdir_separator=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ archive_expsym_cmds="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag="-z nodefs"
+ archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag=' ${wl}-bernotok'
+ allow_undefined_flag=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec='$convenience'
+ archive_cmds_need_lc=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ # see comment about different semantics on the GNU ld section
+ ld_shlibs=no
+ ;;
+
+ bsdi[45]*)
+ export_dynamic_flag_spec=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec=' '
+ allow_undefined_flag=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ old_archive_From_new_cmds='true'
+ # FIXME: Should let the user specify the lib program.
+ old_archive_cmds='lib /OUT:$oldlib$oldobjs$old_deplibs'
+ fix_srcfile_path='`cygpath -w "$srcfile"`'
+ enable_shared_with_static_runtimes=yes
+ ;;
+
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ allow_undefined_flag='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ allow_undefined_flag='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[012])
+ allow_undefined_flag='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ allow_undefined_flag='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ archive_cmds_need_lc=no
+ hardcode_direct=no
+ hardcode_automatic=yes
+ hardcode_shlibpath_var=unsupported
+ whole_archive_flag_spec=''
+ link_all_deplibs=yes
+ if test "$GCC" = yes ; then
+ output_verbose_link_cmd='echo'
+ archive_cmds='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ module_cmds='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ archive_cmds='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ module_cmds='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ freebsd1*)
+ ld_shlibs=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ archive_cmds='$CC -shared -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ archive_cmds='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ archive_cmds='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ export_dynamic_flag_spec='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ archive_cmds='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+
+ hardcode_direct=yes
+ export_dynamic_flag_spec='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_libdir_flag_spec_ld='+b $libdir'
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ ;;
+ *)
+ hardcode_direct=yes
+ export_dynamic_flag_spec='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_ld='-rpath $libdir'
+ fi
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ link_all_deplibs=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ newsos6)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_shlibpath_var=no
+ ;;
+
+ openbsd*)
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec='${wl}-E'
+ else
+ case $host_os in
+ openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-R$libdir'
+ ;;
+ *)
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ allow_undefined_flag=unsupported
+ archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ old_archive_From_new_cmds='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~
+ $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec='-rpath $libdir'
+ fi
+ hardcode_libdir_separator=:
+ ;;
+
+ solaris*)
+ no_undefined_flag=' -z text'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ archive_cmds='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp'
+ else
+ wlarc=''
+ archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ archive_expsym_cmds='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp'
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_shlibpath_var=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl, iff we do not link with $LD.
+ # Luckily, gcc supports the same syntax we need for Sun Studio.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ case $wlarc in
+ '')
+ whole_archive_flag_spec='-z allextract$convenience -z defaultextract' ;;
+ *)
+ whole_archive_flag_spec='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;;
+ esac ;;
+ esac
+ link_all_deplibs=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ archive_cmds='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ reload_cmds='$CC -r -o $output$reload_objs'
+ hardcode_direct=no
+ ;;
+ motorola)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4.3*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ export_dynamic_flag_spec='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ ld_shlibs=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*)
+ no_undefined_flag='${wl}-z,text'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag='${wl}-z,text'
+ allow_undefined_flag='${wl}-z,nodefs'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+ export_dynamic_flag_spec='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $ld_shlibs" >&5
+echo "${ECHO_T}$ld_shlibs" >&6
+test "$ld_shlibs" = no && can_build_shared=no
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5
+echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6
+ $rm conftest*
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl
+ pic_flag=$lt_prog_compiler_pic
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag
+ allow_undefined_flag=
+ if { (eval echo "$as_me:$LINENO: \"$archive_cmds 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5
+ (eval $archive_cmds 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ then
+ archive_cmds_need_lc=no
+ else
+ archive_cmds_need_lc=yes
+ fi
+ allow_undefined_flag=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $rm conftest*
+ echo "$as_me:$LINENO: result: $archive_cmds_need_lc" >&5
+echo "${ECHO_T}$archive_cmds_need_lc" >&6
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5
+echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix4* | aix5*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$host_os in
+ yes,cygwin* | yes,mingw* | yes,pw32*)
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $rm \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib"
+ ;;
+ mingw*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH printed by
+ # mingw gcc, but we are running on Cygwin. Gcc prints its search
+ # path with ; separators, and with drive letters. We can handle the
+ # drive letters (cygwin fileutils understands them), so leave them,
+ # especially as we might pass files found there to a mingw objdump,
+ # which wouldn't understand a cygwinified path. Ahh.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ ;;
+
+ *)
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+ # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same.
+ if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"`
+ else
+ sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib'
+ fi
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd1*)
+ dynamic_linker=no
+ ;;
+
+kfreebsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[123]*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ freebsd*) # from 4.6 on
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+interix3*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # find out which ABI we are using
+ libsuff=
+ case "$host_cpu" in
+ x86_64*|s390x*|powerpc64*)
+ echo '#line 8236 "configure"' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *64-bit*)
+ libsuff=64
+ sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+ esac
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+knetbsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+nto-qnx*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+solaris*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ shlibpath_overrides_runpath=no
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ shlibpath_overrides_runpath=yes
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+echo "$as_me:$LINENO: result: $dynamic_linker" >&5
+echo "${ECHO_T}$dynamic_linker" >&6
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5
+echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" || \
+ test -n "$runpath_var" || \
+ test "X$hardcode_automatic" = "Xyes" ; then
+
+ # We can hardcode non-existant directories.
+ if test "$hardcode_direct" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, )" != no &&
+ test "$hardcode_minus_L" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action=unsupported
+fi
+echo "$as_me:$LINENO: result: $hardcode_action" >&5
+echo "${ECHO_T}$hardcode_action" >&6
+
+if test "$hardcode_action" = relink; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+striplib=
+old_striplib=
+echo "$as_me:$LINENO: checking whether stripping libraries is possible" >&5
+echo $ECHO_N "checking whether stripping libraries is possible... $ECHO_C" >&6
+if test -n "$STRIP" && $STRIP -V 2>&1 | grep "GNU strip" >/dev/null; then
+ test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+ test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+ case $host_os in
+ darwin*)
+ if test -n "$STRIP" ; then
+ striplib="$STRIP -x"
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+ else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+ ;;
+ *)
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+ ;;
+ esac
+fi
+
+if test "x$enable_dlopen" != xyes; then
+ enable_dlopen=unknown
+ enable_dlopen_self=unknown
+ enable_dlopen_self_static=unknown
+else
+ lt_cv_dlopen=no
+ lt_cv_dlopen_libs=
+
+ case $host_os in
+ beos*)
+ lt_cv_dlopen="load_add_on"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ;;
+
+ mingw* | pw32*)
+ lt_cv_dlopen="LoadLibrary"
+ lt_cv_dlopen_libs=
+ ;;
+
+ cygwin*)
+ lt_cv_dlopen="dlopen"
+ lt_cv_dlopen_libs=
+ ;;
+
+ darwin*)
+ # if libdl is installed we need to link against it
+ echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5
+echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6
+if test "${ac_cv_lib_dl_dlopen+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char dlopen ();
+int
+main ()
+{
+dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_lib_dl_dlopen=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_lib_dl_dlopen=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5
+echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6
+if test $ac_cv_lib_dl_dlopen = yes; then
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+
+ lt_cv_dlopen="dyld"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+
+fi
+
+ ;;
+
+ *)
+ echo "$as_me:$LINENO: checking for shl_load" >&5
+echo $ECHO_N "checking for shl_load... $ECHO_C" >&6
+if test "${ac_cv_func_shl_load+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+/* Define shl_load to an innocuous variant, in case <limits.h> declares shl_load.
+ For example, HP-UX 11i <limits.h> declares gettimeofday. */
+#define shl_load innocuous_shl_load
+
+/* System header to define __stub macros and hopefully few prototypes,
+ which can conflict with char shl_load (); below.
+ Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ <limits.h> exists even on freestanding compilers. */
+
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+
+#undef shl_load
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+{
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char shl_load ();
+/* The GNU C library defines this for functions which it implements
+ to always fail with ENOSYS. Some functions are actually named
+ something starting with __ and the normal name is an alias. */
+#if defined (__stub_shl_load) || defined (__stub___shl_load)
+choke me
+#else
+char (*f) () = shl_load;
+#endif
+#ifdef __cplusplus
+}
+#endif
+
+int
+main ()
+{
+return f != shl_load;
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_func_shl_load=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_func_shl_load=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_func_shl_load" >&5
+echo "${ECHO_T}$ac_cv_func_shl_load" >&6
+if test $ac_cv_func_shl_load = yes; then
+ lt_cv_dlopen="shl_load"
+else
+ echo "$as_me:$LINENO: checking for shl_load in -ldld" >&5
+echo $ECHO_N "checking for shl_load in -ldld... $ECHO_C" >&6
+if test "${ac_cv_lib_dld_shl_load+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char shl_load ();
+int
+main ()
+{
+shl_load ();
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_lib_dld_shl_load=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_lib_dld_shl_load=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+echo "$as_me:$LINENO: result: $ac_cv_lib_dld_shl_load" >&5
+echo "${ECHO_T}$ac_cv_lib_dld_shl_load" >&6
+if test $ac_cv_lib_dld_shl_load = yes; then
+ lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-dld"
+else
+ echo "$as_me:$LINENO: checking for dlopen" >&5
+echo $ECHO_N "checking for dlopen... $ECHO_C" >&6
+if test "${ac_cv_func_dlopen+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+/* Define dlopen to an innocuous variant, in case <limits.h> declares dlopen.
+ For example, HP-UX 11i <limits.h> declares gettimeofday. */
+#define dlopen innocuous_dlopen
+
+/* System header to define __stub macros and hopefully few prototypes,
+ which can conflict with char dlopen (); below.
+ Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+ <limits.h> exists even on freestanding compilers. */
+
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+
+#undef dlopen
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+{
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char dlopen ();
+/* The GNU C library defines this for functions which it implements
+ to always fail with ENOSYS. Some functions are actually named
+ something starting with __ and the normal name is an alias. */
+#if defined (__stub_dlopen) || defined (__stub___dlopen)
+choke me
+#else
+char (*f) () = dlopen;
+#endif
+#ifdef __cplusplus
+}
+#endif
+
+int
+main ()
+{
+return f != dlopen;
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_func_dlopen=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_func_dlopen=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_func_dlopen" >&5
+echo "${ECHO_T}$ac_cv_func_dlopen" >&6
+if test $ac_cv_func_dlopen = yes; then
+ lt_cv_dlopen="dlopen"
+else
+ echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5
+echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6
+if test "${ac_cv_lib_dl_dlopen+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char dlopen ();
+int
+main ()
+{
+dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_lib_dl_dlopen=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_lib_dl_dlopen=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5
+echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6
+if test $ac_cv_lib_dl_dlopen = yes; then
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+ echo "$as_me:$LINENO: checking for dlopen in -lsvld" >&5
+echo $ECHO_N "checking for dlopen in -lsvld... $ECHO_C" >&6
+if test "${ac_cv_lib_svld_dlopen+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-lsvld $LIBS"
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char dlopen ();
+int
+main ()
+{
+dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_lib_svld_dlopen=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_lib_svld_dlopen=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+echo "$as_me:$LINENO: result: $ac_cv_lib_svld_dlopen" >&5
+echo "${ECHO_T}$ac_cv_lib_svld_dlopen" >&6
+if test $ac_cv_lib_svld_dlopen = yes; then
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"
+else
+ echo "$as_me:$LINENO: checking for dld_link in -ldld" >&5
+echo $ECHO_N "checking for dld_link in -ldld... $ECHO_C" >&6
+if test "${ac_cv_lib_dld_dld_link+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+/* Override any gcc2 internal prototype to avoid an error. */
+#ifdef __cplusplus
+extern "C"
+#endif
+/* We use char because int might match the return type of a gcc2
+ builtin and then its argument prototype would still apply. */
+char dld_link ();
+int
+main ()
+{
+dld_link ();
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_lib_dld_dld_link=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_lib_dld_dld_link=no
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+echo "$as_me:$LINENO: result: $ac_cv_lib_dld_dld_link" >&5
+echo "${ECHO_T}$ac_cv_lib_dld_dld_link" >&6
+if test $ac_cv_lib_dld_dld_link = yes; then
+ lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-dld"
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+ ;;
+ esac
+
+ if test "x$lt_cv_dlopen" != xno; then
+ enable_dlopen=yes
+ else
+ enable_dlopen=no
+ fi
+
+ case $lt_cv_dlopen in
+ dlopen)
+ save_CPPFLAGS="$CPPFLAGS"
+ test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+ save_LDFLAGS="$LDFLAGS"
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+ save_LIBS="$LIBS"
+ LIBS="$lt_cv_dlopen_libs $LIBS"
+
+ echo "$as_me:$LINENO: checking whether a program can dlopen itself" >&5
+echo $ECHO_N "checking whether a program can dlopen itself... $ECHO_C" >&6
+if test "${lt_cv_dlopen_self+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test "$cross_compiling" = yes; then :
+ lt_cv_dlopen_self=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<EOF
+#line 9133 "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+#ifdef __cplusplus
+extern "C" void exit (int);
+#endif
+
+void fnord() { int i=42;}
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ exit (status);
+}
+EOF
+ if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_dlopen_self" >&5
+echo "${ECHO_T}$lt_cv_dlopen_self" >&6
+
+ if test "x$lt_cv_dlopen_self" = xyes; then
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+ echo "$as_me:$LINENO: checking whether a statically linked program can dlopen itself" >&5
+echo $ECHO_N "checking whether a statically linked program can dlopen itself... $ECHO_C" >&6
+if test "${lt_cv_dlopen_self_static+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test "$cross_compiling" = yes; then :
+ lt_cv_dlopen_self_static=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<EOF
+#line 9233 "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+#ifdef __cplusplus
+extern "C" void exit (int);
+#endif
+
+void fnord() { int i=42;}
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ exit (status);
+}
+EOF
+ if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self_static=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_dlopen_self_static" >&5
+echo "${ECHO_T}$lt_cv_dlopen_self_static" >&6
+ fi
+
+ CPPFLAGS="$save_CPPFLAGS"
+ LDFLAGS="$save_LDFLAGS"
+ LIBS="$save_LIBS"
+ ;;
+ esac
+
+ case $lt_cv_dlopen_self in
+ yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+ *) enable_dlopen_self=unknown ;;
+ esac
+
+ case $lt_cv_dlopen_self_static in
+ yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+ *) enable_dlopen_self_static=unknown ;;
+ esac
+fi
+
+
+# Report which library types will actually be built
+echo "$as_me:$LINENO: checking if libtool supports shared libraries" >&5
+echo $ECHO_N "checking if libtool supports shared libraries... $ECHO_C" >&6
+echo "$as_me:$LINENO: result: $can_build_shared" >&5
+echo "${ECHO_T}$can_build_shared" >&6
+
+echo "$as_me:$LINENO: checking whether to build shared libraries" >&5
+echo $ECHO_N "checking whether to build shared libraries... $ECHO_C" >&6
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case $host_os in
+aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+
+aix4* | aix5*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+esac
+echo "$as_me:$LINENO: result: $enable_shared" >&5
+echo "${ECHO_T}$enable_shared" >&6
+
+echo "$as_me:$LINENO: checking whether to build static libraries" >&5
+echo $ECHO_N "checking whether to build static libraries... $ECHO_C" >&6
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+echo "$as_me:$LINENO: result: $enable_static" >&5
+echo "${ECHO_T}$enable_static" >&6
+
+# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ compiler \
+ CC \
+ LD \
+ lt_prog_compiler_wl \
+ lt_prog_compiler_pic \
+ lt_prog_compiler_static \
+ lt_prog_compiler_no_builtin_flag \
+ export_dynamic_flag_spec \
+ thread_safe_flag_spec \
+ whole_archive_flag_spec \
+ enable_shared_with_static_runtimes \
+ old_archive_cmds \
+ old_archive_from_new_cmds \
+ predep_objects \
+ postdep_objects \
+ predeps \
+ postdeps \
+ compiler_lib_search_path \
+ archive_cmds \
+ archive_expsym_cmds \
+ postinstall_cmds \
+ postuninstall_cmds \
+ old_archive_from_expsyms_cmds \
+ allow_undefined_flag \
+ no_undefined_flag \
+ export_symbols_cmds \
+ hardcode_libdir_flag_spec \
+ hardcode_libdir_flag_spec_ld \
+ hardcode_libdir_separator \
+ hardcode_automatic \
+ module_cmds \
+ module_expsym_cmds \
+ lt_cv_prog_compiler_c_o \
+ exclude_expsyms \
+ include_expsyms; do
+
+ case $var in
+ old_archive_cmds | \
+ old_archive_from_new_cmds | \
+ archive_cmds | \
+ archive_expsym_cmds | \
+ module_cmds | \
+ module_expsym_cmds | \
+ old_archive_from_expsyms_cmds | \
+ export_symbols_cmds | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\$0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'`
+ ;;
+ esac
+
+cfgfile="${ofile}T"
+ trap "$rm \"$cfgfile\"; exit 1" 1 2 15
+ $rm -f "$cfgfile"
+ { echo "$as_me:$LINENO: creating $ofile" >&5
+echo "$as_me: creating $ofile" >&6;}
+
+ cat <<__EOF__ >> "$cfgfile"
+#! $SHELL
+
+# `$echo "$cfgfile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $PROGRAM (GNU $PACKAGE $VERSION$TIMESTAMP)
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001
+# Free Software Foundation, Inc.
+#
+# This file is part of GNU Libtool:
+# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="$SED -e 1s/^X//"
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+# The names of the tagged configurations supported by this script.
+available_tags=
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU C compiler?
+with_gcc=$GCC
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_thread_safe_flag_spec
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_old_archive_cmds
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_predep_objects | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_postdep_objects | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_predeps
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_postdeps
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_compiler_lib_search_path | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$hardcode_automatic
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$fix_srcfile_path"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# ### END LIBTOOL CONFIG
+
+__EOF__
+
+
+ case $host_os in
+ aix3*)
+ cat <<\EOF >> "$cfgfile"
+
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+EOF
+ ;;
+ esac
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" || (rm -f "$cfgfile"; exit 1)
+
+ mv -f "$cfgfile" "$ofile" || \
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+
+# Check whether --with-tags or --without-tags was given.
+if test "${with_tags+set}" = set; then
+ withval="$with_tags"
+ tagnames="$withval"
+fi;
+
+if test -f "$ltmain" && test -n "$tagnames"; then
+ if test ! -f "${ofile}"; then
+ { echo "$as_me:$LINENO: WARNING: output file \`$ofile' does not exist" >&5
+echo "$as_me: WARNING: output file \`$ofile' does not exist" >&2;}
+ fi
+
+ if test -z "$LTCC"; then
+ eval "`$SHELL ${ofile} --config | grep '^LTCC='`"
+ if test -z "$LTCC"; then
+ { echo "$as_me:$LINENO: WARNING: output file \`$ofile' does not look like a libtool script" >&5
+echo "$as_me: WARNING: output file \`$ofile' does not look like a libtool script" >&2;}
+ else
+ { echo "$as_me:$LINENO: WARNING: using \`LTCC=$LTCC', extracted from \`$ofile'" >&5
+echo "$as_me: WARNING: using \`LTCC=$LTCC', extracted from \`$ofile'" >&2;}
+ fi
+ fi
+ if test -z "$LTCFLAGS"; then
+ eval "`$SHELL ${ofile} --config | grep '^LTCFLAGS='`"
+ fi
+
+ # Extract list of available tagged configurations in $ofile.
+ # Note that this assumes the entire list is on one line.
+ available_tags=`grep "^available_tags=" "${ofile}" | $SED -e 's/available_tags=\(.*$\)/\1/' -e 's/\"//g'`
+
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for tagname in $tagnames; do
+ IFS="$lt_save_ifs"
+ # Check whether tagname contains only valid characters
+ case `$echo "X$tagname" | $Xsed -e 's:[-_ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890,/]::g'` in
+ "") ;;
+ *) { { echo "$as_me:$LINENO: error: invalid tag name: $tagname" >&5
+echo "$as_me: error: invalid tag name: $tagname" >&2;}
+ { (exit 1); exit 1; }; }
+ ;;
+ esac
+
+ if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "${ofile}" > /dev/null
+ then
+ { { echo "$as_me:$LINENO: error: tag name \"$tagname\" already exists" >&5
+echo "$as_me: error: tag name \"$tagname\" already exists" >&2;}
+ { (exit 1); exit 1; }; }
+ fi
+
+ # Update the list of available tags.
+ if test -n "$tagname"; then
+ echo appending configuration tag \"$tagname\" to $ofile
+
+ case $tagname in
+ CXX)
+ if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ ac_ext=cc
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+
+
+
+
+archive_cmds_need_lc_CXX=no
+allow_undefined_flag_CXX=
+always_export_symbols_CXX=no
+archive_expsym_cmds_CXX=
+export_dynamic_flag_spec_CXX=
+hardcode_direct_CXX=no
+hardcode_libdir_flag_spec_CXX=
+hardcode_libdir_flag_spec_ld_CXX=
+hardcode_libdir_separator_CXX=
+hardcode_minus_L_CXX=no
+hardcode_shlibpath_var_CXX=unsupported
+hardcode_automatic_CXX=no
+module_cmds_CXX=
+module_expsym_cmds_CXX=
+link_all_deplibs_CXX=unknown
+old_archive_cmds_CXX=$old_archive_cmds
+no_undefined_flag_CXX=
+whole_archive_flag_spec_CXX=
+enable_shared_with_static_runtimes_CXX=no
+
+# Dependencies to place before and after the object being linked:
+predep_objects_CXX=
+postdep_objects_CXX=
+predeps_CXX=
+postdeps_CXX=
+compiler_lib_search_path_CXX=
+
+# Source file extension for C++ test sources.
+ac_ext=cpp
+
+# Object file extension for compiled C++ test sources.
+objext=o
+objext_CXX=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(int, char *[]) { return(0); }\n'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_LD=$LD
+lt_save_GCC=$GCC
+GCC=$GXX
+lt_save_with_gnu_ld=$with_gnu_ld
+lt_save_path_LD=$lt_cv_path_LD
+if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then
+ lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx
+else
+ $as_unset lt_cv_prog_gnu_ld
+fi
+if test -n "${lt_cv_path_LDCXX+set}"; then
+ lt_cv_path_LD=$lt_cv_path_LDCXX
+else
+ $as_unset lt_cv_path_LD
+fi
+test -z "${LDCXX+set}" || LD=$LDCXX
+CC=${CXX-"c++"}
+compiler=$CC
+compiler_CXX=$CC
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+
+# We don't want -fno-exception wen compiling C++ code, so set the
+# no_builtin_flag separately
+if test "$GXX" = yes; then
+ lt_prog_compiler_no_builtin_flag_CXX=' -fno-builtin'
+else
+ lt_prog_compiler_no_builtin_flag_CXX=
+fi
+
+if test "$GXX" = yes; then
+ # Set up default GNU C++ configuration
+
+
+# Check whether --with-gnu-ld or --without-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then
+ withval="$with_gnu_ld"
+ test "$withval" = no || with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi;
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ echo "$as_me:$LINENO: checking for ld used by $CC" >&5
+echo $ECHO_N "checking for ld used by $CC... $ECHO_C" >&6
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [\\/]* | ?:[\\/]*)
+ re_direlt='/[^/][^/]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'`
+ while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ echo "$as_me:$LINENO: checking for GNU ld" >&5
+echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6
+else
+ echo "$as_me:$LINENO: checking for non-GNU ld" >&5
+echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6
+fi
+if test "${lt_cv_path_LD+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+ *GNU* | *'with BFD'*)
+ test "$with_gnu_ld" != no && break
+ ;;
+ *)
+ test "$with_gnu_ld" != yes && break
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+else
+ lt_cv_path_LD="$LD" # Let the user override the test with a path.
+fi
+fi
+
+LD="$lt_cv_path_LD"
+if test -n "$LD"; then
+ echo "$as_me:$LINENO: result: $LD" >&5
+echo "${ECHO_T}$LD" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5
+echo "$as_me: error: no acceptable ld found in \$PATH" >&2;}
+ { (exit 1); exit 1; }; }
+echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5
+echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6
+if test "${lt_cv_prog_gnu_ld+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+ lt_cv_prog_gnu_ld=yes
+ ;;
+*)
+ lt_cv_prog_gnu_ld=no
+ ;;
+esac
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_gnu_ld" >&5
+echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+
+ # Check if GNU C++ uses GNU ld as the underlying linker, since the
+ # archiving commands below assume that GNU ld is being used.
+ if test "$with_gnu_ld" = yes; then
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to
+ # investigate it a little bit more. (MM)
+ wlarc='${wl}'
+
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if eval "`$CC -print-prog-name=ld` --help 2>&1" | \
+ grep 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec_CXX=
+ fi
+ else
+ with_gnu_ld=no
+ wlarc=
+
+ # A generic and very simple default shared library creation
+ # command for GNU C++ for the case where it uses the native
+ # linker, instead of GNU ld. If possible, this setting should
+ # overridden to take advantage of the native linker features on
+ # the platform it is being used on.
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ fi
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+else
+ GXX=no
+ with_gnu_ld=no
+ wlarc=
+fi
+
+# PORTME: fill in a description of your system's C++ link characteristics
+echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6
+ld_shlibs_CXX=yes
+case $host_os in
+ aix3*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ case $ld_flag in
+ *-brtl*)
+ aix_use_runtimelinking=yes
+ break
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds_CXX=''
+ hardcode_direct_CXX=yes
+ hardcode_libdir_separator_CXX=':'
+ link_all_deplibs_CXX=yes
+
+ if test "$GXX" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ hardcode_direct_CXX=yes
+ else
+ # We have old collect2
+ hardcode_direct_CXX=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L_CXX=yes
+ hardcode_libdir_flag_spec_CXX='-L$libdir'
+ hardcode_libdir_separator_CXX=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols_CXX=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag_CXX='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath"
+
+ archive_expsym_cmds_CXX="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec_CXX='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag_CXX="-z nodefs"
+ archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_cxx_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag_CXX=' ${wl}-bernotok'
+ allow_undefined_flag_CXX=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec_CXX='$convenience'
+ archive_cmds_need_lc_CXX=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag_CXX=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds_CXX='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs_CXX=no
+ fi
+ ;;
+
+ chorus*)
+ case $cc_basename in
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, CXX) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec_CXX='-L$libdir'
+ allow_undefined_flag_CXX=unsupported
+ always_export_symbols_CXX=no
+ enable_shared_with_static_runtimes_CXX=yes
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds_CXX='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ allow_undefined_flag_CXX='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ allow_undefined_flag_CXX='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[012])
+ allow_undefined_flag_CXX='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ allow_undefined_flag_CXX='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ archive_cmds_need_lc_CXX=no
+ hardcode_direct_CXX=no
+ hardcode_automatic_CXX=yes
+ hardcode_shlibpath_var_CXX=unsupported
+ whole_archive_flag_spec_CXX=''
+ link_all_deplibs_CXX=yes
+
+ if test "$GXX" = yes ; then
+ lt_int_apple_cc_single_mod=no
+ output_verbose_link_cmd='echo'
+ if $CC -dumpspecs 2>&1 | $EGREP 'single_module' >/dev/null ; then
+ lt_int_apple_cc_single_mod=yes
+ fi
+ if test "X$lt_int_apple_cc_single_mod" = Xyes ; then
+ archive_cmds_CXX='$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ else
+ archive_cmds_CXX='$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ fi
+ module_cmds_CXX='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ if test "X$lt_int_apple_cc_single_mod" = Xyes ; then
+ archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ fi
+ module_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ archive_cmds_CXX='$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ module_cmds_CXX='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+ freebsd[12]*)
+ # C++ shared libraries reported to be fairly broken before switch to ELF
+ ld_shlibs_CXX=no
+ ;;
+ freebsd-elf*)
+ archive_cmds_need_lc_CXX=no
+ ;;
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF
+ # conventions
+ ld_shlibs_CXX=yes
+ ;;
+ gnu*)
+ ;;
+ hpux9*)
+ hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ hardcode_direct_CXX=yes
+ hardcode_minus_L_CXX=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aCC*)
+ archive_cmds_CXX='$rm $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "[-]L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ archive_cmds_CXX='$rm $output_objdir/$soname~$CC -shared -nostdlib -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+ hpux10*|hpux11*)
+ if test $with_gnu_ld = no; then
+ hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_libdir_flag_spec_ld_CXX='+b $libdir'
+ ;;
+ *)
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ ;;
+ esac
+ fi
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_direct_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ ;;
+ *)
+ hardcode_direct_CXX=yes
+ hardcode_minus_L_CXX=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+ ;;
+ esac
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aCC*)
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test $with_gnu_ld = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ fi
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+ interix3*)
+ hardcode_direct_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds_CXX='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds_CXX='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+ irix5* | irix6*)
+ case $cc_basename in
+ CC*)
+ # SGI C++
+ archive_cmds_CXX='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ # Archives containing C++ object files must be created using
+ # "CC -ar", where "CC" is the IRIX C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ old_archive_cmds_CXX='$CC -ar -WR,-u -o $oldlib $oldobjs'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test "$with_gnu_ld" = no; then
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` -o $lib'
+ fi
+ fi
+ link_all_deplibs_CXX=yes
+ ;;
+ esac
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+ ;;
+ linux*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+ archive_expsym_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | grep "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+
+ hardcode_libdir_flag_spec_CXX='${wl}--rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs'
+ ;;
+ icpc*)
+ # Intel C++
+ with_gnu_ld=yes
+ # version 8.0 and above of icpc choke on multiply defined symbols
+ # if we add $predep_objects and $postdep_objects, however 7.1 and
+ # earlier do not add the objects themselves.
+ case `$CC -V 2>&1` in
+ *"Version 7."*)
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ *) # Version 8.0 or newer
+ tmp_idyn=
+ case $host_cpu in
+ ia64*) tmp_idyn=' -i_dynamic';;
+ esac
+ archive_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ esac
+ archive_cmds_need_lc_CXX=no
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+ whole_archive_flag_spec_CXX='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ ;;
+ pgCC*)
+ # Portland Group C++ compiler
+ archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+ whole_archive_flag_spec_CXX='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ ;;
+ cxx*)
+ # Compaq C++
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols'
+
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec_CXX='-rpath $libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ esac
+ ;;
+ lynxos*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ m88k*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds_CXX='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags'
+ wlarc=
+ hardcode_libdir_flag_spec_CXX='-R$libdir'
+ hardcode_direct_CXX=yes
+ hardcode_shlibpath_var_CXX=no
+ fi
+ # Workaround some broken pre-1.5 toolchains
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"'
+ ;;
+ openbsd2*)
+ # C++ shared libraries are fairly broken
+ ld_shlibs_CXX=no
+ ;;
+ openbsd*)
+ hardcode_direct_CXX=yes
+ hardcode_shlibpath_var_CXX=no
+ archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib'
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ fi
+ output_verbose_link_cmd='echo'
+ ;;
+ osf3*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs'
+
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ cxx*)
+ allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && echo ${wl}-set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_CXX='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+ osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Archives containing C++ object files must be created using
+ # the KAI C++ compiler.
+ old_archive_cmds_CXX='$CC -o $oldlib $oldobjs'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ cxx*)
+ allow_undefined_flag_CXX=' -expect_unresolved \*'
+ archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds_CXX='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~
+ echo "-hidden">> $lib.exp~
+ $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname -Wl,-input -Wl,$lib.exp `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~
+ $rm $lib.exp'
+
+ hardcode_libdir_flag_spec_CXX='-rpath $libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_CXX='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+ psos*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ lcc*)
+ # Lucid
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ archive_cmds_need_lc_CXX=yes
+ no_undefined_flag_CXX=' -zdefs'
+ archive_cmds_CXX='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ hardcode_libdir_flag_spec_CXX='-R$libdir'
+ hardcode_shlibpath_var_CXX=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The C++ compiler is used as linker so we must use $wl
+ # flag to pass the commands to the underlying system
+ # linker. We must also pass each convience library through
+ # to the system linker between allextract/defaultextract.
+ # The C++ compiler will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ whole_archive_flag_spec_CXX='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract'
+ ;;
+ esac
+ link_all_deplibs_CXX=yes
+
+ output_verbose_link_cmd='echo'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ old_archive_cmds_CXX='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+
+ # The C++ compiler must be used to create the archive.
+ old_archive_cmds_CXX='$CC $LDFLAGS -archive -o $oldlib $oldobjs'
+ ;;
+ *)
+ # GNU C++ compiler with Solaris linker
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ no_undefined_flag_CXX=' ${wl}-z ${wl}defs'
+ if $CC --version | grep -v '^2\.7' > /dev/null; then
+ archive_cmds_CXX='$CC -shared -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd="$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\""
+ else
+ # g++ 2.7 appears to require `-G' NOT `-shared' on this
+ # platform.
+ archive_cmds_CXX='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd="$CC -G $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\""
+ fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-R $wl$libdir'
+ fi
+ ;;
+ esac
+ ;;
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+ no_undefined_flag_CXX='${wl}-z,text'
+ archive_cmds_need_lc_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ archive_cmds_CXX='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ # For security reasons, it is highly recommended that you always
+ # use absolute paths for naming shared libraries, and exclude the
+ # DT_RUNPATH tag from executables and libraries. But doing so
+ # requires that you compile everything twice, which is a pain.
+ # So that behaviour is only enabled if SCOABSPATH is set to a
+ # non-empty value in the environment. Most likely only useful for
+ # creating official distributions of packages.
+ # This is a hack until libtool officially supports absolute path
+ # names for shared libraries.
+ no_undefined_flag_CXX='${wl}-z,text'
+ allow_undefined_flag_CXX='${wl}-z,nodefs'
+ archive_cmds_need_lc_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ hardcode_libdir_flag_spec_CXX='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ hardcode_libdir_separator_CXX=':'
+ link_all_deplibs_CXX=yes
+ export_dynamic_flag_spec_CXX='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ archive_cmds_CXX='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+ vxworks*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+esac
+echo "$as_me:$LINENO: result: $ld_shlibs_CXX" >&5
+echo "${ECHO_T}$ld_shlibs_CXX" >&6
+test "$ld_shlibs_CXX" = no && can_build_shared=no
+
+GCC_CXX="$GXX"
+LD_CXX="$LD"
+
+
+cat > conftest.$ac_ext <<EOF
+class Foo
+{
+public:
+ Foo (void) { a = 0; }
+private:
+ int a;
+};
+EOF
+
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ # Parse the compiler output and extract the necessary
+ # objects, libraries and library flags.
+
+ # Sentinel used to keep track of whether or not we are before
+ # the conftest object file.
+ pre_test_object_deps_done=no
+
+ # The `*' in the case matches for architectures that use `case' in
+ # $output_verbose_cmd can trigger glob expansion during the loop
+ # eval without this substitution.
+ output_verbose_link_cmd=`$echo "X$output_verbose_link_cmd" | $Xsed -e "$no_glob_subst"`
+
+ for p in `eval $output_verbose_link_cmd`; do
+ case $p in
+
+ -L* | -R* | -l*)
+ # Some compilers place space between "-{L,R}" and the path.
+ # Remove the space.
+ if test $p = "-L" \
+ || test $p = "-R"; then
+ prev=$p
+ continue
+ else
+ prev=
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ case $p in
+ -L* | -R*)
+ # Internal compiler library paths should come after those
+ # provided the user. The postdeps already come after the
+ # user supplied libs so there is no need to process them.
+ if test -z "$compiler_lib_search_path_CXX"; then
+ compiler_lib_search_path_CXX="${prev}${p}"
+ else
+ compiler_lib_search_path_CXX="${compiler_lib_search_path_CXX} ${prev}${p}"
+ fi
+ ;;
+ # The "-l" case would never come before the object being
+ # linked, so don't bother handling this case.
+ esac
+ else
+ if test -z "$postdeps_CXX"; then
+ postdeps_CXX="${prev}${p}"
+ else
+ postdeps_CXX="${postdeps_CXX} ${prev}${p}"
+ fi
+ fi
+ ;;
+
+ *.$objext)
+ # This assumes that the test object file only shows up
+ # once in the compiler output.
+ if test "$p" = "conftest.$objext"; then
+ pre_test_object_deps_done=yes
+ continue
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ if test -z "$predep_objects_CXX"; then
+ predep_objects_CXX="$p"
+ else
+ predep_objects_CXX="$predep_objects_CXX $p"
+ fi
+ else
+ if test -z "$postdep_objects_CXX"; then
+ postdep_objects_CXX="$p"
+ else
+ postdep_objects_CXX="$postdep_objects_CXX $p"
+ fi
+ fi
+ ;;
+
+ *) ;; # Ignore the rest.
+
+ esac
+ done
+
+ # Clean up.
+ rm -f a.out a.exe
+else
+ echo "libtool.m4: error: problem compiling CXX test program"
+fi
+
+$rm -f confest.$objext
+
+# PORTME: override above test on systems where it is broken
+case $host_os in
+interix3*)
+ # Interix 3.5 installs completely hosed .la files for C++, so rather than
+ # hack all around it, let's just trust "g++" to DTRT.
+ predep_objects_CXX=
+ postdep_objects_CXX=
+ postdeps_CXX=
+ ;;
+
+solaris*)
+ case $cc_basename in
+ CC*)
+ # Adding this requires a known-good setup of shared libraries for
+ # Sun compiler versions before 5.6, else PIC objects from an old
+ # archive will be linked into the output, leading to subtle bugs.
+ postdeps_CXX='-lCstd -lCrun'
+ ;;
+ esac
+ ;;
+esac
+
+
+case " $postdeps_CXX " in
+*" -lc "*) archive_cmds_need_lc_CXX=no ;;
+esac
+
+lt_prog_compiler_wl_CXX=
+lt_prog_compiler_pic_CXX=
+lt_prog_compiler_static_CXX=
+
+echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5
+echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6
+
+ # C++ specific cases for pic, static, wl, etc.
+ if test "$GXX" = yes; then
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_CXX='-Bstatic'
+ fi
+ ;;
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic_CXX='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+ mingw* | os2* | pw32*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_CXX='-DDLL_EXPORT'
+ ;;
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic_CXX='-fno-common'
+ ;;
+ *djgpp*)
+ # DJGPP does not support shared libraries at all
+ lt_prog_compiler_pic_CXX=
+ ;;
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic_CXX=-Kconform_pic
+ fi
+ ;;
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ esac
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ esac
+ else
+ case $host_os in
+ aix4* | aix5*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_CXX='-Bstatic'
+ else
+ lt_prog_compiler_static_CXX='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ chorus*)
+ case $cc_basename in
+ cxch68*)
+ # Green Hills C++ Compiler
+ # _LT_AC_TAGVAR(lt_prog_compiler_static, CXX)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a"
+ ;;
+ esac
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ lt_prog_compiler_pic_CXX='-qnocommon'
+ lt_prog_compiler_wl_CXX='-Wl,'
+ ;;
+ esac
+ ;;
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ lt_prog_compiler_pic_CXX='-KPIC'
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ # FreeBSD uses GNU C++
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='${wl}-a ${wl}archive'
+ if test "$host_cpu" != ia64; then
+ lt_prog_compiler_pic_CXX='+Z'
+ fi
+ ;;
+ aCC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='${wl}-a ${wl}archive'
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='+Z'
+ ;;
+ esac
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ interix*)
+ # This is c89, which is MS Visual C++ (no shared libs)
+ # Anyone wants to do a port?
+ ;;
+ irix5* | irix6* | nonstopux*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='-non_shared'
+ # CC pic flag -KPIC is the default.
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ linux*)
+ case $cc_basename in
+ KCC*)
+ # KAI C++ Compiler
+ lt_prog_compiler_wl_CXX='--backend -Wl,'
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ icpc* | ecpc*)
+ # Intel C++
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-static'
+ ;;
+ pgCC*)
+ # Portland Group C++ compiler.
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-fpic'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ cxx*)
+ # Compaq C++
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_static_CXX='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ lynxos*)
+ ;;
+ m88k*)
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ lt_prog_compiler_pic_CXX='-W c,exportall'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ netbsd*)
+ ;;
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ lt_prog_compiler_wl_CXX='--backend -Wl,'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ cxx*)
+ # Digital/Compaq C++
+ lt_prog_compiler_wl_CXX='-Wl,'
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_static_CXX='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ psos*)
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ lt_prog_compiler_wl_CXX='-Qoption ld '
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ lt_prog_compiler_pic_CXX='-PIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ lt_prog_compiler_pic_CXX='-pic'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ lcc*)
+ # Lucid
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ lt_prog_compiler_pic_CXX='-KPIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ esac
+ ;;
+ vxworks*)
+ ;;
+ *)
+ lt_prog_compiler_can_build_shared_CXX=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_CXX" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_CXX" >&6
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic_CXX"; then
+
+echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works" >&5
+echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works... $ECHO_C" >&6
+if test "${lt_prog_compiler_pic_works_CXX+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_pic_works_CXX=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic_CXX -DPIC"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:11576: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:11580: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_pic_works_CXX=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_CXX" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_works_CXX" >&6
+
+if test x"$lt_prog_compiler_pic_works_CXX" = xyes; then
+ case $lt_prog_compiler_pic_CXX in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic_CXX=" $lt_prog_compiler_pic_CXX" ;;
+ esac
+else
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_can_build_shared_CXX=no
+fi
+
+fi
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic_CXX=
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX="$lt_prog_compiler_pic_CXX -DPIC"
+ ;;
+esac
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl_CXX eval lt_tmp_static_flag=\"$lt_prog_compiler_static_CXX\"
+echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6
+if test "${lt_prog_compiler_static_works_CXX+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_static_works_CXX=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ printf "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_static_works_CXX=yes
+ fi
+ else
+ lt_prog_compiler_static_works_CXX=yes
+ fi
+ fi
+ $rm conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_CXX" >&5
+echo "${ECHO_T}$lt_prog_compiler_static_works_CXX" >&6
+
+if test x"$lt_prog_compiler_static_works_CXX" = xyes; then
+ :
+else
+ lt_prog_compiler_static_CXX=
+fi
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5
+echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_c_o_CXX+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_c_o_CXX=no
+ $rm -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:11680: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:11684: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o_CXX=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $rm conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files
+ $rm out/* && rmdir out
+ cd ..
+ rmdir conftest
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_CXX" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_c_o_CXX" >&6
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o_CXX" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ echo "$as_me:$LINENO: checking if we can lock with hard links" >&5
+echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6
+ hard_links=yes
+ $rm conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ echo "$as_me:$LINENO: result: $hard_links" >&5
+echo "${ECHO_T}$hard_links" >&6
+ if test "$hard_links" = no; then
+ { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6
+
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ case $host_os in
+ aix4* | aix5*)
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ export_symbols_cmds_CXX='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds_CXX='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ fi
+ ;;
+ pw32*)
+ export_symbols_cmds_CXX="$ltdll_cmds"
+ ;;
+ cygwin* | mingw*)
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/;/^.* __nm__/s/^.* __nm__\([^ ]*\) [^ ]*/\1 DATA/;/^I /d;/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ *)
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ esac
+
+echo "$as_me:$LINENO: result: $ld_shlibs_CXX" >&5
+echo "${ECHO_T}$ld_shlibs_CXX" >&6
+test "$ld_shlibs_CXX" = no && can_build_shared=no
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc_CXX" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc_CXX=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds_CXX in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5
+echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6
+ $rm conftest*
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl_CXX
+ pic_flag=$lt_prog_compiler_pic_CXX
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag_CXX
+ allow_undefined_flag_CXX=
+ if { (eval echo "$as_me:$LINENO: \"$archive_cmds_CXX 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5
+ (eval $archive_cmds_CXX 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ then
+ archive_cmds_need_lc_CXX=no
+ else
+ archive_cmds_need_lc_CXX=yes
+ fi
+ allow_undefined_flag_CXX=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $rm conftest*
+ echo "$as_me:$LINENO: result: $archive_cmds_need_lc_CXX" >&5
+echo "${ECHO_T}$archive_cmds_need_lc_CXX" >&6
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5
+echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix4* | aix5*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$host_os in
+ yes,cygwin* | yes,mingw* | yes,pw32*)
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $rm \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib"
+ ;;
+ mingw*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH printed by
+ # mingw gcc, but we are running on Cygwin. Gcc prints its search
+ # path with ; separators, and with drive letters. We can handle the
+ # drive letters (cygwin fileutils understands them), so leave them,
+ # especially as we might pass files found there to a mingw objdump,
+ # which wouldn't understand a cygwinified path. Ahh.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ ;;
+
+ *)
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+ # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same.
+ if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"`
+ else
+ sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib'
+ fi
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd1*)
+ dynamic_linker=no
+ ;;
+
+kfreebsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[123]*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ freebsd*) # from 4.6 on
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+interix3*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # find out which ABI we are using
+ libsuff=
+ case "$host_cpu" in
+ x86_64*|s390x*|powerpc64*)
+ echo '#line 12216 "configure"' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *64-bit*)
+ libsuff=64
+ sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+ esac
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+knetbsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+nto-qnx*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+solaris*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ shlibpath_overrides_runpath=no
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ shlibpath_overrides_runpath=yes
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+echo "$as_me:$LINENO: result: $dynamic_linker" >&5
+echo "${ECHO_T}$dynamic_linker" >&6
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5
+echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6
+hardcode_action_CXX=
+if test -n "$hardcode_libdir_flag_spec_CXX" || \
+ test -n "$runpath_var_CXX" || \
+ test "X$hardcode_automatic_CXX" = "Xyes" ; then
+
+ # We can hardcode non-existant directories.
+ if test "$hardcode_direct_CXX" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, CXX)" != no &&
+ test "$hardcode_minus_L_CXX" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action_CXX=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action_CXX=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action_CXX=unsupported
+fi
+echo "$as_me:$LINENO: result: $hardcode_action_CXX" >&5
+echo "${ECHO_T}$hardcode_action_CXX" >&6
+
+if test "$hardcode_action_CXX" = relink; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ compiler_CXX \
+ CC_CXX \
+ LD_CXX \
+ lt_prog_compiler_wl_CXX \
+ lt_prog_compiler_pic_CXX \
+ lt_prog_compiler_static_CXX \
+ lt_prog_compiler_no_builtin_flag_CXX \
+ export_dynamic_flag_spec_CXX \
+ thread_safe_flag_spec_CXX \
+ whole_archive_flag_spec_CXX \
+ enable_shared_with_static_runtimes_CXX \
+ old_archive_cmds_CXX \
+ old_archive_from_new_cmds_CXX \
+ predep_objects_CXX \
+ postdep_objects_CXX \
+ predeps_CXX \
+ postdeps_CXX \
+ compiler_lib_search_path_CXX \
+ archive_cmds_CXX \
+ archive_expsym_cmds_CXX \
+ postinstall_cmds_CXX \
+ postuninstall_cmds_CXX \
+ old_archive_from_expsyms_cmds_CXX \
+ allow_undefined_flag_CXX \
+ no_undefined_flag_CXX \
+ export_symbols_cmds_CXX \
+ hardcode_libdir_flag_spec_CXX \
+ hardcode_libdir_flag_spec_ld_CXX \
+ hardcode_libdir_separator_CXX \
+ hardcode_automatic_CXX \
+ module_cmds_CXX \
+ module_expsym_cmds_CXX \
+ lt_cv_prog_compiler_c_o_CXX \
+ exclude_expsyms_CXX \
+ include_expsyms_CXX; do
+
+ case $var in
+ old_archive_cmds_CXX | \
+ old_archive_from_new_cmds_CXX | \
+ archive_cmds_CXX | \
+ archive_expsym_cmds_CXX | \
+ module_cmds_CXX | \
+ module_expsym_cmds_CXX | \
+ old_archive_from_expsyms_cmds_CXX | \
+ export_symbols_cmds_CXX | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\$0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'`
+ ;;
+ esac
+
+cfgfile="$ofile"
+
+ cat <<__EOF__ >> "$cfgfile"
+# ### BEGIN LIBTOOL TAG CONFIG: $tagname
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_CXX
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_CXX
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_compiler_CXX
+
+# Is the compiler the GNU C compiler?
+with_gcc=$GCC_CXX
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_LD_CXX
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_CXX
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_CXX
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_CXX
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_CXX
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_CXX
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_CXX
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_CXX
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_thread_safe_flag_spec_CXX
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_old_archive_cmds_CXX
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_CXX
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_CXX
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_archive_cmds_CXX
+archive_expsym_cmds=$lt_archive_expsym_cmds_CXX
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_module_cmds_CXX
+module_expsym_cmds=$lt_module_expsym_cmds_CXX
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_predep_objects_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_postdep_objects_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_predeps_CXX
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_postdeps_CXX
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_CXX
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_CXX
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_CXX
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_CXX
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_CXX
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_CXX
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct_CXX
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L_CXX
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_CXX
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$hardcode_automatic_CXX
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_CXX
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$fix_srcfile_path_CXX"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$always_export_symbols_CXX
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_CXX
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_CXX
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_CXX
+
+# ### END LIBTOOL TAG CONFIG: $tagname
+
+__EOF__
+
+
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC=$lt_save_CC
+LDCXX=$LD
+LD=$lt_save_LD
+GCC=$lt_save_GCC
+with_gnu_ldcxx=$with_gnu_ld
+with_gnu_ld=$lt_save_with_gnu_ld
+lt_cv_path_LDCXX=$lt_cv_path_LD
+lt_cv_path_LD=$lt_save_path_LD
+lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld
+lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld
+
+ else
+ tagname=""
+ fi
+ ;;
+
+ F77)
+ if test -n "$F77" && test "X$F77" != "Xno"; then
+
+ac_ext=f
+ac_compile='$F77 -c $FFLAGS conftest.$ac_ext >&5'
+ac_link='$F77 -o conftest$ac_exeext $FFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_f77_compiler_gnu
+
+
+archive_cmds_need_lc_F77=no
+allow_undefined_flag_F77=
+always_export_symbols_F77=no
+archive_expsym_cmds_F77=
+export_dynamic_flag_spec_F77=
+hardcode_direct_F77=no
+hardcode_libdir_flag_spec_F77=
+hardcode_libdir_flag_spec_ld_F77=
+hardcode_libdir_separator_F77=
+hardcode_minus_L_F77=no
+hardcode_automatic_F77=no
+module_cmds_F77=
+module_expsym_cmds_F77=
+link_all_deplibs_F77=unknown
+old_archive_cmds_F77=$old_archive_cmds
+no_undefined_flag_F77=
+whole_archive_flag_spec_F77=
+enable_shared_with_static_runtimes_F77=no
+
+# Source file extension for f77 test sources.
+ac_ext=f
+
+# Object file extension for compiled f77 test sources.
+objext=o
+objext_F77=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code=" subroutine t\n return\n end\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code=" program t\n end\n"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${F77-"f77"}
+compiler=$CC
+compiler_F77=$CC
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+
+echo "$as_me:$LINENO: checking if libtool supports shared libraries" >&5
+echo $ECHO_N "checking if libtool supports shared libraries... $ECHO_C" >&6
+echo "$as_me:$LINENO: result: $can_build_shared" >&5
+echo "${ECHO_T}$can_build_shared" >&6
+
+echo "$as_me:$LINENO: checking whether to build shared libraries" >&5
+echo $ECHO_N "checking whether to build shared libraries... $ECHO_C" >&6
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case $host_os in
+aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+aix4* | aix5*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+esac
+echo "$as_me:$LINENO: result: $enable_shared" >&5
+echo "${ECHO_T}$enable_shared" >&6
+
+echo "$as_me:$LINENO: checking whether to build static libraries" >&5
+echo $ECHO_N "checking whether to build static libraries... $ECHO_C" >&6
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+echo "$as_me:$LINENO: result: $enable_static" >&5
+echo "${ECHO_T}$enable_static" >&6
+
+GCC_F77="$G77"
+LD_F77="$LD"
+
+lt_prog_compiler_wl_F77=
+lt_prog_compiler_pic_F77=
+lt_prog_compiler_static_F77=
+
+echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5
+echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6
+
+ if test "$GCC" = yes; then
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_static_F77='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_F77='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic_F77='-m68020 -resident32 -malways-restore-a4'
+ ;;
+
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_F77='-DDLL_EXPORT'
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic_F77='-fno-common'
+ ;;
+
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ lt_prog_compiler_can_build_shared_F77=no
+ enable_shared=no
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic_F77=-Kconform_pic
+ fi
+ ;;
+
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_F77='-fPIC'
+ ;;
+ esac
+ ;;
+
+ *)
+ lt_prog_compiler_pic_F77='-fPIC'
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_F77='-Bstatic'
+ else
+ lt_prog_compiler_static_F77='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ lt_prog_compiler_pic_F77='-qnocommon'
+ lt_prog_compiler_wl_F77='-Wl,'
+ ;;
+ esac
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_F77='-DDLL_EXPORT'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_F77='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ lt_prog_compiler_static_F77='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ # PIC (with -KPIC) is the default.
+ lt_prog_compiler_static_F77='-non_shared'
+ ;;
+
+ newsos6)
+ lt_prog_compiler_pic_F77='-KPIC'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+
+ linux*)
+ case $cc_basename in
+ icc* | ecc*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_pic_F77='-KPIC'
+ lt_prog_compiler_static_F77='-static'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_pic_F77='-fpic'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+ ccc*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ # All Alpha code is PIC.
+ lt_prog_compiler_static_F77='-non_shared'
+ ;;
+ esac
+ ;;
+
+ osf3* | osf4* | osf5*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ # All OSF/1 code is PIC.
+ lt_prog_compiler_static_F77='-non_shared'
+ ;;
+
+ solaris*)
+ lt_prog_compiler_pic_F77='-KPIC'
+ lt_prog_compiler_static_F77='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95*)
+ lt_prog_compiler_wl_F77='-Qoption ld ';;
+ *)
+ lt_prog_compiler_wl_F77='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ lt_prog_compiler_wl_F77='-Qoption ld '
+ lt_prog_compiler_pic_F77='-PIC'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_pic_F77='-KPIC'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ lt_prog_compiler_pic_F77='-Kconform_pic'
+ lt_prog_compiler_static_F77='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_pic_F77='-KPIC'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+
+ unicos*)
+ lt_prog_compiler_wl_F77='-Wl,'
+ lt_prog_compiler_can_build_shared_F77=no
+ ;;
+
+ uts4*)
+ lt_prog_compiler_pic_F77='-pic'
+ lt_prog_compiler_static_F77='-Bstatic'
+ ;;
+
+ *)
+ lt_prog_compiler_can_build_shared_F77=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_F77" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_F77" >&6
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic_F77"; then
+
+echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_F77 works" >&5
+echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_F77 works... $ECHO_C" >&6
+if test "${lt_prog_compiler_pic_works_F77+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_pic_works_F77=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic_F77"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:13274: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:13278: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_pic_works_F77=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_F77" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_works_F77" >&6
+
+if test x"$lt_prog_compiler_pic_works_F77" = xyes; then
+ case $lt_prog_compiler_pic_F77 in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic_F77=" $lt_prog_compiler_pic_F77" ;;
+ esac
+else
+ lt_prog_compiler_pic_F77=
+ lt_prog_compiler_can_build_shared_F77=no
+fi
+
+fi
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic_F77=
+ ;;
+ *)
+ lt_prog_compiler_pic_F77="$lt_prog_compiler_pic_F77"
+ ;;
+esac
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl_F77 eval lt_tmp_static_flag=\"$lt_prog_compiler_static_F77\"
+echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6
+if test "${lt_prog_compiler_static_works_F77+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_static_works_F77=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ printf "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_static_works_F77=yes
+ fi
+ else
+ lt_prog_compiler_static_works_F77=yes
+ fi
+ fi
+ $rm conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_F77" >&5
+echo "${ECHO_T}$lt_prog_compiler_static_works_F77" >&6
+
+if test x"$lt_prog_compiler_static_works_F77" = xyes; then
+ :
+else
+ lt_prog_compiler_static_F77=
+fi
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5
+echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_c_o_F77+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_c_o_F77=no
+ $rm -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:13378: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:13382: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o_F77=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $rm conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files
+ $rm out/* && rmdir out
+ cd ..
+ rmdir conftest
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_F77" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_c_o_F77" >&6
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o_F77" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ echo "$as_me:$LINENO: checking if we can lock with hard links" >&5
+echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6
+ hard_links=yes
+ $rm conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ echo "$as_me:$LINENO: result: $hard_links" >&5
+echo "${ECHO_T}$hard_links" >&6
+ if test "$hard_links" = no; then
+ { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6
+
+ runpath_var=
+ allow_undefined_flag_F77=
+ enable_shared_with_static_runtimes_F77=no
+ archive_cmds_F77=
+ archive_expsym_cmds_F77=
+ old_archive_From_new_cmds_F77=
+ old_archive_from_expsyms_cmds_F77=
+ export_dynamic_flag_spec_F77=
+ whole_archive_flag_spec_F77=
+ thread_safe_flag_spec_F77=
+ hardcode_libdir_flag_spec_F77=
+ hardcode_libdir_flag_spec_ld_F77=
+ hardcode_libdir_separator_F77=
+ hardcode_direct_F77=no
+ hardcode_minus_L_F77=no
+ hardcode_shlibpath_var_F77=unsupported
+ link_all_deplibs_F77=unknown
+ hardcode_automatic_F77=no
+ module_cmds_F77=
+ module_expsym_cmds_F77=
+ always_export_symbols_F77=no
+ export_symbols_cmds_F77='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ include_expsyms_F77=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ exclude_expsyms_F77="_GLOBAL_OFFSET_TABLE_"
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ extract_expsyms_cmds=
+ # Just being paranoid about ensuring that cc_basename is set.
+ for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+ case $host_os in
+ cygwin* | mingw* | pw32*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ ld_shlibs_F77=yes
+ if test "$with_gnu_ld" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec_F77='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec_F77='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec_F77="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec_F77=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>/dev/null` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix3* | aix4* | aix5*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ ld_shlibs_F77=no
+ cat <<EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.9.1, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to modify your PATH
+*** so that a non-GNU linker is found, and then restart.
+
+EOF
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds_F77='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_minus_L_F77=yes
+
+ # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+ # that the semantics of dynamic libraries on AmigaOS, at least up
+ # to version 4, is to share data among multiple programs linked
+ # with the same dynamic library. Since this doesn't match the
+ # behavior of shared libraries on other platforms, we can't use
+ # them.
+ ld_shlibs_F77=no
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag_F77=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds_F77='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, F77) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ allow_undefined_flag_F77=unsupported
+ always_export_symbols_F77=no
+ enable_shared_with_static_runtimes_F77=yes
+ export_symbols_cmds_F77='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols'
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds_F77='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+
+ interix3*)
+ hardcode_direct_F77=no
+ hardcode_shlibpath_var_F77=no
+ hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_F77='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds_F77='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds_F77='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ linux*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ tmp_addflag=
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ whole_archive_flag_spec_F77='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers
+ whole_archive_flag_spec_F77='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ esac
+ archive_cmds_F77='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test $supports_anon_versioning = yes; then
+ archive_expsym_cmds_F77='$echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ $echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds_F77='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+ ld_shlibs_F77=no
+ cat <<EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+EOF
+ elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs_F77=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec_F77='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib'
+ archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib'
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds_F77='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ hardcode_direct_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs_F77=no
+ fi
+ ;;
+ esac
+
+ if test "$ld_shlibs_F77" = no; then
+ runpath_var=
+ hardcode_libdir_flag_spec_F77=
+ export_dynamic_flag_spec_F77=
+ whole_archive_flag_spec_F77=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ allow_undefined_flag_F77=unsupported
+ always_export_symbols_F77=yes
+ archive_expsym_cmds_F77='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L_F77=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct_F77=unsupported
+ fi
+ ;;
+
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ export_symbols_cmds_F77='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds_F77='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds_F77=''
+ hardcode_direct_F77=yes
+ hardcode_libdir_separator_F77=':'
+ link_all_deplibs_F77=yes
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ hardcode_direct_F77=yes
+ else
+ # We have old collect2
+ hardcode_direct_F77=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L_F77=yes
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_libdir_separator_F77=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols_F77=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag_F77='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+ program main
+
+ end
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_f77_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_F77='${wl}-blibpath:$libdir:'"$aix_libpath"
+ archive_expsym_cmds_F77="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec_F77='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag_F77="-z nodefs"
+ archive_expsym_cmds_F77="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+ program main
+
+ end
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_f77_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_F77='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag_F77=' ${wl}-bernotok'
+ allow_undefined_flag_F77=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec_F77='$convenience'
+ archive_cmds_need_lc_F77=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds_F77="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds_F77='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_minus_L_F77=yes
+ # see comment about different semantics on the GNU ld section
+ ld_shlibs_F77=no
+ ;;
+
+ bsdi[45]*)
+ export_dynamic_flag_spec_F77=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec_F77=' '
+ allow_undefined_flag_F77=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds_F77='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ old_archive_From_new_cmds_F77='true'
+ # FIXME: Should let the user specify the lib program.
+ old_archive_cmds_F77='lib /OUT:$oldlib$oldobjs$old_deplibs'
+ fix_srcfile_path_F77='`cygpath -w "$srcfile"`'
+ enable_shared_with_static_runtimes_F77=yes
+ ;;
+
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ allow_undefined_flag_F77='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ allow_undefined_flag_F77='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[012])
+ allow_undefined_flag_F77='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ allow_undefined_flag_F77='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ archive_cmds_need_lc_F77=no
+ hardcode_direct_F77=no
+ hardcode_automatic_F77=yes
+ hardcode_shlibpath_var_F77=unsupported
+ whole_archive_flag_spec_F77=''
+ link_all_deplibs_F77=yes
+ if test "$GCC" = yes ; then
+ output_verbose_link_cmd='echo'
+ archive_cmds_F77='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ module_cmds_F77='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ archive_cmds_F77='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ module_cmds_F77='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ ld_shlibs_F77=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ freebsd1*)
+ ld_shlibs_F77=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec_F77='-R$libdir'
+ hardcode_direct_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2*)
+ archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_F77=yes
+ hardcode_minus_L_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ archive_cmds_F77='$CC -shared -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec_F77='-R$libdir'
+ hardcode_direct_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ archive_cmds_F77='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ archive_cmds_F77='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+ hardcode_direct_F77=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_F77=yes
+ export_dynamic_flag_spec_F77='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ archive_cmds_F77='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_F77='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+
+ hardcode_direct_F77=yes
+ export_dynamic_flag_spec_F77='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_F77=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_F77='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_F77='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_F77='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_libdir_flag_spec_ld_F77='+b $libdir'
+ hardcode_direct_F77=no
+ hardcode_shlibpath_var_F77=no
+ ;;
+ *)
+ hardcode_direct_F77=yes
+ export_dynamic_flag_spec_F77='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_F77=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ archive_cmds_F77='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_ld_F77='-rpath $libdir'
+ fi
+ hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+ link_all_deplibs_F77=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ archive_cmds_F77='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ hardcode_libdir_flag_spec_F77='-R$libdir'
+ hardcode_direct_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ newsos6)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_F77=yes
+ hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ openbsd*)
+ hardcode_direct_F77=yes
+ hardcode_shlibpath_var_F77=no
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_F77='${wl}-E'
+ else
+ case $host_os in
+ openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+ archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_F77='-R$libdir'
+ ;;
+ *)
+ archive_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_minus_L_F77=yes
+ allow_undefined_flag_F77=unsupported
+ archive_cmds_F77='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ old_archive_From_new_cmds_F77='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ allow_undefined_flag_F77=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_F77='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ allow_undefined_flag_F77=' -expect_unresolved \*'
+ archive_cmds_F77='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_F77=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ allow_undefined_flag_F77=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_F77='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir'
+ else
+ allow_undefined_flag_F77=' -expect_unresolved \*'
+ archive_cmds_F77='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds_F77='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~
+ $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec_F77='-rpath $libdir'
+ fi
+ hardcode_libdir_separator_F77=:
+ ;;
+
+ solaris*)
+ no_undefined_flag_F77=' -z text'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ archive_cmds_F77='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp'
+ else
+ wlarc=''
+ archive_cmds_F77='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ archive_expsym_cmds_F77='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp'
+ fi
+ hardcode_libdir_flag_spec_F77='-R$libdir'
+ hardcode_shlibpath_var_F77=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl, iff we do not link with $LD.
+ # Luckily, gcc supports the same syntax we need for Sun Studio.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ case $wlarc in
+ '')
+ whole_archive_flag_spec_F77='-z allextract$convenience -z defaultextract' ;;
+ *)
+ whole_archive_flag_spec_F77='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;;
+ esac ;;
+ esac
+ link_all_deplibs_F77=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ archive_cmds_F77='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_F77='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_direct_F77=yes
+ hardcode_minus_L_F77=yes
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_F77=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ archive_cmds_F77='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ reload_cmds_F77='$CC -r -o $output$reload_objs'
+ hardcode_direct_F77=no
+ ;;
+ motorola)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_F77=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ sysv4.3*)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var_F77=no
+ export_dynamic_flag_spec_F77='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var_F77=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ ld_shlibs_F77=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*)
+ no_undefined_flag_F77='${wl}-z,text'
+ archive_cmds_need_lc_F77=no
+ hardcode_shlibpath_var_F77=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds_F77='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_F77='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag_F77='${wl}-z,text'
+ allow_undefined_flag_F77='${wl}-z,nodefs'
+ archive_cmds_need_lc_F77=no
+ hardcode_shlibpath_var_F77=no
+ hardcode_libdir_flag_spec_F77='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ hardcode_libdir_separator_F77=':'
+ link_all_deplibs_F77=yes
+ export_dynamic_flag_spec_F77='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds_F77='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_F77='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_F77='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_F77='-L$libdir'
+ hardcode_shlibpath_var_F77=no
+ ;;
+
+ *)
+ ld_shlibs_F77=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $ld_shlibs_F77" >&5
+echo "${ECHO_T}$ld_shlibs_F77" >&6
+test "$ld_shlibs_F77" = no && can_build_shared=no
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc_F77" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc_F77=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds_F77 in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5
+echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6
+ $rm conftest*
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl_F77
+ pic_flag=$lt_prog_compiler_pic_F77
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag_F77
+ allow_undefined_flag_F77=
+ if { (eval echo "$as_me:$LINENO: \"$archive_cmds_F77 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5
+ (eval $archive_cmds_F77 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ then
+ archive_cmds_need_lc_F77=no
+ else
+ archive_cmds_need_lc_F77=yes
+ fi
+ allow_undefined_flag_F77=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $rm conftest*
+ echo "$as_me:$LINENO: result: $archive_cmds_need_lc_F77" >&5
+echo "${ECHO_T}$archive_cmds_need_lc_F77" >&6
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5
+echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix4* | aix5*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$host_os in
+ yes,cygwin* | yes,mingw* | yes,pw32*)
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $rm \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib"
+ ;;
+ mingw*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH printed by
+ # mingw gcc, but we are running on Cygwin. Gcc prints its search
+ # path with ; separators, and with drive letters. We can handle the
+ # drive letters (cygwin fileutils understands them), so leave them,
+ # especially as we might pass files found there to a mingw objdump,
+ # which wouldn't understand a cygwinified path. Ahh.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ ;;
+
+ *)
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+ # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same.
+ if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"`
+ else
+ sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib'
+ fi
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd1*)
+ dynamic_linker=no
+ ;;
+
+kfreebsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[123]*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ freebsd*) # from 4.6 on
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+interix3*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # find out which ABI we are using
+ libsuff=
+ case "$host_cpu" in
+ x86_64*|s390x*|powerpc64*)
+ echo '#line 14827 "configure"' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *64-bit*)
+ libsuff=64
+ sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+ esac
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+knetbsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+nto-qnx*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+solaris*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ shlibpath_overrides_runpath=no
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ shlibpath_overrides_runpath=yes
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+echo "$as_me:$LINENO: result: $dynamic_linker" >&5
+echo "${ECHO_T}$dynamic_linker" >&6
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5
+echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6
+hardcode_action_F77=
+if test -n "$hardcode_libdir_flag_spec_F77" || \
+ test -n "$runpath_var_F77" || \
+ test "X$hardcode_automatic_F77" = "Xyes" ; then
+
+ # We can hardcode non-existant directories.
+ if test "$hardcode_direct_F77" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, F77)" != no &&
+ test "$hardcode_minus_L_F77" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action_F77=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action_F77=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action_F77=unsupported
+fi
+echo "$as_me:$LINENO: result: $hardcode_action_F77" >&5
+echo "${ECHO_T}$hardcode_action_F77" >&6
+
+if test "$hardcode_action_F77" = relink; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ compiler_F77 \
+ CC_F77 \
+ LD_F77 \
+ lt_prog_compiler_wl_F77 \
+ lt_prog_compiler_pic_F77 \
+ lt_prog_compiler_static_F77 \
+ lt_prog_compiler_no_builtin_flag_F77 \
+ export_dynamic_flag_spec_F77 \
+ thread_safe_flag_spec_F77 \
+ whole_archive_flag_spec_F77 \
+ enable_shared_with_static_runtimes_F77 \
+ old_archive_cmds_F77 \
+ old_archive_from_new_cmds_F77 \
+ predep_objects_F77 \
+ postdep_objects_F77 \
+ predeps_F77 \
+ postdeps_F77 \
+ compiler_lib_search_path_F77 \
+ archive_cmds_F77 \
+ archive_expsym_cmds_F77 \
+ postinstall_cmds_F77 \
+ postuninstall_cmds_F77 \
+ old_archive_from_expsyms_cmds_F77 \
+ allow_undefined_flag_F77 \
+ no_undefined_flag_F77 \
+ export_symbols_cmds_F77 \
+ hardcode_libdir_flag_spec_F77 \
+ hardcode_libdir_flag_spec_ld_F77 \
+ hardcode_libdir_separator_F77 \
+ hardcode_automatic_F77 \
+ module_cmds_F77 \
+ module_expsym_cmds_F77 \
+ lt_cv_prog_compiler_c_o_F77 \
+ exclude_expsyms_F77 \
+ include_expsyms_F77; do
+
+ case $var in
+ old_archive_cmds_F77 | \
+ old_archive_from_new_cmds_F77 | \
+ archive_cmds_F77 | \
+ archive_expsym_cmds_F77 | \
+ module_cmds_F77 | \
+ module_expsym_cmds_F77 | \
+ old_archive_from_expsyms_cmds_F77 | \
+ export_symbols_cmds_F77 | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\$0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'`
+ ;;
+ esac
+
+cfgfile="$ofile"
+
+ cat <<__EOF__ >> "$cfgfile"
+# ### BEGIN LIBTOOL TAG CONFIG: $tagname
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_F77
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_F77
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_compiler_F77
+
+# Is the compiler the GNU C compiler?
+with_gcc=$GCC_F77
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_LD_F77
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_F77
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_F77
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_F77
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_F77
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_F77
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_F77
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_F77
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_thread_safe_flag_spec_F77
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_old_archive_cmds_F77
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_F77
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_F77
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_archive_cmds_F77
+archive_expsym_cmds=$lt_archive_expsym_cmds_F77
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_module_cmds_F77
+module_expsym_cmds=$lt_module_expsym_cmds_F77
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_predep_objects_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_postdep_objects_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_predeps_F77
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_postdeps_F77
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_F77
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_F77
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_F77
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_F77
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_F77
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_F77
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct_F77
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L_F77
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_F77
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$hardcode_automatic_F77
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_F77
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$fix_srcfile_path_F77"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$always_export_symbols_F77
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_F77
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_F77
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_F77
+
+# ### END LIBTOOL TAG CONFIG: $tagname
+
+__EOF__
+
+
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+ else
+ tagname=""
+ fi
+ ;;
+
+ GCJ)
+ if test -n "$GCJ" && test "X$GCJ" != "Xno"; then
+
+
+
+# Source file extension for Java test sources.
+ac_ext=java
+
+# Object file extension for compiled Java test sources.
+objext=o
+objext_GCJ=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="class foo {}\n"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='public class conftest { public static void main(String[] argv) {}; }\n'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${GCJ-"gcj"}
+compiler=$CC
+compiler_GCJ=$CC
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+
+# GCJ did not exist at the time GCC didn't implicitly link libc in.
+archive_cmds_need_lc_GCJ=no
+
+old_archive_cmds_GCJ=$old_archive_cmds
+
+
+lt_prog_compiler_no_builtin_flag_GCJ=
+
+if test "$GCC" = yes; then
+ lt_prog_compiler_no_builtin_flag_GCJ=' -fno-builtin'
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -fno-rtti -fno-exceptions" >&5
+echo $ECHO_N "checking if $compiler supports -fno-rtti -fno-exceptions... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_rtti_exceptions+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_rtti_exceptions=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="-fno-rtti -fno-exceptions"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:15605: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:15609: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_rtti_exceptions=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_rtti_exceptions" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_rtti_exceptions" >&6
+
+if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then
+ lt_prog_compiler_no_builtin_flag_GCJ="$lt_prog_compiler_no_builtin_flag_GCJ -fno-rtti -fno-exceptions"
+else
+ :
+fi
+
+fi
+
+lt_prog_compiler_wl_GCJ=
+lt_prog_compiler_pic_GCJ=
+lt_prog_compiler_static_GCJ=
+
+echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5
+echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6
+
+ if test "$GCC" = yes; then
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_static_GCJ='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic_GCJ='-m68020 -resident32 -malways-restore-a4'
+ ;;
+
+ beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_GCJ='-DDLL_EXPORT'
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic_GCJ='-fno-common'
+ ;;
+
+ interix3*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ lt_prog_compiler_can_build_shared_GCJ=no
+ enable_shared=no
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic_GCJ=-Kconform_pic
+ fi
+ ;;
+
+ hpux*)
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_GCJ='-fPIC'
+ ;;
+ esac
+ ;;
+
+ *)
+ lt_prog_compiler_pic_GCJ='-fPIC'
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ else
+ lt_prog_compiler_static_GCJ='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ darwin*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ case $cc_basename in
+ xlc*)
+ lt_prog_compiler_pic_GCJ='-qnocommon'
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ ;;
+ esac
+ ;;
+
+ mingw* | pw32* | os2*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_GCJ='-DDLL_EXPORT'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_GCJ='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ lt_prog_compiler_static_GCJ='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ # PIC (with -KPIC) is the default.
+ lt_prog_compiler_static_GCJ='-non_shared'
+ ;;
+
+ newsos6)
+ lt_prog_compiler_pic_GCJ='-KPIC'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+
+ linux*)
+ case $cc_basename in
+ icc* | ecc*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_pic_GCJ='-KPIC'
+ lt_prog_compiler_static_GCJ='-static'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_pic_GCJ='-fpic'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+ ccc*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ # All Alpha code is PIC.
+ lt_prog_compiler_static_GCJ='-non_shared'
+ ;;
+ esac
+ ;;
+
+ osf3* | osf4* | osf5*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ # All OSF/1 code is PIC.
+ lt_prog_compiler_static_GCJ='-non_shared'
+ ;;
+
+ solaris*)
+ lt_prog_compiler_pic_GCJ='-KPIC'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95*)
+ lt_prog_compiler_wl_GCJ='-Qoption ld ';;
+ *)
+ lt_prog_compiler_wl_GCJ='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ lt_prog_compiler_wl_GCJ='-Qoption ld '
+ lt_prog_compiler_pic_GCJ='-PIC'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_pic_GCJ='-KPIC'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ lt_prog_compiler_pic_GCJ='-Kconform_pic'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_pic_GCJ='-KPIC'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+
+ unicos*)
+ lt_prog_compiler_wl_GCJ='-Wl,'
+ lt_prog_compiler_can_build_shared_GCJ=no
+ ;;
+
+ uts4*)
+ lt_prog_compiler_pic_GCJ='-pic'
+ lt_prog_compiler_static_GCJ='-Bstatic'
+ ;;
+
+ *)
+ lt_prog_compiler_can_build_shared_GCJ=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_GCJ" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_GCJ" >&6
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic_GCJ"; then
+
+echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_GCJ works" >&5
+echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_GCJ works... $ECHO_C" >&6
+if test "${lt_prog_compiler_pic_works_GCJ+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_pic_works_GCJ=no
+ ac_outfile=conftest.$ac_objext
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic_GCJ"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:15873: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:15877: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_pic_works_GCJ=yes
+ fi
+ fi
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_GCJ" >&5
+echo "${ECHO_T}$lt_prog_compiler_pic_works_GCJ" >&6
+
+if test x"$lt_prog_compiler_pic_works_GCJ" = xyes; then
+ case $lt_prog_compiler_pic_GCJ in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic_GCJ=" $lt_prog_compiler_pic_GCJ" ;;
+ esac
+else
+ lt_prog_compiler_pic_GCJ=
+ lt_prog_compiler_can_build_shared_GCJ=no
+fi
+
+fi
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic_GCJ=
+ ;;
+ *)
+ lt_prog_compiler_pic_GCJ="$lt_prog_compiler_pic_GCJ"
+ ;;
+esac
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl_GCJ eval lt_tmp_static_flag=\"$lt_prog_compiler_static_GCJ\"
+echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6
+if test "${lt_prog_compiler_static_works_GCJ+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_prog_compiler_static_works_GCJ=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ printf "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_prog_compiler_static_works_GCJ=yes
+ fi
+ else
+ lt_prog_compiler_static_works_GCJ=yes
+ fi
+ fi
+ $rm conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_GCJ" >&5
+echo "${ECHO_T}$lt_prog_compiler_static_works_GCJ" >&6
+
+if test x"$lt_prog_compiler_static_works_GCJ" = xyes; then
+ :
+else
+ lt_prog_compiler_static_GCJ=
+fi
+
+
+echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5
+echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6
+if test "${lt_cv_prog_compiler_c_o_GCJ+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ lt_cv_prog_compiler_c_o_GCJ=no
+ $rm -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:15977: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:15981: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o_GCJ=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $rm conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files
+ $rm out/* && rmdir out
+ cd ..
+ rmdir conftest
+ $rm conftest*
+
+fi
+echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_GCJ" >&5
+echo "${ECHO_T}$lt_cv_prog_compiler_c_o_GCJ" >&6
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o_GCJ" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ echo "$as_me:$LINENO: checking if we can lock with hard links" >&5
+echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6
+ hard_links=yes
+ $rm conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ echo "$as_me:$LINENO: result: $hard_links" >&5
+echo "${ECHO_T}$hard_links" >&6
+ if test "$hard_links" = no; then
+ { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6
+
+ runpath_var=
+ allow_undefined_flag_GCJ=
+ enable_shared_with_static_runtimes_GCJ=no
+ archive_cmds_GCJ=
+ archive_expsym_cmds_GCJ=
+ old_archive_From_new_cmds_GCJ=
+ old_archive_from_expsyms_cmds_GCJ=
+ export_dynamic_flag_spec_GCJ=
+ whole_archive_flag_spec_GCJ=
+ thread_safe_flag_spec_GCJ=
+ hardcode_libdir_flag_spec_GCJ=
+ hardcode_libdir_flag_spec_ld_GCJ=
+ hardcode_libdir_separator_GCJ=
+ hardcode_direct_GCJ=no
+ hardcode_minus_L_GCJ=no
+ hardcode_shlibpath_var_GCJ=unsupported
+ link_all_deplibs_GCJ=unknown
+ hardcode_automatic_GCJ=no
+ module_cmds_GCJ=
+ module_expsym_cmds_GCJ=
+ always_export_symbols_GCJ=no
+ export_symbols_cmds_GCJ='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ include_expsyms_GCJ=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ exclude_expsyms_GCJ="_GLOBAL_OFFSET_TABLE_"
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ extract_expsyms_cmds=
+ # Just being paranoid about ensuring that cc_basename is set.
+ for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+ case $host_os in
+ cygwin* | mingw* | pw32*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ ld_shlibs_GCJ=yes
+ if test "$with_gnu_ld" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec_GCJ='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec_GCJ='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec_GCJ="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec_GCJ=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>/dev/null` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix3* | aix4* | aix5*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ ld_shlibs_GCJ=no
+ cat <<EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.9.1, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to modify your PATH
+*** so that a non-GNU linker is found, and then restart.
+
+EOF
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds_GCJ='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_minus_L_GCJ=yes
+
+ # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+ # that the semantics of dynamic libraries on AmigaOS, at least up
+ # to version 4, is to share data among multiple programs linked
+ # with the same dynamic library. Since this doesn't match the
+ # behavior of shared libraries on other platforms, we can't use
+ # them.
+ ld_shlibs_GCJ=no
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag_GCJ=unsupported
+ # Joseph Beckenbach <jrb3@best.com> says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds_GCJ='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, GCJ) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ allow_undefined_flag_GCJ=unsupported
+ always_export_symbols_GCJ=no
+ enable_shared_with_static_runtimes_GCJ=yes
+ export_symbols_cmds_GCJ='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols'
+
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds_GCJ='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+
+ interix3*)
+ hardcode_direct_GCJ=no
+ hardcode_shlibpath_var_GCJ=no
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_GCJ='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds_GCJ='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds_GCJ='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ linux*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ tmp_addflag=
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ whole_archive_flag_spec_GCJ='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers
+ whole_archive_flag_spec_GCJ='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ esac
+ archive_cmds_GCJ='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test $supports_anon_versioning = yes; then
+ archive_expsym_cmds_GCJ='$echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ $echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds_GCJ='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+ ld_shlibs_GCJ=no
+ cat <<EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+EOF
+ elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs_GCJ=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec_GCJ='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib'
+ archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib'
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds_GCJ='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ hardcode_direct_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs_GCJ=no
+ fi
+ ;;
+ esac
+
+ if test "$ld_shlibs_GCJ" = no; then
+ runpath_var=
+ hardcode_libdir_flag_spec_GCJ=
+ export_dynamic_flag_spec_GCJ=
+ whole_archive_flag_spec_GCJ=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ allow_undefined_flag_GCJ=unsupported
+ always_export_symbols_GCJ=yes
+ archive_expsym_cmds_GCJ='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L_GCJ=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct_GCJ=unsupported
+ fi
+ ;;
+
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ if $NM -V 2>&1 | grep 'GNU' > /dev/null; then
+ export_symbols_cmds_GCJ='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds_GCJ='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds_GCJ=''
+ hardcode_direct_GCJ=yes
+ hardcode_libdir_separator_GCJ=':'
+ link_all_deplibs_GCJ=yes
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ hardcode_direct_GCJ=yes
+ else
+ # We have old collect2
+ hardcode_direct_GCJ=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L_GCJ=yes
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_libdir_separator_GCJ=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols_GCJ=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag_GCJ='-berok'
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_GCJ='${wl}-blibpath:$libdir:'"$aix_libpath"
+ archive_expsym_cmds_GCJ="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec_GCJ='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag_GCJ="-z nodefs"
+ archive_expsym_cmds_GCJ="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an empty executable.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+
+aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+# Check for a 64-bit object if we didn't find anything.
+if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`; fi
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi
+
+ hardcode_libdir_flag_spec_GCJ='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag_GCJ=' ${wl}-bernotok'
+ allow_undefined_flag_GCJ=' ${wl}-berok'
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec_GCJ='$convenience'
+ archive_cmds_need_lc_GCJ=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds_GCJ="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ archive_cmds_GCJ='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_minus_L_GCJ=yes
+ # see comment about different semantics on the GNU ld section
+ ld_shlibs_GCJ=no
+ ;;
+
+ bsdi[45]*)
+ export_dynamic_flag_spec_GCJ=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec_GCJ=' '
+ allow_undefined_flag_GCJ=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds_GCJ='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ old_archive_From_new_cmds_GCJ='true'
+ # FIXME: Should let the user specify the lib program.
+ old_archive_cmds_GCJ='lib /OUT:$oldlib$oldobjs$old_deplibs'
+ fix_srcfile_path_GCJ='`cygpath -w "$srcfile"`'
+ enable_shared_with_static_runtimes_GCJ=yes
+ ;;
+
+ darwin* | rhapsody*)
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ allow_undefined_flag_GCJ='${wl}-undefined ${wl}suppress'
+ ;;
+ *) # Darwin 1.3 on
+ if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then
+ allow_undefined_flag_GCJ='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ else
+ case ${MACOSX_DEPLOYMENT_TARGET} in
+ 10.[012])
+ allow_undefined_flag_GCJ='${wl}-flat_namespace ${wl}-undefined ${wl}suppress'
+ ;;
+ 10.*)
+ allow_undefined_flag_GCJ='${wl}-undefined ${wl}dynamic_lookup'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ archive_cmds_need_lc_GCJ=no
+ hardcode_direct_GCJ=no
+ hardcode_automatic_GCJ=yes
+ hardcode_shlibpath_var_GCJ=unsupported
+ whole_archive_flag_spec_GCJ=''
+ link_all_deplibs_GCJ=yes
+ if test "$GCC" = yes ; then
+ output_verbose_link_cmd='echo'
+ archive_cmds_GCJ='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring'
+ module_cmds_GCJ='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ else
+ case $cc_basename in
+ xlc*)
+ output_verbose_link_cmd='echo'
+ archive_cmds_GCJ='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring'
+ module_cmds_GCJ='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags'
+ # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds
+ archive_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ module_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ ;;
+ *)
+ ld_shlibs_GCJ=no
+ ;;
+ esac
+ fi
+ ;;
+
+ dgux*)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ freebsd1*)
+ ld_shlibs_GCJ=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec_GCJ='-R$libdir'
+ hardcode_direct_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2*)
+ archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_GCJ=yes
+ hardcode_minus_L_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | kfreebsd*-gnu | dragonfly*)
+ archive_cmds_GCJ='$CC -shared -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec_GCJ='-R$libdir'
+ hardcode_direct_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ archive_cmds_GCJ='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ archive_cmds_GCJ='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+ hardcode_direct_GCJ=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_GCJ=yes
+ export_dynamic_flag_spec_GCJ='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ archive_cmds_GCJ='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_GCJ='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+
+ hardcode_direct_GCJ=yes
+ export_dynamic_flag_spec_GCJ='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_GCJ=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes -a "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_GCJ='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_GCJ='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_GCJ='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_libdir_flag_spec_ld_GCJ='+b $libdir'
+ hardcode_direct_GCJ=no
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+ *)
+ hardcode_direct_GCJ=yes
+ export_dynamic_flag_spec_GCJ='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L_GCJ=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ archive_cmds_GCJ='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_ld_GCJ='-rpath $libdir'
+ fi
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+ link_all_deplibs_GCJ=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ archive_cmds_GCJ='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ hardcode_libdir_flag_spec_GCJ='-R$libdir'
+ hardcode_direct_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ newsos6)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_GCJ=yes
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ openbsd*)
+ hardcode_direct_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_GCJ='${wl}-E'
+ else
+ case $host_os in
+ openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+ archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_GCJ='-R$libdir'
+ ;;
+ *)
+ archive_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_minus_L_GCJ=yes
+ allow_undefined_flag_GCJ=unsupported
+ archive_cmds_GCJ='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ old_archive_From_new_cmds_GCJ='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ allow_undefined_flag_GCJ=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_GCJ='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ allow_undefined_flag_GCJ=' -expect_unresolved \*'
+ archive_cmds_GCJ='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_GCJ=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ allow_undefined_flag_GCJ=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_GCJ='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir'
+ else
+ allow_undefined_flag_GCJ=' -expect_unresolved \*'
+ archive_cmds_GCJ='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds_GCJ='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~
+ $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec_GCJ='-rpath $libdir'
+ fi
+ hardcode_libdir_separator_GCJ=:
+ ;;
+
+ solaris*)
+ no_undefined_flag_GCJ=' -z text'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ archive_cmds_GCJ='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp'
+ else
+ wlarc=''
+ archive_cmds_GCJ='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ archive_expsym_cmds_GCJ='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp'
+ fi
+ hardcode_libdir_flag_spec_GCJ='-R$libdir'
+ hardcode_shlibpath_var_GCJ=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine linker options so we
+ # cannot just pass the convience library names through
+ # without $wl, iff we do not link with $LD.
+ # Luckily, gcc supports the same syntax we need for Sun Studio.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ case $wlarc in
+ '')
+ whole_archive_flag_spec_GCJ='-z allextract$convenience -z defaultextract' ;;
+ *)
+ whole_archive_flag_spec_GCJ='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;;
+ esac ;;
+ esac
+ link_all_deplibs_GCJ=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ archive_cmds_GCJ='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_GCJ='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_direct_GCJ=yes
+ hardcode_minus_L_GCJ=yes
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_GCJ=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ archive_cmds_GCJ='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ reload_cmds_GCJ='$CC -r -o $output$reload_objs'
+ hardcode_direct_GCJ=no
+ ;;
+ motorola)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct_GCJ=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ sysv4.3*)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var_GCJ=no
+ export_dynamic_flag_spec_GCJ='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var_GCJ=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ ld_shlibs_GCJ=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*)
+ no_undefined_flag_GCJ='${wl}-z,text'
+ archive_cmds_need_lc_GCJ=no
+ hardcode_shlibpath_var_GCJ=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds_GCJ='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_GCJ='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag_GCJ='${wl}-z,text'
+ allow_undefined_flag_GCJ='${wl}-z,nodefs'
+ archive_cmds_need_lc_GCJ=no
+ hardcode_shlibpath_var_GCJ=no
+ hardcode_libdir_flag_spec_GCJ='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ hardcode_libdir_separator_GCJ=':'
+ link_all_deplibs_GCJ=yes
+ export_dynamic_flag_spec_GCJ='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds_GCJ='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds_GCJ='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_GCJ='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec_GCJ='-L$libdir'
+ hardcode_shlibpath_var_GCJ=no
+ ;;
+
+ *)
+ ld_shlibs_GCJ=no
+ ;;
+ esac
+ fi
+
+echo "$as_me:$LINENO: result: $ld_shlibs_GCJ" >&5
+echo "${ECHO_T}$ld_shlibs_GCJ" >&6
+test "$ld_shlibs_GCJ" = no && can_build_shared=no
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc_GCJ" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc_GCJ=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds_GCJ in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5
+echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6
+ $rm conftest*
+ printf "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl_GCJ
+ pic_flag=$lt_prog_compiler_pic_GCJ
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag_GCJ
+ allow_undefined_flag_GCJ=
+ if { (eval echo "$as_me:$LINENO: \"$archive_cmds_GCJ 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5
+ (eval $archive_cmds_GCJ 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+ then
+ archive_cmds_need_lc_GCJ=no
+ else
+ archive_cmds_need_lc_GCJ=yes
+ fi
+ allow_undefined_flag_GCJ=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $rm conftest*
+ echo "$as_me:$LINENO: result: $archive_cmds_need_lc_GCJ" >&5
+echo "${ECHO_T}$archive_cmds_need_lc_GCJ" >&6
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5
+echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix4* | aix5*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+ # instead of lib<name>.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$host_os in
+ yes,cygwin* | yes,mingw* | yes,pw32*)
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $rm \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib"
+ ;;
+ mingw*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"`
+ if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH printed by
+ # mingw gcc, but we are running on Cygwin. Gcc prints its search
+ # path with ; separators, and with drive letters. We can handle the
+ # drive letters (cygwin fileutils understands them), so leave them,
+ # especially as we might pass files found there to a mingw objdump,
+ # which wouldn't understand a cygwinified path. Ahh.
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ ;;
+
+ *)
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+ # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same.
+ if test "$GCC" = yes; then
+ sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"`
+ else
+ sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib'
+ fi
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd1*)
+ dynamic_linker=no
+ ;;
+
+kfreebsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[123]*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ freebsd*) # from 4.6 on
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+interix3*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # find out which ABI we are using
+ libsuff=
+ case "$host_cpu" in
+ x86_64*|s390x*|powerpc64*)
+ echo '#line 17446 "configure"' > conftest.$ac_ext
+ if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *64-bit*)
+ libsuff=64
+ sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+ esac
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+knetbsd*-gnu)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='GNU ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+nto-qnx*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+solaris*)
+ version_type=linux
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ shlibpath_overrides_runpath=no
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ shlibpath_overrides_runpath=yes
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+echo "$as_me:$LINENO: result: $dynamic_linker" >&5
+echo "${ECHO_T}$dynamic_linker" >&6
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5
+echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6
+hardcode_action_GCJ=
+if test -n "$hardcode_libdir_flag_spec_GCJ" || \
+ test -n "$runpath_var_GCJ" || \
+ test "X$hardcode_automatic_GCJ" = "Xyes" ; then
+
+ # We can hardcode non-existant directories.
+ if test "$hardcode_direct_GCJ" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, GCJ)" != no &&
+ test "$hardcode_minus_L_GCJ" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action_GCJ=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action_GCJ=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action_GCJ=unsupported
+fi
+echo "$as_me:$LINENO: result: $hardcode_action_GCJ" >&5
+echo "${ECHO_T}$hardcode_action_GCJ" >&6
+
+if test "$hardcode_action_GCJ" = relink; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ compiler_GCJ \
+ CC_GCJ \
+ LD_GCJ \
+ lt_prog_compiler_wl_GCJ \
+ lt_prog_compiler_pic_GCJ \
+ lt_prog_compiler_static_GCJ \
+ lt_prog_compiler_no_builtin_flag_GCJ \
+ export_dynamic_flag_spec_GCJ \
+ thread_safe_flag_spec_GCJ \
+ whole_archive_flag_spec_GCJ \
+ enable_shared_with_static_runtimes_GCJ \
+ old_archive_cmds_GCJ \
+ old_archive_from_new_cmds_GCJ \
+ predep_objects_GCJ \
+ postdep_objects_GCJ \
+ predeps_GCJ \
+ postdeps_GCJ \
+ compiler_lib_search_path_GCJ \
+ archive_cmds_GCJ \
+ archive_expsym_cmds_GCJ \
+ postinstall_cmds_GCJ \
+ postuninstall_cmds_GCJ \
+ old_archive_from_expsyms_cmds_GCJ \
+ allow_undefined_flag_GCJ \
+ no_undefined_flag_GCJ \
+ export_symbols_cmds_GCJ \
+ hardcode_libdir_flag_spec_GCJ \
+ hardcode_libdir_flag_spec_ld_GCJ \
+ hardcode_libdir_separator_GCJ \
+ hardcode_automatic_GCJ \
+ module_cmds_GCJ \
+ module_expsym_cmds_GCJ \
+ lt_cv_prog_compiler_c_o_GCJ \
+ exclude_expsyms_GCJ \
+ include_expsyms_GCJ; do
+
+ case $var in
+ old_archive_cmds_GCJ | \
+ old_archive_from_new_cmds_GCJ | \
+ archive_cmds_GCJ | \
+ archive_expsym_cmds_GCJ | \
+ module_cmds_GCJ | \
+ module_expsym_cmds_GCJ | \
+ old_archive_from_expsyms_cmds_GCJ | \
+ export_symbols_cmds_GCJ | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\$0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'`
+ ;;
+ esac
+
+cfgfile="$ofile"
+
+ cat <<__EOF__ >> "$cfgfile"
+# ### BEGIN LIBTOOL TAG CONFIG: $tagname
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_GCJ
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_GCJ
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_compiler_GCJ
+
+# Is the compiler the GNU C compiler?
+with_gcc=$GCC_GCJ
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_LD_GCJ
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_GCJ
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_GCJ
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_GCJ
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_GCJ
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_GCJ
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_GCJ
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_GCJ
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_thread_safe_flag_spec_GCJ
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_old_archive_cmds_GCJ
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_GCJ
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_GCJ
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_archive_cmds_GCJ
+archive_expsym_cmds=$lt_archive_expsym_cmds_GCJ
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_module_cmds_GCJ
+module_expsym_cmds=$lt_module_expsym_cmds_GCJ
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_predep_objects_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_postdep_objects_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_predeps_GCJ
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_postdeps_GCJ
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_GCJ
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_GCJ
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_GCJ
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_GCJ
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_GCJ
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_GCJ
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct_GCJ
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L_GCJ
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_GCJ
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$hardcode_automatic_GCJ
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_GCJ
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$fix_srcfile_path_GCJ"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$always_export_symbols_GCJ
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_GCJ
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_GCJ
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_GCJ
+
+# ### END LIBTOOL TAG CONFIG: $tagname
+
+__EOF__
+
+
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+ else
+ tagname=""
+ fi
+ ;;
+
+ RC)
+
+
+
+# Source file extension for RC test sources.
+ac_ext=rc
+
+# Object file extension for compiled RC test sources.
+objext=o
+objext_RC=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }\n'
+
+# Code to be used in simple link tests
+lt_simple_link_test_code="$lt_simple_compile_test_code"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$rm conftest*
+
+ac_outfile=conftest.$ac_objext
+printf "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$rm conftest*
+
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+CC=${RC-"windres"}
+compiler=$CC
+compiler_RC=$CC
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"`
+
+lt_cv_prog_compiler_c_o_RC=yes
+
+# The else clause should only fire when bootstrapping the
+# libtool distribution, otherwise you forgot to ship ltmain.sh
+# with your package, and you will get complaints that there are
+# no rules to generate ltmain.sh.
+if test -f "$ltmain"; then
+ # See if we are running on zsh, and set the options which allow our commands through
+ # without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+ # Now quote all the things that may contain metacharacters while being
+ # careful not to overquote the AC_SUBSTed values. We take copies of the
+ # variables and quote the copies for generation of the libtool script.
+ for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \
+ SED SHELL STRIP \
+ libname_spec library_names_spec soname_spec extract_expsyms_cmds \
+ old_striplib striplib file_magic_cmd finish_cmds finish_eval \
+ deplibs_check_method reload_flag reload_cmds need_locks \
+ lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \
+ lt_cv_sys_global_symbol_to_c_name_address \
+ sys_lib_search_path_spec sys_lib_dlsearch_path_spec \
+ old_postinstall_cmds old_postuninstall_cmds \
+ compiler_RC \
+ CC_RC \
+ LD_RC \
+ lt_prog_compiler_wl_RC \
+ lt_prog_compiler_pic_RC \
+ lt_prog_compiler_static_RC \
+ lt_prog_compiler_no_builtin_flag_RC \
+ export_dynamic_flag_spec_RC \
+ thread_safe_flag_spec_RC \
+ whole_archive_flag_spec_RC \
+ enable_shared_with_static_runtimes_RC \
+ old_archive_cmds_RC \
+ old_archive_from_new_cmds_RC \
+ predep_objects_RC \
+ postdep_objects_RC \
+ predeps_RC \
+ postdeps_RC \
+ compiler_lib_search_path_RC \
+ archive_cmds_RC \
+ archive_expsym_cmds_RC \
+ postinstall_cmds_RC \
+ postuninstall_cmds_RC \
+ old_archive_from_expsyms_cmds_RC \
+ allow_undefined_flag_RC \
+ no_undefined_flag_RC \
+ export_symbols_cmds_RC \
+ hardcode_libdir_flag_spec_RC \
+ hardcode_libdir_flag_spec_ld_RC \
+ hardcode_libdir_separator_RC \
+ hardcode_automatic_RC \
+ module_cmds_RC \
+ module_expsym_cmds_RC \
+ lt_cv_prog_compiler_c_o_RC \
+ exclude_expsyms_RC \
+ include_expsyms_RC; do
+
+ case $var in
+ old_archive_cmds_RC | \
+ old_archive_from_new_cmds_RC | \
+ archive_cmds_RC | \
+ archive_expsym_cmds_RC | \
+ module_cmds_RC | \
+ module_expsym_cmds_RC | \
+ old_archive_from_expsyms_cmds_RC | \
+ export_symbols_cmds_RC | \
+ extract_expsyms_cmds | reload_cmds | finish_cmds | \
+ postinstall_cmds | postuninstall_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | \
+ sys_lib_search_path_spec | sys_lib_dlsearch_path_spec)
+ # Double-quote double-evaled strings.
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\""
+ ;;
+ *)
+ eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\""
+ ;;
+ esac
+ done
+
+ case $lt_echo in
+ *'\$0 --fallback-echo"')
+ lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'`
+ ;;
+ esac
+
+cfgfile="$ofile"
+
+ cat <<__EOF__ >> "$cfgfile"
+# ### BEGIN LIBTOOL TAG CONFIG: $tagname
+
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_RC
+
+# Whether or not to disallow shared libs when runtime libs are static
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_RC
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# An echo program that does not interpret backslashes.
+echo=$lt_echo
+
+# The archiver.
+AR=$lt_AR
+AR_FLAGS=$lt_AR_FLAGS
+
+# A C compiler.
+LTCC=$lt_LTCC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_LTCFLAGS
+
+# A language-specific compiler.
+CC=$lt_compiler_RC
+
+# Is the compiler the GNU C compiler?
+with_gcc=$GCC_RC
+
+gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\`
+gcc_ver=\`gcc -dumpversion\`
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# The linker used to build libraries.
+LD=$lt_LD_RC
+
+# Whether we need hard or soft links.
+LN_S=$lt_LN_S
+
+# A BSD-compatible nm program.
+NM=$lt_NM
+
+# A symbol stripping program
+STRIP=$lt_STRIP
+
+# Used to examine libraries when file_magic_cmd begins "file"
+MAGIC_CMD=$MAGIC_CMD
+
+# Used on cygwin: DLL creation program.
+DLLTOOL="$DLLTOOL"
+
+# Used on cygwin: object dumper.
+OBJDUMP="$OBJDUMP"
+
+# Used on cygwin: assembler.
+AS="$AS"
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_RC
+
+# Object file suffix (normally "o").
+objext="$ac_objext"
+
+# Old archive suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally ".so").
+shrext_cmds='$shrext_cmds'
+
+# Executable file suffix (normally "").
+exeext="$exeext"
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_RC
+pic_mode=$pic_mode
+
+# What is the maximum length of a command?
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_RC
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Do we need the lib prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_RC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_RC
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_RC
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_RC
+
+# Compiler flag to generate thread-safe objects.
+thread_safe_flag_spec=$lt_thread_safe_flag_spec_RC
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Commands used to build and install an old-style archive.
+RANLIB=$lt_RANLIB
+old_archive_cmds=$lt_old_archive_cmds_RC
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_RC
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_RC
+
+# Commands used to build and install a shared archive.
+archive_cmds=$lt_archive_cmds_RC
+archive_expsym_cmds=$lt_archive_expsym_cmds_RC
+postinstall_cmds=$lt_postinstall_cmds
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to build a loadable module (assumed same as above if empty)
+module_cmds=$lt_module_cmds_RC
+module_expsym_cmds=$lt_module_expsym_cmds_RC
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predep_objects=\`echo $lt_predep_objects_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdep_objects=\`echo $lt_postdep_objects_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Dependencies to place before the objects being linked to create a
+# shared library.
+predeps=$lt_predeps_RC
+
+# Dependencies to place after the objects being linked to create a
+# shared library.
+postdeps=$lt_postdeps_RC
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method == file_magic.
+file_magic_cmd=$lt_file_magic_cmd
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_RC
+
+# Flag that forces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_RC
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval=$lt_finish_eval
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_RC
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_RC
+
+# If ld is used when linking, flag to hardcode \$libdir into
+# a binary during linking. This must work even if \$libdir does
+# not exist.
+hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_RC
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_RC
+
+# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct_RC
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L_RC
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_RC
+
+# Set to yes if building a shared library automatically hardcodes DIR into the library
+# and all subsequent libraries and executables linked against it.
+hardcode_automatic=$hardcode_automatic_RC
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at relink time.
+variables_saved_for_relink="$variables_saved_for_relink"
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_RC
+
+# Compile-time system search path for libraries
+sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\`
+
+# Run-time system search path for libraries
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Fix the shell variable \$srcfile for the compiler.
+fix_srcfile_path="$fix_srcfile_path_RC"
+
+# Set to yes if exported symbols are required.
+always_export_symbols=$always_export_symbols_RC
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_RC
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_RC
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_RC
+
+# ### END LIBTOOL TAG CONFIG: $tagname
+
+__EOF__
+
+
+else
+ # If there is no Makefile yet, we rely on a make rule to execute
+ # `config.status --recheck' to rerun these tests and create the
+ # libtool script then.
+ ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'`
+ if test -f "$ltmain_in"; then
+ test -f Makefile && make "$ltmain"
+ fi
+fi
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+ ;;
+
+ *)
+ { { echo "$as_me:$LINENO: error: Unsupported tag name: $tagname" >&5
+echo "$as_me: error: Unsupported tag name: $tagname" >&2;}
+ { (exit 1); exit 1; }; }
+ ;;
+ esac
+
+ # Append the new tag name to the list of available tags.
+ if test -n "$tagname" ; then
+ available_tags="$available_tags $tagname"
+ fi
+ fi
+ done
+ IFS="$lt_save_ifs"
+
+ # Now substitute the updated list of available tags.
+ if eval "sed -e 's/^available_tags=.*\$/available_tags=\"$available_tags\"/' \"$ofile\" > \"${ofile}T\""; then
+ mv "${ofile}T" "$ofile"
+ chmod +x "$ofile"
+ else
+ rm -f "${ofile}T"
+ { { echo "$as_me:$LINENO: error: unable to update list of available tagged configurations." >&5
+echo "$as_me: error: unable to update list of available tagged configurations." >&2;}
+ { (exit 1); exit 1; }; }
+ fi
+fi
+
+
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ac_aux_dir/ltmain.sh"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+
+# Prevent multiple expansion
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}gcc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}gcc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "gcc", so it can be a program name with args.
+set dummy gcc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="gcc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ CC=$ac_ct_CC
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ CC=$ac_ct_CC
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+fi
+if test -z "$CC"; then
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+ ac_prog_rejected=no
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then
+ ac_prog_rejected=yes
+ continue
+ fi
+ ac_cv_prog_CC="cc"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+if test $ac_prog_rejected = yes; then
+ # We found a bogon in the path, so make sure we never use it.
+ set dummy $ac_cv_prog_CC
+ shift
+ if test $# != 0; then
+ # We chose a different compiler from the bogus one.
+ # However, it has the same basename, so the bogon will be chosen
+ # first if we set CC to just the basename; use the full file name.
+ shift
+ ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@"
+ fi
+fi
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in cl
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="$ac_tool_prefix$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ echo "$as_me:$LINENO: result: $CC" >&5
+echo "${ECHO_T}$CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$CC" && break
+ done
+fi
+if test -z "$CC"; then
+ ac_ct_CC=$CC
+ for ac_prog in cl
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_prog_ac_ct_CC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="$ac_prog"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ echo "$as_me:$LINENO: result: $ac_ct_CC" >&5
+echo "${ECHO_T}$ac_ct_CC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ test -n "$ac_ct_CC" && break
+done
+
+ CC=$ac_ct_CC
+fi
+
+fi
+
+
+test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH
+See \`config.log' for more details." >&5
+echo "$as_me: error: no acceptable C compiler found in \$PATH
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+
+# Provide some information about the compiler.
+echo "$as_me:$LINENO:" \
+ "checking for C compiler version" >&5
+ac_compiler=`set X $ac_compile; echo $2`
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5
+ (eval $ac_compiler --version </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5
+ (eval $ac_compiler -v </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5
+ (eval $ac_compiler -V </dev/null >&5) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }
+
+echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5
+echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6
+if test "${ac_cv_c_compiler_gnu+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_compiler_gnu=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_compiler_gnu=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_c_compiler_gnu=$ac_compiler_gnu
+
+fi
+echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5
+echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6
+GCC=`test $ac_compiler_gnu = yes && echo yes`
+ac_test_CFLAGS=${CFLAGS+set}
+ac_save_CFLAGS=$CFLAGS
+CFLAGS="-g"
+echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5
+echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6
+if test "${ac_cv_prog_cc_g+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_cc_g=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_prog_cc_g=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5
+echo "${ECHO_T}$ac_cv_prog_cc_g" >&6
+if test "$ac_test_CFLAGS" = set; then
+ CFLAGS=$ac_save_CFLAGS
+elif test $ac_cv_prog_cc_g = yes; then
+ if test "$GCC" = yes; then
+ CFLAGS="-g -O2"
+ else
+ CFLAGS="-g"
+ fi
+else
+ if test "$GCC" = yes; then
+ CFLAGS="-O2"
+ else
+ CFLAGS=
+ fi
+fi
+echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5
+echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6
+if test "${ac_cv_prog_cc_stdc+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ ac_cv_prog_cc_stdc=no
+ac_save_CC=$CC
+cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdarg.h>
+#include <stdio.h>
+#include <sys/types.h>
+#include <sys/stat.h>
+/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */
+struct buf { int x; };
+FILE * (*rcsopen) (struct buf *, struct stat *, int);
+static char *e (p, i)
+ char **p;
+ int i;
+{
+ return p[i];
+}
+static char *f (char * (*g) (char **, int), char **p, ...)
+{
+ char *s;
+ va_list v;
+ va_start (v,p);
+ s = g (p, va_arg (v,int));
+ va_end (v);
+ return s;
+}
+
+/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has
+ function prototypes and stuff, but not '\xHH' hex character constants.
+ These don't provoke an error unfortunately, instead are silently treated
+ as 'x'. The following induces an error, until -std1 is added to get
+ proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an
+ array size at least. It's necessary to write '\x00'==0 to get something
+ that's true only with -std1. */
+int osf4_cc_array ['\x00' == 0 ? 1 : -1];
+
+int test (int i, double x);
+struct s1 {int (*f) (int a);};
+struct s2 {int (*f) (double a);};
+int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int);
+int argc;
+char **argv;
+int
+main ()
+{
+return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1];
+ ;
+ return 0;
+}
+_ACEOF
+# Don't try gcc -ansi; that turns off useful extensions and
+# breaks some systems' header files.
+# AIX -qlanglvl=ansi
+# Ultrix and OSF/1 -std1
+# HP-UX 10.20 and later -Ae
+# HP-UX older versions -Aa -D_HPUX_SOURCE
+# SVR4 -Xc -D__EXTENSIONS__
+for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__"
+do
+ CC="$ac_save_CC $ac_arg"
+ rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_prog_cc_stdc=$ac_arg
+break
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext
+done
+rm -f conftest.$ac_ext conftest.$ac_objext
+CC=$ac_save_CC
+
+fi
+
+case "x$ac_cv_prog_cc_stdc" in
+ x|xno)
+ echo "$as_me:$LINENO: result: none needed" >&5
+echo "${ECHO_T}none needed" >&6 ;;
+ *)
+ echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5
+echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6
+ CC="$CC $ac_cv_prog_cc_stdc" ;;
+esac
+
+# Some people use a C++ compiler to compile C. Since we use `exit',
+# in C++ we need to declare it. In case someone uses the same compiler
+# for both compiling C and C++ we need to have the C++ compiler decide
+# the declaration of exit, since it's the most demanding environment.
+cat >conftest.$ac_ext <<_ACEOF
+#ifndef __cplusplus
+ choke me
+#endif
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ for ac_declaration in \
+ '' \
+ 'extern "C" void std::exit (int) throw (); using std::exit;' \
+ 'extern "C" void std::exit (int); using std::exit;' \
+ 'extern "C" void exit (int) throw ();' \
+ 'extern "C" void exit (int);' \
+ 'void exit (int);'
+do
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+#include <stdlib.h>
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ :
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+continue
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+$ac_declaration
+int
+main ()
+{
+exit (42);
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ break
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+done
+rm -f conftest*
+if test -n "$ac_declaration"; then
+ echo '#ifdef __cplusplus' >>confdefs.h
+ echo $ac_declaration >>confdefs.h
+ echo '#endif' >>confdefs.h
+fi
+
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+depcc="$CC" am_compiler_list=
+
+echo "$as_me:$LINENO: checking dependency style of $depcc" >&5
+echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6
+if test "${am_cv_CC_dependencies_compiler_type+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named `D' -- because `-MD' means `put the output
+ # in D'.
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CC_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+ # Solaris 8's {/usr,}/bin/sh.
+ touch sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ case $depmode in
+ nosideeffect)
+ # after this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ none) break ;;
+ esac
+ # We check with `-c' and `-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle `-M -o', and we need to detect this.
+ if depmode=$depmode \
+ source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CC_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CC_dependencies_compiler_type=none
+fi
+
+fi
+echo "$as_me:$LINENO: result: $am_cv_CC_dependencies_compiler_type" >&5
+echo "${ECHO_T}$am_cv_CC_dependencies_compiler_type" >&6
+CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type
+
+
+
+if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then
+ am__fastdepCC_TRUE=
+ am__fastdepCC_FALSE='#'
+else
+ am__fastdepCC_TRUE='#'
+ am__fastdepCC_FALSE=
+fi
+
+
+
+
+
+
+#AC_DEFINE(XFree86LOADER,1,[Stub define for loadable drivers])
+#
+#AC_ARG_ENABLE(XINPUT, AS_HELP_STRING([--enable-xinput],
+# [Build XInput support (default: yes)]),
+# [XINPUT=$enableval],[XINPUT=yes])
+#AM_CONDITIONAL(XINPUT, test "x$XINPUT" = "xyes")
+#if test "x$XINPUT" = "xyes" ; then
+# AC_DEFINE(XINPUT,1,[Enable XInput support])
+#fi
+#
+#AC_ARG_ENABLE(XKB, AS_HELP_STRING([--enable-xkb],
+# [Build XKB support (default: yes)]),
+# [XKB=$enableval],[XKB=yes])
+#AM_CONDITIONAL(XKB, test "x$XKB" = "xyes")
+#if test "x$XKB" = "xyes" ; then
+# AC_DEFINE(XKB,1,[Enable XKB support])
+#fi
+
+
+# Check whether --with-xorg-module-dir or --without-xorg-module-dir was given.
+if test "${with_xorg_module_dir+set}" = set; then
+ withval="$with_xorg_module_dir"
+ moduledir="$withval"
+else
+ moduledir="$libdir/xorg/modules"
+fi;
+inputdir=${moduledir}/input
+
+
+# Checks for extensions
+
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`"
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+#include "xorg-server.h"
+#if !defined RANDR
+#error RANDR not defined
+#endif
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ _EXT_CHECK=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+_EXT_CHECK=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ CFLAGS="$SAVE_CFLAGS"
+ echo "$as_me:$LINENO: checking if RANDR is defined" >&5
+echo $ECHO_N "checking if RANDR is defined... $ECHO_C" >&6
+ echo "$as_me:$LINENO: result: $_EXT_CHECK" >&5
+echo "${ECHO_T}$_EXT_CHECK" >&6
+ if test "$_EXT_CHECK" != no; then
+ REQUIRED_MODULES="$REQUIRED_MODULES randrproto"
+ fi
+
+
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`"
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+
+#include "xorg-server.h"
+#if !defined XINPUT
+#error XINPUT not defined
+#endif
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ _EXT_CHECK=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+_EXT_CHECK=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+ CFLAGS="$SAVE_CFLAGS"
+ echo "$as_me:$LINENO: checking if XINPUT is defined" >&5
+echo $ECHO_N "checking if XINPUT is defined... $ECHO_C" >&6
+ echo "$as_me:$LINENO: result: $_EXT_CHECK" >&5
+echo "${ECHO_T}$_EXT_CHECK" >&6
+ if test "$_EXT_CHECK" != no; then
+ REQUIRED_MODULES="$REQUIRED_MODULES inputproto"
+ fi
+
+
+# Checks for pkg-config packages
+
+
+if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args.
+set dummy ${ac_tool_prefix}pkg-config; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_path_PKG_CONFIG+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $PKG_CONFIG in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ ;;
+esac
+fi
+PKG_CONFIG=$ac_cv_path_PKG_CONFIG
+
+if test -n "$PKG_CONFIG"; then
+ echo "$as_me:$LINENO: result: $PKG_CONFIG" >&5
+echo "${ECHO_T}$PKG_CONFIG" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+fi
+if test -z "$ac_cv_path_PKG_CONFIG"; then
+ ac_pt_PKG_CONFIG=$PKG_CONFIG
+ # Extract the first word of "pkg-config", so it can be a program name with args.
+set dummy pkg-config; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_path_ac_pt_PKG_CONFIG+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $ac_pt_PKG_CONFIG in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_ac_pt_PKG_CONFIG="$ac_pt_PKG_CONFIG" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_ac_pt_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ ;;
+esac
+fi
+ac_pt_PKG_CONFIG=$ac_cv_path_ac_pt_PKG_CONFIG
+
+if test -n "$ac_pt_PKG_CONFIG"; then
+ echo "$as_me:$LINENO: result: $ac_pt_PKG_CONFIG" >&5
+echo "${ECHO_T}$ac_pt_PKG_CONFIG" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+ PKG_CONFIG=$ac_pt_PKG_CONFIG
+else
+ PKG_CONFIG="$ac_cv_path_PKG_CONFIG"
+fi
+
+fi
+if test -n "$PKG_CONFIG"; then
+ _pkg_min_version=0.9.0
+ echo "$as_me:$LINENO: checking pkg-config is at least version $_pkg_min_version" >&5
+echo $ECHO_N "checking pkg-config is at least version $_pkg_min_version... $ECHO_C" >&6
+ if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+ else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+ PKG_CONFIG=""
+ fi
+
+fi
+
+pkg_failed=no
+echo "$as_me:$LINENO: checking for XORG" >&5
+echo $ECHO_N "checking for XORG... $ECHO_C" >&6
+
+if test -n "$PKG_CONFIG"; then
+ if test -n "$XORG_CFLAGS"; then
+ pkg_cv_XORG_CFLAGS="$XORG_CFLAGS"
+ else
+ if test -n "$PKG_CONFIG" && \
+ { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"xorg-server >= 1.0.99.901 xproto \$REQUIRED_MODULES\"") >&5
+ ($PKG_CONFIG --exists --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES") 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ pkg_cv_XORG_CFLAGS=`$PKG_CONFIG --cflags "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES" 2>/dev/null`
+else
+ pkg_failed=yes
+fi
+ fi
+else
+ pkg_failed=untried
+fi
+if test -n "$PKG_CONFIG"; then
+ if test -n "$XORG_LIBS"; then
+ pkg_cv_XORG_LIBS="$XORG_LIBS"
+ else
+ if test -n "$PKG_CONFIG" && \
+ { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"xorg-server >= 1.0.99.901 xproto \$REQUIRED_MODULES\"") >&5
+ ($PKG_CONFIG --exists --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES") 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; then
+ pkg_cv_XORG_LIBS=`$PKG_CONFIG --libs "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES" 2>/dev/null`
+else
+ pkg_failed=yes
+fi
+ fi
+else
+ pkg_failed=untried
+fi
+
+
+
+if test $pkg_failed = yes; then
+
+if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then
+ _pkg_short_errors_supported=yes
+else
+ _pkg_short_errors_supported=no
+fi
+ if test $_pkg_short_errors_supported = yes; then
+ XORG_PKG_ERRORS=`$PKG_CONFIG --short-errors --errors-to-stdout --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES"`
+ else
+ XORG_PKG_ERRORS=`$PKG_CONFIG --errors-to-stdout --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES"`
+ fi
+ # Put the nasty error message in config.log where it belongs
+ echo "$XORG_PKG_ERRORS" >&5
+
+ { { echo "$as_me:$LINENO: error: Package requirements (xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES) were not met:
+
+$XORG_PKG_ERRORS
+
+Consider adjusting the PKG_CONFIG_PATH environment variable if you
+installed software in a non-standard prefix.
+
+Alternatively, you may set the environment variables XORG_CFLAGS
+and XORG_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.
+" >&5
+echo "$as_me: error: Package requirements (xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES) were not met:
+
+$XORG_PKG_ERRORS
+
+Consider adjusting the PKG_CONFIG_PATH environment variable if you
+installed software in a non-standard prefix.
+
+Alternatively, you may set the environment variables XORG_CFLAGS
+and XORG_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.
+" >&2;}
+ { (exit 1); exit 1; }; }
+elif test $pkg_failed = untried; then
+ { { echo "$as_me:$LINENO: error: The pkg-config script could not be found or is too old. Make sure it
+is in your PATH or set the PKG_CONFIG environment variable to the full
+path to pkg-config.
+
+Alternatively, you may set the environment variables XORG_CFLAGS
+and XORG_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.
+
+To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>.
+See \`config.log' for more details." >&5
+echo "$as_me: error: The pkg-config script could not be found or is too old. Make sure it
+is in your PATH or set the PKG_CONFIG environment variable to the full
+path to pkg-config.
+
+Alternatively, you may set the environment variables XORG_CFLAGS
+and XORG_LIBS to avoid the need to call pkg-config.
+See the pkg-config man page for more details.
+
+To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>.
+See \`config.log' for more details." >&2;}
+ { (exit 1); exit 1; }; }
+else
+ XORG_CFLAGS=$pkg_cv_XORG_CFLAGS
+ XORG_LIBS=$pkg_cv_XORG_LIBS
+ echo "$as_me:$LINENO: result: yes" >&5
+echo "${ECHO_T}yes" >&6
+ :
+fi
+sdkdir=$(pkg-config --variable=sdkdir xorg-server)
+
+CFLAGS="$CFLAGS $XORG_CFLAGS "' -I$(top_srcdir)/src'
+
+
+# Checks for libraries.
+
+# Checks for header files.
+echo "$as_me:$LINENO: checking for ANSI C header files" >&5
+echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6
+if test "${ac_cv_header_stdc+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.$ac_objext
+if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5
+ (eval $ac_compile) 2>conftest.er1
+ ac_status=$?
+ grep -v '^ *+' conftest.er1 >conftest.err
+ rm -f conftest.er1
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } &&
+ { ac_try='test -z "$ac_c_werror_flag"
+ || test ! -s conftest.err'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; } &&
+ { ac_try='test -s conftest.$ac_objext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ ac_cv_header_stdc=yes
+else
+ echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ac_cv_header_stdc=no
+fi
+rm -f conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then
+ :
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then
+ :
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then
+ :
+else
+ cat >conftest.$ac_ext <<_ACEOF
+/* confdefs.h. */
+_ACEOF
+cat confdefs.h >>conftest.$ac_ext
+cat >>conftest.$ac_ext <<_ACEOF
+/* end confdefs.h. */
+#include <ctype.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ exit(2);
+ exit (0);
+}
+_ACEOF
+rm -f conftest$ac_exeext
+if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); } && { ac_try='./conftest$ac_exeext'
+ { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5
+ (eval $ac_try) 2>&5
+ ac_status=$?
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ (exit $ac_status); }; }; then
+ :
+else
+ echo "$as_me: program exited with status $ac_status" >&5
+echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+( exit $ac_status )
+ac_cv_header_stdc=no
+fi
+rm -f core *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext
+fi
+fi
+fi
+echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5
+echo "${ECHO_T}$ac_cv_header_stdc" >&6
+if test $ac_cv_header_stdc = yes; then
+
+cat >>confdefs.h <<\_ACEOF
+#define STDC_HEADERS 1
+_ACEOF
+
+fi
+
+
+
+
+
+if test x$APP_MAN_SUFFIX = x ; then
+ APP_MAN_SUFFIX=1
+fi
+if test x$APP_MAN_DIR = x ; then
+ APP_MAN_DIR='$(mandir)/man$(APP_MAN_SUFFIX)'
+fi
+
+if test x$LIB_MAN_SUFFIX = x ; then
+ LIB_MAN_SUFFIX=3
+fi
+if test x$LIB_MAN_DIR = x ; then
+ LIB_MAN_DIR='$(mandir)/man$(LIB_MAN_SUFFIX)'
+fi
+
+if test x$FILE_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) FILE_MAN_SUFFIX=4 ;;
+ *) FILE_MAN_SUFFIX=5 ;;
+ esac
+fi
+if test x$FILE_MAN_DIR = x ; then
+ FILE_MAN_DIR='$(mandir)/man$(FILE_MAN_SUFFIX)'
+fi
+
+if test x$MISC_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) MISC_MAN_SUFFIX=5 ;;
+ *) MISC_MAN_SUFFIX=7 ;;
+ esac
+fi
+if test x$MISC_MAN_DIR = x ; then
+ MISC_MAN_DIR='$(mandir)/man$(MISC_MAN_SUFFIX)'
+fi
+
+if test x$DRIVER_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) DRIVER_MAN_SUFFIX=7 ;;
+ *) DRIVER_MAN_SUFFIX=4 ;;
+ esac
+fi
+if test x$DRIVER_MAN_DIR = x ; then
+ DRIVER_MAN_DIR='$(mandir)/man$(DRIVER_MAN_SUFFIX)'
+fi
+
+if test x$ADMIN_MAN_SUFFIX = x ; then
+ case $host_os in
+ solaris*) ADMIN_MAN_SUFFIX=1m ;;
+ *) ADMIN_MAN_SUFFIX=8 ;;
+ esac
+fi
+if test x$ADMIN_MAN_DIR = x ; then
+ ADMIN_MAN_DIR='$(mandir)/man$(ADMIN_MAN_SUFFIX)'
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-release-version or --without-release-version was given.
+if test "${with_release_version+set}" = set; then
+ withval="$with_release_version"
+ RELEASE_VERSION="$withval"
+else
+ RELEASE_VERSION=""
+fi;
+ if test "x$RELEASE_VERSION" != "x"; then
+ PACKAGE="$PACKAGE-$RELEASE_VERSION"
+ PACKAGE_TARNAME="$PACKAGE_TARNAME-$RELEASE_VERSION"
+ { echo "$as_me:$LINENO: Building with package name set to $PACKAGE" >&5
+echo "$as_me: Building with package name set to $PACKAGE" >&6;}
+ fi
+
+
+
+as_ac_File=`echo "ac_cv_file_$prefix/share/X11/sgml/defs.ent" | $as_tr_sh`
+echo "$as_me:$LINENO: checking for $prefix/share/X11/sgml/defs.ent" >&5
+echo $ECHO_N "checking for $prefix/share/X11/sgml/defs.ent... $ECHO_C" >&6
+if eval "test \"\${$as_ac_File+set}\" = set"; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ test "$cross_compiling" = yes &&
+ { { echo "$as_me:$LINENO: error: cannot check for file existence when cross compiling" >&5
+echo "$as_me: error: cannot check for file existence when cross compiling" >&2;}
+ { (exit 1); exit 1; }; }
+if test -r "$prefix/share/X11/sgml/defs.ent"; then
+ eval "$as_ac_File=yes"
+else
+ eval "$as_ac_File=no"
+fi
+fi
+echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_File'}'`" >&5
+echo "${ECHO_T}`eval echo '${'$as_ac_File'}'`" >&6
+if test `eval echo '${'$as_ac_File'}'` = yes; then
+ DEFS_ENT_PATH=$prefix/share/X11/sgml
+else
+ DEFS_ENT_PATH=
+
+fi
+
+
+# Extract the first word of "linuxdoc", so it can be a program name with args.
+set dummy linuxdoc; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_path_LINUXDOC+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $LINUXDOC in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_LINUXDOC="$LINUXDOC" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_LINUXDOC="$as_dir/$ac_word$ac_exec_ext"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ ;;
+esac
+fi
+LINUXDOC=$ac_cv_path_LINUXDOC
+
+if test -n "$LINUXDOC"; then
+ echo "$as_me:$LINENO: result: $LINUXDOC" >&5
+echo "${ECHO_T}$LINUXDOC" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+# Extract the first word of "ps2pdf", so it can be a program name with args.
+set dummy ps2pdf; ac_word=$2
+echo "$as_me:$LINENO: checking for $ac_word" >&5
+echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6
+if test "${ac_cv_path_PS2PDF+set}" = set; then
+ echo $ECHO_N "(cached) $ECHO_C" >&6
+else
+ case $PS2PDF in
+ [\\/]* | ?:[\\/]*)
+ ac_cv_path_PS2PDF="$PS2PDF" # Let the user override the test with a path.
+ ;;
+ *)
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_path_PS2PDF="$as_dir/$ac_word$ac_exec_ext"
+ echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+done
+
+ ;;
+esac
+fi
+PS2PDF=$ac_cv_path_PS2PDF
+
+if test -n "$PS2PDF"; then
+ echo "$as_me:$LINENO: result: $PS2PDF" >&5
+echo "${ECHO_T}$PS2PDF" >&6
+else
+ echo "$as_me:$LINENO: result: no" >&5
+echo "${ECHO_T}no" >&6
+fi
+
+
+echo "$as_me:$LINENO: checking Whether to build documentation" >&5
+echo $ECHO_N "checking Whether to build documentation... $ECHO_C" >&6
+
+if test x$DEFS_ENT_PATH != x && test x$LINUXDOC != x ; then
+ BUILDDOC=yes
+else
+ BUILDDOC=no
+fi
+
+
+
+if test x$BUILDDOC = xyes; then
+ BUILD_LINUXDOC_TRUE=
+ BUILD_LINUXDOC_FALSE='#'
+else
+ BUILD_LINUXDOC_TRUE='#'
+ BUILD_LINUXDOC_FALSE=
+fi
+
+
+echo "$as_me:$LINENO: result: $BUILDDOC" >&5
+echo "${ECHO_T}$BUILDDOC" >&6
+
+echo "$as_me:$LINENO: checking Whether to build pdf documentation" >&5
+echo $ECHO_N "checking Whether to build pdf documentation... $ECHO_C" >&6
+
+if test x$PS2PDF != x ; then
+ BUILDPDFDOC=yes
+else
+ BUILDPDFDOC=no
+fi
+
+
+
+if test x$BUILDPDFDOC = xyes; then
+ BUILD_PDFDOC_TRUE=
+ BUILD_PDFDOC_FALSE='#'
+else
+ BUILD_PDFDOC_TRUE='#'
+ BUILD_PDFDOC_FALSE=
+fi
+
+
+echo "$as_me:$LINENO: result: $BUILDPDFDOC" >&5
+echo "${ECHO_T}$BUILDPDFDOC" >&6
+
+MAKE_TEXT="SGML_SEARCH_PATH=$DEFS_ENT_PATH GROFF_NO_SGR=y $LINUXDOC -B txt"
+MAKE_PS="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B latex --papersize=letter --output=ps"
+MAKE_PDF="$PS2PDF"
+MAKE_HTML="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B html --split=0"
+
+
+
+
+
+
+
+ ac_config_files="$ac_config_files Makefile src/Makefile man/Makefile"
+cat >confcache <<\_ACEOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs, see configure's option --config-cache.
+# It is not useful on other systems. If it contains results you don't
+# want to keep, you may remove or edit it.
+#
+# config.status only pays attention to the cache file if you give it
+# the --recheck option to rerun configure.
+#
+# `ac_cv_env_foo' variables (set or unset) will be overridden when
+# loading this file, other *unset* `ac_cv_foo' will be assigned the
+# following values.
+
+_ACEOF
+
+# The following way of writing the cache mishandles newlines in values,
+# but we know of no workaround that is simple, portable, and efficient.
+# So, don't put newlines in cache variables' values.
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+{
+ (set) 2>&1 |
+ case `(ac_space=' '; set | grep ac_space) 2>&1` in
+ *ac_space=\ *)
+ # `set' does not quote correctly, so add quotes (double-quote
+ # substitution turns \\\\ into \\, and sed turns \\ into \).
+ sed -n \
+ "s/'/'\\\\''/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p"
+ ;;
+ *)
+ # `set' quotes correctly as required by POSIX, so do not add quotes.
+ sed -n \
+ "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p"
+ ;;
+ esac;
+} |
+ sed '
+ t clear
+ : clear
+ s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/
+ t end
+ /^ac_cv_env/!s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/
+ : end' >>confcache
+if diff $cache_file confcache >/dev/null 2>&1; then :; else
+ if test -w $cache_file; then
+ test "x$cache_file" != "x/dev/null" && echo "updating cache $cache_file"
+ cat confcache >$cache_file
+ else
+ echo "not updating unwritable cache $cache_file"
+ fi
+fi
+rm -f confcache
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+# VPATH may cause trouble with some makes, so we remove $(srcdir),
+# ${srcdir} and @srcdir@ from VPATH if srcdir is ".", strip leading and
+# trailing colons and then remove the whole line if VPATH becomes empty
+# (actually we leave an empty line to preserve line numbers).
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=/{
+s/:*\$(srcdir):*/:/;
+s/:*\${srcdir}:*/:/;
+s/:*@srcdir@:*/:/;
+s/^\([^=]*=[ ]*\):*/\1/;
+s/:*$//;
+s/^[^=]*=[ ]*$//;
+}'
+fi
+
+DEFS=-DHAVE_CONFIG_H
+
+ac_libobjs=
+ac_ltlibobjs=
+for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue
+ # 1. Remove the extension, and $U if already installed.
+ ac_i=`echo "$ac_i" |
+ sed 's/\$U\././;s/\.o$//;s/\.obj$//'`
+ # 2. Add them.
+ ac_libobjs="$ac_libobjs $ac_i\$U.$ac_objext"
+ ac_ltlibobjs="$ac_ltlibobjs $ac_i"'$U.lo'
+done
+LIBOBJS=$ac_libobjs
+
+LTLIBOBJS=$ac_ltlibobjs
+
+
+if test -z "${MAINTAINER_MODE_TRUE}" && test -z "${MAINTAINER_MODE_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"MAINTAINER_MODE\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"MAINTAINER_MODE\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"AMDEP\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"AMDEP\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${am__fastdepCXX_TRUE}" && test -z "${am__fastdepCXX_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCXX\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"am__fastdepCXX\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${BUILD_LINUXDOC_TRUE}" && test -z "${BUILD_LINUXDOC_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"BUILD_LINUXDOC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"BUILD_LINUXDOC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+if test -z "${BUILD_PDFDOC_TRUE}" && test -z "${BUILD_PDFDOC_FALSE}"; then
+ { { echo "$as_me:$LINENO: error: conditional \"BUILD_PDFDOC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&5
+echo "$as_me: error: conditional \"BUILD_PDFDOC\" was never defined.
+Usually this means the macro was only invoked conditionally." >&2;}
+ { (exit 1); exit 1; }; }
+fi
+
+: ${CONFIG_STATUS=./config.status}
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files $CONFIG_STATUS"
+{ echo "$as_me:$LINENO: creating $CONFIG_STATUS" >&5
+echo "$as_me: creating $CONFIG_STATUS" >&6;}
+cat >$CONFIG_STATUS <<_ACEOF
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate the current configuration.
+# Compiler output produced by configure, useful for debugging
+# configure, is in config.log if it exists.
+
+debug=false
+ac_cs_recheck=false
+ac_cs_silent=false
+SHELL=\${CONFIG_SHELL-$SHELL}
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+## --------------------- ##
+## M4sh Initialization. ##
+## --------------------- ##
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then
+ set -o posix
+fi
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# Support unset when possible.
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+ as_unset=unset
+else
+ as_unset=false
+fi
+
+
+# Work around bugs in pre-3.0 UWIN ksh.
+$as_unset ENV MAIL MAILPATH
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+for as_var in \
+ LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \
+ LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \
+ LC_TELEPHONE LC_TIME
+do
+ if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then
+ eval $as_var=C; export $as_var
+ else
+ $as_unset $as_var
+ fi
+done
+
+# Required to use basename.
+if expr a : '\(a\)' >/dev/null 2>&1; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+
+# Name of the executable.
+as_me=`$as_basename "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)$' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; }
+ /^X\/\(\/\/\)$/{ s//\1/; q; }
+ /^X\/\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+
+
+# PATH needs CR, and LINENO needs CR and PATH.
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ echo "#! /bin/sh" >conf$$.sh
+ echo "exit 0" >>conf$$.sh
+ chmod +x conf$$.sh
+ if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then
+ PATH_SEPARATOR=';'
+ else
+ PATH_SEPARATOR=:
+ fi
+ rm -f conf$$.sh
+fi
+
+
+ as_lineno_1=$LINENO
+ as_lineno_2=$LINENO
+ as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null`
+ test "x$as_lineno_1" != "x$as_lineno_2" &&
+ test "x$as_lineno_3" = "x$as_lineno_2" || {
+ # Find who we are. Look in the path if we contain no path at all
+ # relative or not.
+ case $0 in
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+done
+
+ ;;
+ esac
+ # We did not find ourselves, most probably we were run as `sh COMMAND'
+ # in which case we are not to be found in the path.
+ if test "x$as_myself" = x; then
+ as_myself=$0
+ fi
+ if test ! -f "$as_myself"; then
+ { { echo "$as_me:$LINENO: error: cannot find myself; rerun with an absolute path" >&5
+echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2;}
+ { (exit 1); exit 1; }; }
+ fi
+ case $CONFIG_SHELL in
+ '')
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for as_base in sh bash ksh sh5; do
+ case $as_dir in
+ /*)
+ if ("$as_dir/$as_base" -c '
+ as_lineno_1=$LINENO
+ as_lineno_2=$LINENO
+ as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null`
+ test "x$as_lineno_1" != "x$as_lineno_2" &&
+ test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then
+ $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; }
+ $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; }
+ CONFIG_SHELL=$as_dir/$as_base
+ export CONFIG_SHELL
+ exec "$CONFIG_SHELL" "$0" ${1+"$@"}
+ fi;;
+ esac
+ done
+done
+;;
+ esac
+
+ # Create $as_me.lineno as a copy of $as_myself, but with $LINENO
+ # uniformly replaced by the line number. The first 'sed' inserts a
+ # line-number line before each line; the second 'sed' does the real
+ # work. The second script uses 'N' to pair each line-number line
+ # with the numbered line, and appends trailing '-' during
+ # substitution so that $LINENO is not a special case at line end.
+ # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the
+ # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-)
+ sed '=' <$as_myself |
+ sed '
+ N
+ s,$,-,
+ : loop
+ s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3,
+ t loop
+ s,-$,,
+ s,^['$as_cr_digits']*\n,,
+ ' >$as_me.lineno &&
+ chmod +x $as_me.lineno ||
+ { { echo "$as_me:$LINENO: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&5
+echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2;}
+ { (exit 1); exit 1; }; }
+
+ # Don't try to exec as it changes $[0], causing all sort of problems
+ # (the dirname of $[0] is not the place where we might find the
+ # original and so on. Autoconf is especially sensible to this).
+ . ./$as_me.lineno
+ # Exit status is that of the last command.
+ exit
+}
+
+
+case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in
+ *c*,-n*) ECHO_N= ECHO_C='
+' ECHO_T=' ' ;;
+ *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;;
+ *) ECHO_N= ECHO_C='\c' ECHO_T= ;;
+esac
+
+if expr a : '\(a\)' >/dev/null 2>&1; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+rm -f conf$$ conf$$.exe conf$$.file
+echo >conf$$.file
+if ln -s conf$$.file conf$$ 2>/dev/null; then
+ # We could just check for DJGPP; but this test a) works b) is more generic
+ # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04).
+ if test -f conf$$.exe; then
+ # Don't use ln at all; we don't have any links
+ as_ln_s='cp -p'
+ else
+ as_ln_s='ln -s'
+ fi
+elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+else
+ as_ln_s='cp -p'
+fi
+rm -f conf$$ conf$$.exe conf$$.file
+
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p=:
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+as_executable_p="test -f"
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+# IFS
+# We need space, tab and new line, in precisely that order.
+as_nl='
+'
+IFS=" $as_nl"
+
+# CDPATH.
+$as_unset CDPATH
+
+exec 6>&1
+
+# Open the log real soon, to keep \$[0] and so on meaningful, and to
+# report actual input values of CONFIG_FILES etc. instead of their
+# values after options handling. Logging --version etc. is OK.
+exec 5>>config.log
+{
+ echo
+ sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+} >&5
+cat >&5 <<_CSEOF
+
+This file was extended by xf86-input-mouse $as_me 1.1.2, which was
+generated by GNU Autoconf 2.59. Invocation command line was
+
+ CONFIG_FILES = $CONFIG_FILES
+ CONFIG_HEADERS = $CONFIG_HEADERS
+ CONFIG_LINKS = $CONFIG_LINKS
+ CONFIG_COMMANDS = $CONFIG_COMMANDS
+ $ $0 $@
+
+_CSEOF
+echo "on `(hostname || uname -n) 2>/dev/null | sed 1q`" >&5
+echo >&5
+_ACEOF
+
+# Files that config.status was made for.
+if test -n "$ac_config_files"; then
+ echo "config_files=\"$ac_config_files\"" >>$CONFIG_STATUS
+fi
+
+if test -n "$ac_config_headers"; then
+ echo "config_headers=\"$ac_config_headers\"" >>$CONFIG_STATUS
+fi
+
+if test -n "$ac_config_links"; then
+ echo "config_links=\"$ac_config_links\"" >>$CONFIG_STATUS
+fi
+
+if test -n "$ac_config_commands"; then
+ echo "config_commands=\"$ac_config_commands\"" >>$CONFIG_STATUS
+fi
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+
+ac_cs_usage="\
+\`$as_me' instantiates files from templates according to the
+current configuration.
+
+Usage: $0 [OPTIONS] [FILE]...
+
+ -h, --help print this help, then exit
+ -V, --version print version number, then exit
+ -q, --quiet do not print progress messages
+ -d, --debug don't remove temporary files
+ --recheck update $as_me by reconfiguring in the same conditions
+ --file=FILE[:TEMPLATE]
+ instantiate the configuration file FILE
+ --header=FILE[:TEMPLATE]
+ instantiate the configuration header FILE
+
+Configuration files:
+$config_files
+
+Configuration headers:
+$config_headers
+
+Configuration commands:
+$config_commands
+
+Report bugs to <bug-autoconf@gnu.org>."
+_ACEOF
+
+cat >>$CONFIG_STATUS <<_ACEOF
+ac_cs_version="\\
+xf86-input-mouse config.status 1.1.2
+configured by $0, generated by GNU Autoconf 2.59,
+ with options \\"`echo "$ac_configure_args" | sed 's/[\\""\`\$]/\\\\&/g'`\\"
+
+Copyright (C) 2003 Free Software Foundation, Inc.
+This config.status script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it."
+srcdir=$srcdir
+INSTALL="$INSTALL"
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+# If no file are specified by the user, then we need to provide default
+# value. By we need to know if files were specified by the user.
+ac_need_defaults=:
+while test $# != 0
+do
+ case $1 in
+ --*=*)
+ ac_option=`expr "x$1" : 'x\([^=]*\)='`
+ ac_optarg=`expr "x$1" : 'x[^=]*=\(.*\)'`
+ ac_shift=:
+ ;;
+ -*)
+ ac_option=$1
+ ac_optarg=$2
+ ac_shift=shift
+ ;;
+ *) # This is not an option, so the user has probably given explicit
+ # arguments.
+ ac_option=$1
+ ac_need_defaults=false;;
+ esac
+
+ case $ac_option in
+ # Handling of the options.
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ ac_cs_recheck=: ;;
+ --version | --vers* | -V )
+ echo "$ac_cs_version"; exit 0 ;;
+ --he | --h)
+ # Conflict between --help and --header
+ { { echo "$as_me:$LINENO: error: ambiguous option: $1
+Try \`$0 --help' for more information." >&5
+echo "$as_me: error: ambiguous option: $1
+Try \`$0 --help' for more information." >&2;}
+ { (exit 1); exit 1; }; };;
+ --help | --hel | -h )
+ echo "$ac_cs_usage"; exit 0 ;;
+ --debug | --d* | -d )
+ debug=: ;;
+ --file | --fil | --fi | --f )
+ $ac_shift
+ CONFIG_FILES="$CONFIG_FILES $ac_optarg"
+ ac_need_defaults=false;;
+ --header | --heade | --head | --hea )
+ $ac_shift
+ CONFIG_HEADERS="$CONFIG_HEADERS $ac_optarg"
+ ac_need_defaults=false;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil | --si | --s)
+ ac_cs_silent=: ;;
+
+ # This is an error.
+ -*) { { echo "$as_me:$LINENO: error: unrecognized option: $1
+Try \`$0 --help' for more information." >&5
+echo "$as_me: error: unrecognized option: $1
+Try \`$0 --help' for more information." >&2;}
+ { (exit 1); exit 1; }; } ;;
+
+ *) ac_config_targets="$ac_config_targets $1" ;;
+
+ esac
+ shift
+done
+
+ac_configure_extra_args=
+
+if $ac_cs_silent; then
+ exec 6>/dev/null
+ ac_configure_extra_args="$ac_configure_extra_args --silent"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF
+if \$ac_cs_recheck; then
+ echo "running $SHELL $0 " $ac_configure_args \$ac_configure_extra_args " --no-create --no-recursion" >&6
+ exec $SHELL $0 $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion
+fi
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<_ACEOF
+#
+# INIT-COMMANDS section.
+#
+
+AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"
+
+_ACEOF
+
+
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+for ac_config_target in $ac_config_targets
+do
+ case "$ac_config_target" in
+ # Handling of arguments.
+ "Makefile" ) CONFIG_FILES="$CONFIG_FILES Makefile" ;;
+ "src/Makefile" ) CONFIG_FILES="$CONFIG_FILES src/Makefile" ;;
+ "man/Makefile" ) CONFIG_FILES="$CONFIG_FILES man/Makefile" ;;
+ "depfiles" ) CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;;
+ "config.h" ) CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;;
+ *) { { echo "$as_me:$LINENO: error: invalid argument: $ac_config_target" >&5
+echo "$as_me: error: invalid argument: $ac_config_target" >&2;}
+ { (exit 1); exit 1; }; };;
+ esac
+done
+
+# If the user did not use the arguments to specify the items to instantiate,
+# then the envvar interface is used. Set only those that are not.
+# We use the long form for the default assignment because of an extremely
+# bizarre bug on SunOS 4.1.3.
+if $ac_need_defaults; then
+ test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files
+ test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers
+ test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands
+fi
+
+# Have a temporary directory for convenience. Make it in the build tree
+# simply because there is no reason to put it here, and in addition,
+# creating and moving files from /tmp can sometimes cause problems.
+# Create a temporary directory, and hook for its removal unless debugging.
+$debug ||
+{
+ trap 'exit_status=$?; rm -rf $tmp && exit $exit_status' 0
+ trap '{ (exit 1); exit 1; }' 1 2 13 15
+}
+
+# Create a (secure) tmp directory for tmp files.
+
+{
+ tmp=`(umask 077 && mktemp -d -q "./confstatXXXXXX") 2>/dev/null` &&
+ test -n "$tmp" && test -d "$tmp"
+} ||
+{
+ tmp=./confstat$$-$RANDOM
+ (umask 077 && mkdir $tmp)
+} ||
+{
+ echo "$me: cannot create a temporary directory in ." >&2
+ { (exit 1); exit 1; }
+}
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<_ACEOF
+
+#
+# CONFIG_FILES section.
+#
+
+# No need to generate the scripts if there are no CONFIG_FILES.
+# This happens for instance when ./config.status config.h
+if test -n "\$CONFIG_FILES"; then
+ # Protect against being on the right side of a sed subst in config.status.
+ sed 's/,@/@@/; s/@,/@@/; s/,;t t\$/@;t t/; /@;t t\$/s/[\\\\&,]/\\\\&/g;
+ s/@@/,@/; s/@@/@,/; s/@;t t\$/,;t t/' >\$tmp/subs.sed <<\\CEOF
+s,@SHELL@,$SHELL,;t t
+s,@PATH_SEPARATOR@,$PATH_SEPARATOR,;t t
+s,@PACKAGE_NAME@,$PACKAGE_NAME,;t t
+s,@PACKAGE_TARNAME@,$PACKAGE_TARNAME,;t t
+s,@PACKAGE_VERSION@,$PACKAGE_VERSION,;t t
+s,@PACKAGE_STRING@,$PACKAGE_STRING,;t t
+s,@PACKAGE_BUGREPORT@,$PACKAGE_BUGREPORT,;t t
+s,@exec_prefix@,$exec_prefix,;t t
+s,@prefix@,$prefix,;t t
+s,@program_transform_name@,$program_transform_name,;t t
+s,@bindir@,$bindir,;t t
+s,@sbindir@,$sbindir,;t t
+s,@libexecdir@,$libexecdir,;t t
+s,@datadir@,$datadir,;t t
+s,@sysconfdir@,$sysconfdir,;t t
+s,@sharedstatedir@,$sharedstatedir,;t t
+s,@localstatedir@,$localstatedir,;t t
+s,@libdir@,$libdir,;t t
+s,@includedir@,$includedir,;t t
+s,@oldincludedir@,$oldincludedir,;t t
+s,@infodir@,$infodir,;t t
+s,@mandir@,$mandir,;t t
+s,@build_alias@,$build_alias,;t t
+s,@host_alias@,$host_alias,;t t
+s,@target_alias@,$target_alias,;t t
+s,@DEFS@,$DEFS,;t t
+s,@ECHO_C@,$ECHO_C,;t t
+s,@ECHO_N@,$ECHO_N,;t t
+s,@ECHO_T@,$ECHO_T,;t t
+s,@LIBS@,$LIBS,;t t
+s,@INSTALL_PROGRAM@,$INSTALL_PROGRAM,;t t
+s,@INSTALL_SCRIPT@,$INSTALL_SCRIPT,;t t
+s,@INSTALL_DATA@,$INSTALL_DATA,;t t
+s,@CYGPATH_W@,$CYGPATH_W,;t t
+s,@PACKAGE@,$PACKAGE,;t t
+s,@VERSION@,$VERSION,;t t
+s,@ACLOCAL@,$ACLOCAL,;t t
+s,@AUTOCONF@,$AUTOCONF,;t t
+s,@AUTOMAKE@,$AUTOMAKE,;t t
+s,@AUTOHEADER@,$AUTOHEADER,;t t
+s,@MAKEINFO@,$MAKEINFO,;t t
+s,@install_sh@,$install_sh,;t t
+s,@STRIP@,$STRIP,;t t
+s,@ac_ct_STRIP@,$ac_ct_STRIP,;t t
+s,@INSTALL_STRIP_PROGRAM@,$INSTALL_STRIP_PROGRAM,;t t
+s,@mkdir_p@,$mkdir_p,;t t
+s,@AWK@,$AWK,;t t
+s,@SET_MAKE@,$SET_MAKE,;t t
+s,@am__leading_dot@,$am__leading_dot,;t t
+s,@AMTAR@,$AMTAR,;t t
+s,@am__tar@,$am__tar,;t t
+s,@am__untar@,$am__untar,;t t
+s,@MAINTAINER_MODE_TRUE@,$MAINTAINER_MODE_TRUE,;t t
+s,@MAINTAINER_MODE_FALSE@,$MAINTAINER_MODE_FALSE,;t t
+s,@MAINT@,$MAINT,;t t
+s,@DRIVER_NAME@,$DRIVER_NAME,;t t
+s,@build@,$build,;t t
+s,@build_cpu@,$build_cpu,;t t
+s,@build_vendor@,$build_vendor,;t t
+s,@build_os@,$build_os,;t t
+s,@host@,$host,;t t
+s,@host_cpu@,$host_cpu,;t t
+s,@host_vendor@,$host_vendor,;t t
+s,@host_os@,$host_os,;t t
+s,@CC@,$CC,;t t
+s,@CFLAGS@,$CFLAGS,;t t
+s,@LDFLAGS@,$LDFLAGS,;t t
+s,@CPPFLAGS@,$CPPFLAGS,;t t
+s,@ac_ct_CC@,$ac_ct_CC,;t t
+s,@EXEEXT@,$EXEEXT,;t t
+s,@OBJEXT@,$OBJEXT,;t t
+s,@DEPDIR@,$DEPDIR,;t t
+s,@am__include@,$am__include,;t t
+s,@am__quote@,$am__quote,;t t
+s,@AMDEP_TRUE@,$AMDEP_TRUE,;t t
+s,@AMDEP_FALSE@,$AMDEP_FALSE,;t t
+s,@AMDEPBACKSLASH@,$AMDEPBACKSLASH,;t t
+s,@CCDEPMODE@,$CCDEPMODE,;t t
+s,@am__fastdepCC_TRUE@,$am__fastdepCC_TRUE,;t t
+s,@am__fastdepCC_FALSE@,$am__fastdepCC_FALSE,;t t
+s,@SED@,$SED,;t t
+s,@EGREP@,$EGREP,;t t
+s,@LN_S@,$LN_S,;t t
+s,@ECHO@,$ECHO,;t t
+s,@AR@,$AR,;t t
+s,@ac_ct_AR@,$ac_ct_AR,;t t
+s,@RANLIB@,$RANLIB,;t t
+s,@ac_ct_RANLIB@,$ac_ct_RANLIB,;t t
+s,@CPP@,$CPP,;t t
+s,@CXX@,$CXX,;t t
+s,@CXXFLAGS@,$CXXFLAGS,;t t
+s,@ac_ct_CXX@,$ac_ct_CXX,;t t
+s,@CXXDEPMODE@,$CXXDEPMODE,;t t
+s,@am__fastdepCXX_TRUE@,$am__fastdepCXX_TRUE,;t t
+s,@am__fastdepCXX_FALSE@,$am__fastdepCXX_FALSE,;t t
+s,@CXXCPP@,$CXXCPP,;t t
+s,@F77@,$F77,;t t
+s,@FFLAGS@,$FFLAGS,;t t
+s,@ac_ct_F77@,$ac_ct_F77,;t t
+s,@LIBTOOL@,$LIBTOOL,;t t
+s,@inputdir@,$inputdir,;t t
+s,@PKG_CONFIG@,$PKG_CONFIG,;t t
+s,@ac_pt_PKG_CONFIG@,$ac_pt_PKG_CONFIG,;t t
+s,@XORG_CFLAGS@,$XORG_CFLAGS,;t t
+s,@XORG_LIBS@,$XORG_LIBS,;t t
+s,@APP_MAN_SUFFIX@,$APP_MAN_SUFFIX,;t t
+s,@LIB_MAN_SUFFIX@,$LIB_MAN_SUFFIX,;t t
+s,@FILE_MAN_SUFFIX@,$FILE_MAN_SUFFIX,;t t
+s,@MISC_MAN_SUFFIX@,$MISC_MAN_SUFFIX,;t t
+s,@DRIVER_MAN_SUFFIX@,$DRIVER_MAN_SUFFIX,;t t
+s,@ADMIN_MAN_SUFFIX@,$ADMIN_MAN_SUFFIX,;t t
+s,@APP_MAN_DIR@,$APP_MAN_DIR,;t t
+s,@LIB_MAN_DIR@,$LIB_MAN_DIR,;t t
+s,@FILE_MAN_DIR@,$FILE_MAN_DIR,;t t
+s,@MISC_MAN_DIR@,$MISC_MAN_DIR,;t t
+s,@DRIVER_MAN_DIR@,$DRIVER_MAN_DIR,;t t
+s,@ADMIN_MAN_DIR@,$ADMIN_MAN_DIR,;t t
+s,@LINUXDOC@,$LINUXDOC,;t t
+s,@PS2PDF@,$PS2PDF,;t t
+s,@BUILD_LINUXDOC_TRUE@,$BUILD_LINUXDOC_TRUE,;t t
+s,@BUILD_LINUXDOC_FALSE@,$BUILD_LINUXDOC_FALSE,;t t
+s,@BUILD_PDFDOC_TRUE@,$BUILD_PDFDOC_TRUE,;t t
+s,@BUILD_PDFDOC_FALSE@,$BUILD_PDFDOC_FALSE,;t t
+s,@MAKE_TEXT@,$MAKE_TEXT,;t t
+s,@MAKE_PS@,$MAKE_PS,;t t
+s,@MAKE_PDF@,$MAKE_PDF,;t t
+s,@MAKE_HTML@,$MAKE_HTML,;t t
+s,@LIBOBJS@,$LIBOBJS,;t t
+s,@LTLIBOBJS@,$LTLIBOBJS,;t t
+CEOF
+
+_ACEOF
+
+ cat >>$CONFIG_STATUS <<\_ACEOF
+ # Split the substitutions into bite-sized pieces for seds with
+ # small command number limits, like on Digital OSF/1 and HP-UX.
+ ac_max_sed_lines=48
+ ac_sed_frag=1 # Number of current file.
+ ac_beg=1 # First line for current file.
+ ac_end=$ac_max_sed_lines # Line after last line for current file.
+ ac_more_lines=:
+ ac_sed_cmds=
+ while $ac_more_lines; do
+ if test $ac_beg -gt 1; then
+ sed "1,${ac_beg}d; ${ac_end}q" $tmp/subs.sed >$tmp/subs.frag
+ else
+ sed "${ac_end}q" $tmp/subs.sed >$tmp/subs.frag
+ fi
+ if test ! -s $tmp/subs.frag; then
+ ac_more_lines=false
+ else
+ # The purpose of the label and of the branching condition is to
+ # speed up the sed processing (if there are no `@' at all, there
+ # is no need to browse any of the substitutions).
+ # These are the two extra sed commands mentioned above.
+ (echo ':t
+ /@[a-zA-Z_][a-zA-Z_0-9]*@/!b' && cat $tmp/subs.frag) >$tmp/subs-$ac_sed_frag.sed
+ if test -z "$ac_sed_cmds"; then
+ ac_sed_cmds="sed -f $tmp/subs-$ac_sed_frag.sed"
+ else
+ ac_sed_cmds="$ac_sed_cmds | sed -f $tmp/subs-$ac_sed_frag.sed"
+ fi
+ ac_sed_frag=`expr $ac_sed_frag + 1`
+ ac_beg=$ac_end
+ ac_end=`expr $ac_end + $ac_max_sed_lines`
+ fi
+ done
+ if test -z "$ac_sed_cmds"; then
+ ac_sed_cmds=cat
+ fi
+fi # test -n "$CONFIG_FILES"
+
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF
+for ac_file in : $CONFIG_FILES; do test "x$ac_file" = x: && continue
+ # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in".
+ case $ac_file in
+ - | *:- | *:-:* ) # input from stdin
+ cat >$tmp/stdin
+ ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'`
+ ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;;
+ *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'`
+ ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;;
+ * ) ac_file_in=$ac_file.in ;;
+ esac
+
+ # Compute @srcdir@, @top_srcdir@, and @INSTALL@ for subdirectories.
+ ac_dir=`(dirname "$ac_file") 2>/dev/null ||
+$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$ac_file" : 'X\(//\)[^/]' \| \
+ X"$ac_file" : 'X\(//\)$' \| \
+ X"$ac_file" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$ac_file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ { if $as_mkdir_p; then
+ mkdir -p "$ac_dir"
+ else
+ as_dir="$ac_dir"
+ as_dirs=
+ while test ! -d "$as_dir"; do
+ as_dirs="$as_dir $as_dirs"
+ as_dir=`(dirname "$as_dir") 2>/dev/null ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ done
+ test ! -n "$as_dirs" || mkdir $as_dirs
+ fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5
+echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;}
+ { (exit 1); exit 1; }; }; }
+
+ ac_builddir=.
+
+if test "$ac_dir" != .; then
+ ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'`
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'`
+else
+ ac_dir_suffix= ac_top_builddir=
+fi
+
+case $srcdir in
+ .) # No --srcdir option. We are building in place.
+ ac_srcdir=.
+ if test -z "$ac_top_builddir"; then
+ ac_top_srcdir=.
+ else
+ ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'`
+ fi ;;
+ [\\/]* | ?:[\\/]* ) # Absolute path.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir ;;
+ *) # Relative path.
+ ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_builddir$srcdir ;;
+esac
+
+# Do not use `cd foo && pwd` to compute absolute paths, because
+# the directories may not exist.
+case `pwd` in
+.) ac_abs_builddir="$ac_dir";;
+*)
+ case "$ac_dir" in
+ .) ac_abs_builddir=`pwd`;;
+ [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";;
+ *) ac_abs_builddir=`pwd`/"$ac_dir";;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_builddir=${ac_top_builddir}.;;
+*)
+ case ${ac_top_builddir}. in
+ .) ac_abs_top_builddir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;;
+ *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_srcdir=$ac_srcdir;;
+*)
+ case $ac_srcdir in
+ .) ac_abs_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;;
+ *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_srcdir=$ac_top_srcdir;;
+*)
+ case $ac_top_srcdir in
+ .) ac_abs_top_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;;
+ *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;;
+ esac;;
+esac
+
+
+ case $INSTALL in
+ [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;;
+ *) ac_INSTALL=$ac_top_builddir$INSTALL ;;
+ esac
+
+ if test x"$ac_file" != x-; then
+ { echo "$as_me:$LINENO: creating $ac_file" >&5
+echo "$as_me: creating $ac_file" >&6;}
+ rm -f "$ac_file"
+ fi
+ # Let's still pretend it is `configure' which instantiates (i.e., don't
+ # use $as_me), people would be surprised to read:
+ # /* config.h. Generated by config.status. */
+ if test x"$ac_file" = x-; then
+ configure_input=
+ else
+ configure_input="$ac_file. "
+ fi
+ configure_input=$configure_input"Generated from `echo $ac_file_in |
+ sed 's,.*/,,'` by configure."
+
+ # First look for the input files in the build tree, otherwise in the
+ # src tree.
+ ac_file_inputs=`IFS=:
+ for f in $ac_file_in; do
+ case $f in
+ -) echo $tmp/stdin ;;
+ [\\/$]*)
+ # Absolute (can't be DOS-style, as IFS=:)
+ test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5
+echo "$as_me: error: cannot find input file: $f" >&2;}
+ { (exit 1); exit 1; }; }
+ echo "$f";;
+ *) # Relative
+ if test -f "$f"; then
+ # Build tree
+ echo "$f"
+ elif test -f "$srcdir/$f"; then
+ # Source tree
+ echo "$srcdir/$f"
+ else
+ # /dev/null tree
+ { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5
+echo "$as_me: error: cannot find input file: $f" >&2;}
+ { (exit 1); exit 1; }; }
+ fi;;
+ esac
+ done` || { (exit 1); exit 1; }
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF
+ sed "$ac_vpsub
+$extrasub
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF
+:t
+/@[a-zA-Z_][a-zA-Z_0-9]*@/!b
+s,@configure_input@,$configure_input,;t t
+s,@srcdir@,$ac_srcdir,;t t
+s,@abs_srcdir@,$ac_abs_srcdir,;t t
+s,@top_srcdir@,$ac_top_srcdir,;t t
+s,@abs_top_srcdir@,$ac_abs_top_srcdir,;t t
+s,@builddir@,$ac_builddir,;t t
+s,@abs_builddir@,$ac_abs_builddir,;t t
+s,@top_builddir@,$ac_top_builddir,;t t
+s,@abs_top_builddir@,$ac_abs_top_builddir,;t t
+s,@INSTALL@,$ac_INSTALL,;t t
+" $ac_file_inputs | (eval "$ac_sed_cmds") >$tmp/out
+ rm -f $tmp/stdin
+ if test x"$ac_file" != x-; then
+ mv $tmp/out $ac_file
+ else
+ cat $tmp/out
+ rm -f $tmp/out
+ fi
+
+done
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF
+
+#
+# CONFIG_HEADER section.
+#
+
+# These sed commands are passed to sed as "A NAME B NAME C VALUE D", where
+# NAME is the cpp macro being defined and VALUE is the value it is being given.
+#
+# ac_d sets the value in "#define NAME VALUE" lines.
+ac_dA='s,^\([ ]*\)#\([ ]*define[ ][ ]*\)'
+ac_dB='[ ].*$,\1#\2'
+ac_dC=' '
+ac_dD=',;t'
+# ac_u turns "#undef NAME" without trailing blanks into "#define NAME VALUE".
+ac_uA='s,^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)'
+ac_uB='$,\1#\2define\3'
+ac_uC=' '
+ac_uD=',;t'
+
+for ac_file in : $CONFIG_HEADERS; do test "x$ac_file" = x: && continue
+ # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in".
+ case $ac_file in
+ - | *:- | *:-:* ) # input from stdin
+ cat >$tmp/stdin
+ ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'`
+ ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;;
+ *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'`
+ ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;;
+ * ) ac_file_in=$ac_file.in ;;
+ esac
+
+ test x"$ac_file" != x- && { echo "$as_me:$LINENO: creating $ac_file" >&5
+echo "$as_me: creating $ac_file" >&6;}
+
+ # First look for the input files in the build tree, otherwise in the
+ # src tree.
+ ac_file_inputs=`IFS=:
+ for f in $ac_file_in; do
+ case $f in
+ -) echo $tmp/stdin ;;
+ [\\/$]*)
+ # Absolute (can't be DOS-style, as IFS=:)
+ test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5
+echo "$as_me: error: cannot find input file: $f" >&2;}
+ { (exit 1); exit 1; }; }
+ # Do quote $f, to prevent DOS paths from being IFS'd.
+ echo "$f";;
+ *) # Relative
+ if test -f "$f"; then
+ # Build tree
+ echo "$f"
+ elif test -f "$srcdir/$f"; then
+ # Source tree
+ echo "$srcdir/$f"
+ else
+ # /dev/null tree
+ { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5
+echo "$as_me: error: cannot find input file: $f" >&2;}
+ { (exit 1); exit 1; }; }
+ fi;;
+ esac
+ done` || { (exit 1); exit 1; }
+ # Remove the trailing spaces.
+ sed 's/[ ]*$//' $ac_file_inputs >$tmp/in
+
+_ACEOF
+
+# Transform confdefs.h into two sed scripts, `conftest.defines' and
+# `conftest.undefs', that substitutes the proper values into
+# config.h.in to produce config.h. The first handles `#define'
+# templates, and the second `#undef' templates.
+# And first: Protect against being on the right side of a sed subst in
+# config.status. Protect against being in an unquoted here document
+# in config.status.
+rm -f conftest.defines conftest.undefs
+# Using a here document instead of a string reduces the quoting nightmare.
+# Putting comments in sed scripts is not portable.
+#
+# `end' is used to avoid that the second main sed command (meant for
+# 0-ary CPP macros) applies to n-ary macro definitions.
+# See the Autoconf documentation for `clear'.
+cat >confdef2sed.sed <<\_ACEOF
+s/[\\&,]/\\&/g
+s,[\\$`],\\&,g
+t clear
+: clear
+s,^[ ]*#[ ]*define[ ][ ]*\([^ (][^ (]*\)\(([^)]*)\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1\2${ac_dC}\3${ac_dD},gp
+t end
+s,^[ ]*#[ ]*define[ ][ ]*\([^ ][^ ]*\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1${ac_dC}\2${ac_dD},gp
+: end
+_ACEOF
+# If some macros were called several times there might be several times
+# the same #defines, which is useless. Nevertheless, we may not want to
+# sort them, since we want the *last* AC-DEFINE to be honored.
+uniq confdefs.h | sed -n -f confdef2sed.sed >conftest.defines
+sed 's/ac_d/ac_u/g' conftest.defines >conftest.undefs
+rm -f confdef2sed.sed
+
+# This sed command replaces #undef with comments. This is necessary, for
+# example, in the case of _POSIX_SOURCE, which is predefined and required
+# on some systems where configure will not decide to define it.
+cat >>conftest.undefs <<\_ACEOF
+s,^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */,
+_ACEOF
+
+# Break up conftest.defines because some shells have a limit on the size
+# of here documents, and old seds have small limits too (100 cmds).
+echo ' # Handle all the #define templates only if necessary.' >>$CONFIG_STATUS
+echo ' if grep "^[ ]*#[ ]*define" $tmp/in >/dev/null; then' >>$CONFIG_STATUS
+echo ' # If there are no defines, we may have an empty if/fi' >>$CONFIG_STATUS
+echo ' :' >>$CONFIG_STATUS
+rm -f conftest.tail
+while grep . conftest.defines >/dev/null
+do
+ # Write a limited-size here document to $tmp/defines.sed.
+ echo ' cat >$tmp/defines.sed <<CEOF' >>$CONFIG_STATUS
+ # Speed up: don't consider the non `#define' lines.
+ echo '/^[ ]*#[ ]*define/!b' >>$CONFIG_STATUS
+ # Work around the forget-to-reset-the-flag bug.
+ echo 't clr' >>$CONFIG_STATUS
+ echo ': clr' >>$CONFIG_STATUS
+ sed ${ac_max_here_lines}q conftest.defines >>$CONFIG_STATUS
+ echo 'CEOF
+ sed -f $tmp/defines.sed $tmp/in >$tmp/out
+ rm -f $tmp/in
+ mv $tmp/out $tmp/in
+' >>$CONFIG_STATUS
+ sed 1,${ac_max_here_lines}d conftest.defines >conftest.tail
+ rm -f conftest.defines
+ mv conftest.tail conftest.defines
+done
+rm -f conftest.defines
+echo ' fi # grep' >>$CONFIG_STATUS
+echo >>$CONFIG_STATUS
+
+# Break up conftest.undefs because some shells have a limit on the size
+# of here documents, and old seds have small limits too (100 cmds).
+echo ' # Handle all the #undef templates' >>$CONFIG_STATUS
+rm -f conftest.tail
+while grep . conftest.undefs >/dev/null
+do
+ # Write a limited-size here document to $tmp/undefs.sed.
+ echo ' cat >$tmp/undefs.sed <<CEOF' >>$CONFIG_STATUS
+ # Speed up: don't consider the non `#undef'
+ echo '/^[ ]*#[ ]*undef/!b' >>$CONFIG_STATUS
+ # Work around the forget-to-reset-the-flag bug.
+ echo 't clr' >>$CONFIG_STATUS
+ echo ': clr' >>$CONFIG_STATUS
+ sed ${ac_max_here_lines}q conftest.undefs >>$CONFIG_STATUS
+ echo 'CEOF
+ sed -f $tmp/undefs.sed $tmp/in >$tmp/out
+ rm -f $tmp/in
+ mv $tmp/out $tmp/in
+' >>$CONFIG_STATUS
+ sed 1,${ac_max_here_lines}d conftest.undefs >conftest.tail
+ rm -f conftest.undefs
+ mv conftest.tail conftest.undefs
+done
+rm -f conftest.undefs
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+ # Let's still pretend it is `configure' which instantiates (i.e., don't
+ # use $as_me), people would be surprised to read:
+ # /* config.h. Generated by config.status. */
+ if test x"$ac_file" = x-; then
+ echo "/* Generated by configure. */" >$tmp/config.h
+ else
+ echo "/* $ac_file. Generated by configure. */" >$tmp/config.h
+ fi
+ cat $tmp/in >>$tmp/config.h
+ rm -f $tmp/in
+ if test x"$ac_file" != x-; then
+ if diff $ac_file $tmp/config.h >/dev/null 2>&1; then
+ { echo "$as_me:$LINENO: $ac_file is unchanged" >&5
+echo "$as_me: $ac_file is unchanged" >&6;}
+ else
+ ac_dir=`(dirname "$ac_file") 2>/dev/null ||
+$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$ac_file" : 'X\(//\)[^/]' \| \
+ X"$ac_file" : 'X\(//\)$' \| \
+ X"$ac_file" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$ac_file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ { if $as_mkdir_p; then
+ mkdir -p "$ac_dir"
+ else
+ as_dir="$ac_dir"
+ as_dirs=
+ while test ! -d "$as_dir"; do
+ as_dirs="$as_dir $as_dirs"
+ as_dir=`(dirname "$as_dir") 2>/dev/null ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ done
+ test ! -n "$as_dirs" || mkdir $as_dirs
+ fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5
+echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;}
+ { (exit 1); exit 1; }; }; }
+
+ rm -f $ac_file
+ mv $tmp/config.h $ac_file
+ fi
+ else
+ cat $tmp/config.h
+ rm -f $tmp/config.h
+ fi
+# Compute $ac_file's index in $config_headers.
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $ac_file | $ac_file:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $ac_file" >`(dirname $ac_file) 2>/dev/null ||
+$as_expr X$ac_file : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X$ac_file : 'X\(//\)[^/]' \| \
+ X$ac_file : 'X\(//\)$' \| \
+ X$ac_file : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X$ac_file |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`/stamp-h$_am_stamp_count
+done
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF
+
+#
+# CONFIG_COMMANDS section.
+#
+for ac_file in : $CONFIG_COMMANDS; do test "x$ac_file" = x: && continue
+ ac_dest=`echo "$ac_file" | sed 's,:.*,,'`
+ ac_source=`echo "$ac_file" | sed 's,[^:]*:,,'`
+ ac_dir=`(dirname "$ac_dest") 2>/dev/null ||
+$as_expr X"$ac_dest" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$ac_dest" : 'X\(//\)[^/]' \| \
+ X"$ac_dest" : 'X\(//\)$' \| \
+ X"$ac_dest" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$ac_dest" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ { if $as_mkdir_p; then
+ mkdir -p "$ac_dir"
+ else
+ as_dir="$ac_dir"
+ as_dirs=
+ while test ! -d "$as_dir"; do
+ as_dirs="$as_dir $as_dirs"
+ as_dir=`(dirname "$as_dir") 2>/dev/null ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ done
+ test ! -n "$as_dirs" || mkdir $as_dirs
+ fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5
+echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;}
+ { (exit 1); exit 1; }; }; }
+
+ ac_builddir=.
+
+if test "$ac_dir" != .; then
+ ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'`
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'`
+else
+ ac_dir_suffix= ac_top_builddir=
+fi
+
+case $srcdir in
+ .) # No --srcdir option. We are building in place.
+ ac_srcdir=.
+ if test -z "$ac_top_builddir"; then
+ ac_top_srcdir=.
+ else
+ ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'`
+ fi ;;
+ [\\/]* | ?:[\\/]* ) # Absolute path.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir ;;
+ *) # Relative path.
+ ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_builddir$srcdir ;;
+esac
+
+# Do not use `cd foo && pwd` to compute absolute paths, because
+# the directories may not exist.
+case `pwd` in
+.) ac_abs_builddir="$ac_dir";;
+*)
+ case "$ac_dir" in
+ .) ac_abs_builddir=`pwd`;;
+ [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";;
+ *) ac_abs_builddir=`pwd`/"$ac_dir";;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_builddir=${ac_top_builddir}.;;
+*)
+ case ${ac_top_builddir}. in
+ .) ac_abs_top_builddir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;;
+ *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_srcdir=$ac_srcdir;;
+*)
+ case $ac_srcdir in
+ .) ac_abs_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;;
+ *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;;
+ esac;;
+esac
+case $ac_abs_builddir in
+.) ac_abs_top_srcdir=$ac_top_srcdir;;
+*)
+ case $ac_top_srcdir in
+ .) ac_abs_top_srcdir=$ac_abs_builddir;;
+ [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;;
+ *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;;
+ esac;;
+esac
+
+
+ { echo "$as_me:$LINENO: executing $ac_dest commands" >&5
+echo "$as_me: executing $ac_dest commands" >&6;}
+ case $ac_dest in
+ depfiles ) test x"$AMDEP_TRUE" != x"" || for mf in $CONFIG_FILES; do
+ # Strip MF so we end up with the name of the file.
+ mf=`echo "$mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile or not.
+ # We used to match only the files named `Makefile.in', but
+ # some people rename them; so instead we look at the file content.
+ # Grep'ing the first line is not enough: some people post-process
+ # each Makefile.in and add a new line on top of each file to say so.
+ # So let's grep whole file.
+ if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then
+ dirpart=`(dirname "$mf") 2>/dev/null ||
+$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$mf" : 'X\(//\)[^/]' \| \
+ X"$mf" : 'X\(//\)$' \| \
+ X"$mf" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$mf" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ else
+ continue
+ fi
+ # Extract the definition of DEPDIR, am__include, and am__quote
+ # from the Makefile without running `make'.
+ DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+ test -z "$DEPDIR" && continue
+ am__include=`sed -n 's/^am__include = //p' < "$mf"`
+ test -z "am__include" && continue
+ am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+ # When using ansi2knr, U may be empty or an underscore; expand it
+ U=`sed -n 's/^U = //p' < "$mf"`
+ # Find all dependency output files, they are included files with
+ # $(DEPDIR) in their names. We invoke sed twice because it is the
+ # simplest approach to changing $(DEPDIR) to its actual value in the
+ # expansion.
+ for file in `sed -n "
+ s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+ sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do
+ # Make sure the directory exists.
+ test -f "$dirpart/$file" && continue
+ fdir=`(dirname "$file") 2>/dev/null ||
+$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$file" : 'X\(//\)[^/]' \| \
+ X"$file" : 'X\(//\)$' \| \
+ X"$file" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ { if $as_mkdir_p; then
+ mkdir -p $dirpart/$fdir
+ else
+ as_dir=$dirpart/$fdir
+ as_dirs=
+ while test ! -d "$as_dir"; do
+ as_dirs="$as_dir $as_dirs"
+ as_dir=`(dirname "$as_dir") 2>/dev/null ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| \
+ . : '\(.\)' 2>/dev/null ||
+echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; }
+ /^X\(\/\/\)[^/].*/{ s//\1/; q; }
+ /^X\(\/\/\)$/{ s//\1/; q; }
+ /^X\(\/\).*/{ s//\1/; q; }
+ s/.*/./; q'`
+ done
+ test ! -n "$as_dirs" || mkdir $as_dirs
+ fi || { { echo "$as_me:$LINENO: error: cannot create directory $dirpart/$fdir" >&5
+echo "$as_me: error: cannot create directory $dirpart/$fdir" >&2;}
+ { (exit 1); exit 1; }; }; }
+
+ # echo "creating $dirpart/$file"
+ echo '# dummy' > "$dirpart/$file"
+ done
+done
+ ;;
+ esac
+done
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF
+
+{ (exit 0); exit 0; }
+_ACEOF
+chmod +x $CONFIG_STATUS
+ac_clean_files=$ac_clean_files_save
+
+
+# configure is writing to config.log, and then calls config.status.
+# config.status does its own redirection, appending to config.log.
+# Unfortunately, on DOS this fails, as config.log is still kept open
+# by configure, so config.status won't be able to write to it; its
+# output is simply discarded. So we exec the FD to /dev/null,
+# effectively closing config.log, so it can be properly (re)opened and
+# appended to by config.status. When coming back to configure, we
+# need to make the FD available again.
+if test "$no_create" != yes; then
+ ac_cs_success=:
+ ac_config_status_args=
+ test "$silent" = yes &&
+ ac_config_status_args="$ac_config_status_args --quiet"
+ exec 5>/dev/null
+ $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false
+ exec 5>>config.log
+ # Use ||, not &&, to avoid exiting from the if with $? = 1, which
+ # would make configure fail if this is the last instruction.
+ $ac_cs_success || { (exit 1); exit 1; }
+fi
+
diff --git a/driver/xf86-input-mouse/configure.ac b/driver/xf86-input-mouse/configure.ac
new file mode 100644
index 000000000..c524c35f7
--- /dev/null
+++ b/driver/xf86-input-mouse/configure.ac
@@ -0,0 +1,94 @@
+# Copyright 2005 Adam Jackson.
+#
+# Permission is hereby granted, free of charge, to any person obtaining a
+# copy of this software and associated documentation files (the "Software"),
+# to deal in the Software without restriction, including without limitation
+# on the rights to use, copy, modify, merge, publish, distribute, sub
+# license, and/or sell copies of the Software, and to permit persons to whom
+# the Software is furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice (including the next
+# paragraph) shall be included in all copies or substantial portions of the
+# Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL
+# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Process this file with autoconf to produce a configure script
+
+AC_PREREQ(2.57)
+AC_INIT([xf86-input-mouse],
+ 1.1.2,
+ [https://bugs.freedesktop.org/enter_bug.cgi?product=xorg],
+ xf86-input-mouse)
+
+AC_CONFIG_SRCDIR([Makefile.am])
+AC_CONFIG_AUX_DIR(.)
+AM_INIT_AUTOMAKE([dist-bzip2])
+
+AM_MAINTAINER_MODE
+
+DRIVER_NAME=mouse
+AC_SUBST([DRIVER_NAME])
+
+AM_CONFIG_HEADER([config.h])
+
+# Checks for programs.
+AC_DISABLE_STATIC
+AC_PROG_LIBTOOL
+AC_PROG_CC
+
+AH_TOP([#include "xorg-server.h"])
+
+#AC_DEFINE(XFree86LOADER,1,[Stub define for loadable drivers])
+#
+#AC_ARG_ENABLE(XINPUT, AS_HELP_STRING([--enable-xinput],
+# [Build XInput support (default: yes)]),
+# [XINPUT=$enableval],[XINPUT=yes])
+#AM_CONDITIONAL(XINPUT, test "x$XINPUT" = "xyes")
+#if test "x$XINPUT" = "xyes" ; then
+# AC_DEFINE(XINPUT,1,[Enable XInput support])
+#fi
+#
+#AC_ARG_ENABLE(XKB, AS_HELP_STRING([--enable-xkb],
+# [Build XKB support (default: yes)]),
+# [XKB=$enableval],[XKB=yes])
+#AM_CONDITIONAL(XKB, test "x$XKB" = "xyes")
+#if test "x$XKB" = "xyes" ; then
+# AC_DEFINE(XKB,1,[Enable XKB support])
+#fi
+
+AC_ARG_WITH(xorg-module-dir,
+ AC_HELP_STRING([--with-xorg-module-dir=DIR],
+ [Default xorg module directory [[default=$libdir/xorg/modules]]]),
+ [moduledir="$withval"],
+ [moduledir="$libdir/xorg/modules"])
+inputdir=${moduledir}/input
+AC_SUBST(inputdir)
+
+# Checks for extensions
+XORG_DRIVER_CHECK_EXT(RANDR, randrproto)
+XORG_DRIVER_CHECK_EXT(XINPUT, inputproto)
+
+# Checks for pkg-config packages
+PKG_CHECK_MODULES(XORG, [xorg-server >= 1.0.99.901] xproto $REQUIRED_MODULES)
+sdkdir=$(pkg-config --variable=sdkdir xorg-server)
+
+CFLAGS="$CFLAGS $XORG_CFLAGS "' -I$(top_srcdir)/src'
+AC_SUBST([CFLAGS])
+
+# Checks for libraries.
+
+# Checks for header files.
+AC_HEADER_STDC
+
+XORG_MANPAGE_SECTIONS
+XORG_RELEASE_VERSION
+
+XORG_CHECK_LINUXDOC
+
+AC_OUTPUT([Makefile src/Makefile man/Makefile])
diff --git a/driver/xf86-input-mouse/depcomp b/driver/xf86-input-mouse/depcomp
new file mode 100644
index 000000000..04701da53
--- /dev/null
+++ b/driver/xf86-input-mouse/depcomp
@@ -0,0 +1,530 @@
+#! /bin/sh
+# depcomp - compile a program generating dependencies as side-effects
+
+scriptversion=2005-07-09.11
+
+# Copyright (C) 1999, 2000, 2003, 2004, 2005 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA
+# 02110-1301, USA.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Alexandre Oliva <oliva@dcc.unicamp.br>.
+
+case $1 in
+ '')
+ echo "$0: No command. Try \`$0 --help' for more information." 1>&2
+ exit 1;
+ ;;
+ -h | --h*)
+ cat <<\EOF
+Usage: depcomp [--help] [--version] PROGRAM [ARGS]
+
+Run PROGRAMS ARGS to compile a file, generating dependencies
+as side-effects.
+
+Environment variables:
+ depmode Dependency tracking mode.
+ source Source file read by `PROGRAMS ARGS'.
+ object Object file output by `PROGRAMS ARGS'.
+ DEPDIR directory where to store dependencies.
+ depfile Dependency file to output.
+ tmpdepfile Temporary file to use when outputing dependencies.
+ libtool Whether libtool is used (yes/no).
+
+Report bugs to <bug-automake@gnu.org>.
+EOF
+ exit $?
+ ;;
+ -v | --v*)
+ echo "depcomp $scriptversion"
+ exit $?
+ ;;
+esac
+
+if test -z "$depmode" || test -z "$source" || test -z "$object"; then
+ echo "depcomp: Variables source, object and depmode must be set" 1>&2
+ exit 1
+fi
+
+# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po.
+depfile=${depfile-`echo "$object" |
+ sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`}
+tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`}
+
+rm -f "$tmpdepfile"
+
+# Some modes work just like other modes, but use different flags. We
+# parameterize here, but still list the modes in the big case below,
+# to make depend.m4 easier to write. Note that we *cannot* use a case
+# here, because this file can only contain one case statement.
+if test "$depmode" = hp; then
+ # HP compiler uses -M and no extra arg.
+ gccflag=-M
+ depmode=gcc
+fi
+
+if test "$depmode" = dashXmstdout; then
+ # This is just like dashmstdout with a different argument.
+ dashmflag=-xM
+ depmode=dashmstdout
+fi
+
+case "$depmode" in
+gcc3)
+## gcc 3 implements dependency tracking that does exactly what
+## we want. Yay! Note: for some reason libtool 1.4 doesn't like
+## it if -MD -MP comes after the -MF stuff. Hmm.
+ "$@" -MT "$object" -MD -MP -MF "$tmpdepfile"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ mv "$tmpdepfile" "$depfile"
+ ;;
+
+gcc)
+## There are various ways to get dependency output from gcc. Here's
+## why we pick this rather obscure method:
+## - Don't want to use -MD because we'd like the dependencies to end
+## up in a subdir. Having to rename by hand is ugly.
+## (We might end up doing this anyway to support other compilers.)
+## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like
+## -MM, not -M (despite what the docs say).
+## - Using -M directly means running the compiler twice (even worse
+## than renaming).
+ if test -z "$gccflag"; then
+ gccflag=-MD,
+ fi
+ "$@" -Wp,"$gccflag$tmpdepfile"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ alpha=ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz
+## The second -e expression handles DOS-style file names with drive letters.
+ sed -e 's/^[^:]*: / /' \
+ -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile"
+## This next piece of magic avoids the `deleted header file' problem.
+## The problem is that when a header file which appears in a .P file
+## is deleted, the dependency causes make to die (because there is
+## typically no way to rebuild the header). We avoid this by adding
+## dummy dependencies for each header file. Too bad gcc doesn't do
+## this for us directly.
+ tr ' ' '
+' < "$tmpdepfile" |
+## Some versions of gcc put a space before the `:'. On the theory
+## that the space means something, we add a space to the output as
+## well.
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+hp)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+sgi)
+ if test "$libtool" = yes; then
+ "$@" "-Wp,-MDupdate,$tmpdepfile"
+ else
+ "$@" -MDupdate "$tmpdepfile"
+ fi
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+
+ if test -f "$tmpdepfile"; then # yes, the sourcefile depend on other files
+ echo "$object : \\" > "$depfile"
+
+ # Clip off the initial element (the dependent). Don't try to be
+ # clever and replace this with sed code, as IRIX sed won't handle
+ # lines with more than a fixed number of characters (4096 in
+ # IRIX 6.2 sed, 8192 in IRIX 6.5). We also remove comment lines;
+ # the IRIX cc adds comments like `#:fec' to the end of the
+ # dependency line.
+ tr ' ' '
+' < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' | \
+ tr '
+' ' ' >> $depfile
+ echo >> $depfile
+
+ # The second pass generates a dummy entry for each header file.
+ tr ' ' '
+' < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \
+ >> $depfile
+ else
+ # The sourcefile does not contain any dependencies, so just
+ # store a dummy comment line, to avoid errors with the Makefile
+ # "include basename.Plo" scheme.
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+aix)
+ # The C for AIX Compiler uses -M and outputs the dependencies
+ # in a .u file. In older versions, this file always lives in the
+ # current directory. Also, the AIX compiler puts `$object:' at the
+ # start of each line; $object doesn't have directory information.
+ # Version 6 uses the directory in both cases.
+ stripped=`echo "$object" | sed 's/\(.*\)\..*$/\1/'`
+ tmpdepfile="$stripped.u"
+ if test "$libtool" = yes; then
+ "$@" -Wc,-M
+ else
+ "$@" -M
+ fi
+ stat=$?
+
+ if test -f "$tmpdepfile"; then :
+ else
+ stripped=`echo "$stripped" | sed 's,^.*/,,'`
+ tmpdepfile="$stripped.u"
+ fi
+
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+
+ if test -f "$tmpdepfile"; then
+ outname="$stripped.o"
+ # Each line is of the form `foo.o: dependent.h'.
+ # Do two passes, one to just change these to
+ # `$object: dependent.h' and one to simply `dependent.h:'.
+ sed -e "s,^$outname:,$object :," < "$tmpdepfile" > "$depfile"
+ sed -e "s,^$outname: \(.*\)$,\1:," < "$tmpdepfile" >> "$depfile"
+ else
+ # The sourcefile does not contain any dependencies, so just
+ # store a dummy comment line, to avoid errors with the Makefile
+ # "include basename.Plo" scheme.
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+icc)
+ # Intel's C compiler understands `-MD -MF file'. However on
+ # icc -MD -MF foo.d -c -o sub/foo.o sub/foo.c
+ # ICC 7.0 will fill foo.d with something like
+ # foo.o: sub/foo.c
+ # foo.o: sub/foo.h
+ # which is wrong. We want:
+ # sub/foo.o: sub/foo.c
+ # sub/foo.o: sub/foo.h
+ # sub/foo.c:
+ # sub/foo.h:
+ # ICC 7.1 will output
+ # foo.o: sub/foo.c sub/foo.h
+ # and will wrap long lines using \ :
+ # foo.o: sub/foo.c ... \
+ # sub/foo.h ... \
+ # ...
+
+ "$@" -MD -MF "$tmpdepfile"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ # Each line is of the form `foo.o: dependent.h',
+ # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'.
+ # Do two passes, one to just change these to
+ # `$object: dependent.h' and one to simply `dependent.h:'.
+ sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile"
+ # Some versions of the HPUX 10.20 sed can't process this invocation
+ # correctly. Breaking it into two sed invocations is a workaround.
+ sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" |
+ sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+tru64)
+ # The Tru64 compiler uses -MD to generate dependencies as a side
+ # effect. `cc -MD -o foo.o ...' puts the dependencies into `foo.o.d'.
+ # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put
+ # dependencies in `foo.d' instead, so we check for that too.
+ # Subdirectories are respected.
+ dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+ test "x$dir" = "x$object" && dir=
+ base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+
+ if test "$libtool" = yes; then
+ # With Tru64 cc, shared objects can also be used to make a
+ # static library. This mecanism is used in libtool 1.4 series to
+ # handle both shared and static libraries in a single compilation.
+ # With libtool 1.4, dependencies were output in $dir.libs/$base.lo.d.
+ #
+ # With libtool 1.5 this exception was removed, and libtool now
+ # generates 2 separate objects for the 2 libraries. These two
+ # compilations output dependencies in in $dir.libs/$base.o.d and
+ # in $dir$base.o.d. We have to check for both files, because
+ # one of the two compilations can be disabled. We should prefer
+ # $dir$base.o.d over $dir.libs/$base.o.d because the latter is
+ # automatically cleaned when .libs/ is deleted, while ignoring
+ # the former would cause a distcleancheck panic.
+ tmpdepfile1=$dir.libs/$base.lo.d # libtool 1.4
+ tmpdepfile2=$dir$base.o.d # libtool 1.5
+ tmpdepfile3=$dir.libs/$base.o.d # libtool 1.5
+ tmpdepfile4=$dir.libs/$base.d # Compaq CCC V6.2-504
+ "$@" -Wc,-MD
+ else
+ tmpdepfile1=$dir$base.o.d
+ tmpdepfile2=$dir$base.d
+ tmpdepfile3=$dir$base.d
+ tmpdepfile4=$dir$base.d
+ "$@" -MD
+ fi
+
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ if test -f "$tmpdepfile"; then
+ sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile"
+ # That's a tab and a space in the [].
+ sed -e 's,^.*\.[a-z]*:[ ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile"
+ else
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+#nosideeffect)
+ # This comment above is used by automake to tell side-effect
+ # dependency tracking mechanisms from slower ones.
+
+dashmstdout)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout, regardless of -o.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test $1 != '--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove `-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ test -z "$dashmflag" && dashmflag=-M
+ # Require at least two characters before searching for `:'
+ # in the target name. This is to cope with DOS-style filenames:
+ # a dependency such as `c:/foo/bar' could be seen as target `c' otherwise.
+ "$@" $dashmflag |
+ sed 's:^[ ]*[^: ][^:][^:]*\:[ ]*:'"$object"'\: :' > "$tmpdepfile"
+ rm -f "$depfile"
+ cat < "$tmpdepfile" > "$depfile"
+ tr ' ' '
+' < "$tmpdepfile" | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+dashXmstdout)
+ # This case only exists to satisfy depend.m4. It is never actually
+ # run, as this mode is specially recognized in the preamble.
+ exit 1
+ ;;
+
+makedepend)
+ "$@" || exit $?
+ # Remove any Libtool call
+ if test "$libtool" = yes; then
+ while test $1 != '--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+ # X makedepend
+ shift
+ cleared=no
+ for arg in "$@"; do
+ case $cleared in
+ no)
+ set ""; shift
+ cleared=yes ;;
+ esac
+ case "$arg" in
+ -D*|-I*)
+ set fnord "$@" "$arg"; shift ;;
+ # Strip any option that makedepend may not understand. Remove
+ # the object too, otherwise makedepend will parse it as a source file.
+ -*|$object)
+ ;;
+ *)
+ set fnord "$@" "$arg"; shift ;;
+ esac
+ done
+ obj_suffix="`echo $object | sed 's/^.*\././'`"
+ touch "$tmpdepfile"
+ ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@"
+ rm -f "$depfile"
+ cat < "$tmpdepfile" > "$depfile"
+ sed '1,2d' "$tmpdepfile" | tr ' ' '
+' | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile" "$tmpdepfile".bak
+ ;;
+
+cpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test $1 != '--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove `-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ "$@" -E |
+ sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+ -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' |
+ sed '$ s: \\$::' > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ cat < "$tmpdepfile" >> "$depfile"
+ sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+msvisualcpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout, regardless of -o,
+ # because we must use -o when running libtool.
+ "$@" || exit $?
+ IFS=" "
+ for arg
+ do
+ case "$arg" in
+ "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI")
+ set fnord "$@"
+ shift
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift
+ shift
+ ;;
+ esac
+ done
+ "$@" -E |
+ sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::echo "`cygpath -u \\"\1\\"`":p' | sort | uniq > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ . "$tmpdepfile" | sed 's% %\\ %g' | sed -n '/^\(.*\)$/ s:: \1 \\:p' >> "$depfile"
+ echo " " >> "$depfile"
+ . "$tmpdepfile" | sed 's% %\\ %g' | sed -n '/^\(.*\)$/ s::\1\::p' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+none)
+ exec "$@"
+ ;;
+
+*)
+ echo "Unknown depmode $depmode" 1>&2
+ exit 1
+ ;;
+esac
+
+exit 0
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-end: "$"
+# End:
diff --git a/driver/xf86-input-mouse/install-sh b/driver/xf86-input-mouse/install-sh
new file mode 100644
index 000000000..4d4a9519e
--- /dev/null
+++ b/driver/xf86-input-mouse/install-sh
@@ -0,0 +1,323 @@
+#!/bin/sh
+# install - install a program, script, or datafile
+
+scriptversion=2005-05-14.22
+
+# This originates from X11R5 (mit/util/scripts/install.sh), which was
+# later released in X11R6 (xc/config/util/install.sh) with the
+# following copyright and license.
+#
+# Copyright (C) 1994 X Consortium
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to
+# deal in the Software without restriction, including without limitation the
+# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+# sell copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in
+# all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC-
+# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the X Consortium shall not
+# be used in advertising or otherwise to promote the sale, use or other deal-
+# ings in this Software without prior written authorization from the X Consor-
+# tium.
+#
+#
+# FSF changes to this file are in the public domain.
+#
+# Calling this script install-sh is preferred over install.sh, to prevent
+# `make' implicit rules from creating a file called install from it
+# when there is no Makefile.
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch. It can only install one file at a time, a restriction
+# shared with many OS's install programs.
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit="${DOITPROG-}"
+
+# put in absolute paths if you don't have them in your path; or use env. vars.
+
+mvprog="${MVPROG-mv}"
+cpprog="${CPPROG-cp}"
+chmodprog="${CHMODPROG-chmod}"
+chownprog="${CHOWNPROG-chown}"
+chgrpprog="${CHGRPPROG-chgrp}"
+stripprog="${STRIPPROG-strip}"
+rmprog="${RMPROG-rm}"
+mkdirprog="${MKDIRPROG-mkdir}"
+
+chmodcmd="$chmodprog 0755"
+chowncmd=
+chgrpcmd=
+stripcmd=
+rmcmd="$rmprog -f"
+mvcmd="$mvprog"
+src=
+dst=
+dir_arg=
+dstarg=
+no_target_directory=
+
+usage="Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE
+ or: $0 [OPTION]... SRCFILES... DIRECTORY
+ or: $0 [OPTION]... -t DIRECTORY SRCFILES...
+ or: $0 [OPTION]... -d DIRECTORIES...
+
+In the 1st form, copy SRCFILE to DSTFILE.
+In the 2nd and 3rd, copy all SRCFILES to DIRECTORY.
+In the 4th, create DIRECTORIES.
+
+Options:
+-c (ignored)
+-d create directories instead of installing files.
+-g GROUP $chgrpprog installed files to GROUP.
+-m MODE $chmodprog installed files to MODE.
+-o USER $chownprog installed files to USER.
+-s $stripprog installed files.
+-t DIRECTORY install into DIRECTORY.
+-T report an error if DSTFILE is a directory.
+--help display this help and exit.
+--version display version info and exit.
+
+Environment variables override the default commands:
+ CHGRPPROG CHMODPROG CHOWNPROG CPPROG MKDIRPROG MVPROG RMPROG STRIPPROG
+"
+
+while test -n "$1"; do
+ case $1 in
+ -c) shift
+ continue;;
+
+ -d) dir_arg=true
+ shift
+ continue;;
+
+ -g) chgrpcmd="$chgrpprog $2"
+ shift
+ shift
+ continue;;
+
+ --help) echo "$usage"; exit $?;;
+
+ -m) chmodcmd="$chmodprog $2"
+ shift
+ shift
+ continue;;
+
+ -o) chowncmd="$chownprog $2"
+ shift
+ shift
+ continue;;
+
+ -s) stripcmd=$stripprog
+ shift
+ continue;;
+
+ -t) dstarg=$2
+ shift
+ shift
+ continue;;
+
+ -T) no_target_directory=true
+ shift
+ continue;;
+
+ --version) echo "$0 $scriptversion"; exit $?;;
+
+ *) # When -d is used, all remaining arguments are directories to create.
+ # When -t is used, the destination is already specified.
+ test -n "$dir_arg$dstarg" && break
+ # Otherwise, the last argument is the destination. Remove it from $@.
+ for arg
+ do
+ if test -n "$dstarg"; then
+ # $@ is not empty: it contains at least $arg.
+ set fnord "$@" "$dstarg"
+ shift # fnord
+ fi
+ shift # arg
+ dstarg=$arg
+ done
+ break;;
+ esac
+done
+
+if test -z "$1"; then
+ if test -z "$dir_arg"; then
+ echo "$0: no input file specified." >&2
+ exit 1
+ fi
+ # It's OK to call `install-sh -d' without argument.
+ # This can happen when creating conditional directories.
+ exit 0
+fi
+
+for src
+do
+ # Protect names starting with `-'.
+ case $src in
+ -*) src=./$src ;;
+ esac
+
+ if test -n "$dir_arg"; then
+ dst=$src
+ src=
+
+ if test -d "$dst"; then
+ mkdircmd=:
+ chmodcmd=
+ else
+ mkdircmd=$mkdirprog
+ fi
+ else
+ # Waiting for this to be detected by the "$cpprog $src $dsttmp" command
+ # might cause directories to be created, which would be especially bad
+ # if $src (and thus $dsttmp) contains '*'.
+ if test ! -f "$src" && test ! -d "$src"; then
+ echo "$0: $src does not exist." >&2
+ exit 1
+ fi
+
+ if test -z "$dstarg"; then
+ echo "$0: no destination specified." >&2
+ exit 1
+ fi
+
+ dst=$dstarg
+ # Protect names starting with `-'.
+ case $dst in
+ -*) dst=./$dst ;;
+ esac
+
+ # If destination is a directory, append the input filename; won't work
+ # if double slashes aren't ignored.
+ if test -d "$dst"; then
+ if test -n "$no_target_directory"; then
+ echo "$0: $dstarg: Is a directory" >&2
+ exit 1
+ fi
+ dst=$dst/`basename "$src"`
+ fi
+ fi
+
+ # This sed command emulates the dirname command.
+ dstdir=`echo "$dst" | sed -e 's,/*$,,;s,[^/]*$,,;s,/*$,,;s,^$,.,'`
+
+ # Make sure that the destination directory exists.
+
+ # Skip lots of stat calls in the usual case.
+ if test ! -d "$dstdir"; then
+ defaultIFS='
+ '
+ IFS="${IFS-$defaultIFS}"
+
+ oIFS=$IFS
+ # Some sh's can't handle IFS=/ for some reason.
+ IFS='%'
+ set x `echo "$dstdir" | sed -e 's@/@%@g' -e 's@^%@/@'`
+ shift
+ IFS=$oIFS
+
+ pathcomp=
+
+ while test $# -ne 0 ; do
+ pathcomp=$pathcomp$1
+ shift
+ if test ! -d "$pathcomp"; then
+ $mkdirprog "$pathcomp"
+ # mkdir can fail with a `File exist' error in case several
+ # install-sh are creating the directory concurrently. This
+ # is OK.
+ test -d "$pathcomp" || exit
+ fi
+ pathcomp=$pathcomp/
+ done
+ fi
+
+ if test -n "$dir_arg"; then
+ $doit $mkdircmd "$dst" \
+ && { test -z "$chowncmd" || $doit $chowncmd "$dst"; } \
+ && { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } \
+ && { test -z "$stripcmd" || $doit $stripcmd "$dst"; } \
+ && { test -z "$chmodcmd" || $doit $chmodcmd "$dst"; }
+
+ else
+ dstfile=`basename "$dst"`
+
+ # Make a couple of temp file names in the proper directory.
+ dsttmp=$dstdir/_inst.$$_
+ rmtmp=$dstdir/_rm.$$_
+
+ # Trap to clean up those temp files at exit.
+ trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
+ trap '(exit $?); exit' 1 2 13 15
+
+ # Copy the file name to the temp name.
+ $doit $cpprog "$src" "$dsttmp" &&
+
+ # and set any options; do chmod last to preserve setuid bits.
+ #
+ # If any of these fail, we abort the whole thing. If we want to
+ # ignore errors from any of these, just make sure not to ignore
+ # errors from the above "$doit $cpprog $src $dsttmp" command.
+ #
+ { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } \
+ && { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } \
+ && { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } \
+ && { test -z "$chmodcmd" || $doit $chmodcmd "$dsttmp"; } &&
+
+ # Now rename the file to the real destination.
+ { $doit $mvcmd -f "$dsttmp" "$dstdir/$dstfile" 2>/dev/null \
+ || {
+ # The rename failed, perhaps because mv can't rename something else
+ # to itself, or perhaps because mv is so ancient that it does not
+ # support -f.
+
+ # Now remove or move aside any old file at destination location.
+ # We try this two ways since rm can't unlink itself on some
+ # systems and the destination file might be busy for other
+ # reasons. In this case, the final cleanup might fail but the new
+ # file should still install successfully.
+ {
+ if test -f "$dstdir/$dstfile"; then
+ $doit $rmcmd -f "$dstdir/$dstfile" 2>/dev/null \
+ || $doit $mvcmd -f "$dstdir/$dstfile" "$rmtmp" 2>/dev/null \
+ || {
+ echo "$0: cannot unlink or rename $dstdir/$dstfile" >&2
+ (exit 1); exit 1
+ }
+ else
+ :
+ fi
+ } &&
+
+ # Now rename the file to the real destination.
+ $doit $mvcmd "$dsttmp" "$dstdir/$dstfile"
+ }
+ }
+ fi || { (exit 1); exit 1; }
+done
+
+# The final little trick to "correctly" pass the exit status to the exit trap.
+{
+ (exit 0); exit 0
+}
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-end: "$"
+# End:
diff --git a/driver/xf86-input-mouse/ltmain.sh b/driver/xf86-input-mouse/ltmain.sh
new file mode 100644
index 000000000..0223495a0
--- /dev/null
+++ b/driver/xf86-input-mouse/ltmain.sh
@@ -0,0 +1,6911 @@
+# ltmain.sh - Provide generalized library-building support services.
+# NOTE: Changing this file will not affect anything until you rerun configure.
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+basename="s,^.*/,,g"
+
+# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh
+# is ksh but when the shell is invoked as "sh" and the current value of
+# the _XPG environment variable is not equal to 1 (one), the special
+# positional parameter $0, within a function call, is the name of the
+# function.
+progpath="$0"
+
+# The name of this program:
+progname=`echo "$progpath" | $SED $basename`
+modename="$progname"
+
+# Global variables:
+EXIT_SUCCESS=0
+EXIT_FAILURE=1
+
+PROGRAM=ltmain.sh
+PACKAGE=libtool
+VERSION=1.5.22
+TIMESTAMP=" (1.1220.2.365 2005/12/18 22:14:06)"
+
+# Be Bourne compatible (taken from Autoconf:_AS_BOURNE_COMPATIBLE).
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac
+fi
+
+# Check that we have a working $echo.
+if test "X$1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X$1" = X--fallback-echo; then
+ # Avoid inline document here, it may be left over
+ :
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then
+ # Yippee, $echo works!
+ :
+else
+ # Restart under the correct shell, and then maybe $echo will work.
+ exec $SHELL "$progpath" --no-reexec ${1+"$@"}
+fi
+
+if test "X$1" = X--fallback-echo; then
+ # used as fallback echo
+ shift
+ cat <<EOF
+$*
+EOF
+ exit $EXIT_SUCCESS
+fi
+
+default_mode=
+help="Try \`$progname --help' for more information."
+magic="%%%MAGIC variable%%%"
+mkdir="mkdir"
+mv="mv -f"
+rm="rm -f"
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed="${SED}"' -e 1s/^X//'
+sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g'
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+ # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+ SP2NL='tr \040 \012'
+ NL2SP='tr \015\012 \040\040'
+ ;;
+ *) # EBCDIC based system
+ SP2NL='tr \100 \n'
+ NL2SP='tr \r\n \100\100'
+ ;;
+esac
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+# We save the old values to restore during execute mode.
+for lt_var in LANG LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+do
+ eval "if test \"\${$lt_var+set}\" = set; then
+ save_$lt_var=\$$lt_var
+ $lt_var=C
+ export $lt_var
+ fi"
+done
+
+# Make sure IFS has a sensible default
+lt_nl='
+'
+IFS=" $lt_nl"
+
+if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+ $echo "$modename: not configured to build any kind of library" 1>&2
+ $echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2
+ exit $EXIT_FAILURE
+fi
+
+# Global variables.
+mode=$default_mode
+nonopt=
+prev=
+prevopt=
+run=
+show="$echo"
+show_help=
+execute_dlfiles=
+duplicate_deps=no
+preserve_args=
+lo2o="s/\\.lo\$/.${objext}/"
+o2lo="s/\\.${objext}\$/.lo/"
+extracted_archives=
+extracted_serial=0
+
+#####################################
+# Shell function definitions:
+# This seems to be the best place for them
+
+# func_mktempdir [string]
+# Make a temporary directory that won't clash with other running
+# libtool processes, and avoids race conditions if possible. If
+# given, STRING is the basename for that directory.
+func_mktempdir ()
+{
+ my_template="${TMPDIR-/tmp}/${1-$progname}"
+
+ if test "$run" = ":"; then
+ # Return a directory name, but don't create it in dry-run mode
+ my_tmpdir="${my_template}-$$"
+ else
+
+ # If mktemp works, use that first and foremost
+ my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null`
+
+ if test ! -d "$my_tmpdir"; then
+ # Failing that, at least try and use $RANDOM to avoid a race
+ my_tmpdir="${my_template}-${RANDOM-0}$$"
+
+ save_mktempdir_umask=`umask`
+ umask 0077
+ $mkdir "$my_tmpdir"
+ umask $save_mktempdir_umask
+ fi
+
+ # If we're not in dry-run mode, bomb out on failure
+ test -d "$my_tmpdir" || {
+ $echo "cannot create temporary directory \`$my_tmpdir'" 1>&2
+ exit $EXIT_FAILURE
+ }
+ fi
+
+ $echo "X$my_tmpdir" | $Xsed
+}
+
+
+# func_win32_libid arg
+# return the library type of file 'arg'
+#
+# Need a lot of goo to handle *both* DLLs and import libs
+# Has to be a shell function in order to 'eat' the argument
+# that is supplied when $file_magic_command is called.
+func_win32_libid ()
+{
+ win32_libid_type="unknown"
+ win32_fileres=`file -L $1 2>/dev/null`
+ case $win32_fileres in
+ *ar\ archive\ import\ library*) # definitely import
+ win32_libid_type="x86 archive import"
+ ;;
+ *ar\ archive*) # could be an import, or static
+ if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null | \
+ $EGREP -e 'file format pe-i386(.*architecture: i386)?' >/dev/null ; then
+ win32_nmres=`eval $NM -f posix -A $1 | \
+ $SED -n -e '1,100{/ I /{s,.*,import,;p;q;};}'`
+ case $win32_nmres in
+ import*) win32_libid_type="x86 archive import";;
+ *) win32_libid_type="x86 archive static";;
+ esac
+ fi
+ ;;
+ *DLL*)
+ win32_libid_type="x86 DLL"
+ ;;
+ *executable*) # but shell scripts are "executable" too...
+ case $win32_fileres in
+ *MS\ Windows\ PE\ Intel*)
+ win32_libid_type="x86 DLL"
+ ;;
+ esac
+ ;;
+ esac
+ $echo $win32_libid_type
+}
+
+
+# func_infer_tag arg
+# Infer tagged configuration to use if any are available and
+# if one wasn't chosen via the "--tag" command line option.
+# Only attempt this if the compiler in the base compile
+# command doesn't match the default compiler.
+# arg is usually of the form 'gcc ...'
+func_infer_tag ()
+{
+ if test -n "$available_tags" && test -z "$tagname"; then
+ CC_quoted=
+ for arg in $CC; do
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ CC_quoted="$CC_quoted $arg"
+ done
+ case $@ in
+ # Blanks in the command may have been stripped by the calling shell,
+ # but not from the CC environment variable when configure was run.
+ " $CC "* | "$CC "* | " `$echo $CC` "* | "`$echo $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$echo $CC_quoted` "* | "`$echo $CC_quoted` "*) ;;
+ # Blanks at the start of $base_compile will cause this to fail
+ # if we don't check for them as well.
+ *)
+ for z in $available_tags; do
+ if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then
+ # Evaluate the configuration.
+ eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`"
+ CC_quoted=
+ for arg in $CC; do
+ # Double-quote args containing other shell metacharacters.
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ CC_quoted="$CC_quoted $arg"
+ done
+ case "$@ " in
+ " $CC "* | "$CC "* | " `$echo $CC` "* | "`$echo $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$echo $CC_quoted` "* | "`$echo $CC_quoted` "*)
+ # The compiler in the base compile command matches
+ # the one in the tagged configuration.
+ # Assume this is the tagged configuration we want.
+ tagname=$z
+ break
+ ;;
+ esac
+ fi
+ done
+ # If $tagname still isn't set, then no tagged configuration
+ # was found and let the user know that the "--tag" command
+ # line option must be used.
+ if test -z "$tagname"; then
+ $echo "$modename: unable to infer tagged configuration"
+ $echo "$modename: specify a tag with \`--tag'" 1>&2
+ exit $EXIT_FAILURE
+# else
+# $echo "$modename: using $tagname tagged configuration"
+ fi
+ ;;
+ esac
+ fi
+}
+
+
+# func_extract_an_archive dir oldlib
+func_extract_an_archive ()
+{
+ f_ex_an_ar_dir="$1"; shift
+ f_ex_an_ar_oldlib="$1"
+
+ $show "(cd $f_ex_an_ar_dir && $AR x $f_ex_an_ar_oldlib)"
+ $run eval "(cd \$f_ex_an_ar_dir && $AR x \$f_ex_an_ar_oldlib)" || exit $?
+ if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then
+ :
+ else
+ $echo "$modename: ERROR: object name conflicts: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib" 1>&2
+ exit $EXIT_FAILURE
+ fi
+}
+
+# func_extract_archives gentop oldlib ...
+func_extract_archives ()
+{
+ my_gentop="$1"; shift
+ my_oldlibs=${1+"$@"}
+ my_oldobjs=""
+ my_xlib=""
+ my_xabs=""
+ my_xdir=""
+ my_status=""
+
+ $show "${rm}r $my_gentop"
+ $run ${rm}r "$my_gentop"
+ $show "$mkdir $my_gentop"
+ $run $mkdir "$my_gentop"
+ my_status=$?
+ if test "$my_status" -ne 0 && test ! -d "$my_gentop"; then
+ exit $my_status
+ fi
+
+ for my_xlib in $my_oldlibs; do
+ # Extract the objects.
+ case $my_xlib in
+ [\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;;
+ *) my_xabs=`pwd`"/$my_xlib" ;;
+ esac
+ my_xlib=`$echo "X$my_xlib" | $Xsed -e 's%^.*/%%'`
+ my_xlib_u=$my_xlib
+ while :; do
+ case " $extracted_archives " in
+ *" $my_xlib_u "*)
+ extracted_serial=`expr $extracted_serial + 1`
+ my_xlib_u=lt$extracted_serial-$my_xlib ;;
+ *) break ;;
+ esac
+ done
+ extracted_archives="$extracted_archives $my_xlib_u"
+ my_xdir="$my_gentop/$my_xlib_u"
+
+ $show "${rm}r $my_xdir"
+ $run ${rm}r "$my_xdir"
+ $show "$mkdir $my_xdir"
+ $run $mkdir "$my_xdir"
+ exit_status=$?
+ if test "$exit_status" -ne 0 && test ! -d "$my_xdir"; then
+ exit $exit_status
+ fi
+ case $host in
+ *-darwin*)
+ $show "Extracting $my_xabs"
+ # Do not bother doing anything if just a dry run
+ if test -z "$run"; then
+ darwin_orig_dir=`pwd`
+ cd $my_xdir || exit $?
+ darwin_archive=$my_xabs
+ darwin_curdir=`pwd`
+ darwin_base_archive=`$echo "X$darwin_archive" | $Xsed -e 's%^.*/%%'`
+ darwin_arches=`lipo -info "$darwin_archive" 2>/dev/null | $EGREP Architectures 2>/dev/null`
+ if test -n "$darwin_arches"; then
+ darwin_arches=`echo "$darwin_arches" | $SED -e 's/.*are://'`
+ darwin_arch=
+ $show "$darwin_base_archive has multiple architectures $darwin_arches"
+ for darwin_arch in $darwin_arches ; do
+ mkdir -p "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ lipo -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}"
+ cd "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ func_extract_an_archive "`pwd`" "${darwin_base_archive}"
+ cd "$darwin_curdir"
+ $rm "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}"
+ done # $darwin_arches
+ ## Okay now we have a bunch of thin objects, gotta fatten them up :)
+ darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print| xargs basename | sort -u | $NL2SP`
+ darwin_file=
+ darwin_files=
+ for darwin_file in $darwin_filelist; do
+ darwin_files=`find unfat-$$ -name $darwin_file -print | $NL2SP`
+ lipo -create -output "$darwin_file" $darwin_files
+ done # $darwin_filelist
+ ${rm}r unfat-$$
+ cd "$darwin_orig_dir"
+ else
+ cd "$darwin_orig_dir"
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ fi # $darwin_arches
+ fi # $run
+ ;;
+ *)
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ ;;
+ esac
+ my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | $NL2SP`
+ done
+ func_extract_archives_result="$my_oldobjs"
+}
+# End of Shell function definitions
+#####################################
+
+# Darwin sucks
+eval std_shrext=\"$shrext_cmds\"
+
+disable_libs=no
+
+# Parse our command line options once, thoroughly.
+while test "$#" -gt 0
+do
+ arg="$1"
+ shift
+
+ case $arg in
+ -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) optarg= ;;
+ esac
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ case $prev in
+ execute_dlfiles)
+ execute_dlfiles="$execute_dlfiles $arg"
+ ;;
+ tag)
+ tagname="$arg"
+ preserve_args="${preserve_args}=$arg"
+
+ # Check whether tagname contains only valid characters
+ case $tagname in
+ *[!-_A-Za-z0-9,/]*)
+ $echo "$progname: invalid tag name: $tagname" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ case $tagname in
+ CC)
+ # Don't test for the "default" C tag, as we know, it's there, but
+ # not specially marked.
+ ;;
+ *)
+ if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "$progpath" > /dev/null; then
+ taglist="$taglist $tagname"
+ # Evaluate the configuration.
+ eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$tagname'$/,/^# ### END LIBTOOL TAG CONFIG: '$tagname'$/p' < $progpath`"
+ else
+ $echo "$progname: ignoring unknown tag $tagname" 1>&2
+ fi
+ ;;
+ esac
+ ;;
+ *)
+ eval "$prev=\$arg"
+ ;;
+ esac
+
+ prev=
+ prevopt=
+ continue
+ fi
+
+ # Have we seen a non-optional argument yet?
+ case $arg in
+ --help)
+ show_help=yes
+ ;;
+
+ --version)
+ $echo "$PROGRAM (GNU $PACKAGE) $VERSION$TIMESTAMP"
+ $echo
+ $echo "Copyright (C) 2005 Free Software Foundation, Inc."
+ $echo "This is free software; see the source for copying conditions. There is NO"
+ $echo "warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+ exit $?
+ ;;
+
+ --config)
+ ${SED} -e '1,/^# ### BEGIN LIBTOOL CONFIG/d' -e '/^# ### END LIBTOOL CONFIG/,$d' $progpath
+ # Now print the configurations for the tags.
+ for tagname in $taglist; do
+ ${SED} -n -e "/^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$/,/^# ### END LIBTOOL TAG CONFIG: $tagname$/p" < "$progpath"
+ done
+ exit $?
+ ;;
+
+ --debug)
+ $echo "$progname: enabling shell trace mode"
+ set -x
+ preserve_args="$preserve_args $arg"
+ ;;
+
+ --dry-run | -n)
+ run=:
+ ;;
+
+ --features)
+ $echo "host: $host"
+ if test "$build_libtool_libs" = yes; then
+ $echo "enable shared libraries"
+ else
+ $echo "disable shared libraries"
+ fi
+ if test "$build_old_libs" = yes; then
+ $echo "enable static libraries"
+ else
+ $echo "disable static libraries"
+ fi
+ exit $?
+ ;;
+
+ --finish) mode="finish" ;;
+
+ --mode) prevopt="--mode" prev=mode ;;
+ --mode=*) mode="$optarg" ;;
+
+ --preserve-dup-deps) duplicate_deps="yes" ;;
+
+ --quiet | --silent)
+ show=:
+ preserve_args="$preserve_args $arg"
+ ;;
+
+ --tag)
+ prevopt="--tag"
+ prev=tag
+ preserve_args="$preserve_args --tag"
+ ;;
+ --tag=*)
+ set tag "$optarg" ${1+"$@"}
+ shift
+ prev=tag
+ preserve_args="$preserve_args --tag"
+ ;;
+
+ -dlopen)
+ prevopt="-dlopen"
+ prev=execute_dlfiles
+ ;;
+
+ -*)
+ $echo "$modename: unrecognized option \`$arg'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+
+ *)
+ nonopt="$arg"
+ break
+ ;;
+ esac
+done
+
+if test -n "$prevopt"; then
+ $echo "$modename: option \`$prevopt' requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+fi
+
+case $disable_libs in
+no)
+ ;;
+shared)
+ build_libtool_libs=no
+ build_old_libs=yes
+ ;;
+static)
+ build_old_libs=`case $build_libtool_libs in yes) echo no;; *) echo yes;; esac`
+ ;;
+esac
+
+# If this variable is set in any of the actions, the command in it
+# will be execed at the end. This prevents here-documents from being
+# left over by shells.
+exec_cmd=
+
+if test -z "$show_help"; then
+
+ # Infer the operation mode.
+ if test -z "$mode"; then
+ $echo "*** Warning: inferring the mode of operation is deprecated." 1>&2
+ $echo "*** Future versions of Libtool will require --mode=MODE be specified." 1>&2
+ case $nonopt in
+ *cc | cc* | *++ | gcc* | *-gcc* | g++* | xlc*)
+ mode=link
+ for arg
+ do
+ case $arg in
+ -c)
+ mode=compile
+ break
+ ;;
+ esac
+ done
+ ;;
+ *db | *dbx | *strace | *truss)
+ mode=execute
+ ;;
+ *install*|cp|mv)
+ mode=install
+ ;;
+ *rm)
+ mode=uninstall
+ ;;
+ *)
+ # If we have no mode, but dlfiles were specified, then do execute mode.
+ test -n "$execute_dlfiles" && mode=execute
+
+ # Just use the default operation mode.
+ if test -z "$mode"; then
+ if test -n "$nonopt"; then
+ $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2
+ else
+ $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2
+ fi
+ fi
+ ;;
+ esac
+ fi
+
+ # Only execute mode is allowed to have -dlopen flags.
+ if test -n "$execute_dlfiles" && test "$mode" != execute; then
+ $echo "$modename: unrecognized option \`-dlopen'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Change the help message to a mode-specific one.
+ generic_help="$help"
+ help="Try \`$modename --help --mode=$mode' for more information."
+
+ # These modes are in order of execution frequency so that they run quickly.
+ case $mode in
+ # libtool compile mode
+ compile)
+ modename="$modename: compile"
+ # Get the compilation command and the source file.
+ base_compile=
+ srcfile="$nonopt" # always keep a non-empty value in "srcfile"
+ suppress_opt=yes
+ suppress_output=
+ arg_mode=normal
+ libobj=
+ later=
+
+ for arg
+ do
+ case $arg_mode in
+ arg )
+ # do not "continue". Instead, add this to base_compile
+ lastarg="$arg"
+ arg_mode=normal
+ ;;
+
+ target )
+ libobj="$arg"
+ arg_mode=normal
+ continue
+ ;;
+
+ normal )
+ # Accept any command-line options.
+ case $arg in
+ -o)
+ if test -n "$libobj" ; then
+ $echo "$modename: you cannot specify \`-o' more than once" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ arg_mode=target
+ continue
+ ;;
+
+ -static | -prefer-pic | -prefer-non-pic)
+ later="$later $arg"
+ continue
+ ;;
+
+ -no-suppress)
+ suppress_opt=no
+ continue
+ ;;
+
+ -Xcompiler)
+ arg_mode=arg # the next one goes into the "base_compile" arg list
+ continue # The current "srcfile" will either be retained or
+ ;; # replaced later. I would guess that would be a bug.
+
+ -Wc,*)
+ args=`$echo "X$arg" | $Xsed -e "s/^-Wc,//"`
+ lastarg=
+ save_ifs="$IFS"; IFS=','
+ for arg in $args; do
+ IFS="$save_ifs"
+
+ # Double-quote args containing other shell metacharacters.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, so we specify it separately.
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ lastarg="$lastarg $arg"
+ done
+ IFS="$save_ifs"
+ lastarg=`$echo "X$lastarg" | $Xsed -e "s/^ //"`
+
+ # Add the arguments to base_compile.
+ base_compile="$base_compile $lastarg"
+ continue
+ ;;
+
+ * )
+ # Accept the current argument as the source file.
+ # The previous "srcfile" becomes the current argument.
+ #
+ lastarg="$srcfile"
+ srcfile="$arg"
+ ;;
+ esac # case $arg
+ ;;
+ esac # case $arg_mode
+
+ # Aesthetically quote the previous argument.
+ lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"`
+
+ case $lastarg in
+ # Double-quote args containing other shell metacharacters.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, and some SunOS ksh mistreat backslash-escaping
+ # in scan sets (worked around with variable expansion),
+ # and furthermore cannot handle '|' '&' '(' ')' in scan sets
+ # at all, so we specify them separately.
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ lastarg="\"$lastarg\""
+ ;;
+ esac
+
+ base_compile="$base_compile $lastarg"
+ done # for arg
+
+ case $arg_mode in
+ arg)
+ $echo "$modename: you must specify an argument for -Xcompile"
+ exit $EXIT_FAILURE
+ ;;
+ target)
+ $echo "$modename: you must specify a target with \`-o'" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ *)
+ # Get the name of the library object.
+ [ -z "$libobj" ] && libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'`
+ ;;
+ esac
+
+ # Recognize several different file suffixes.
+ # If the user specifies -o file.o, it is replaced with file.lo
+ xform='[cCFSifmso]'
+ case $libobj in
+ *.ada) xform=ada ;;
+ *.adb) xform=adb ;;
+ *.ads) xform=ads ;;
+ *.asm) xform=asm ;;
+ *.c++) xform=c++ ;;
+ *.cc) xform=cc ;;
+ *.ii) xform=ii ;;
+ *.class) xform=class ;;
+ *.cpp) xform=cpp ;;
+ *.cxx) xform=cxx ;;
+ *.f90) xform=f90 ;;
+ *.for) xform=for ;;
+ *.java) xform=java ;;
+ *.obj) xform=obj ;;
+ esac
+
+ libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"`
+
+ case $libobj in
+ *.lo) obj=`$echo "X$libobj" | $Xsed -e "$lo2o"` ;;
+ *)
+ $echo "$modename: cannot determine name of library object from \`$libobj'" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ func_infer_tag $base_compile
+
+ for arg in $later; do
+ case $arg in
+ -static)
+ build_old_libs=yes
+ continue
+ ;;
+
+ -prefer-pic)
+ pic_mode=yes
+ continue
+ ;;
+
+ -prefer-non-pic)
+ pic_mode=no
+ continue
+ ;;
+ esac
+ done
+
+ qlibobj=`$echo "X$libobj" | $Xsed -e "$sed_quote_subst"`
+ case $qlibobj in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ qlibobj="\"$qlibobj\"" ;;
+ esac
+ test "X$libobj" != "X$qlibobj" \
+ && $echo "X$libobj" | grep '[]~#^*{};<>?"'"'"' &()|`$[]' \
+ && $echo "$modename: libobj name \`$libobj' may not contain shell special characters."
+ objname=`$echo "X$obj" | $Xsed -e 's%^.*/%%'`
+ xdir=`$echo "X$obj" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$xdir" = "X$obj"; then
+ xdir=
+ else
+ xdir=$xdir/
+ fi
+ lobj=${xdir}$objdir/$objname
+
+ if test -z "$base_compile"; then
+ $echo "$modename: you must specify a compilation command" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Delete any leftover library objects.
+ if test "$build_old_libs" = yes; then
+ removelist="$obj $lobj $libobj ${libobj}T"
+ else
+ removelist="$lobj $libobj ${libobj}T"
+ fi
+
+ $run $rm $removelist
+ trap "$run $rm $removelist; exit $EXIT_FAILURE" 1 2 15
+
+ # On Cygwin there's no "real" PIC flag so we must build both object types
+ case $host_os in
+ cygwin* | mingw* | pw32* | os2*)
+ pic_mode=default
+ ;;
+ esac
+ if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then
+ # non-PIC code in shared libraries is not supported
+ pic_mode=default
+ fi
+
+ # Calculate the filename of the output object if compiler does
+ # not support -o with -c
+ if test "$compiler_c_o" = no; then
+ output_obj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%' -e 's%\.[^.]*$%%'`.${objext}
+ lockfile="$output_obj.lock"
+ removelist="$removelist $output_obj $lockfile"
+ trap "$run $rm $removelist; exit $EXIT_FAILURE" 1 2 15
+ else
+ output_obj=
+ need_locks=no
+ lockfile=
+ fi
+
+ # Lock this critical section if it is needed
+ # We use this script file to make the link, it avoids creating a new file
+ if test "$need_locks" = yes; then
+ until $run ln "$progpath" "$lockfile" 2>/dev/null; do
+ $show "Waiting for $lockfile to be removed"
+ sleep 2
+ done
+ elif test "$need_locks" = warn; then
+ if test -f "$lockfile"; then
+ $echo "\
+*** ERROR, $lockfile exists and contains:
+`cat $lockfile 2>/dev/null`
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $run $rm $removelist
+ exit $EXIT_FAILURE
+ fi
+ $echo "$srcfile" > "$lockfile"
+ fi
+
+ if test -n "$fix_srcfile_path"; then
+ eval srcfile=\"$fix_srcfile_path\"
+ fi
+ qsrcfile=`$echo "X$srcfile" | $Xsed -e "$sed_quote_subst"`
+ case $qsrcfile in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ qsrcfile="\"$qsrcfile\"" ;;
+ esac
+
+ $run $rm "$libobj" "${libobj}T"
+
+ # Create a libtool object file (analogous to a ".la" file),
+ # but don't create it if we're doing a dry run.
+ test -z "$run" && cat > ${libobj}T <<EOF
+# $libobj - a libtool object file
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# Name of the PIC object.
+EOF
+
+ # Only build a PIC object if we are building libtool libraries.
+ if test "$build_libtool_libs" = yes; then
+ # Without this assignment, base_compile gets emptied.
+ fbsd_hideous_sh_bug=$base_compile
+
+ if test "$pic_mode" != no; then
+ command="$base_compile $qsrcfile $pic_flag"
+ else
+ # Don't build PIC code
+ command="$base_compile $qsrcfile"
+ fi
+
+ if test ! -d "${xdir}$objdir"; then
+ $show "$mkdir ${xdir}$objdir"
+ $run $mkdir ${xdir}$objdir
+ exit_status=$?
+ if test "$exit_status" -ne 0 && test ! -d "${xdir}$objdir"; then
+ exit $exit_status
+ fi
+ fi
+
+ if test -z "$output_obj"; then
+ # Place PIC objects in $objdir
+ command="$command -o $lobj"
+ fi
+
+ $run $rm "$lobj" "$output_obj"
+
+ $show "$command"
+ if $run eval "$command"; then :
+ else
+ test -n "$output_obj" && $run $rm $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $echo "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $run $rm $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed, then go on to compile the next one
+ if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then
+ $show "$mv $output_obj $lobj"
+ if $run $mv $output_obj $lobj; then :
+ else
+ error=$?
+ $run $rm $removelist
+ exit $error
+ fi
+ fi
+
+ # Append the name of the PIC object to the libtool object file.
+ test -z "$run" && cat >> ${libobj}T <<EOF
+pic_object='$objdir/$objname'
+
+EOF
+
+ # Allow error messages only from the first compilation.
+ if test "$suppress_opt" = yes; then
+ suppress_output=' >/dev/null 2>&1'
+ fi
+ else
+ # No PIC object so indicate it doesn't exist in the libtool
+ # object file.
+ test -z "$run" && cat >> ${libobj}T <<EOF
+pic_object=none
+
+EOF
+ fi
+
+ # Only build a position-dependent object if we build old libraries.
+ if test "$build_old_libs" = yes; then
+ if test "$pic_mode" != yes; then
+ # Don't build PIC code
+ command="$base_compile $qsrcfile"
+ else
+ command="$base_compile $qsrcfile $pic_flag"
+ fi
+ if test "$compiler_c_o" = yes; then
+ command="$command -o $obj"
+ fi
+
+ # Suppress compiler output if we already did a PIC compilation.
+ command="$command$suppress_output"
+ $run $rm "$obj" "$output_obj"
+ $show "$command"
+ if $run eval "$command"; then :
+ else
+ $run $rm $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $echo "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $run $rm $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed
+ if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then
+ $show "$mv $output_obj $obj"
+ if $run $mv $output_obj $obj; then :
+ else
+ error=$?
+ $run $rm $removelist
+ exit $error
+ fi
+ fi
+
+ # Append the name of the non-PIC object the libtool object file.
+ # Only append if the libtool object file exists.
+ test -z "$run" && cat >> ${libobj}T <<EOF
+# Name of the non-PIC object.
+non_pic_object='$objname'
+
+EOF
+ else
+ # Append the name of the non-PIC object the libtool object file.
+ # Only append if the libtool object file exists.
+ test -z "$run" && cat >> ${libobj}T <<EOF
+# Name of the non-PIC object.
+non_pic_object=none
+
+EOF
+ fi
+
+ $run $mv "${libobj}T" "${libobj}"
+
+ # Unlock the critical section if it was locked
+ if test "$need_locks" != no; then
+ $run $rm "$lockfile"
+ fi
+
+ exit $EXIT_SUCCESS
+ ;;
+
+ # libtool link mode
+ link | relink)
+ modename="$modename: link"
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*)
+ # It is impossible to link a dll without this setting, and
+ # we shouldn't force the makefile maintainer to figure out
+ # which system we are compiling for in order to pass an extra
+ # flag for every libtool invocation.
+ # allow_undefined=no
+
+ # FIXME: Unfortunately, there are problems with the above when trying
+ # to make a dll which has undefined symbols, in which case not
+ # even a static library is built. For now, we need to specify
+ # -no-undefined on the libtool link line when we can be certain
+ # that all symbols are satisfied, otherwise we get a static library.
+ allow_undefined=yes
+ ;;
+ *)
+ allow_undefined=yes
+ ;;
+ esac
+ libtool_args="$nonopt"
+ base_compile="$nonopt $@"
+ compile_command="$nonopt"
+ finalize_command="$nonopt"
+
+ compile_rpath=
+ finalize_rpath=
+ compile_shlibpath=
+ finalize_shlibpath=
+ convenience=
+ old_convenience=
+ deplibs=
+ old_deplibs=
+ compiler_flags=
+ linker_flags=
+ dllsearchpath=
+ lib_search_path=`pwd`
+ inst_prefix_dir=
+
+ avoid_version=no
+ dlfiles=
+ dlprefiles=
+ dlself=no
+ export_dynamic=no
+ export_symbols=
+ export_symbols_regex=
+ generated=
+ libobjs=
+ ltlibs=
+ module=no
+ no_install=no
+ objs=
+ non_pic_objects=
+ notinst_path= # paths that contain not-installed libtool libraries
+ precious_files_regex=
+ prefer_static_libs=no
+ preload=no
+ prev=
+ prevarg=
+ release=
+ rpath=
+ xrpath=
+ perm_rpath=
+ temp_rpath=
+ thread_safe=no
+ vinfo=
+ vinfo_number=no
+
+ func_infer_tag $base_compile
+
+ # We need to know -static, to get the right output filenames.
+ for arg
+ do
+ case $arg in
+ -all-static | -static | -static-libtool-libs)
+ case $arg in
+ -all-static)
+ if test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then
+ $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2
+ fi
+ if test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=yes
+ ;;
+ -static)
+ if test -z "$pic_flag" && test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=built
+ ;;
+ -static-libtool-libs)
+ if test -z "$pic_flag" && test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=yes
+ ;;
+ esac
+ build_libtool_libs=no
+ build_old_libs=yes
+ break
+ ;;
+ esac
+ done
+
+ # See if our shared archives depend on static archives.
+ test -n "$old_archive_from_new_cmds" && build_old_libs=yes
+
+ # Go through the arguments, transforming them on the way.
+ while test "$#" -gt 0; do
+ arg="$1"
+ shift
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ qarg=\"`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`\" ### testsuite: skip nested quoting test
+ ;;
+ *) qarg=$arg ;;
+ esac
+ libtool_args="$libtool_args $qarg"
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ case $prev in
+ output)
+ compile_command="$compile_command @OUTPUT@"
+ finalize_command="$finalize_command @OUTPUT@"
+ ;;
+ esac
+
+ case $prev in
+ dlfiles|dlprefiles)
+ if test "$preload" = no; then
+ # Add the symbol object into the linking commands.
+ compile_command="$compile_command @SYMFILE@"
+ finalize_command="$finalize_command @SYMFILE@"
+ preload=yes
+ fi
+ case $arg in
+ *.la | *.lo) ;; # We handle these cases below.
+ force)
+ if test "$dlself" = no; then
+ dlself=needless
+ export_dynamic=yes
+ fi
+ prev=
+ continue
+ ;;
+ self)
+ if test "$prev" = dlprefiles; then
+ dlself=yes
+ elif test "$prev" = dlfiles && test "$dlopen_self" != yes; then
+ dlself=yes
+ else
+ dlself=needless
+ export_dynamic=yes
+ fi
+ prev=
+ continue
+ ;;
+ *)
+ if test "$prev" = dlfiles; then
+ dlfiles="$dlfiles $arg"
+ else
+ dlprefiles="$dlprefiles $arg"
+ fi
+ prev=
+ continue
+ ;;
+ esac
+ ;;
+ expsyms)
+ export_symbols="$arg"
+ if test ! -f "$arg"; then
+ $echo "$modename: symbol file \`$arg' does not exist"
+ exit $EXIT_FAILURE
+ fi
+ prev=
+ continue
+ ;;
+ expsyms_regex)
+ export_symbols_regex="$arg"
+ prev=
+ continue
+ ;;
+ inst_prefix)
+ inst_prefix_dir="$arg"
+ prev=
+ continue
+ ;;
+ precious_regex)
+ precious_files_regex="$arg"
+ prev=
+ continue
+ ;;
+ release)
+ release="-$arg"
+ prev=
+ continue
+ ;;
+ objectlist)
+ if test -f "$arg"; then
+ save_arg=$arg
+ moreargs=
+ for fil in `cat $save_arg`
+ do
+# moreargs="$moreargs $fil"
+ arg=$fil
+ # A libtool-controlled object.
+
+ # Check to see that this really is a libtool object.
+ if (${SED} -e '2q' $arg | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ pic_object=
+ non_pic_object=
+
+ # Read the .lo file
+ # If there is no directory component, then add one.
+ case $arg in
+ */* | *\\*) . $arg ;;
+ *) . ./$arg ;;
+ esac
+
+ if test -z "$pic_object" || \
+ test -z "$non_pic_object" ||
+ test "$pic_object" = none && \
+ test "$non_pic_object" = none; then
+ $echo "$modename: cannot find name of object for \`$arg'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Extract subdirectory from the argument.
+ xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$xdir" = "X$arg"; then
+ xdir=
+ else
+ xdir="$xdir/"
+ fi
+
+ if test "$pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ pic_object="$xdir$pic_object"
+
+ if test "$prev" = dlfiles; then
+ if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+ dlfiles="$dlfiles $pic_object"
+ prev=
+ continue
+ else
+ # If libtool objects are unsupported, then we need to preload.
+ prev=dlprefiles
+ fi
+ fi
+
+ # CHECK ME: I think I busted this. -Ossama
+ if test "$prev" = dlprefiles; then
+ # Preload the old-style object.
+ dlprefiles="$dlprefiles $pic_object"
+ prev=
+ fi
+
+ # A PIC object.
+ libobjs="$libobjs $pic_object"
+ arg="$pic_object"
+ fi
+
+ # Non-PIC object.
+ if test "$non_pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ non_pic_object="$xdir$non_pic_object"
+
+ # A standard non-PIC object
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ if test -z "$pic_object" || test "$pic_object" = none ; then
+ arg="$non_pic_object"
+ fi
+ else
+ # If the PIC object exists, use it instead.
+ # $xdir was prepended to $pic_object above.
+ non_pic_object="$pic_object"
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ fi
+ else
+ # Only an error if not doing a dry-run.
+ if test -z "$run"; then
+ $echo "$modename: \`$arg' is not a valid libtool object" 1>&2
+ exit $EXIT_FAILURE
+ else
+ # Dry-run case.
+
+ # Extract subdirectory from the argument.
+ xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$xdir" = "X$arg"; then
+ xdir=
+ else
+ xdir="$xdir/"
+ fi
+
+ pic_object=`$echo "X${xdir}${objdir}/${arg}" | $Xsed -e "$lo2o"`
+ non_pic_object=`$echo "X${xdir}${arg}" | $Xsed -e "$lo2o"`
+ libobjs="$libobjs $pic_object"
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ fi
+ fi
+ done
+ else
+ $echo "$modename: link input file \`$save_arg' does not exist"
+ exit $EXIT_FAILURE
+ fi
+ arg=$save_arg
+ prev=
+ continue
+ ;;
+ rpath | xrpath)
+ # We need an absolute path.
+ case $arg in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ $echo "$modename: only absolute run-paths are allowed" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+ if test "$prev" = rpath; then
+ case "$rpath " in
+ *" $arg "*) ;;
+ *) rpath="$rpath $arg" ;;
+ esac
+ else
+ case "$xrpath " in
+ *" $arg "*) ;;
+ *) xrpath="$xrpath $arg" ;;
+ esac
+ fi
+ prev=
+ continue
+ ;;
+ xcompiler)
+ compiler_flags="$compiler_flags $qarg"
+ prev=
+ compile_command="$compile_command $qarg"
+ finalize_command="$finalize_command $qarg"
+ continue
+ ;;
+ xlinker)
+ linker_flags="$linker_flags $qarg"
+ compiler_flags="$compiler_flags $wl$qarg"
+ prev=
+ compile_command="$compile_command $wl$qarg"
+ finalize_command="$finalize_command $wl$qarg"
+ continue
+ ;;
+ xcclinker)
+ linker_flags="$linker_flags $qarg"
+ compiler_flags="$compiler_flags $qarg"
+ prev=
+ compile_command="$compile_command $qarg"
+ finalize_command="$finalize_command $qarg"
+ continue
+ ;;
+ shrext)
+ shrext_cmds="$arg"
+ prev=
+ continue
+ ;;
+ darwin_framework|darwin_framework_skip)
+ test "$prev" = "darwin_framework" && compiler_flags="$compiler_flags $arg"
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ prev=
+ continue
+ ;;
+ *)
+ eval "$prev=\"\$arg\""
+ prev=
+ continue
+ ;;
+ esac
+ fi # test -n "$prev"
+
+ prevarg="$arg"
+
+ case $arg in
+ -all-static)
+ if test -n "$link_static_flag"; then
+ compile_command="$compile_command $link_static_flag"
+ finalize_command="$finalize_command $link_static_flag"
+ fi
+ continue
+ ;;
+
+ -allow-undefined)
+ # FIXME: remove this flag sometime in the future.
+ $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2
+ continue
+ ;;
+
+ -avoid-version)
+ avoid_version=yes
+ continue
+ ;;
+
+ -dlopen)
+ prev=dlfiles
+ continue
+ ;;
+
+ -dlpreopen)
+ prev=dlprefiles
+ continue
+ ;;
+
+ -export-dynamic)
+ export_dynamic=yes
+ continue
+ ;;
+
+ -export-symbols | -export-symbols-regex)
+ if test -n "$export_symbols" || test -n "$export_symbols_regex"; then
+ $echo "$modename: more than one -exported-symbols argument is not allowed"
+ exit $EXIT_FAILURE
+ fi
+ if test "X$arg" = "X-export-symbols"; then
+ prev=expsyms
+ else
+ prev=expsyms_regex
+ fi
+ continue
+ ;;
+
+ -framework|-arch|-isysroot)
+ case " $CC " in
+ *" ${arg} ${1} "* | *" ${arg} ${1} "*)
+ prev=darwin_framework_skip ;;
+ *) compiler_flags="$compiler_flags $arg"
+ prev=darwin_framework ;;
+ esac
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ continue
+ ;;
+
+ -inst-prefix-dir)
+ prev=inst_prefix
+ continue
+ ;;
+
+ # The native IRIX linker understands -LANG:*, -LIST:* and -LNO:*
+ # so, if we see these flags be careful not to treat them like -L
+ -L[A-Z][A-Z]*:*)
+ case $with_gcc/$host in
+ no/*-*-irix* | /*-*-irix*)
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ ;;
+ esac
+ continue
+ ;;
+
+ -L*)
+ dir=`$echo "X$arg" | $Xsed -e 's/^-L//'`
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ absdir=`cd "$dir" && pwd`
+ if test -z "$absdir"; then
+ $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2
+ absdir="$dir"
+ notinst_path="$notinst_path $dir"
+ fi
+ dir="$absdir"
+ ;;
+ esac
+ case "$deplibs " in
+ *" -L$dir "*) ;;
+ *)
+ deplibs="$deplibs -L$dir"
+ lib_search_path="$lib_search_path $dir"
+ ;;
+ esac
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*)
+ testbindir=`$echo "X$dir" | $Xsed -e 's*/lib$*/bin*'`
+ case :$dllsearchpath: in
+ *":$dir:"*) ;;
+ *) dllsearchpath="$dllsearchpath:$dir";;
+ esac
+ case :$dllsearchpath: in
+ *":$testbindir:"*) ;;
+ *) dllsearchpath="$dllsearchpath:$testbindir";;
+ esac
+ ;;
+ esac
+ continue
+ ;;
+
+ -l*)
+ if test "X$arg" = "X-lc" || test "X$arg" = "X-lm"; then
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-beos*)
+ # These systems don't actually have a C or math library (as such)
+ continue
+ ;;
+ *-*-os2*)
+ # These systems don't actually have a C library (as such)
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc due to us having libc/libc_r.
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # Rhapsody C and math libraries are in the System framework
+ deplibs="$deplibs -framework System"
+ continue
+ ;;
+ *-*-sco3.2v5* | *-*-sco5v6*)
+ # Causes problems with __ctype
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+ # Compiler inserts libc in the correct place for threads to work
+ test "X$arg" = "X-lc" && continue
+ ;;
+ esac
+ elif test "X$arg" = "X-lc_r"; then
+ case $host in
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc_r directly, use -pthread flag.
+ continue
+ ;;
+ esac
+ fi
+ deplibs="$deplibs $arg"
+ continue
+ ;;
+
+ # Tru64 UNIX uses -model [arg] to determine the layout of C++
+ # classes, name mangling, and exception handling.
+ -model)
+ compile_command="$compile_command $arg"
+ compiler_flags="$compiler_flags $arg"
+ finalize_command="$finalize_command $arg"
+ prev=xcompiler
+ continue
+ ;;
+
+ -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe)
+ compiler_flags="$compiler_flags $arg"
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ continue
+ ;;
+
+ -module)
+ module=yes
+ continue
+ ;;
+
+ # -64, -mips[0-9] enable 64-bit mode on the SGI compiler
+ # -r[0-9][0-9]* specifies the processor on the SGI compiler
+ # -xarch=*, -xtarget=* enable 64-bit mode on the Sun compiler
+ # +DA*, +DD* enable 64-bit mode on the HP compiler
+ # -q* pass through compiler args for the IBM compiler
+ # -m* pass through architecture-specific compiler args for GCC
+ # -m*, -t[45]*, -txscale* pass through architecture-specific
+ # compiler args for GCC
+ # -pg pass through profiling flag for GCC
+ # @file GCC response files
+ -64|-mips[0-9]|-r[0-9][0-9]*|-xarch=*|-xtarget=*|+DA*|+DD*|-q*|-m*|-pg| \
+ -t[45]*|-txscale*|@*)
+
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ compiler_flags="$compiler_flags $arg"
+ continue
+ ;;
+
+ -shrext)
+ prev=shrext
+ continue
+ ;;
+
+ -no-fast-install)
+ fast_install=no
+ continue
+ ;;
+
+ -no-install)
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*)
+ # The PATH hackery in wrapper scripts is required on Windows
+ # in order for the loader to find any dlls it needs.
+ $echo "$modename: warning: \`-no-install' is ignored for $host" 1>&2
+ $echo "$modename: warning: assuming \`-no-fast-install' instead" 1>&2
+ fast_install=no
+ ;;
+ *) no_install=yes ;;
+ esac
+ continue
+ ;;
+
+ -no-undefined)
+ allow_undefined=no
+ continue
+ ;;
+
+ -objectlist)
+ prev=objectlist
+ continue
+ ;;
+
+ -o) prev=output ;;
+
+ -precious-files-regex)
+ prev=precious_regex
+ continue
+ ;;
+
+ -release)
+ prev=release
+ continue
+ ;;
+
+ -rpath)
+ prev=rpath
+ continue
+ ;;
+
+ -R)
+ prev=xrpath
+ continue
+ ;;
+
+ -R*)
+ dir=`$echo "X$arg" | $Xsed -e 's/^-R//'`
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ $echo "$modename: only absolute run-paths are allowed" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+ case "$xrpath " in
+ *" $dir "*) ;;
+ *) xrpath="$xrpath $dir" ;;
+ esac
+ continue
+ ;;
+
+ -static | -static-libtool-libs)
+ # The effects of -static are defined in a previous loop.
+ # We used to do the same as -all-static on platforms that
+ # didn't have a PIC flag, but the assumption that the effects
+ # would be equivalent was wrong. It would break on at least
+ # Digital Unix and AIX.
+ continue
+ ;;
+
+ -thread-safe)
+ thread_safe=yes
+ continue
+ ;;
+
+ -version-info)
+ prev=vinfo
+ continue
+ ;;
+ -version-number)
+ prev=vinfo
+ vinfo_number=yes
+ continue
+ ;;
+
+ -Wc,*)
+ args=`$echo "X$arg" | $Xsed -e "$sed_quote_subst" -e 's/^-Wc,//'`
+ arg=
+ save_ifs="$IFS"; IFS=','
+ for flag in $args; do
+ IFS="$save_ifs"
+ case $flag in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ flag="\"$flag\""
+ ;;
+ esac
+ arg="$arg $wl$flag"
+ compiler_flags="$compiler_flags $flag"
+ done
+ IFS="$save_ifs"
+ arg=`$echo "X$arg" | $Xsed -e "s/^ //"`
+ ;;
+
+ -Wl,*)
+ args=`$echo "X$arg" | $Xsed -e "$sed_quote_subst" -e 's/^-Wl,//'`
+ arg=
+ save_ifs="$IFS"; IFS=','
+ for flag in $args; do
+ IFS="$save_ifs"
+ case $flag in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ flag="\"$flag\""
+ ;;
+ esac
+ arg="$arg $wl$flag"
+ compiler_flags="$compiler_flags $wl$flag"
+ linker_flags="$linker_flags $flag"
+ done
+ IFS="$save_ifs"
+ arg=`$echo "X$arg" | $Xsed -e "s/^ //"`
+ ;;
+
+ -Xcompiler)
+ prev=xcompiler
+ continue
+ ;;
+
+ -Xlinker)
+ prev=xlinker
+ continue
+ ;;
+
+ -XCClinker)
+ prev=xcclinker
+ continue
+ ;;
+
+ # Some other compiler flag.
+ -* | +*)
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ ;;
+
+ *.$objext)
+ # A standard object.
+ objs="$objs $arg"
+ ;;
+
+ *.lo)
+ # A libtool-controlled object.
+
+ # Check to see that this really is a libtool object.
+ if (${SED} -e '2q' $arg | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ pic_object=
+ non_pic_object=
+
+ # Read the .lo file
+ # If there is no directory component, then add one.
+ case $arg in
+ */* | *\\*) . $arg ;;
+ *) . ./$arg ;;
+ esac
+
+ if test -z "$pic_object" || \
+ test -z "$non_pic_object" ||
+ test "$pic_object" = none && \
+ test "$non_pic_object" = none; then
+ $echo "$modename: cannot find name of object for \`$arg'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Extract subdirectory from the argument.
+ xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$xdir" = "X$arg"; then
+ xdir=
+ else
+ xdir="$xdir/"
+ fi
+
+ if test "$pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ pic_object="$xdir$pic_object"
+
+ if test "$prev" = dlfiles; then
+ if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+ dlfiles="$dlfiles $pic_object"
+ prev=
+ continue
+ else
+ # If libtool objects are unsupported, then we need to preload.
+ prev=dlprefiles
+ fi
+ fi
+
+ # CHECK ME: I think I busted this. -Ossama
+ if test "$prev" = dlprefiles; then
+ # Preload the old-style object.
+ dlprefiles="$dlprefiles $pic_object"
+ prev=
+ fi
+
+ # A PIC object.
+ libobjs="$libobjs $pic_object"
+ arg="$pic_object"
+ fi
+
+ # Non-PIC object.
+ if test "$non_pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ non_pic_object="$xdir$non_pic_object"
+
+ # A standard non-PIC object
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ if test -z "$pic_object" || test "$pic_object" = none ; then
+ arg="$non_pic_object"
+ fi
+ else
+ # If the PIC object exists, use it instead.
+ # $xdir was prepended to $pic_object above.
+ non_pic_object="$pic_object"
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ fi
+ else
+ # Only an error if not doing a dry-run.
+ if test -z "$run"; then
+ $echo "$modename: \`$arg' is not a valid libtool object" 1>&2
+ exit $EXIT_FAILURE
+ else
+ # Dry-run case.
+
+ # Extract subdirectory from the argument.
+ xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$xdir" = "X$arg"; then
+ xdir=
+ else
+ xdir="$xdir/"
+ fi
+
+ pic_object=`$echo "X${xdir}${objdir}/${arg}" | $Xsed -e "$lo2o"`
+ non_pic_object=`$echo "X${xdir}${arg}" | $Xsed -e "$lo2o"`
+ libobjs="$libobjs $pic_object"
+ non_pic_objects="$non_pic_objects $non_pic_object"
+ fi
+ fi
+ ;;
+
+ *.$libext)
+ # An archive.
+ deplibs="$deplibs $arg"
+ old_deplibs="$old_deplibs $arg"
+ continue
+ ;;
+
+ *.la)
+ # A libtool-controlled library.
+
+ if test "$prev" = dlfiles; then
+ # This library was specified with -dlopen.
+ dlfiles="$dlfiles $arg"
+ prev=
+ elif test "$prev" = dlprefiles; then
+ # The library was specified with -dlpreopen.
+ dlprefiles="$dlprefiles $arg"
+ prev=
+ else
+ deplibs="$deplibs $arg"
+ fi
+ continue
+ ;;
+
+ # Some other compiler argument.
+ *)
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ ;;
+ esac # arg
+
+ # Now actually substitute the argument into the commands.
+ if test -n "$arg"; then
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ fi
+ done # argument parsing loop
+
+ if test -n "$prev"; then
+ $echo "$modename: the \`$prevarg' option requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ if test "$export_dynamic" = yes && test -n "$export_dynamic_flag_spec"; then
+ eval arg=\"$export_dynamic_flag_spec\"
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ fi
+
+ oldlibs=
+ # calculate the name of the file, without its directory
+ outputname=`$echo "X$output" | $Xsed -e 's%^.*/%%'`
+ libobjs_save="$libobjs"
+
+ if test -n "$shlibpath_var"; then
+ # get the directories listed in $shlibpath_var
+ eval shlib_search_path=\`\$echo \"X\${$shlibpath_var}\" \| \$Xsed -e \'s/:/ /g\'\`
+ else
+ shlib_search_path=
+ fi
+ eval sys_lib_search_path=\"$sys_lib_search_path_spec\"
+ eval sys_lib_dlsearch_path=\"$sys_lib_dlsearch_path_spec\"
+
+ output_objdir=`$echo "X$output" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$output_objdir" = "X$output"; then
+ output_objdir="$objdir"
+ else
+ output_objdir="$output_objdir/$objdir"
+ fi
+ # Create the object directory.
+ if test ! -d "$output_objdir"; then
+ $show "$mkdir $output_objdir"
+ $run $mkdir $output_objdir
+ exit_status=$?
+ if test "$exit_status" -ne 0 && test ! -d "$output_objdir"; then
+ exit $exit_status
+ fi
+ fi
+
+ # Determine the type of output
+ case $output in
+ "")
+ $echo "$modename: you must specify an output file" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ *.$libext) linkmode=oldlib ;;
+ *.lo | *.$objext) linkmode=obj ;;
+ *.la) linkmode=lib ;;
+ *) linkmode=prog ;; # Anything else should be a program.
+ esac
+
+ case $host in
+ *cygwin* | *mingw* | *pw32*)
+ # don't eliminate duplications in $postdeps and $predeps
+ duplicate_compiler_generated_deps=yes
+ ;;
+ *)
+ duplicate_compiler_generated_deps=$duplicate_deps
+ ;;
+ esac
+ specialdeplibs=
+
+ libs=
+ # Find all interdependent deplibs by searching for libraries
+ # that are linked more than once (e.g. -la -lb -la)
+ for deplib in $deplibs; do
+ if test "X$duplicate_deps" = "Xyes" ; then
+ case "$libs " in
+ *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;;
+ esac
+ fi
+ libs="$libs $deplib"
+ done
+
+ if test "$linkmode" = lib; then
+ libs="$predeps $libs $compiler_lib_search_path $postdeps"
+
+ # Compute libraries that are listed more than once in $predeps
+ # $postdeps and mark them as special (i.e., whose duplicates are
+ # not to be eliminated).
+ pre_post_deps=
+ if test "X$duplicate_compiler_generated_deps" = "Xyes" ; then
+ for pre_post_dep in $predeps $postdeps; do
+ case "$pre_post_deps " in
+ *" $pre_post_dep "*) specialdeplibs="$specialdeplibs $pre_post_deps" ;;
+ esac
+ pre_post_deps="$pre_post_deps $pre_post_dep"
+ done
+ fi
+ pre_post_deps=
+ fi
+
+ deplibs=
+ newdependency_libs=
+ newlib_search_path=
+ need_relink=no # whether we're linking any uninstalled libtool libraries
+ notinst_deplibs= # not-installed libtool libraries
+ case $linkmode in
+ lib)
+ passes="conv link"
+ for file in $dlfiles $dlprefiles; do
+ case $file in
+ *.la) ;;
+ *)
+ $echo "$modename: libraries can \`-dlopen' only libtool libraries: $file" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+ done
+ ;;
+ prog)
+ compile_deplibs=
+ finalize_deplibs=
+ alldeplibs=no
+ newdlfiles=
+ newdlprefiles=
+ passes="conv scan dlopen dlpreopen link"
+ ;;
+ *) passes="conv"
+ ;;
+ esac
+ for pass in $passes; do
+ if test "$linkmode,$pass" = "lib,link" ||
+ test "$linkmode,$pass" = "prog,scan"; then
+ libs="$deplibs"
+ deplibs=
+ fi
+ if test "$linkmode" = prog; then
+ case $pass in
+ dlopen) libs="$dlfiles" ;;
+ dlpreopen) libs="$dlprefiles" ;;
+ link) libs="$deplibs %DEPLIBS% $dependency_libs" ;;
+ esac
+ fi
+ if test "$pass" = dlopen; then
+ # Collect dlpreopened libraries
+ save_deplibs="$deplibs"
+ deplibs=
+ fi
+ for deplib in $libs; do
+ lib=
+ found=no
+ case $deplib in
+ -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe)
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ compiler_flags="$compiler_flags $deplib"
+ fi
+ continue
+ ;;
+ -l*)
+ if test "$linkmode" != lib && test "$linkmode" != prog; then
+ $echo "$modename: warning: \`-l' is ignored for archives/objects" 1>&2
+ continue
+ fi
+ name=`$echo "X$deplib" | $Xsed -e 's/^-l//'`
+ for searchdir in $newlib_search_path $lib_search_path $sys_lib_search_path $shlib_search_path; do
+ for search_ext in .la $std_shrext .so .a; do
+ # Search the libtool library
+ lib="$searchdir/lib${name}${search_ext}"
+ if test -f "$lib"; then
+ if test "$search_ext" = ".la"; then
+ found=yes
+ else
+ found=no
+ fi
+ break 2
+ fi
+ done
+ done
+ if test "$found" != yes; then
+ # deplib doesn't seem to be a libtool library
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ deplibs="$deplib $deplibs"
+ test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+ fi
+ continue
+ else # deplib is a libtool library
+ # If $allow_libtool_libs_with_static_runtimes && $deplib is a stdlib,
+ # We need to do some special things here, and not later.
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $deplib "*)
+ if (${SED} -e '2q' $lib |
+ grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ library_names=
+ old_library=
+ case $lib in
+ */* | *\\*) . $lib ;;
+ *) . ./$lib ;;
+ esac
+ for l in $old_library $library_names; do
+ ll="$l"
+ done
+ if test "X$ll" = "X$old_library" ; then # only static version available
+ found=no
+ ladir=`$echo "X$lib" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$ladir" = "X$lib" && ladir="."
+ lib=$ladir/$old_library
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ deplibs="$deplib $deplibs"
+ test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+ fi
+ continue
+ fi
+ fi
+ ;;
+ *) ;;
+ esac
+ fi
+ fi
+ ;; # -l
+ -L*)
+ case $linkmode in
+ lib)
+ deplibs="$deplib $deplibs"
+ test "$pass" = conv && continue
+ newdependency_libs="$deplib $newdependency_libs"
+ newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'`
+ ;;
+ prog)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ continue
+ fi
+ if test "$pass" = scan; then
+ deplibs="$deplib $deplibs"
+ else
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ fi
+ newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'`
+ ;;
+ *)
+ $echo "$modename: warning: \`-L' is ignored for archives/objects" 1>&2
+ ;;
+ esac # linkmode
+ continue
+ ;; # -L
+ -R*)
+ if test "$pass" = link; then
+ dir=`$echo "X$deplib" | $Xsed -e 's/^-R//'`
+ # Make sure the xrpath contains only unique directories.
+ case "$xrpath " in
+ *" $dir "*) ;;
+ *) xrpath="$xrpath $dir" ;;
+ esac
+ fi
+ deplibs="$deplib $deplibs"
+ continue
+ ;;
+ *.la) lib="$deplib" ;;
+ *.$libext)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ continue
+ fi
+ case $linkmode in
+ lib)
+ valid_a_lib=no
+ case $deplibs_check_method in
+ match_pattern*)
+ set dummy $deplibs_check_method
+ match_pattern_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"`
+ if eval $echo \"$deplib\" 2>/dev/null \
+ | $SED 10q \
+ | $EGREP "$match_pattern_regex" > /dev/null; then
+ valid_a_lib=yes
+ fi
+ ;;
+ pass_all)
+ valid_a_lib=yes
+ ;;
+ esac
+ if test "$valid_a_lib" != yes; then
+ $echo
+ $echo "*** Warning: Trying to link with static lib archive $deplib."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which you do not appear to have"
+ $echo "*** because the file extensions .$libext of this argument makes me believe"
+ $echo "*** that it is just a static archive that I should not used here."
+ else
+ $echo
+ $echo "*** Warning: Linking the shared library $output against the"
+ $echo "*** static library $deplib is not portable!"
+ deplibs="$deplib $deplibs"
+ fi
+ continue
+ ;;
+ prog)
+ if test "$pass" != link; then
+ deplibs="$deplib $deplibs"
+ else
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ fi
+ continue
+ ;;
+ esac # linkmode
+ ;; # *.$libext
+ *.lo | *.$objext)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ elif test "$linkmode" = prog; then
+ if test "$pass" = dlpreopen || test "$dlopen_support" != yes || test "$build_libtool_libs" = no; then
+ # If there is no dlopen support or we're linking statically,
+ # we need to preload.
+ newdlprefiles="$newdlprefiles $deplib"
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ newdlfiles="$newdlfiles $deplib"
+ fi
+ fi
+ continue
+ ;;
+ %DEPLIBS%)
+ alldeplibs=yes
+ continue
+ ;;
+ esac # case $deplib
+ if test "$found" = yes || test -f "$lib"; then :
+ else
+ $echo "$modename: cannot find the library \`$lib' or unhandled argument \`$deplib'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Check to see that this really is a libtool archive.
+ if (${SED} -e '2q' $lib | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ ladir=`$echo "X$lib" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$ladir" = "X$lib" && ladir="."
+
+ dlname=
+ dlopen=
+ dlpreopen=
+ libdir=
+ library_names=
+ old_library=
+ # If the library was installed with an old release of libtool,
+ # it will not redefine variables installed, or shouldnotlink
+ installed=yes
+ shouldnotlink=no
+ avoidtemprpath=
+
+
+ # Read the .la file
+ case $lib in
+ */* | *\\*) . $lib ;;
+ *) . ./$lib ;;
+ esac
+
+ if test "$linkmode,$pass" = "lib,link" ||
+ test "$linkmode,$pass" = "prog,scan" ||
+ { test "$linkmode" != prog && test "$linkmode" != lib; }; then
+ test -n "$dlopen" && dlfiles="$dlfiles $dlopen"
+ test -n "$dlpreopen" && dlprefiles="$dlprefiles $dlpreopen"
+ fi
+
+ if test "$pass" = conv; then
+ # Only check for convenience libraries
+ deplibs="$lib $deplibs"
+ if test -z "$libdir"; then
+ if test -z "$old_library"; then
+ $echo "$modename: cannot find name of link library for \`$lib'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ # It is a libtool convenience library, so add in its objects.
+ convenience="$convenience $ladir/$objdir/$old_library"
+ old_convenience="$old_convenience $ladir/$objdir/$old_library"
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ deplibs="$deplib $deplibs"
+ if test "X$duplicate_deps" = "Xyes" ; then
+ case "$tmp_libs " in
+ *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;;
+ esac
+ fi
+ tmp_libs="$tmp_libs $deplib"
+ done
+ elif test "$linkmode" != prog && test "$linkmode" != lib; then
+ $echo "$modename: \`$lib' is not a convenience library" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ continue
+ fi # $pass = conv
+
+
+ # Get the name of the library we link against.
+ linklib=
+ for l in $old_library $library_names; do
+ linklib="$l"
+ done
+ if test -z "$linklib"; then
+ $echo "$modename: cannot find name of link library for \`$lib'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # This library was specified with -dlopen.
+ if test "$pass" = dlopen; then
+ if test -z "$libdir"; then
+ $echo "$modename: cannot -dlopen a convenience library: \`$lib'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ if test -z "$dlname" ||
+ test "$dlopen_support" != yes ||
+ test "$build_libtool_libs" = no; then
+ # If there is no dlname, no dlopen support or we're linking
+ # statically, we need to preload. We also need to preload any
+ # dependent libraries so libltdl's deplib preloader doesn't
+ # bomb out in the load deplibs phase.
+ dlprefiles="$dlprefiles $lib $dependency_libs"
+ else
+ newdlfiles="$newdlfiles $lib"
+ fi
+ continue
+ fi # $pass = dlopen
+
+ # We need an absolute path.
+ case $ladir in
+ [\\/]* | [A-Za-z]:[\\/]*) abs_ladir="$ladir" ;;
+ *)
+ abs_ladir=`cd "$ladir" && pwd`
+ if test -z "$abs_ladir"; then
+ $echo "$modename: warning: cannot determine absolute directory name of \`$ladir'" 1>&2
+ $echo "$modename: passing it literally to the linker, although it might fail" 1>&2
+ abs_ladir="$ladir"
+ fi
+ ;;
+ esac
+ laname=`$echo "X$lib" | $Xsed -e 's%^.*/%%'`
+
+ # Find the relevant object directory and library name.
+ if test "X$installed" = Xyes; then
+ if test ! -f "$libdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+ $echo "$modename: warning: library \`$lib' was moved." 1>&2
+ dir="$ladir"
+ absdir="$abs_ladir"
+ libdir="$abs_ladir"
+ else
+ dir="$libdir"
+ absdir="$libdir"
+ fi
+ test "X$hardcode_automatic" = Xyes && avoidtemprpath=yes
+ else
+ if test ! -f "$ladir/$objdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+ dir="$ladir"
+ absdir="$abs_ladir"
+ # Remove this search path later
+ notinst_path="$notinst_path $abs_ladir"
+ else
+ dir="$ladir/$objdir"
+ absdir="$abs_ladir/$objdir"
+ # Remove this search path later
+ notinst_path="$notinst_path $abs_ladir"
+ fi
+ fi # $installed = yes
+ name=`$echo "X$laname" | $Xsed -e 's/\.la$//' -e 's/^lib//'`
+
+ # This library was specified with -dlpreopen.
+ if test "$pass" = dlpreopen; then
+ if test -z "$libdir"; then
+ $echo "$modename: cannot -dlpreopen a convenience library: \`$lib'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ # Prefer using a static library (so that no silly _DYNAMIC symbols
+ # are required to link).
+ if test -n "$old_library"; then
+ newdlprefiles="$newdlprefiles $dir/$old_library"
+ # Otherwise, use the dlname, so that lt_dlopen finds it.
+ elif test -n "$dlname"; then
+ newdlprefiles="$newdlprefiles $dir/$dlname"
+ else
+ newdlprefiles="$newdlprefiles $dir/$linklib"
+ fi
+ fi # $pass = dlpreopen
+
+ if test -z "$libdir"; then
+ # Link the convenience library
+ if test "$linkmode" = lib; then
+ deplibs="$dir/$old_library $deplibs"
+ elif test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$dir/$old_library $compile_deplibs"
+ finalize_deplibs="$dir/$old_library $finalize_deplibs"
+ else
+ deplibs="$lib $deplibs" # used for prog,scan pass
+ fi
+ continue
+ fi
+
+
+ if test "$linkmode" = prog && test "$pass" != link; then
+ newlib_search_path="$newlib_search_path $ladir"
+ deplibs="$lib $deplibs"
+
+ linkalldeplibs=no
+ if test "$link_all_deplibs" != no || test -z "$library_names" ||
+ test "$build_libtool_libs" = no; then
+ linkalldeplibs=yes
+ fi
+
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ case $deplib in
+ -L*) newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'`;; ### testsuite: skip nested quoting test
+ esac
+ # Need to link against all dependency_libs?
+ if test "$linkalldeplibs" = yes; then
+ deplibs="$deplib $deplibs"
+ else
+ # Need to hardcode shared library paths
+ # or/and link against static libraries
+ newdependency_libs="$deplib $newdependency_libs"
+ fi
+ if test "X$duplicate_deps" = "Xyes" ; then
+ case "$tmp_libs " in
+ *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;;
+ esac
+ fi
+ tmp_libs="$tmp_libs $deplib"
+ done # for deplib
+ continue
+ fi # $linkmode = prog...
+
+ if test "$linkmode,$pass" = "prog,link"; then
+ if test -n "$library_names" &&
+ { { test "$prefer_static_libs" = no ||
+ test "$prefer_static_libs,$installed" = "built,yes"; } ||
+ test -z "$old_library"; }; then
+ # We need to hardcode the library path
+ if test -n "$shlibpath_var" && test -z "$avoidtemprpath" ; then
+ # Make sure the rpath contains only unique directories.
+ case "$temp_rpath " in
+ *" $dir "*) ;;
+ *" $absdir "*) ;;
+ *) temp_rpath="$temp_rpath $absdir" ;;
+ esac
+ fi
+
+ # Hardcode the library path.
+ # Skip directories that are in the system default run-time
+ # search path.
+ case " $sys_lib_dlsearch_path " in
+ *" $absdir "*) ;;
+ *)
+ case "$compile_rpath " in
+ *" $absdir "*) ;;
+ *) compile_rpath="$compile_rpath $absdir"
+ esac
+ ;;
+ esac
+ case " $sys_lib_dlsearch_path " in
+ *" $libdir "*) ;;
+ *)
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) finalize_rpath="$finalize_rpath $libdir"
+ esac
+ ;;
+ esac
+ fi # $linkmode,$pass = prog,link...
+
+ if test "$alldeplibs" = yes &&
+ { test "$deplibs_check_method" = pass_all ||
+ { test "$build_libtool_libs" = yes &&
+ test -n "$library_names"; }; }; then
+ # We only need to search for static libraries
+ continue
+ fi
+ fi
+
+ link_static=no # Whether the deplib will be linked statically
+ use_static_libs=$prefer_static_libs
+ if test "$use_static_libs" = built && test "$installed" = yes ; then
+ use_static_libs=no
+ fi
+ if test -n "$library_names" &&
+ { test "$use_static_libs" = no || test -z "$old_library"; }; then
+ if test "$installed" = no; then
+ notinst_deplibs="$notinst_deplibs $lib"
+ need_relink=yes
+ fi
+ # This is a shared library
+
+ # Warn about portability, can't link against -module's on
+ # some systems (darwin)
+ if test "$shouldnotlink" = yes && test "$pass" = link ; then
+ $echo
+ if test "$linkmode" = prog; then
+ $echo "*** Warning: Linking the executable $output against the loadable module"
+ else
+ $echo "*** Warning: Linking the shared library $output against the loadable module"
+ fi
+ $echo "*** $linklib is not portable!"
+ fi
+ if test "$linkmode" = lib &&
+ test "$hardcode_into_libs" = yes; then
+ # Hardcode the library path.
+ # Skip directories that are in the system default run-time
+ # search path.
+ case " $sys_lib_dlsearch_path " in
+ *" $absdir "*) ;;
+ *)
+ case "$compile_rpath " in
+ *" $absdir "*) ;;
+ *) compile_rpath="$compile_rpath $absdir"
+ esac
+ ;;
+ esac
+ case " $sys_lib_dlsearch_path " in
+ *" $libdir "*) ;;
+ *)
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) finalize_rpath="$finalize_rpath $libdir"
+ esac
+ ;;
+ esac
+ fi
+
+ if test -n "$old_archive_from_expsyms_cmds"; then
+ # figure out the soname
+ set dummy $library_names
+ realname="$2"
+ shift; shift
+ libname=`eval \\$echo \"$libname_spec\"`
+ # use dlname if we got it. it's perfectly good, no?
+ if test -n "$dlname"; then
+ soname="$dlname"
+ elif test -n "$soname_spec"; then
+ # bleh windows
+ case $host in
+ *cygwin* | mingw*)
+ major=`expr $current - $age`
+ versuffix="-$major"
+ ;;
+ esac
+ eval soname=\"$soname_spec\"
+ else
+ soname="$realname"
+ fi
+
+ # Make a new name for the extract_expsyms_cmds to use
+ soroot="$soname"
+ soname=`$echo $soroot | ${SED} -e 's/^.*\///'`
+ newlib="libimp-`$echo $soname | ${SED} 's/^lib//;s/\.dll$//'`.a"
+
+ # If the library has no export list, then create one now
+ if test -f "$output_objdir/$soname-def"; then :
+ else
+ $show "extracting exported symbol list from \`$soname'"
+ save_ifs="$IFS"; IFS='~'
+ cmds=$extract_expsyms_cmds
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ fi
+
+ # Create $newlib
+ if test -f "$output_objdir/$newlib"; then :; else
+ $show "generating import library for \`$soname'"
+ save_ifs="$IFS"; IFS='~'
+ cmds=$old_archive_from_expsyms_cmds
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ fi
+ # make sure the library variables are pointing to the new library
+ dir=$output_objdir
+ linklib=$newlib
+ fi # test -n "$old_archive_from_expsyms_cmds"
+
+ if test "$linkmode" = prog || test "$mode" != relink; then
+ add_shlibpath=
+ add_dir=
+ add=
+ lib_linked=yes
+ case $hardcode_action in
+ immediate | unsupported)
+ if test "$hardcode_direct" = no; then
+ add="$dir/$linklib"
+ case $host in
+ *-*-sco3.2v5.0.[024]*) add_dir="-L$dir" ;;
+ *-*-sysv4*uw2*) add_dir="-L$dir" ;;
+ *-*-sysv5OpenUNIX* | *-*-sysv5UnixWare7.[01].[10]* | \
+ *-*-unixware7*) add_dir="-L$dir" ;;
+ *-*-darwin* )
+ # if the lib is a module then we can not link against
+ # it, someone is ignoring the new warnings I added
+ if /usr/bin/file -L $add 2> /dev/null |
+ $EGREP ": [^:]* bundle" >/dev/null ; then
+ $echo "** Warning, lib $linklib is a module, not a shared library"
+ if test -z "$old_library" ; then
+ $echo
+ $echo "** And there doesn't seem to be a static archive available"
+ $echo "** The link will probably fail, sorry"
+ else
+ add="$dir/$old_library"
+ fi
+ fi
+ esac
+ elif test "$hardcode_minus_L" = no; then
+ case $host in
+ *-*-sunos*) add_shlibpath="$dir" ;;
+ esac
+ add_dir="-L$dir"
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = no; then
+ add_shlibpath="$dir"
+ add="-l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+ relink)
+ if test "$hardcode_direct" = yes; then
+ add="$dir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ add_dir="-L$dir"
+ # Try looking first in the location we're being installed to.
+ if test -n "$inst_prefix_dir"; then
+ case $libdir in
+ [\\/]*)
+ add_dir="$add_dir -L$inst_prefix_dir$libdir"
+ ;;
+ esac
+ fi
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ add_shlibpath="$dir"
+ add="-l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+ *) lib_linked=no ;;
+ esac
+
+ if test "$lib_linked" != yes; then
+ $echo "$modename: configuration error: unsupported hardcode properties"
+ exit $EXIT_FAILURE
+ fi
+
+ if test -n "$add_shlibpath"; then
+ case :$compile_shlibpath: in
+ *":$add_shlibpath:"*) ;;
+ *) compile_shlibpath="$compile_shlibpath$add_shlibpath:" ;;
+ esac
+ fi
+ if test "$linkmode" = prog; then
+ test -n "$add_dir" && compile_deplibs="$add_dir $compile_deplibs"
+ test -n "$add" && compile_deplibs="$add $compile_deplibs"
+ else
+ test -n "$add_dir" && deplibs="$add_dir $deplibs"
+ test -n "$add" && deplibs="$add $deplibs"
+ if test "$hardcode_direct" != yes && \
+ test "$hardcode_minus_L" != yes && \
+ test "$hardcode_shlibpath_var" = yes; then
+ case :$finalize_shlibpath: in
+ *":$libdir:"*) ;;
+ *) finalize_shlibpath="$finalize_shlibpath$libdir:" ;;
+ esac
+ fi
+ fi
+ fi
+
+ if test "$linkmode" = prog || test "$mode" = relink; then
+ add_shlibpath=
+ add_dir=
+ add=
+ # Finalize command for both is simple: just hardcode it.
+ if test "$hardcode_direct" = yes; then
+ add="$libdir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ add_dir="-L$libdir"
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ case :$finalize_shlibpath: in
+ *":$libdir:"*) ;;
+ *) finalize_shlibpath="$finalize_shlibpath$libdir:" ;;
+ esac
+ add="-l$name"
+ elif test "$hardcode_automatic" = yes; then
+ if test -n "$inst_prefix_dir" &&
+ test -f "$inst_prefix_dir$libdir/$linklib" ; then
+ add="$inst_prefix_dir$libdir/$linklib"
+ else
+ add="$libdir/$linklib"
+ fi
+ else
+ # We cannot seem to hardcode it, guess we'll fake it.
+ add_dir="-L$libdir"
+ # Try looking first in the location we're being installed to.
+ if test -n "$inst_prefix_dir"; then
+ case $libdir in
+ [\\/]*)
+ add_dir="$add_dir -L$inst_prefix_dir$libdir"
+ ;;
+ esac
+ fi
+ add="-l$name"
+ fi
+
+ if test "$linkmode" = prog; then
+ test -n "$add_dir" && finalize_deplibs="$add_dir $finalize_deplibs"
+ test -n "$add" && finalize_deplibs="$add $finalize_deplibs"
+ else
+ test -n "$add_dir" && deplibs="$add_dir $deplibs"
+ test -n "$add" && deplibs="$add $deplibs"
+ fi
+ fi
+ elif test "$linkmode" = prog; then
+ # Here we assume that one of hardcode_direct or hardcode_minus_L
+ # is not unsupported. This is valid on all known static and
+ # shared platforms.
+ if test "$hardcode_direct" != unsupported; then
+ test -n "$old_library" && linklib="$old_library"
+ compile_deplibs="$dir/$linklib $compile_deplibs"
+ finalize_deplibs="$dir/$linklib $finalize_deplibs"
+ else
+ compile_deplibs="-l$name -L$dir $compile_deplibs"
+ finalize_deplibs="-l$name -L$dir $finalize_deplibs"
+ fi
+ elif test "$build_libtool_libs" = yes; then
+ # Not a shared library
+ if test "$deplibs_check_method" != pass_all; then
+ # We're trying link a shared library against a static one
+ # but the system doesn't support it.
+
+ # Just print a warning and add the library to dependency_libs so
+ # that the program can be linked against the static library.
+ $echo
+ $echo "*** Warning: This system can not link to static lib archive $lib."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which you do not appear to have."
+ if test "$module" = yes; then
+ $echo "*** But as you try to build a module library, libtool will still create "
+ $echo "*** a static module, that should work as long as the dlopening application"
+ $echo "*** is linked with the -dlopen flag to resolve symbols at runtime."
+ if test -z "$global_symbol_pipe"; then
+ $echo
+ $echo "*** However, this would only work if libtool was able to extract symbol"
+ $echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+ $echo "*** not find such a program. So, this module is probably useless."
+ $echo "*** \`nm' from GNU binutils and a full rebuild may help."
+ fi
+ if test "$build_old_libs" = no; then
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ fi
+ else
+ deplibs="$dir/$old_library $deplibs"
+ link_static=yes
+ fi
+ fi # link shared/static library?
+
+ if test "$linkmode" = lib; then
+ if test -n "$dependency_libs" &&
+ { test "$hardcode_into_libs" != yes ||
+ test "$build_old_libs" = yes ||
+ test "$link_static" = yes; }; then
+ # Extract -R from dependency_libs
+ temp_deplibs=
+ for libdir in $dependency_libs; do
+ case $libdir in
+ -R*) temp_xrpath=`$echo "X$libdir" | $Xsed -e 's/^-R//'`
+ case " $xrpath " in
+ *" $temp_xrpath "*) ;;
+ *) xrpath="$xrpath $temp_xrpath";;
+ esac;;
+ *) temp_deplibs="$temp_deplibs $libdir";;
+ esac
+ done
+ dependency_libs="$temp_deplibs"
+ fi
+
+ newlib_search_path="$newlib_search_path $absdir"
+ # Link against this library
+ test "$link_static" = no && newdependency_libs="$abs_ladir/$laname $newdependency_libs"
+ # ... and its dependency_libs
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ newdependency_libs="$deplib $newdependency_libs"
+ if test "X$duplicate_deps" = "Xyes" ; then
+ case "$tmp_libs " in
+ *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;;
+ esac
+ fi
+ tmp_libs="$tmp_libs $deplib"
+ done
+
+ if test "$link_all_deplibs" != no; then
+ # Add the search paths of all dependency libraries
+ for deplib in $dependency_libs; do
+ case $deplib in
+ -L*) path="$deplib" ;;
+ *.la)
+ dir=`$echo "X$deplib" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$deplib" && dir="."
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) absdir="$dir" ;;
+ *)
+ absdir=`cd "$dir" && pwd`
+ if test -z "$absdir"; then
+ $echo "$modename: warning: cannot determine absolute directory name of \`$dir'" 1>&2
+ absdir="$dir"
+ fi
+ ;;
+ esac
+ if grep "^installed=no" $deplib > /dev/null; then
+ path="$absdir/$objdir"
+ else
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib`
+ if test -z "$libdir"; then
+ $echo "$modename: \`$deplib' is not a valid libtool archive" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ if test "$absdir" != "$libdir"; then
+ $echo "$modename: warning: \`$deplib' seems to be moved" 1>&2
+ fi
+ path="$absdir"
+ fi
+ depdepl=
+ case $host in
+ *-*-darwin*)
+ # we do not want to link against static libs,
+ # but need to link against shared
+ eval deplibrary_names=`${SED} -n -e 's/^library_names=\(.*\)$/\1/p' $deplib`
+ if test -n "$deplibrary_names" ; then
+ for tmp in $deplibrary_names ; do
+ depdepl=$tmp
+ done
+ if test -f "$path/$depdepl" ; then
+ depdepl="$path/$depdepl"
+ fi
+ # do not add paths which are already there
+ case " $newlib_search_path " in
+ *" $path "*) ;;
+ *) newlib_search_path="$newlib_search_path $path";;
+ esac
+ fi
+ path=""
+ ;;
+ *)
+ path="-L$path"
+ ;;
+ esac
+ ;;
+ -l*)
+ case $host in
+ *-*-darwin*)
+ # Again, we only want to link against shared libraries
+ eval tmp_libs=`$echo "X$deplib" | $Xsed -e "s,^\-l,,"`
+ for tmp in $newlib_search_path ; do
+ if test -f "$tmp/lib$tmp_libs.dylib" ; then
+ eval depdepl="$tmp/lib$tmp_libs.dylib"
+ break
+ fi
+ done
+ path=""
+ ;;
+ *) continue ;;
+ esac
+ ;;
+ *) continue ;;
+ esac
+ case " $deplibs " in
+ *" $path "*) ;;
+ *) deplibs="$path $deplibs" ;;
+ esac
+ case " $deplibs " in
+ *" $depdepl "*) ;;
+ *) deplibs="$depdepl $deplibs" ;;
+ esac
+ done
+ fi # link_all_deplibs != no
+ fi # linkmode = lib
+ done # for deplib in $libs
+ dependency_libs="$newdependency_libs"
+ if test "$pass" = dlpreopen; then
+ # Link the dlpreopened libraries before other libraries
+ for deplib in $save_deplibs; do
+ deplibs="$deplib $deplibs"
+ done
+ fi
+ if test "$pass" != dlopen; then
+ if test "$pass" != conv; then
+ # Make sure lib_search_path contains only unique directories.
+ lib_search_path=
+ for dir in $newlib_search_path; do
+ case "$lib_search_path " in
+ *" $dir "*) ;;
+ *) lib_search_path="$lib_search_path $dir" ;;
+ esac
+ done
+ newlib_search_path=
+ fi
+
+ if test "$linkmode,$pass" != "prog,link"; then
+ vars="deplibs"
+ else
+ vars="compile_deplibs finalize_deplibs"
+ fi
+ for var in $vars dependency_libs; do
+ # Add libraries to $var in reverse order
+ eval tmp_libs=\"\$$var\"
+ new_libs=
+ for deplib in $tmp_libs; do
+ # FIXME: Pedantically, this is the right thing to do, so
+ # that some nasty dependency loop isn't accidentally
+ # broken:
+ #new_libs="$deplib $new_libs"
+ # Pragmatically, this seems to cause very few problems in
+ # practice:
+ case $deplib in
+ -L*) new_libs="$deplib $new_libs" ;;
+ -R*) ;;
+ *)
+ # And here is the reason: when a library appears more
+ # than once as an explicit dependence of a library, or
+ # is implicitly linked in more than once by the
+ # compiler, it is considered special, and multiple
+ # occurrences thereof are not removed. Compare this
+ # with having the same library being listed as a
+ # dependency of multiple other libraries: in this case,
+ # we know (pedantically, we assume) the library does not
+ # need to be listed more than once, so we keep only the
+ # last copy. This is not always right, but it is rare
+ # enough that we require users that really mean to play
+ # such unportable linking tricks to link the library
+ # using -Wl,-lname, so that libtool does not consider it
+ # for duplicate removal.
+ case " $specialdeplibs " in
+ *" $deplib "*) new_libs="$deplib $new_libs" ;;
+ *)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) new_libs="$deplib $new_libs" ;;
+ esac
+ ;;
+ esac
+ ;;
+ esac
+ done
+ tmp_libs=
+ for deplib in $new_libs; do
+ case $deplib in
+ -L*)
+ case " $tmp_libs " in
+ *" $deplib "*) ;;
+ *) tmp_libs="$tmp_libs $deplib" ;;
+ esac
+ ;;
+ *) tmp_libs="$tmp_libs $deplib" ;;
+ esac
+ done
+ eval $var=\"$tmp_libs\"
+ done # for var
+ fi
+ # Last step: remove runtime libs from dependency_libs
+ # (they stay in deplibs)
+ tmp_libs=
+ for i in $dependency_libs ; do
+ case " $predeps $postdeps $compiler_lib_search_path " in
+ *" $i "*)
+ i=""
+ ;;
+ esac
+ if test -n "$i" ; then
+ tmp_libs="$tmp_libs $i"
+ fi
+ done
+ dependency_libs=$tmp_libs
+ done # for pass
+ if test "$linkmode" = prog; then
+ dlfiles="$newdlfiles"
+ dlprefiles="$newdlprefiles"
+ fi
+
+ case $linkmode in
+ oldlib)
+ if test -n "$deplibs"; then
+ $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2
+ fi
+
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$rpath"; then
+ $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$xrpath"; then
+ $echo "$modename: warning: \`-R' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info/-version-number' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$export_symbols" || test -n "$export_symbols_regex"; then
+ $echo "$modename: warning: \`-export-symbols' is ignored for archives" 1>&2
+ fi
+
+ # Now set the variables for building old libraries.
+ build_libtool_libs=no
+ oldlibs="$output"
+ objs="$objs$old_deplibs"
+ ;;
+
+ lib)
+ # Make sure we only generate libraries of the form `libNAME.la'.
+ case $outputname in
+ lib*)
+ name=`$echo "X$outputname" | $Xsed -e 's/\.la$//' -e 's/^lib//'`
+ eval shared_ext=\"$shrext_cmds\"
+ eval libname=\"$libname_spec\"
+ ;;
+ *)
+ if test "$module" = no; then
+ $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ if test "$need_lib_prefix" != no; then
+ # Add the "lib" prefix for modules if required
+ name=`$echo "X$outputname" | $Xsed -e 's/\.la$//'`
+ eval shared_ext=\"$shrext_cmds\"
+ eval libname=\"$libname_spec\"
+ else
+ libname=`$echo "X$outputname" | $Xsed -e 's/\.la$//'`
+ fi
+ ;;
+ esac
+
+ if test -n "$objs"; then
+ if test "$deplibs_check_method" != pass_all; then
+ $echo "$modename: cannot build libtool library \`$output' from non-libtool objects on this host:$objs" 2>&1
+ exit $EXIT_FAILURE
+ else
+ $echo
+ $echo "*** Warning: Linking the shared library $output against the non-libtool"
+ $echo "*** objects $objs is not portable!"
+ libobjs="$libobjs $objs"
+ fi
+ fi
+
+ if test "$dlself" != no; then
+ $echo "$modename: warning: \`-dlopen self' is ignored for libtool libraries" 1>&2
+ fi
+
+ set dummy $rpath
+ if test "$#" -gt 2; then
+ $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2
+ fi
+ install_libdir="$2"
+
+ oldlibs=
+ if test -z "$rpath"; then
+ if test "$build_libtool_libs" = yes; then
+ # Building a libtool convenience library.
+ # Some compilers have problems with a `.al' extension so
+ # convenience libraries should have the same extension an
+ # archive normally would.
+ oldlibs="$output_objdir/$libname.$libext $oldlibs"
+ build_libtool_libs=convenience
+ build_old_libs=yes
+ fi
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info/-version-number' is ignored for convenience libraries" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2
+ fi
+ else
+
+ # Parse the version information argument.
+ save_ifs="$IFS"; IFS=':'
+ set dummy $vinfo 0 0 0
+ IFS="$save_ifs"
+
+ if test -n "$8"; then
+ $echo "$modename: too many parameters to \`-version-info'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # convert absolute version numbers to libtool ages
+ # this retains compatibility with .la files and attempts
+ # to make the code below a bit more comprehensible
+
+ case $vinfo_number in
+ yes)
+ number_major="$2"
+ number_minor="$3"
+ number_revision="$4"
+ #
+ # There are really only two kinds -- those that
+ # use the current revision as the major version
+ # and those that subtract age and use age as
+ # a minor version. But, then there is irix
+ # which has an extra 1 added just for fun
+ #
+ case $version_type in
+ darwin|linux|osf|windows|none)
+ current=`expr $number_major + $number_minor`
+ age="$number_minor"
+ revision="$number_revision"
+ ;;
+ freebsd-aout|freebsd-elf|sunos)
+ current="$number_major"
+ revision="$number_minor"
+ age="0"
+ ;;
+ irix|nonstopux)
+ current=`expr $number_major + $number_minor - 1`
+ age="$number_minor"
+ revision="$number_minor"
+ ;;
+ esac
+ ;;
+ no)
+ current="$2"
+ revision="$3"
+ age="$4"
+ ;;
+ esac
+
+ # Check that each of the things are valid numbers.
+ case $current in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ $echo "$modename: CURRENT \`$current' must be a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ case $revision in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ $echo "$modename: REVISION \`$revision' must be a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ case $age in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ $echo "$modename: AGE \`$age' must be a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ if test "$age" -gt "$current"; then
+ $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Calculate the version variables.
+ major=
+ versuffix=
+ verstring=
+ case $version_type in
+ none) ;;
+
+ darwin)
+ # Like Linux, but with the current version available in
+ # verstring for coding it into the library header
+ major=.`expr $current - $age`
+ versuffix="$major.$age.$revision"
+ # Darwin ld doesn't like 0 for these options...
+ minor_current=`expr $current + 1`
+ verstring="${wl}-compatibility_version ${wl}$minor_current ${wl}-current_version ${wl}$minor_current.$revision"
+ ;;
+
+ freebsd-aout)
+ major=".$current"
+ versuffix=".$current.$revision";
+ ;;
+
+ freebsd-elf)
+ major=".$current"
+ versuffix=".$current";
+ ;;
+
+ irix | nonstopux)
+ major=`expr $current - $age + 1`
+
+ case $version_type in
+ nonstopux) verstring_prefix=nonstopux ;;
+ *) verstring_prefix=sgi ;;
+ esac
+ verstring="$verstring_prefix$major.$revision"
+
+ # Add in all the interfaces that we are compatible with.
+ loop=$revision
+ while test "$loop" -ne 0; do
+ iface=`expr $revision - $loop`
+ loop=`expr $loop - 1`
+ verstring="$verstring_prefix$major.$iface:$verstring"
+ done
+
+ # Before this point, $major must not contain `.'.
+ major=.$major
+ versuffix="$major.$revision"
+ ;;
+
+ linux)
+ major=.`expr $current - $age`
+ versuffix="$major.$age.$revision"
+ ;;
+
+ osf)
+ major=.`expr $current - $age`
+ versuffix=".$current.$age.$revision"
+ verstring="$current.$age.$revision"
+
+ # Add in all the interfaces that we are compatible with.
+ loop=$age
+ while test "$loop" -ne 0; do
+ iface=`expr $current - $loop`
+ loop=`expr $loop - 1`
+ verstring="$verstring:${iface}.0"
+ done
+
+ # Make executables depend on our current version.
+ verstring="$verstring:${current}.0"
+ ;;
+
+ sunos)
+ major=".$current"
+ versuffix=".$current.$revision"
+ ;;
+
+ windows)
+ # Use '-' rather than '.', since we only want one
+ # extension on DOS 8.3 filesystems.
+ major=`expr $current - $age`
+ versuffix="-$major"
+ ;;
+
+ *)
+ $echo "$modename: unknown library version type \`$version_type'" 1>&2
+ $echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ # Clear the version info if we defaulted, and they specified a release.
+ if test -z "$vinfo" && test -n "$release"; then
+ major=
+ case $version_type in
+ darwin)
+ # we can't check for "0.0" in archive_cmds due to quoting
+ # problems, so we reset it completely
+ verstring=
+ ;;
+ *)
+ verstring="0.0"
+ ;;
+ esac
+ if test "$need_version" = no; then
+ versuffix=
+ else
+ versuffix=".0.0"
+ fi
+ fi
+
+ # Remove version info from name if versioning should be avoided
+ if test "$avoid_version" = yes && test "$need_version" = no; then
+ major=
+ versuffix=
+ verstring=""
+ fi
+
+ # Check to see if the archive will have undefined symbols.
+ if test "$allow_undefined" = yes; then
+ if test "$allow_undefined_flag" = unsupported; then
+ $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2
+ build_libtool_libs=no
+ build_old_libs=yes
+ fi
+ else
+ # Don't allow undefined symbols.
+ allow_undefined_flag="$no_undefined_flag"
+ fi
+ fi
+
+ if test "$mode" != relink; then
+ # Remove our outputs, but don't remove object files since they
+ # may have been created when compiling PIC objects.
+ removelist=
+ tempremovelist=`$echo "$output_objdir/*"`
+ for p in $tempremovelist; do
+ case $p in
+ *.$objext)
+ ;;
+ $output_objdir/$outputname | $output_objdir/$libname.* | $output_objdir/${libname}${release}.*)
+ if test "X$precious_files_regex" != "X"; then
+ if echo $p | $EGREP -e "$precious_files_regex" >/dev/null 2>&1
+ then
+ continue
+ fi
+ fi
+ removelist="$removelist $p"
+ ;;
+ *) ;;
+ esac
+ done
+ if test -n "$removelist"; then
+ $show "${rm}r $removelist"
+ $run ${rm}r $removelist
+ fi
+ fi
+
+ # Now set the variables for building old libraries.
+ if test "$build_old_libs" = yes && test "$build_libtool_libs" != convenience ; then
+ oldlibs="$oldlibs $output_objdir/$libname.$libext"
+
+ # Transform .lo files to .o files.
+ oldobjs="$objs "`$echo "X$libobjs" | $SP2NL | $Xsed -e '/\.'${libext}'$/d' -e "$lo2o" | $NL2SP`
+ fi
+
+ # Eliminate all temporary directories.
+# for path in $notinst_path; do
+# lib_search_path=`$echo "$lib_search_path " | ${SED} -e "s% $path % %g"`
+# deplibs=`$echo "$deplibs " | ${SED} -e "s% -L$path % %g"`
+# dependency_libs=`$echo "$dependency_libs " | ${SED} -e "s% -L$path % %g"`
+# done
+
+ if test -n "$xrpath"; then
+ # If the user specified any rpath flags, then add them.
+ temp_xrpath=
+ for libdir in $xrpath; do
+ temp_xrpath="$temp_xrpath -R$libdir"
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) finalize_rpath="$finalize_rpath $libdir" ;;
+ esac
+ done
+ if test "$hardcode_into_libs" != yes || test "$build_old_libs" = yes; then
+ dependency_libs="$temp_xrpath $dependency_libs"
+ fi
+ fi
+
+ # Make sure dlfiles contains only unique files that won't be dlpreopened
+ old_dlfiles="$dlfiles"
+ dlfiles=
+ for lib in $old_dlfiles; do
+ case " $dlprefiles $dlfiles " in
+ *" $lib "*) ;;
+ *) dlfiles="$dlfiles $lib" ;;
+ esac
+ done
+
+ # Make sure dlprefiles contains only unique files
+ old_dlprefiles="$dlprefiles"
+ dlprefiles=
+ for lib in $old_dlprefiles; do
+ case "$dlprefiles " in
+ *" $lib "*) ;;
+ *) dlprefiles="$dlprefiles $lib" ;;
+ esac
+ done
+
+ if test "$build_libtool_libs" = yes; then
+ if test -n "$rpath"; then
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-beos*)
+ # these systems don't actually have a c library (as such)!
+ ;;
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # Rhapsody C library is in the System framework
+ deplibs="$deplibs -framework System"
+ ;;
+ *-*-netbsd*)
+ # Don't link with libc until the a.out ld.so is fixed.
+ ;;
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc due to us having libc/libc_r.
+ ;;
+ *-*-sco3.2v5* | *-*-sco5v6*)
+ # Causes problems with __ctype
+ ;;
+ *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+ # Compiler inserts libc in the correct place for threads to work
+ ;;
+ *)
+ # Add libc to deplibs on all other systems if necessary.
+ if test "$build_libtool_need_lc" = "yes"; then
+ deplibs="$deplibs -lc"
+ fi
+ ;;
+ esac
+ fi
+
+ # Transform deplibs into only deplibs that can be linked in shared.
+ name_save=$name
+ libname_save=$libname
+ release_save=$release
+ versuffix_save=$versuffix
+ major_save=$major
+ # I'm not sure if I'm treating the release correctly. I think
+ # release should show up in the -l (ie -lgmp5) so we don't want to
+ # add it in twice. Is that correct?
+ release=""
+ versuffix=""
+ major=""
+ newdeplibs=
+ droppeddeps=no
+ case $deplibs_check_method in
+ pass_all)
+ # Don't check for shared/static. Everything works.
+ # This might be a little naive. We might want to check
+ # whether the library exists or not. But this is on
+ # osf3 & osf4 and I'm not really sure... Just
+ # implementing what was already the behavior.
+ newdeplibs=$deplibs
+ ;;
+ test_compile)
+ # This code stresses the "libraries are programs" paradigm to its
+ # limits. Maybe even breaks it. We compile a program, linking it
+ # against the deplibs as a proxy for the library. Then we can check
+ # whether they linked in statically or dynamically with ldd.
+ $rm conftest.c
+ cat > conftest.c <<EOF
+ int main() { return 0; }
+EOF
+ $rm conftest
+ if $LTCC $LTCFLAGS -o conftest conftest.c $deplibs; then
+ ldd_output=`ldd conftest`
+ for i in $deplibs; do
+ name=`expr $i : '-l\(.*\)'`
+ # If $name is empty we are operating on a -L argument.
+ if test "$name" != "" && test "$name" != "0"; then
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $i "*)
+ newdeplibs="$newdeplibs $i"
+ i=""
+ ;;
+ esac
+ fi
+ if test -n "$i" ; then
+ libname=`eval \\$echo \"$libname_spec\"`
+ deplib_matches=`eval \\$echo \"$library_names_spec\"`
+ set dummy $deplib_matches
+ deplib_match=$2
+ if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then
+ newdeplibs="$newdeplibs $i"
+ else
+ droppeddeps=yes
+ $echo
+ $echo "*** Warning: dynamic linker does not accept needed library $i."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which I believe you do not have"
+ $echo "*** because a test_compile did reveal that the linker did not use it for"
+ $echo "*** its dynamic dependency list that programs get resolved with at runtime."
+ fi
+ fi
+ else
+ newdeplibs="$newdeplibs $i"
+ fi
+ done
+ else
+ # Error occurred in the first compile. Let's try to salvage
+ # the situation: Compile a separate program for each library.
+ for i in $deplibs; do
+ name=`expr $i : '-l\(.*\)'`
+ # If $name is empty we are operating on a -L argument.
+ if test "$name" != "" && test "$name" != "0"; then
+ $rm conftest
+ if $LTCC $LTCFLAGS -o conftest conftest.c $i; then
+ ldd_output=`ldd conftest`
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $i "*)
+ newdeplibs="$newdeplibs $i"
+ i=""
+ ;;
+ esac
+ fi
+ if test -n "$i" ; then
+ libname=`eval \\$echo \"$libname_spec\"`
+ deplib_matches=`eval \\$echo \"$library_names_spec\"`
+ set dummy $deplib_matches
+ deplib_match=$2
+ if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then
+ newdeplibs="$newdeplibs $i"
+ else
+ droppeddeps=yes
+ $echo
+ $echo "*** Warning: dynamic linker does not accept needed library $i."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which you do not appear to have"
+ $echo "*** because a test_compile did reveal that the linker did not use this one"
+ $echo "*** as a dynamic dependency that programs can get resolved with at runtime."
+ fi
+ fi
+ else
+ droppeddeps=yes
+ $echo
+ $echo "*** Warning! Library $i is needed by this library but I was not able to"
+ $echo "*** make it link in! You will probably need to install it or some"
+ $echo "*** library that it depends on before this library will be fully"
+ $echo "*** functional. Installing it before continuing would be even better."
+ fi
+ else
+ newdeplibs="$newdeplibs $i"
+ fi
+ done
+ fi
+ ;;
+ file_magic*)
+ set dummy $deplibs_check_method
+ file_magic_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"`
+ for a_deplib in $deplibs; do
+ name=`expr $a_deplib : '-l\(.*\)'`
+ # If $name is empty we are operating on a -L argument.
+ if test "$name" != "" && test "$name" != "0"; then
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $a_deplib "*)
+ newdeplibs="$newdeplibs $a_deplib"
+ a_deplib=""
+ ;;
+ esac
+ fi
+ if test -n "$a_deplib" ; then
+ libname=`eval \\$echo \"$libname_spec\"`
+ for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do
+ potential_libs=`ls $i/$libname[.-]* 2>/dev/null`
+ for potent_lib in $potential_libs; do
+ # Follow soft links.
+ if ls -lLd "$potent_lib" 2>/dev/null \
+ | grep " -> " >/dev/null; then
+ continue
+ fi
+ # The statement above tries to avoid entering an
+ # endless loop below, in case of cyclic links.
+ # We might still enter an endless loop, since a link
+ # loop can be closed while we follow links,
+ # but so what?
+ potlib="$potent_lib"
+ while test -h "$potlib" 2>/dev/null; do
+ potliblink=`ls -ld $potlib | ${SED} 's/.* -> //'`
+ case $potliblink in
+ [\\/]* | [A-Za-z]:[\\/]*) potlib="$potliblink";;
+ *) potlib=`$echo "X$potlib" | $Xsed -e 's,[^/]*$,,'`"$potliblink";;
+ esac
+ done
+ if eval $file_magic_cmd \"\$potlib\" 2>/dev/null \
+ | ${SED} 10q \
+ | $EGREP "$file_magic_regex" > /dev/null; then
+ newdeplibs="$newdeplibs $a_deplib"
+ a_deplib=""
+ break 2
+ fi
+ done
+ done
+ fi
+ if test -n "$a_deplib" ; then
+ droppeddeps=yes
+ $echo
+ $echo "*** Warning: linker path does not have real file for library $a_deplib."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which you do not appear to have"
+ $echo "*** because I did check the linker path looking for a file starting"
+ if test -z "$potlib" ; then
+ $echo "*** with $libname but no candidates were found. (...for file magic test)"
+ else
+ $echo "*** with $libname and none of the candidates passed a file format test"
+ $echo "*** using a file magic. Last file checked: $potlib"
+ fi
+ fi
+ else
+ # Add a -L argument.
+ newdeplibs="$newdeplibs $a_deplib"
+ fi
+ done # Gone through all deplibs.
+ ;;
+ match_pattern*)
+ set dummy $deplibs_check_method
+ match_pattern_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"`
+ for a_deplib in $deplibs; do
+ name=`expr $a_deplib : '-l\(.*\)'`
+ # If $name is empty we are operating on a -L argument.
+ if test -n "$name" && test "$name" != "0"; then
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $a_deplib "*)
+ newdeplibs="$newdeplibs $a_deplib"
+ a_deplib=""
+ ;;
+ esac
+ fi
+ if test -n "$a_deplib" ; then
+ libname=`eval \\$echo \"$libname_spec\"`
+ for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do
+ potential_libs=`ls $i/$libname[.-]* 2>/dev/null`
+ for potent_lib in $potential_libs; do
+ potlib="$potent_lib" # see symlink-check above in file_magic test
+ if eval $echo \"$potent_lib\" 2>/dev/null \
+ | ${SED} 10q \
+ | $EGREP "$match_pattern_regex" > /dev/null; then
+ newdeplibs="$newdeplibs $a_deplib"
+ a_deplib=""
+ break 2
+ fi
+ done
+ done
+ fi
+ if test -n "$a_deplib" ; then
+ droppeddeps=yes
+ $echo
+ $echo "*** Warning: linker path does not have real file for library $a_deplib."
+ $echo "*** I have the capability to make that library automatically link in when"
+ $echo "*** you link to this library. But I can only do this if you have a"
+ $echo "*** shared version of the library, which you do not appear to have"
+ $echo "*** because I did check the linker path looking for a file starting"
+ if test -z "$potlib" ; then
+ $echo "*** with $libname but no candidates were found. (...for regex pattern test)"
+ else
+ $echo "*** with $libname and none of the candidates passed a file format test"
+ $echo "*** using a regex pattern. Last file checked: $potlib"
+ fi
+ fi
+ else
+ # Add a -L argument.
+ newdeplibs="$newdeplibs $a_deplib"
+ fi
+ done # Gone through all deplibs.
+ ;;
+ none | unknown | *)
+ newdeplibs=""
+ tmp_deplibs=`$echo "X $deplibs" | $Xsed -e 's/ -lc$//' \
+ -e 's/ -[LR][^ ]*//g'`
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ for i in $predeps $postdeps ; do
+ # can't use Xsed below, because $i might contain '/'
+ tmp_deplibs=`$echo "X $tmp_deplibs" | ${SED} -e "1s,^X,," -e "s,$i,,"`
+ done
+ fi
+ if $echo "X $tmp_deplibs" | $Xsed -e 's/[ ]//g' \
+ | grep . >/dev/null; then
+ $echo
+ if test "X$deplibs_check_method" = "Xnone"; then
+ $echo "*** Warning: inter-library dependencies are not supported in this platform."
+ else
+ $echo "*** Warning: inter-library dependencies are not known to be supported."
+ fi
+ $echo "*** All declared inter-library dependencies are being dropped."
+ droppeddeps=yes
+ fi
+ ;;
+ esac
+ versuffix=$versuffix_save
+ major=$major_save
+ release=$release_save
+ libname=$libname_save
+ name=$name_save
+
+ case $host in
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # On Rhapsody replace the C library is the System framework
+ newdeplibs=`$echo "X $newdeplibs" | $Xsed -e 's/ -lc / -framework System /'`
+ ;;
+ esac
+
+ if test "$droppeddeps" = yes; then
+ if test "$module" = yes; then
+ $echo
+ $echo "*** Warning: libtool could not satisfy all declared inter-library"
+ $echo "*** dependencies of module $libname. Therefore, libtool will create"
+ $echo "*** a static module, that should work as long as the dlopening"
+ $echo "*** application is linked with the -dlopen flag."
+ if test -z "$global_symbol_pipe"; then
+ $echo
+ $echo "*** However, this would only work if libtool was able to extract symbol"
+ $echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+ $echo "*** not find such a program. So, this module is probably useless."
+ $echo "*** \`nm' from GNU binutils and a full rebuild may help."
+ fi
+ if test "$build_old_libs" = no; then
+ oldlibs="$output_objdir/$libname.$libext"
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ else
+ $echo "*** The inter-library dependencies that have been dropped here will be"
+ $echo "*** automatically added whenever a program is linked with this library"
+ $echo "*** or is declared to -dlopen it."
+
+ if test "$allow_undefined" = no; then
+ $echo
+ $echo "*** Since this library must not contain undefined symbols,"
+ $echo "*** because either the platform does not support them or"
+ $echo "*** it was explicitly requested with -no-undefined,"
+ $echo "*** libtool will only create a static version of it."
+ if test "$build_old_libs" = no; then
+ oldlibs="$output_objdir/$libname.$libext"
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ fi
+ fi
+ fi
+ # Done checking deplibs!
+ deplibs=$newdeplibs
+ fi
+
+
+ # move library search paths that coincide with paths to not yet
+ # installed libraries to the beginning of the library search list
+ new_libs=
+ for path in $notinst_path; do
+ case " $new_libs " in
+ *" -L$path/$objdir "*) ;;
+ *)
+ case " $deplibs " in
+ *" -L$path/$objdir "*)
+ new_libs="$new_libs -L$path/$objdir" ;;
+ esac
+ ;;
+ esac
+ done
+ for deplib in $deplibs; do
+ case $deplib in
+ -L*)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) new_libs="$new_libs $deplib" ;;
+ esac
+ ;;
+ *) new_libs="$new_libs $deplib" ;;
+ esac
+ done
+ deplibs="$new_libs"
+
+
+ # All the library-specific variables (install_libdir is set above).
+ library_names=
+ old_library=
+ dlname=
+
+ # Test again, we may have decided not to build it any more
+ if test "$build_libtool_libs" = yes; then
+ if test "$hardcode_into_libs" = yes; then
+ # Hardcode the library paths
+ hardcode_libdirs=
+ dep_rpath=
+ rpath="$finalize_rpath"
+ test "$mode" != relink && rpath="$compile_rpath$rpath"
+ for libdir in $rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ dep_rpath="$dep_rpath $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) perm_rpath="$perm_rpath $libdir" ;;
+ esac
+ fi
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ if test -n "$hardcode_libdir_flag_spec_ld"; then
+ eval dep_rpath=\"$hardcode_libdir_flag_spec_ld\"
+ else
+ eval dep_rpath=\"$hardcode_libdir_flag_spec\"
+ fi
+ fi
+ if test -n "$runpath_var" && test -n "$perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $perm_rpath; do
+ rpath="$rpath$dir:"
+ done
+ eval "$runpath_var='$rpath\$$runpath_var'; export $runpath_var"
+ fi
+ test -n "$dep_rpath" && deplibs="$dep_rpath $deplibs"
+ fi
+
+ shlibpath="$finalize_shlibpath"
+ test "$mode" != relink && shlibpath="$compile_shlibpath$shlibpath"
+ if test -n "$shlibpath"; then
+ eval "$shlibpath_var='$shlibpath\$$shlibpath_var'; export $shlibpath_var"
+ fi
+
+ # Get the real and link names of the library.
+ eval shared_ext=\"$shrext_cmds\"
+ eval library_names=\"$library_names_spec\"
+ set dummy $library_names
+ realname="$2"
+ shift; shift
+
+ if test -n "$soname_spec"; then
+ eval soname=\"$soname_spec\"
+ else
+ soname="$realname"
+ fi
+ if test -z "$dlname"; then
+ dlname=$soname
+ fi
+
+ lib="$output_objdir/$realname"
+ linknames=
+ for link
+ do
+ linknames="$linknames $link"
+ done
+
+ # Use standard objects if they are pic
+ test -z "$pic_flag" && libobjs=`$echo "X$libobjs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+
+ # Prepare the list of exported symbols
+ if test -z "$export_symbols"; then
+ if test "$always_export_symbols" = yes || test -n "$export_symbols_regex"; then
+ $show "generating symbol list for \`$libname.la'"
+ export_symbols="$output_objdir/$libname.exp"
+ $run $rm $export_symbols
+ cmds=$export_symbols_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ if len=`expr "X$cmd" : ".*"` &&
+ test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ skipped_export=false
+ else
+ # The command line is too long to execute in one step.
+ $show "using reloadable object file for export list..."
+ skipped_export=:
+ # Break out early, otherwise skipped_export may be
+ # set to false by a later but shorter cmd.
+ break
+ fi
+ done
+ IFS="$save_ifs"
+ if test -n "$export_symbols_regex"; then
+ $show "$EGREP -e \"$export_symbols_regex\" \"$export_symbols\" > \"${export_symbols}T\""
+ $run eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"'
+ $show "$mv \"${export_symbols}T\" \"$export_symbols\""
+ $run eval '$mv "${export_symbols}T" "$export_symbols"'
+ fi
+ fi
+ fi
+
+ if test -n "$export_symbols" && test -n "$include_expsyms"; then
+ $run eval '$echo "X$include_expsyms" | $SP2NL >> "$export_symbols"'
+ fi
+
+ tmp_deplibs=
+ for test_deplib in $deplibs; do
+ case " $convenience " in
+ *" $test_deplib "*) ;;
+ *)
+ tmp_deplibs="$tmp_deplibs $test_deplib"
+ ;;
+ esac
+ done
+ deplibs="$tmp_deplibs"
+
+ if test -n "$convenience"; then
+ if test -n "$whole_archive_flag_spec"; then
+ save_libobjs=$libobjs
+ eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+ else
+ gentop="$output_objdir/${outputname}x"
+ generated="$generated $gentop"
+
+ func_extract_archives $gentop $convenience
+ libobjs="$libobjs $func_extract_archives_result"
+ fi
+ fi
+
+ if test "$thread_safe" = yes && test -n "$thread_safe_flag_spec"; then
+ eval flag=\"$thread_safe_flag_spec\"
+ linker_flags="$linker_flags $flag"
+ fi
+
+ # Make a backup of the uninstalled library when relinking
+ if test "$mode" = relink; then
+ $run eval '(cd $output_objdir && $rm ${realname}U && $mv $realname ${realname}U)' || exit $?
+ fi
+
+ # Do each of the archive commands.
+ if test "$module" = yes && test -n "$module_cmds" ; then
+ if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+ eval test_cmds=\"$module_expsym_cmds\"
+ cmds=$module_expsym_cmds
+ else
+ eval test_cmds=\"$module_cmds\"
+ cmds=$module_cmds
+ fi
+ else
+ if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+ eval test_cmds=\"$archive_expsym_cmds\"
+ cmds=$archive_expsym_cmds
+ else
+ eval test_cmds=\"$archive_cmds\"
+ cmds=$archive_cmds
+ fi
+ fi
+
+ if test "X$skipped_export" != "X:" &&
+ len=`expr "X$test_cmds" : ".*" 2>/dev/null` &&
+ test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+ :
+ else
+ # The command line is too long to link in one step, link piecewise.
+ $echo "creating reloadable object files..."
+
+ # Save the value of $output and $libobjs because we want to
+ # use them later. If we have whole_archive_flag_spec, we
+ # want to use save_libobjs as it was before
+ # whole_archive_flag_spec was expanded, because we can't
+ # assume the linker understands whole_archive_flag_spec.
+ # This may have to be revisited, in case too many
+ # convenience libraries get linked in and end up exceeding
+ # the spec.
+ if test -z "$convenience" || test -z "$whole_archive_flag_spec"; then
+ save_libobjs=$libobjs
+ fi
+ save_output=$output
+ output_la=`$echo "X$output" | $Xsed -e "$basename"`
+
+ # Clear the reloadable object creation command queue and
+ # initialize k to one.
+ test_cmds=
+ concat_cmds=
+ objlist=
+ delfiles=
+ last_robj=
+ k=1
+ output=$output_objdir/$output_la-${k}.$objext
+ # Loop over the list of objects to be linked.
+ for obj in $save_libobjs
+ do
+ eval test_cmds=\"$reload_cmds $objlist $last_robj\"
+ if test "X$objlist" = X ||
+ { len=`expr "X$test_cmds" : ".*" 2>/dev/null` &&
+ test "$len" -le "$max_cmd_len"; }; then
+ objlist="$objlist $obj"
+ else
+ # The command $test_cmds is almost too long, add a
+ # command to the queue.
+ if test "$k" -eq 1 ; then
+ # The first file doesn't have a previous command to add.
+ eval concat_cmds=\"$reload_cmds $objlist $last_robj\"
+ else
+ # All subsequent reloadable object files will link in
+ # the last one created.
+ eval concat_cmds=\"\$concat_cmds~$reload_cmds $objlist $last_robj\"
+ fi
+ last_robj=$output_objdir/$output_la-${k}.$objext
+ k=`expr $k + 1`
+ output=$output_objdir/$output_la-${k}.$objext
+ objlist=$obj
+ len=1
+ fi
+ done
+ # Handle the remaining objects by creating one last
+ # reloadable object file. All subsequent reloadable object
+ # files will link in the last one created.
+ test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+ eval concat_cmds=\"\${concat_cmds}$reload_cmds $objlist $last_robj\"
+
+ if ${skipped_export-false}; then
+ $show "generating symbol list for \`$libname.la'"
+ export_symbols="$output_objdir/$libname.exp"
+ $run $rm $export_symbols
+ libobjs=$output
+ # Append the command to create the export file.
+ eval concat_cmds=\"\$concat_cmds~$export_symbols_cmds\"
+ fi
+
+ # Set up a command to remove the reloadable object files
+ # after they are used.
+ i=0
+ while test "$i" -lt "$k"
+ do
+ i=`expr $i + 1`
+ delfiles="$delfiles $output_objdir/$output_la-${i}.$objext"
+ done
+
+ $echo "creating a temporary reloadable object file: $output"
+
+ # Loop through the commands generated above and execute them.
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $concat_cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+
+ libobjs=$output
+ # Restore the value of output.
+ output=$save_output
+
+ if test -n "$convenience" && test -n "$whole_archive_flag_spec"; then
+ eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+ fi
+ # Expand the library linking commands again to reset the
+ # value of $libobjs for piecewise linking.
+
+ # Do each of the archive commands.
+ if test "$module" = yes && test -n "$module_cmds" ; then
+ if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+ cmds=$module_expsym_cmds
+ else
+ cmds=$module_cmds
+ fi
+ else
+ if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+ cmds=$archive_expsym_cmds
+ else
+ cmds=$archive_cmds
+ fi
+ fi
+
+ # Append the command to remove the reloadable object files
+ # to the just-reset $cmds.
+ eval cmds=\"\$cmds~\$rm $delfiles\"
+ fi
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || {
+ lt_exit=$?
+
+ # Restore the uninstalled library and exit
+ if test "$mode" = relink; then
+ $run eval '(cd $output_objdir && $rm ${realname}T && $mv ${realname}U $realname)'
+ fi
+
+ exit $lt_exit
+ }
+ done
+ IFS="$save_ifs"
+
+ # Restore the uninstalled library and exit
+ if test "$mode" = relink; then
+ $run eval '(cd $output_objdir && $rm ${realname}T && $mv $realname ${realname}T && $mv "$realname"U $realname)' || exit $?
+
+ if test -n "$convenience"; then
+ if test -z "$whole_archive_flag_spec"; then
+ $show "${rm}r $gentop"
+ $run ${rm}r "$gentop"
+ fi
+ fi
+
+ exit $EXIT_SUCCESS
+ fi
+
+ # Create links to the real library.
+ for linkname in $linknames; do
+ if test "$realname" != "$linkname"; then
+ $show "(cd $output_objdir && $rm $linkname && $LN_S $realname $linkname)"
+ $run eval '(cd $output_objdir && $rm $linkname && $LN_S $realname $linkname)' || exit $?
+ fi
+ done
+
+ # If -module or -export-dynamic was specified, set the dlname.
+ if test "$module" = yes || test "$export_dynamic" = yes; then
+ # On all known operating systems, these are identical.
+ dlname="$soname"
+ fi
+ fi
+ ;;
+
+ obj)
+ if test -n "$deplibs"; then
+ $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2
+ fi
+
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$rpath"; then
+ $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$xrpath"; then
+ $echo "$modename: warning: \`-R' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for objects" 1>&2
+ fi
+
+ case $output in
+ *.lo)
+ if test -n "$objs$old_deplibs"; then
+ $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ libobj="$output"
+ obj=`$echo "X$output" | $Xsed -e "$lo2o"`
+ ;;
+ *)
+ libobj=
+ obj="$output"
+ ;;
+ esac
+
+ # Delete the old objects.
+ $run $rm $obj $libobj
+
+ # Objects from convenience libraries. This assumes
+ # single-version convenience libraries. Whenever we create
+ # different ones for PIC/non-PIC, this we'll have to duplicate
+ # the extraction.
+ reload_conv_objs=
+ gentop=
+ # reload_cmds runs $LD directly, so let us get rid of
+ # -Wl from whole_archive_flag_spec and hope we can get by with
+ # turning comma into space..
+ wl=
+
+ if test -n "$convenience"; then
+ if test -n "$whole_archive_flag_spec"; then
+ eval tmp_whole_archive_flags=\"$whole_archive_flag_spec\"
+ reload_conv_objs=$reload_objs\ `$echo "X$tmp_whole_archive_flags" | $Xsed -e 's|,| |g'`
+ else
+ gentop="$output_objdir/${obj}x"
+ generated="$generated $gentop"
+
+ func_extract_archives $gentop $convenience
+ reload_conv_objs="$reload_objs $func_extract_archives_result"
+ fi
+ fi
+
+ # Create the old-style object.
+ reload_objs="$objs$old_deplibs "`$echo "X$libobjs" | $SP2NL | $Xsed -e '/\.'${libext}$'/d' -e '/\.lib$/d' -e "$lo2o" | $NL2SP`" $reload_conv_objs" ### testsuite: skip nested quoting test
+
+ output="$obj"
+ cmds=$reload_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+
+ # Exit if we aren't doing a library object file.
+ if test -z "$libobj"; then
+ if test -n "$gentop"; then
+ $show "${rm}r $gentop"
+ $run ${rm}r $gentop
+ fi
+
+ exit $EXIT_SUCCESS
+ fi
+
+ if test "$build_libtool_libs" != yes; then
+ if test -n "$gentop"; then
+ $show "${rm}r $gentop"
+ $run ${rm}r $gentop
+ fi
+
+ # Create an invalid libtool object if no PIC, so that we don't
+ # accidentally link it into a program.
+ # $show "echo timestamp > $libobj"
+ # $run eval "echo timestamp > $libobj" || exit $?
+ exit $EXIT_SUCCESS
+ fi
+
+ if test -n "$pic_flag" || test "$pic_mode" != default; then
+ # Only do commands if we really have different PIC objects.
+ reload_objs="$libobjs $reload_conv_objs"
+ output="$libobj"
+ cmds=$reload_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ fi
+
+ if test -n "$gentop"; then
+ $show "${rm}r $gentop"
+ $run ${rm}r $gentop
+ fi
+
+ exit $EXIT_SUCCESS
+ ;;
+
+ prog)
+ case $host in
+ *cygwin*) output=`$echo $output | ${SED} -e 's,.exe$,,;s,$,.exe,'` ;;
+ esac
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for programs" 1>&2
+ fi
+
+ if test "$preload" = yes; then
+ if test "$dlopen_support" = unknown && test "$dlopen_self" = unknown &&
+ test "$dlopen_self_static" = unknown; then
+ $echo "$modename: warning: \`AC_LIBTOOL_DLOPEN' not used. Assuming no dlopen support."
+ fi
+ fi
+
+ case $host in
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # On Rhapsody replace the C library is the System framework
+ compile_deplibs=`$echo "X $compile_deplibs" | $Xsed -e 's/ -lc / -framework System /'`
+ finalize_deplibs=`$echo "X $finalize_deplibs" | $Xsed -e 's/ -lc / -framework System /'`
+ ;;
+ esac
+
+ case $host in
+ *darwin*)
+ # Don't allow lazy linking, it breaks C++ global constructors
+ if test "$tagname" = CXX ; then
+ compile_command="$compile_command ${wl}-bind_at_load"
+ finalize_command="$finalize_command ${wl}-bind_at_load"
+ fi
+ ;;
+ esac
+
+
+ # move library search paths that coincide with paths to not yet
+ # installed libraries to the beginning of the library search list
+ new_libs=
+ for path in $notinst_path; do
+ case " $new_libs " in
+ *" -L$path/$objdir "*) ;;
+ *)
+ case " $compile_deplibs " in
+ *" -L$path/$objdir "*)
+ new_libs="$new_libs -L$path/$objdir" ;;
+ esac
+ ;;
+ esac
+ done
+ for deplib in $compile_deplibs; do
+ case $deplib in
+ -L*)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) new_libs="$new_libs $deplib" ;;
+ esac
+ ;;
+ *) new_libs="$new_libs $deplib" ;;
+ esac
+ done
+ compile_deplibs="$new_libs"
+
+
+ compile_command="$compile_command $compile_deplibs"
+ finalize_command="$finalize_command $finalize_deplibs"
+
+ if test -n "$rpath$xrpath"; then
+ # If the user specified any rpath flags, then add them.
+ for libdir in $rpath $xrpath; do
+ # This is the magic to use -rpath.
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) finalize_rpath="$finalize_rpath $libdir" ;;
+ esac
+ done
+ fi
+
+ # Now hardcode the library paths
+ rpath=
+ hardcode_libdirs=
+ for libdir in $compile_rpath $finalize_rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ rpath="$rpath $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) perm_rpath="$perm_rpath $libdir" ;;
+ esac
+ fi
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*)
+ testbindir=`$echo "X$libdir" | $Xsed -e 's*/lib$*/bin*'`
+ case :$dllsearchpath: in
+ *":$libdir:"*) ;;
+ *) dllsearchpath="$dllsearchpath:$libdir";;
+ esac
+ case :$dllsearchpath: in
+ *":$testbindir:"*) ;;
+ *) dllsearchpath="$dllsearchpath:$testbindir";;
+ esac
+ ;;
+ esac
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ eval rpath=\" $hardcode_libdir_flag_spec\"
+ fi
+ compile_rpath="$rpath"
+
+ rpath=
+ hardcode_libdirs=
+ for libdir in $finalize_rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ rpath="$rpath $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$finalize_perm_rpath " in
+ *" $libdir "*) ;;
+ *) finalize_perm_rpath="$finalize_perm_rpath $libdir" ;;
+ esac
+ fi
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ eval rpath=\" $hardcode_libdir_flag_spec\"
+ fi
+ finalize_rpath="$rpath"
+
+ if test -n "$libobjs" && test "$build_old_libs" = yes; then
+ # Transform all the library objects into standard objects.
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+ finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+ fi
+
+ dlsyms=
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ if test -n "$NM" && test -n "$global_symbol_pipe"; then
+ dlsyms="${outputname}S.c"
+ else
+ $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2
+ fi
+ fi
+
+ if test -n "$dlsyms"; then
+ case $dlsyms in
+ "") ;;
+ *.c)
+ # Discover the nlist of each of the dlfiles.
+ nlist="$output_objdir/${outputname}.nm"
+
+ $show "$rm $nlist ${nlist}S ${nlist}T"
+ $run $rm "$nlist" "${nlist}S" "${nlist}T"
+
+ # Parse the name list into a source file.
+ $show "creating $output_objdir/$dlsyms"
+
+ test -z "$run" && $echo > "$output_objdir/$dlsyms" "\
+/* $dlsyms - symbol resolution table for \`$outputname' dlsym emulation. */
+/* Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+/* Prevent the only kind of declaration conflicts we can make. */
+#define lt_preloaded_symbols some_other_symbol
+
+/* External symbol declarations for the compiler. */\
+"
+
+ if test "$dlself" = yes; then
+ $show "generating symbol list for \`$output'"
+
+ test -z "$run" && $echo ': @PROGRAM@ ' > "$nlist"
+
+ # Add our own program objects to the symbol list.
+ progfiles=`$echo "X$objs$old_deplibs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+ for arg in $progfiles; do
+ $show "extracting global C symbols from \`$arg'"
+ $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'"
+ done
+
+ if test -n "$exclude_expsyms"; then
+ $run eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T'
+ $run eval '$mv "$nlist"T "$nlist"'
+ fi
+
+ if test -n "$export_symbols_regex"; then
+ $run eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T'
+ $run eval '$mv "$nlist"T "$nlist"'
+ fi
+
+ # Prepare the list of exported symbols
+ if test -z "$export_symbols"; then
+ export_symbols="$output_objdir/$outputname.exp"
+ $run $rm $export_symbols
+ $run eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"'
+ case $host in
+ *cygwin* | *mingw* )
+ $run eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ $run eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ else
+ $run eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"'
+ $run eval 'grep -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T'
+ $run eval 'mv "$nlist"T "$nlist"'
+ case $host in
+ *cygwin* | *mingw* )
+ $run eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ $run eval 'cat "$nlist" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ fi
+ fi
+
+ for arg in $dlprefiles; do
+ $show "extracting global C symbols from \`$arg'"
+ name=`$echo "$arg" | ${SED} -e 's%^.*/%%'`
+ $run eval '$echo ": $name " >> "$nlist"'
+ $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'"
+ done
+
+ if test -z "$run"; then
+ # Make sure we have at least an empty file.
+ test -f "$nlist" || : > "$nlist"
+
+ if test -n "$exclude_expsyms"; then
+ $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T
+ $mv "$nlist"T "$nlist"
+ fi
+
+ # Try sorting and uniquifying the output.
+ if grep -v "^: " < "$nlist" |
+ if sort -k 3 </dev/null >/dev/null 2>&1; then
+ sort -k 3
+ else
+ sort +2
+ fi |
+ uniq > "$nlist"S; then
+ :
+ else
+ grep -v "^: " < "$nlist" > "$nlist"S
+ fi
+
+ if test -f "$nlist"S; then
+ eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$dlsyms"'
+ else
+ $echo '/* NONE */' >> "$output_objdir/$dlsyms"
+ fi
+
+ $echo >> "$output_objdir/$dlsyms" "\
+
+#undef lt_preloaded_symbols
+
+#if defined (__STDC__) && __STDC__
+# define lt_ptr void *
+#else
+# define lt_ptr char *
+# define const
+#endif
+
+/* The mapping between symbol names and symbols. */
+"
+
+ case $host in
+ *cygwin* | *mingw* )
+ $echo >> "$output_objdir/$dlsyms" "\
+/* DATA imports from DLLs on WIN32 can't be const, because
+ runtime relocations are performed -- see ld's documentation
+ on pseudo-relocs */
+struct {
+"
+ ;;
+ * )
+ $echo >> "$output_objdir/$dlsyms" "\
+const struct {
+"
+ ;;
+ esac
+
+
+ $echo >> "$output_objdir/$dlsyms" "\
+ const char *name;
+ lt_ptr address;
+}
+lt_preloaded_symbols[] =
+{\
+"
+
+ eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$dlsyms"
+
+ $echo >> "$output_objdir/$dlsyms" "\
+ {0, (lt_ptr) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif\
+"
+ fi
+
+ pic_flag_for_symtable=
+ case $host in
+ # compiling the symbol table file with pic_flag works around
+ # a FreeBSD bug that causes programs to crash when -lm is
+ # linked before any other PIC object. But we must not use
+ # pic_flag when linking with -static. The problem exists in
+ # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1.
+ *-*-freebsd2*|*-*-freebsd3.0*|*-*-freebsdelf3.0*)
+ case "$compile_command " in
+ *" -static "*) ;;
+ *) pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND";;
+ esac;;
+ *-*-hpux*)
+ case "$compile_command " in
+ *" -static "*) ;;
+ *) pic_flag_for_symtable=" $pic_flag";;
+ esac
+ esac
+
+ # Now compile the dynamic symbol file.
+ $show "(cd $output_objdir && $LTCC $LTCFLAGS -c$no_builtin_flag$pic_flag_for_symtable \"$dlsyms\")"
+ $run eval '(cd $output_objdir && $LTCC $LTCFLAGS -c$no_builtin_flag$pic_flag_for_symtable "$dlsyms")' || exit $?
+
+ # Clean up the generated files.
+ $show "$rm $output_objdir/$dlsyms $nlist ${nlist}S ${nlist}T"
+ $run $rm "$output_objdir/$dlsyms" "$nlist" "${nlist}S" "${nlist}T"
+
+ # Transform the symbol file into the correct name.
+ case $host in
+ *cygwin* | *mingw* )
+ if test -f "$output_objdir/${outputname}.def" ; then
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}.def $output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}.def $output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ else
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ fi
+ ;;
+ * )
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP`
+ ;;
+ esac
+ ;;
+ *)
+ $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+ else
+ # We keep going just in case the user didn't refer to
+ # lt_preloaded_symbols. The linker will fail if global_symbol_pipe
+ # really was required.
+
+ # Nullify the symbol file.
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s% @SYMFILE@%%" | $NL2SP`
+ finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s% @SYMFILE@%%" | $NL2SP`
+ fi
+
+ if test "$need_relink" = no || test "$build_libtool_libs" != yes; then
+ # Replace the output file specification.
+ compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e 's%@OUTPUT@%'"$output"'%g' | $NL2SP`
+ link_command="$compile_command$compile_rpath"
+
+ # We have no uninstalled library dependencies, so finalize right now.
+ $show "$link_command"
+ $run eval "$link_command"
+ exit_status=$?
+
+ # Delete the generated files.
+ if test -n "$dlsyms"; then
+ $show "$rm $output_objdir/${outputname}S.${objext}"
+ $run $rm "$output_objdir/${outputname}S.${objext}"
+ fi
+
+ exit $exit_status
+ fi
+
+ if test -n "$shlibpath_var"; then
+ # We should set the shlibpath_var
+ rpath=
+ for dir in $temp_rpath; do
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*)
+ # Absolute path.
+ rpath="$rpath$dir:"
+ ;;
+ *)
+ # Relative path: add a thisdir entry.
+ rpath="$rpath\$thisdir/$dir:"
+ ;;
+ esac
+ done
+ temp_rpath="$rpath"
+ fi
+
+ if test -n "$compile_shlibpath$finalize_shlibpath"; then
+ compile_command="$shlibpath_var=\"$compile_shlibpath$finalize_shlibpath\$$shlibpath_var\" $compile_command"
+ fi
+ if test -n "$finalize_shlibpath"; then
+ finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command"
+ fi
+
+ compile_var=
+ finalize_var=
+ if test -n "$runpath_var"; then
+ if test -n "$perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $perm_rpath; do
+ rpath="$rpath$dir:"
+ done
+ compile_var="$runpath_var=\"$rpath\$$runpath_var\" "
+ fi
+ if test -n "$finalize_perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $finalize_perm_rpath; do
+ rpath="$rpath$dir:"
+ done
+ finalize_var="$runpath_var=\"$rpath\$$runpath_var\" "
+ fi
+ fi
+
+ if test "$no_install" = yes; then
+ # We don't need to create a wrapper script.
+ link_command="$compile_var$compile_command$compile_rpath"
+ # Replace the output file specification.
+ link_command=`$echo "X$link_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'`
+ # Delete the old output file.
+ $run $rm $output
+ # Link the executable and exit
+ $show "$link_command"
+ $run eval "$link_command" || exit $?
+ exit $EXIT_SUCCESS
+ fi
+
+ if test "$hardcode_action" = relink; then
+ # Fast installation is not supported
+ link_command="$compile_var$compile_command$compile_rpath"
+ relink_command="$finalize_var$finalize_command$finalize_rpath"
+
+ $echo "$modename: warning: this platform does not like uninstalled shared libraries" 1>&2
+ $echo "$modename: \`$output' will be relinked during installation" 1>&2
+ else
+ if test "$fast_install" != no; then
+ link_command="$finalize_var$compile_command$finalize_rpath"
+ if test "$fast_install" = yes; then
+ relink_command=`$echo "X$compile_var$compile_command$compile_rpath" | $SP2NL | $Xsed -e 's%@OUTPUT@%\$progdir/\$file%g' | $NL2SP`
+ else
+ # fast_install is set to needless
+ relink_command=
+ fi
+ else
+ link_command="$compile_var$compile_command$compile_rpath"
+ relink_command="$finalize_var$finalize_command$finalize_rpath"
+ fi
+ fi
+
+ # Replace the output file specification.
+ link_command=`$echo "X$link_command" | $Xsed -e 's%@OUTPUT@%'"$output_objdir/$outputname"'%g'`
+
+ # Delete the old output files.
+ $run $rm $output $output_objdir/$outputname $output_objdir/lt-$outputname
+
+ $show "$link_command"
+ $run eval "$link_command" || exit $?
+
+ # Now create the wrapper script.
+ $show "creating $output"
+
+ # Quote the relink command for shipping.
+ if test -n "$relink_command"; then
+ # Preserve any variables that may affect compiler behavior
+ for var in $variables_saved_for_relink; do
+ if eval test -z \"\${$var+set}\"; then
+ relink_command="{ test -z \"\${$var+set}\" || unset $var || { $var=; export $var; }; }; $relink_command"
+ elif eval var_value=\$$var; test -z "$var_value"; then
+ relink_command="$var=; export $var; $relink_command"
+ else
+ var_value=`$echo "X$var_value" | $Xsed -e "$sed_quote_subst"`
+ relink_command="$var=\"$var_value\"; export $var; $relink_command"
+ fi
+ done
+ relink_command="(cd `pwd`; $relink_command)"
+ relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e "$sed_quote_subst" | $NL2SP`
+ fi
+
+ # Quote $echo for shipping.
+ if test "X$echo" = "X$SHELL $progpath --fallback-echo"; then
+ case $progpath in
+ [\\/]* | [A-Za-z]:[\\/]*) qecho="$SHELL $progpath --fallback-echo";;
+ *) qecho="$SHELL `pwd`/$progpath --fallback-echo";;
+ esac
+ qecho=`$echo "X$qecho" | $Xsed -e "$sed_quote_subst"`
+ else
+ qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"`
+ fi
+
+ # Only actually do things if our run command is non-null.
+ if test -z "$run"; then
+ # win32 will think the script is a binary if it has
+ # a .exe suffix, so we strip it off here.
+ case $output in
+ *.exe) output=`$echo $output|${SED} 's,.exe$,,'` ;;
+ esac
+ # test for cygwin because mv fails w/o .exe extensions
+ case $host in
+ *cygwin*)
+ exeext=.exe
+ outputname=`$echo $outputname|${SED} 's,.exe$,,'` ;;
+ *) exeext= ;;
+ esac
+ case $host in
+ *cygwin* | *mingw* )
+ output_name=`basename $output`
+ output_path=`dirname $output`
+ cwrappersource="$output_path/$objdir/lt-$output_name.c"
+ cwrapper="$output_path/$output_name.exe"
+ $rm $cwrappersource $cwrapper
+ trap "$rm $cwrappersource $cwrapper; exit $EXIT_FAILURE" 1 2 15
+
+ cat > $cwrappersource <<EOF
+
+/* $cwrappersource - temporary wrapper executable for $objdir/$outputname
+ Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP
+
+ The $output program cannot be directly executed until all the libtool
+ libraries that it depends on are installed.
+
+ This wrapper executable should never be moved out of the build directory.
+ If it is, it will not operate correctly.
+
+ Currently, it simply execs the wrapper *script* "/bin/sh $output",
+ but could eventually absorb all of the scripts functionality and
+ exec $objdir/$outputname directly.
+*/
+EOF
+ cat >> $cwrappersource<<"EOF"
+#include <stdio.h>
+#include <stdlib.h>
+#include <unistd.h>
+#include <malloc.h>
+#include <stdarg.h>
+#include <assert.h>
+#include <string.h>
+#include <ctype.h>
+#include <sys/stat.h>
+
+#if defined(PATH_MAX)
+# define LT_PATHMAX PATH_MAX
+#elif defined(MAXPATHLEN)
+# define LT_PATHMAX MAXPATHLEN
+#else
+# define LT_PATHMAX 1024
+#endif
+
+#ifndef DIR_SEPARATOR
+# define DIR_SEPARATOR '/'
+# define PATH_SEPARATOR ':'
+#endif
+
+#if defined (_WIN32) || defined (__MSDOS__) || defined (__DJGPP__) || \
+ defined (__OS2__)
+# define HAVE_DOS_BASED_FILE_SYSTEM
+# ifndef DIR_SEPARATOR_2
+# define DIR_SEPARATOR_2 '\\'
+# endif
+# ifndef PATH_SEPARATOR_2
+# define PATH_SEPARATOR_2 ';'
+# endif
+#endif
+
+#ifndef DIR_SEPARATOR_2
+# define IS_DIR_SEPARATOR(ch) ((ch) == DIR_SEPARATOR)
+#else /* DIR_SEPARATOR_2 */
+# define IS_DIR_SEPARATOR(ch) \
+ (((ch) == DIR_SEPARATOR) || ((ch) == DIR_SEPARATOR_2))
+#endif /* DIR_SEPARATOR_2 */
+
+#ifndef PATH_SEPARATOR_2
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR)
+#else /* PATH_SEPARATOR_2 */
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR_2)
+#endif /* PATH_SEPARATOR_2 */
+
+#define XMALLOC(type, num) ((type *) xmalloc ((num) * sizeof(type)))
+#define XFREE(stale) do { \
+ if (stale) { free ((void *) stale); stale = 0; } \
+} while (0)
+
+/* -DDEBUG is fairly common in CFLAGS. */
+#undef DEBUG
+#if defined DEBUGWRAPPER
+# define DEBUG(format, ...) fprintf(stderr, format, __VA_ARGS__)
+#else
+# define DEBUG(format, ...)
+#endif
+
+const char *program_name = NULL;
+
+void * xmalloc (size_t num);
+char * xstrdup (const char *string);
+const char * base_name (const char *name);
+char * find_executable(const char *wrapper);
+int check_executable(const char *path);
+char * strendzap(char *str, const char *pat);
+void lt_fatal (const char *message, ...);
+
+int
+main (int argc, char *argv[])
+{
+ char **newargz;
+ int i;
+
+ program_name = (char *) xstrdup (base_name (argv[0]));
+ DEBUG("(main) argv[0] : %s\n",argv[0]);
+ DEBUG("(main) program_name : %s\n",program_name);
+ newargz = XMALLOC(char *, argc+2);
+EOF
+
+ cat >> $cwrappersource <<EOF
+ newargz[0] = (char *) xstrdup("$SHELL");
+EOF
+
+ cat >> $cwrappersource <<"EOF"
+ newargz[1] = find_executable(argv[0]);
+ if (newargz[1] == NULL)
+ lt_fatal("Couldn't find %s", argv[0]);
+ DEBUG("(main) found exe at : %s\n",newargz[1]);
+ /* we know the script has the same name, without the .exe */
+ /* so make sure newargz[1] doesn't end in .exe */
+ strendzap(newargz[1],".exe");
+ for (i = 1; i < argc; i++)
+ newargz[i+1] = xstrdup(argv[i]);
+ newargz[argc+1] = NULL;
+
+ for (i=0; i<argc+1; i++)
+ {
+ DEBUG("(main) newargz[%d] : %s\n",i,newargz[i]);
+ ;
+ }
+
+EOF
+
+ case $host_os in
+ mingw*)
+ cat >> $cwrappersource <<EOF
+ execv("$SHELL",(char const **)newargz);
+EOF
+ ;;
+ *)
+ cat >> $cwrappersource <<EOF
+ execv("$SHELL",newargz);
+EOF
+ ;;
+ esac
+
+ cat >> $cwrappersource <<"EOF"
+ return 127;
+}
+
+void *
+xmalloc (size_t num)
+{
+ void * p = (void *) malloc (num);
+ if (!p)
+ lt_fatal ("Memory exhausted");
+
+ return p;
+}
+
+char *
+xstrdup (const char *string)
+{
+ return string ? strcpy ((char *) xmalloc (strlen (string) + 1), string) : NULL
+;
+}
+
+const char *
+base_name (const char *name)
+{
+ const char *base;
+
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+ /* Skip over the disk name in MSDOS pathnames. */
+ if (isalpha ((unsigned char)name[0]) && name[1] == ':')
+ name += 2;
+#endif
+
+ for (base = name; *name; name++)
+ if (IS_DIR_SEPARATOR (*name))
+ base = name + 1;
+ return base;
+}
+
+int
+check_executable(const char * path)
+{
+ struct stat st;
+
+ DEBUG("(check_executable) : %s\n", path ? (*path ? path : "EMPTY!") : "NULL!");
+ if ((!path) || (!*path))
+ return 0;
+
+ if ((stat (path, &st) >= 0) &&
+ (
+ /* MinGW & native WIN32 do not support S_IXOTH or S_IXGRP */
+#if defined (S_IXOTH)
+ ((st.st_mode & S_IXOTH) == S_IXOTH) ||
+#endif
+#if defined (S_IXGRP)
+ ((st.st_mode & S_IXGRP) == S_IXGRP) ||
+#endif
+ ((st.st_mode & S_IXUSR) == S_IXUSR))
+ )
+ return 1;
+ else
+ return 0;
+}
+
+/* Searches for the full path of the wrapper. Returns
+ newly allocated full path name if found, NULL otherwise */
+char *
+find_executable (const char* wrapper)
+{
+ int has_slash = 0;
+ const char* p;
+ const char* p_next;
+ /* static buffer for getcwd */
+ char tmp[LT_PATHMAX + 1];
+ int tmp_len;
+ char* concat_name;
+
+ DEBUG("(find_executable) : %s\n", wrapper ? (*wrapper ? wrapper : "EMPTY!") : "NULL!");
+
+ if ((wrapper == NULL) || (*wrapper == '\0'))
+ return NULL;
+
+ /* Absolute path? */
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+ if (isalpha ((unsigned char)wrapper[0]) && wrapper[1] == ':')
+ {
+ concat_name = xstrdup (wrapper);
+ if (check_executable(concat_name))
+ return concat_name;
+ XFREE(concat_name);
+ }
+ else
+ {
+#endif
+ if (IS_DIR_SEPARATOR (wrapper[0]))
+ {
+ concat_name = xstrdup (wrapper);
+ if (check_executable(concat_name))
+ return concat_name;
+ XFREE(concat_name);
+ }
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+ }
+#endif
+
+ for (p = wrapper; *p; p++)
+ if (*p == '/')
+ {
+ has_slash = 1;
+ break;
+ }
+ if (!has_slash)
+ {
+ /* no slashes; search PATH */
+ const char* path = getenv ("PATH");
+ if (path != NULL)
+ {
+ for (p = path; *p; p = p_next)
+ {
+ const char* q;
+ size_t p_len;
+ for (q = p; *q; q++)
+ if (IS_PATH_SEPARATOR(*q))
+ break;
+ p_len = q - p;
+ p_next = (*q == '\0' ? q : q + 1);
+ if (p_len == 0)
+ {
+ /* empty path: current directory */
+ if (getcwd (tmp, LT_PATHMAX) == NULL)
+ lt_fatal ("getcwd failed");
+ tmp_len = strlen(tmp);
+ concat_name = XMALLOC(char, tmp_len + 1 + strlen(wrapper) + 1);
+ memcpy (concat_name, tmp, tmp_len);
+ concat_name[tmp_len] = '/';
+ strcpy (concat_name + tmp_len + 1, wrapper);
+ }
+ else
+ {
+ concat_name = XMALLOC(char, p_len + 1 + strlen(wrapper) + 1);
+ memcpy (concat_name, p, p_len);
+ concat_name[p_len] = '/';
+ strcpy (concat_name + p_len + 1, wrapper);
+ }
+ if (check_executable(concat_name))
+ return concat_name;
+ XFREE(concat_name);
+ }
+ }
+ /* not found in PATH; assume curdir */
+ }
+ /* Relative path | not found in path: prepend cwd */
+ if (getcwd (tmp, LT_PATHMAX) == NULL)
+ lt_fatal ("getcwd failed");
+ tmp_len = strlen(tmp);
+ concat_name = XMALLOC(char, tmp_len + 1 + strlen(wrapper) + 1);
+ memcpy (concat_name, tmp, tmp_len);
+ concat_name[tmp_len] = '/';
+ strcpy (concat_name + tmp_len + 1, wrapper);
+
+ if (check_executable(concat_name))
+ return concat_name;
+ XFREE(concat_name);
+ return NULL;
+}
+
+char *
+strendzap(char *str, const char *pat)
+{
+ size_t len, patlen;
+
+ assert(str != NULL);
+ assert(pat != NULL);
+
+ len = strlen(str);
+ patlen = strlen(pat);
+
+ if (patlen <= len)
+ {
+ str += len - patlen;
+ if (strcmp(str, pat) == 0)
+ *str = '\0';
+ }
+ return str;
+}
+
+static void
+lt_error_core (int exit_status, const char * mode,
+ const char * message, va_list ap)
+{
+ fprintf (stderr, "%s: %s: ", program_name, mode);
+ vfprintf (stderr, message, ap);
+ fprintf (stderr, ".\n");
+
+ if (exit_status >= 0)
+ exit (exit_status);
+}
+
+void
+lt_fatal (const char *message, ...)
+{
+ va_list ap;
+ va_start (ap, message);
+ lt_error_core (EXIT_FAILURE, "FATAL", message, ap);
+ va_end (ap);
+}
+EOF
+ # we should really use a build-platform specific compiler
+ # here, but OTOH, the wrappers (shell script and this C one)
+ # are only useful if you want to execute the "real" binary.
+ # Since the "real" binary is built for $host, then this
+ # wrapper might as well be built for $host, too.
+ $run $LTCC $LTCFLAGS -s -o $cwrapper $cwrappersource
+ ;;
+ esac
+ $rm $output
+ trap "$rm $output; exit $EXIT_FAILURE" 1 2 15
+
+ $echo > $output "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$outputname
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of the build directory.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='${SED} -e 1s/^X//'
+sed_quote_subst='$sed_quote_subst'
+
+# Be Bourne compatible (taken from Autoconf:_AS_BOURNE_COMPATIBLE).
+if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '\${1+\"\$@\"}'='\"\$@\"'
+ setopt NO_GLOB_SUBST
+else
+ case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac
+fi
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+relink_command=\"$relink_command\"
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+ # install mode needs the following variable:
+ notinst_deplibs='$notinst_deplibs'
+else
+ # When we are sourced in execute mode, \$file and \$echo are already set.
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ echo=\"$qecho\"
+ file=\"\$0\"
+ # Make sure echo works.
+ if test \"X\$1\" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+ elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then
+ # Yippee, \$echo works!
+ :
+ else
+ # Restart under the correct shell, and then maybe \$echo will work.
+ exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"}
+ fi
+ fi\
+"
+ $echo >> $output "\
+
+ # Find the directory that this script lives in.
+ thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\`
+ test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+ # Follow symbolic links until we get to the real thisdir.
+ file=\`ls -ld \"\$file\" | ${SED} -n 's/.*-> //p'\`
+ while test -n \"\$file\"; do
+ destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\`
+
+ # If there was a directory component, then change thisdir.
+ if test \"x\$destdir\" != \"x\$file\"; then
+ case \"\$destdir\" in
+ [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;;
+ *) thisdir=\"\$thisdir/\$destdir\" ;;
+ esac
+ fi
+
+ file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\`
+ file=\`ls -ld \"\$thisdir/\$file\" | ${SED} -n 's/.*-> //p'\`
+ done
+
+ # Try to get the absolute directory name.
+ absdir=\`cd \"\$thisdir\" && pwd\`
+ test -n \"\$absdir\" && thisdir=\"\$absdir\"
+"
+
+ if test "$fast_install" = yes; then
+ $echo >> $output "\
+ program=lt-'$outputname'$exeext
+ progdir=\"\$thisdir/$objdir\"
+
+ if test ! -f \"\$progdir/\$program\" || \\
+ { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\
+ test \"X\$file\" != \"X\$progdir/\$program\"; }; then
+
+ file=\"\$\$-\$program\"
+
+ if test ! -d \"\$progdir\"; then
+ $mkdir \"\$progdir\"
+ else
+ $rm \"\$progdir/\$file\"
+ fi"
+
+ $echo >> $output "\
+
+ # relink executable if necessary
+ if test -n \"\$relink_command\"; then
+ if relink_command_output=\`eval \$relink_command 2>&1\`; then :
+ else
+ $echo \"\$relink_command_output\" >&2
+ $rm \"\$progdir/\$file\"
+ exit $EXIT_FAILURE
+ fi
+ fi
+
+ $mv \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null ||
+ { $rm \"\$progdir/\$program\";
+ $mv \"\$progdir/\$file\" \"\$progdir/\$program\"; }
+ $rm \"\$progdir/\$file\"
+ fi"
+ else
+ $echo >> $output "\
+ program='$outputname'
+ progdir=\"\$thisdir/$objdir\"
+"
+ fi
+
+ $echo >> $output "\
+
+ if test -f \"\$progdir/\$program\"; then"
+
+ # Export our shlibpath_var if we have one.
+ if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+ $echo >> $output "\
+ # Add our own library path to $shlibpath_var
+ $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+ # Some systems cannot cope with colon-terminated $shlibpath_var
+ # The second colon is a workaround for a bug in BeOS R4 sed
+ $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/::*\$//'\`
+
+ export $shlibpath_var
+"
+ fi
+
+ # fixup the dll searchpath if we need to.
+ if test -n "$dllsearchpath"; then
+ $echo >> $output "\
+ # Add the dll search path components to the executable PATH
+ PATH=$dllsearchpath:\$PATH
+"
+ fi
+
+ $echo >> $output "\
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ # Run the actual program with our arguments.
+"
+ case $host in
+ # Backslashes separate directories on plain windows
+ *-*-mingw | *-*-os2*)
+ $echo >> $output "\
+ exec \"\$progdir\\\\\$program\" \${1+\"\$@\"}
+"
+ ;;
+
+ *)
+ $echo >> $output "\
+ exec \"\$progdir/\$program\" \${1+\"\$@\"}
+"
+ ;;
+ esac
+ $echo >> $output "\
+ \$echo \"\$0: cannot exec \$program \$*\"
+ exit $EXIT_FAILURE
+ fi
+ else
+ # The program doesn't exist.
+ \$echo \"\$0: error: \\\`\$progdir/\$program' does not exist\" 1>&2
+ \$echo \"This script is just a wrapper for \$program.\" 1>&2
+ $echo \"See the $PACKAGE documentation for more information.\" 1>&2
+ exit $EXIT_FAILURE
+ fi
+fi\
+"
+ chmod +x $output
+ fi
+ exit $EXIT_SUCCESS
+ ;;
+ esac
+
+ # See if we need to build an old-fashioned archive.
+ for oldlib in $oldlibs; do
+
+ if test "$build_libtool_libs" = convenience; then
+ oldobjs="$libobjs_save"
+ addlibs="$convenience"
+ build_libtool_libs=no
+ else
+ if test "$build_libtool_libs" = module; then
+ oldobjs="$libobjs_save"
+ build_libtool_libs=no
+ else
+ oldobjs="$old_deplibs $non_pic_objects"
+ fi
+ addlibs="$old_convenience"
+ fi
+
+ if test -n "$addlibs"; then
+ gentop="$output_objdir/${outputname}x"
+ generated="$generated $gentop"
+
+ func_extract_archives $gentop $addlibs
+ oldobjs="$oldobjs $func_extract_archives_result"
+ fi
+
+ # Do each command in the archive commands.
+ if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then
+ cmds=$old_archive_from_new_cmds
+ else
+ # POSIX demands no paths to be encoded in archives. We have
+ # to avoid creating archives with duplicate basenames if we
+ # might have to extract them afterwards, e.g., when creating a
+ # static archive out of a convenience library, or when linking
+ # the entirety of a libtool archive into another (currently
+ # not supported by libtool).
+ if (for obj in $oldobjs
+ do
+ $echo "X$obj" | $Xsed -e 's%^.*/%%'
+ done | sort | sort -uc >/dev/null 2>&1); then
+ :
+ else
+ $echo "copying selected object files to avoid basename conflicts..."
+
+ if test -z "$gentop"; then
+ gentop="$output_objdir/${outputname}x"
+ generated="$generated $gentop"
+
+ $show "${rm}r $gentop"
+ $run ${rm}r "$gentop"
+ $show "$mkdir $gentop"
+ $run $mkdir "$gentop"
+ exit_status=$?
+ if test "$exit_status" -ne 0 && test ! -d "$gentop"; then
+ exit $exit_status
+ fi
+ fi
+
+ save_oldobjs=$oldobjs
+ oldobjs=
+ counter=1
+ for obj in $save_oldobjs
+ do
+ objbase=`$echo "X$obj" | $Xsed -e 's%^.*/%%'`
+ case " $oldobjs " in
+ " ") oldobjs=$obj ;;
+ *[\ /]"$objbase "*)
+ while :; do
+ # Make sure we don't pick an alternate name that also
+ # overlaps.
+ newobj=lt$counter-$objbase
+ counter=`expr $counter + 1`
+ case " $oldobjs " in
+ *[\ /]"$newobj "*) ;;
+ *) if test ! -f "$gentop/$newobj"; then break; fi ;;
+ esac
+ done
+ $show "ln $obj $gentop/$newobj || cp $obj $gentop/$newobj"
+ $run ln "$obj" "$gentop/$newobj" ||
+ $run cp "$obj" "$gentop/$newobj"
+ oldobjs="$oldobjs $gentop/$newobj"
+ ;;
+ *) oldobjs="$oldobjs $obj" ;;
+ esac
+ done
+ fi
+
+ eval cmds=\"$old_archive_cmds\"
+
+ if len=`expr "X$cmds" : ".*"` &&
+ test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+ cmds=$old_archive_cmds
+ else
+ # the command line is too long to link in one step, link in parts
+ $echo "using piecewise archive linking..."
+ save_RANLIB=$RANLIB
+ RANLIB=:
+ objlist=
+ concat_cmds=
+ save_oldobjs=$oldobjs
+
+ # Is there a better way of finding the last object in the list?
+ for obj in $save_oldobjs
+ do
+ last_oldobj=$obj
+ done
+ for obj in $save_oldobjs
+ do
+ oldobjs="$objlist $obj"
+ objlist="$objlist $obj"
+ eval test_cmds=\"$old_archive_cmds\"
+ if len=`expr "X$test_cmds" : ".*" 2>/dev/null` &&
+ test "$len" -le "$max_cmd_len"; then
+ :
+ else
+ # the above command should be used before it gets too long
+ oldobjs=$objlist
+ if test "$obj" = "$last_oldobj" ; then
+ RANLIB=$save_RANLIB
+ fi
+ test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+ eval concat_cmds=\"\${concat_cmds}$old_archive_cmds\"
+ objlist=
+ fi
+ done
+ RANLIB=$save_RANLIB
+ oldobjs=$objlist
+ if test "X$oldobjs" = "X" ; then
+ eval cmds=\"\$concat_cmds\"
+ else
+ eval cmds=\"\$concat_cmds~\$old_archive_cmds\"
+ fi
+ fi
+ fi
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ eval cmd=\"$cmd\"
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ done
+
+ if test -n "$generated"; then
+ $show "${rm}r$generated"
+ $run ${rm}r$generated
+ fi
+
+ # Now create the libtool archive.
+ case $output in
+ *.la)
+ old_library=
+ test "$build_old_libs" = yes && old_library="$libname.$libext"
+ $show "creating $output"
+
+ # Preserve any variables that may affect compiler behavior
+ for var in $variables_saved_for_relink; do
+ if eval test -z \"\${$var+set}\"; then
+ relink_command="{ test -z \"\${$var+set}\" || unset $var || { $var=; export $var; }; }; $relink_command"
+ elif eval var_value=\$$var; test -z "$var_value"; then
+ relink_command="$var=; export $var; $relink_command"
+ else
+ var_value=`$echo "X$var_value" | $Xsed -e "$sed_quote_subst"`
+ relink_command="$var=\"$var_value\"; export $var; $relink_command"
+ fi
+ done
+ # Quote the link command for shipping.
+ relink_command="(cd `pwd`; $SHELL $progpath $preserve_args --mode=relink $libtool_args @inst_prefix_dir@)"
+ relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e "$sed_quote_subst" | $NL2SP`
+ if test "$hardcode_automatic" = yes ; then
+ relink_command=
+ fi
+
+
+ # Only create the output if not a dry run.
+ if test -z "$run"; then
+ for installed in no yes; do
+ if test "$installed" = yes; then
+ if test -z "$install_libdir"; then
+ break
+ fi
+ output="$output_objdir/$outputname"i
+ # Replace all uninstalled libtool libraries with the installed ones
+ newdependency_libs=
+ for deplib in $dependency_libs; do
+ case $deplib in
+ *.la)
+ name=`$echo "X$deplib" | $Xsed -e 's%^.*/%%'`
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib`
+ if test -z "$libdir"; then
+ $echo "$modename: \`$deplib' is not a valid libtool archive" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ newdependency_libs="$newdependency_libs $libdir/$name"
+ ;;
+ *) newdependency_libs="$newdependency_libs $deplib" ;;
+ esac
+ done
+ dependency_libs="$newdependency_libs"
+ newdlfiles=
+ for lib in $dlfiles; do
+ name=`$echo "X$lib" | $Xsed -e 's%^.*/%%'`
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+ if test -z "$libdir"; then
+ $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ newdlfiles="$newdlfiles $libdir/$name"
+ done
+ dlfiles="$newdlfiles"
+ newdlprefiles=
+ for lib in $dlprefiles; do
+ name=`$echo "X$lib" | $Xsed -e 's%^.*/%%'`
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+ if test -z "$libdir"; then
+ $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ newdlprefiles="$newdlprefiles $libdir/$name"
+ done
+ dlprefiles="$newdlprefiles"
+ else
+ newdlfiles=
+ for lib in $dlfiles; do
+ case $lib in
+ [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+ *) abs=`pwd`"/$lib" ;;
+ esac
+ newdlfiles="$newdlfiles $abs"
+ done
+ dlfiles="$newdlfiles"
+ newdlprefiles=
+ for lib in $dlprefiles; do
+ case $lib in
+ [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+ *) abs=`pwd`"/$lib" ;;
+ esac
+ newdlprefiles="$newdlprefiles $abs"
+ done
+ dlprefiles="$newdlprefiles"
+ fi
+ $rm $output
+ # place dlname in correct position for cygwin
+ tdlname=$dlname
+ case $host,$output,$installed,$module,$dlname in
+ *cygwin*,*lai,yes,no,*.dll | *mingw*,*lai,yes,no,*.dll) tdlname=../bin/$dlname ;;
+ esac
+ $echo > $output "\
+# $outputname - a libtool library file
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# The name that we can dlopen(3).
+dlname='$tdlname'
+
+# Names of this library.
+library_names='$library_names'
+
+# The name of the static archive.
+old_library='$old_library'
+
+# Libraries that this one depends upon.
+dependency_libs='$dependency_libs'
+
+# Version information for $libname.
+current=$current
+age=$age
+revision=$revision
+
+# Is this an already installed library?
+installed=$installed
+
+# Should we warn about portability when linking against -modules?
+shouldnotlink=$module
+
+# Files to dlopen/dlpreopen
+dlopen='$dlfiles'
+dlpreopen='$dlprefiles'
+
+# Directory that this library needs to be installed in:
+libdir='$install_libdir'"
+ if test "$installed" = no && test "$need_relink" = yes; then
+ $echo >> $output "\
+relink_command=\"$relink_command\""
+ fi
+ done
+ fi
+
+ # Do a symbolic link so that the libtool archive can be found in
+ # LD_LIBRARY_PATH before the program is installed.
+ $show "(cd $output_objdir && $rm $outputname && $LN_S ../$outputname $outputname)"
+ $run eval '(cd $output_objdir && $rm $outputname && $LN_S ../$outputname $outputname)' || exit $?
+ ;;
+ esac
+ exit $EXIT_SUCCESS
+ ;;
+
+ # libtool install mode
+ install)
+ modename="$modename: install"
+
+ # There may be an optional sh(1) argument at the beginning of
+ # install_prog (especially on Windows NT).
+ if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh ||
+ # Allow the use of GNU shtool's install command.
+ $echo "X$nonopt" | grep shtool > /dev/null; then
+ # Aesthetically quote it.
+ arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$arg "
+ arg="$1"
+ shift
+ else
+ install_prog=
+ arg=$nonopt
+ fi
+
+ # The real first argument should be the name of the installation program.
+ # Aesthetically quote it.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$install_prog$arg"
+
+ # We need to accept at least all the BSD install flags.
+ dest=
+ files=
+ opts=
+ prev=
+ install_type=
+ isdir=no
+ stripme=
+ for arg
+ do
+ if test -n "$dest"; then
+ files="$files $dest"
+ dest=$arg
+ continue
+ fi
+
+ case $arg in
+ -d) isdir=yes ;;
+ -f)
+ case " $install_prog " in
+ *[\\\ /]cp\ *) ;;
+ *) prev=$arg ;;
+ esac
+ ;;
+ -g | -m | -o) prev=$arg ;;
+ -s)
+ stripme=" -s"
+ continue
+ ;;
+ -*)
+ ;;
+ *)
+ # If the previous option needed an argument, then skip it.
+ if test -n "$prev"; then
+ prev=
+ else
+ dest=$arg
+ continue
+ fi
+ ;;
+ esac
+
+ # Aesthetically quote the argument.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case $arg in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$install_prog $arg"
+ done
+
+ if test -z "$install_prog"; then
+ $echo "$modename: you must specify an install program" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ if test -n "$prev"; then
+ $echo "$modename: the \`$prev' option requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ if test -z "$files"; then
+ if test -z "$dest"; then
+ $echo "$modename: no file or destination specified" 1>&2
+ else
+ $echo "$modename: you must specify a destination" 1>&2
+ fi
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Strip any trailing slash from the destination.
+ dest=`$echo "X$dest" | $Xsed -e 's%/$%%'`
+
+ # Check to see that the destination is a directory.
+ test -d "$dest" && isdir=yes
+ if test "$isdir" = yes; then
+ destdir="$dest"
+ destname=
+ else
+ destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$destdir" = "X$dest" && destdir=.
+ destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'`
+
+ # Not a directory, so check to see that there is only one file specified.
+ set dummy $files
+ if test "$#" -gt 2; then
+ $echo "$modename: \`$dest' is not a directory" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ fi
+ case $destdir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ for file in $files; do
+ case $file in
+ *.lo) ;;
+ *)
+ $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ staticlibs=
+ future_libdirs=
+ current_libdirs=
+ for file in $files; do
+
+ # Do each installation.
+ case $file in
+ *.$libext)
+ # Do the static libraries later.
+ staticlibs="$staticlibs $file"
+ ;;
+
+ *.la)
+ # Check to see that this really is a libtool archive.
+ if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$file' is not a valid libtool archive" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ library_names=
+ old_library=
+ relink_command=
+ # If there is no directory component, then add one.
+ case $file in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Add the libdir to current_libdirs if it is the destination.
+ if test "X$destdir" = "X$libdir"; then
+ case "$current_libdirs " in
+ *" $libdir "*) ;;
+ *) current_libdirs="$current_libdirs $libdir" ;;
+ esac
+ else
+ # Note the libdir as a future libdir.
+ case "$future_libdirs " in
+ *" $libdir "*) ;;
+ *) future_libdirs="$future_libdirs $libdir" ;;
+ esac
+ fi
+
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/
+ test "X$dir" = "X$file/" && dir=
+ dir="$dir$objdir"
+
+ if test -n "$relink_command"; then
+ # Determine the prefix the user has applied to our future dir.
+ inst_prefix_dir=`$echo "$destdir" | $SED "s%$libdir\$%%"`
+
+ # Don't allow the user to place us outside of our expected
+ # location b/c this prevents finding dependent libraries that
+ # are installed to the same prefix.
+ # At present, this check doesn't affect windows .dll's that
+ # are installed into $libdir/../bin (currently, that works fine)
+ # but it's something to keep an eye on.
+ if test "$inst_prefix_dir" = "$destdir"; then
+ $echo "$modename: error: cannot install \`$file' to a directory not ending in $libdir" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ if test -n "$inst_prefix_dir"; then
+ # Stick the inst_prefix_dir data into the link command.
+ relink_command=`$echo "$relink_command" | $SP2NL | $SED "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%" | $NL2SP`
+ else
+ relink_command=`$echo "$relink_command" | $SP2NL | $SED "s%@inst_prefix_dir@%%" | $NL2SP`
+ fi
+
+ $echo "$modename: warning: relinking \`$file'" 1>&2
+ $show "$relink_command"
+ if $run eval "$relink_command"; then :
+ else
+ $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ fi
+
+ # See the names of the shared library.
+ set dummy $library_names
+ if test -n "$2"; then
+ realname="$2"
+ shift
+ shift
+
+ srcname="$realname"
+ test -n "$relink_command" && srcname="$realname"T
+
+ # Install the shared library and build the symlinks.
+ $show "$install_prog $dir/$srcname $destdir/$realname"
+ $run eval "$install_prog $dir/$srcname $destdir/$realname" || exit $?
+ if test -n "$stripme" && test -n "$striplib"; then
+ $show "$striplib $destdir/$realname"
+ $run eval "$striplib $destdir/$realname" || exit $?
+ fi
+
+ if test "$#" -gt 0; then
+ # Delete the old symlinks, and create new ones.
+ # Try `ln -sf' first, because the `ln' binary might depend on
+ # the symlink we replace! Solaris /bin/ln does not understand -f,
+ # so we also need to try rm && ln -s.
+ for linkname
+ do
+ if test "$linkname" != "$realname"; then
+ $show "(cd $destdir && { $LN_S -f $realname $linkname || { $rm $linkname && $LN_S $realname $linkname; }; })"
+ $run eval "(cd $destdir && { $LN_S -f $realname $linkname || { $rm $linkname && $LN_S $realname $linkname; }; })"
+ fi
+ done
+ fi
+
+ # Do each command in the postinstall commands.
+ lib="$destdir/$realname"
+ cmds=$postinstall_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || {
+ lt_exit=$?
+
+ # Restore the uninstalled library and exit
+ if test "$mode" = relink; then
+ $run eval '(cd $output_objdir && $rm ${realname}T && $mv ${realname}U $realname)'
+ fi
+
+ exit $lt_exit
+ }
+ done
+ IFS="$save_ifs"
+ fi
+
+ # Install the pseudo-library for information purposes.
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ instname="$dir/$name"i
+ $show "$install_prog $instname $destdir/$name"
+ $run eval "$install_prog $instname $destdir/$name" || exit $?
+
+ # Maybe install the static library, too.
+ test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library"
+ ;;
+
+ *.lo)
+ # Install (i.e. copy) a libtool object.
+
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ destfile="$destdir/$destfile"
+ fi
+
+ # Deduce the name of the destination old-style object file.
+ case $destfile in
+ *.lo)
+ staticdest=`$echo "X$destfile" | $Xsed -e "$lo2o"`
+ ;;
+ *.$objext)
+ staticdest="$destfile"
+ destfile=
+ ;;
+ *)
+ $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ # Install the libtool object if requested.
+ if test -n "$destfile"; then
+ $show "$install_prog $file $destfile"
+ $run eval "$install_prog $file $destfile" || exit $?
+ fi
+
+ # Install the old object if enabled.
+ if test "$build_old_libs" = yes; then
+ # Deduce the name of the old-style object file.
+ staticobj=`$echo "X$file" | $Xsed -e "$lo2o"`
+
+ $show "$install_prog $staticobj $staticdest"
+ $run eval "$install_prog \$staticobj \$staticdest" || exit $?
+ fi
+ exit $EXIT_SUCCESS
+ ;;
+
+ *)
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ destfile="$destdir/$destfile"
+ fi
+
+ # If the file is missing, and there is a .exe on the end, strip it
+ # because it is most likely a libtool script we actually want to
+ # install
+ stripped_ext=""
+ case $file in
+ *.exe)
+ if test ! -f "$file"; then
+ file=`$echo $file|${SED} 's,.exe$,,'`
+ stripped_ext=".exe"
+ fi
+ ;;
+ esac
+
+ # Do a test to see if this is really a libtool program.
+ case $host in
+ *cygwin*|*mingw*)
+ wrapper=`$echo $file | ${SED} -e 's,.exe$,,'`
+ ;;
+ *)
+ wrapper=$file
+ ;;
+ esac
+ if (${SED} -e '4q' $wrapper | grep "^# Generated by .*$PACKAGE")>/dev/null 2>&1; then
+ notinst_deplibs=
+ relink_command=
+
+ # Note that it is not necessary on cygwin/mingw to append a dot to
+ # foo even if both foo and FILE.exe exist: automatic-append-.exe
+ # behavior happens only for exec(3), not for open(2)! Also, sourcing
+ # `FILE.' does not work on cygwin managed mounts.
+ #
+ # If there is no directory component, then add one.
+ case $wrapper in
+ */* | *\\*) . ${wrapper} ;;
+ *) . ./${wrapper} ;;
+ esac
+
+ # Check the variables that should have been set.
+ if test -z "$notinst_deplibs"; then
+ $echo "$modename: invalid libtool wrapper script \`$wrapper'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ finalize=yes
+ for lib in $notinst_deplibs; do
+ # Check to see that each library is installed.
+ libdir=
+ if test -f "$lib"; then
+ # If there is no directory component, then add one.
+ case $lib in
+ */* | *\\*) . $lib ;;
+ *) . ./$lib ;;
+ esac
+ fi
+ libfile="$libdir/"`$echo "X$lib" | $Xsed -e 's%^.*/%%g'` ### testsuite: skip nested quoting test
+ if test -n "$libdir" && test ! -f "$libfile"; then
+ $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2
+ finalize=no
+ fi
+ done
+
+ relink_command=
+ # Note that it is not necessary on cygwin/mingw to append a dot to
+ # foo even if both foo and FILE.exe exist: automatic-append-.exe
+ # behavior happens only for exec(3), not for open(2)! Also, sourcing
+ # `FILE.' does not work on cygwin managed mounts.
+ #
+ # If there is no directory component, then add one.
+ case $wrapper in
+ */* | *\\*) . ${wrapper} ;;
+ *) . ./${wrapper} ;;
+ esac
+
+ outputname=
+ if test "$fast_install" = no && test -n "$relink_command"; then
+ if test "$finalize" = yes && test -z "$run"; then
+ tmpdir=`func_mktempdir`
+ file=`$echo "X$file$stripped_ext" | $Xsed -e 's%^.*/%%'`
+ outputname="$tmpdir/$file"
+ # Replace the output file specification.
+ relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e 's%@OUTPUT@%'"$outputname"'%g' | $NL2SP`
+
+ $show "$relink_command"
+ if $run eval "$relink_command"; then :
+ else
+ $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2
+ ${rm}r "$tmpdir"
+ continue
+ fi
+ file="$outputname"
+ else
+ $echo "$modename: warning: cannot relink \`$file'" 1>&2
+ fi
+ else
+ # Install the binary that we compiled earlier.
+ file=`$echo "X$file$stripped_ext" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"`
+ fi
+ fi
+
+ # remove .exe since cygwin /usr/bin/install will append another
+ # one anyway
+ case $install_prog,$host in
+ */usr/bin/install*,*cygwin*)
+ case $file:$destfile in
+ *.exe:*.exe)
+ # this is ok
+ ;;
+ *.exe:*)
+ destfile=$destfile.exe
+ ;;
+ *:*.exe)
+ destfile=`$echo $destfile | ${SED} -e 's,.exe$,,'`
+ ;;
+ esac
+ ;;
+ esac
+ $show "$install_prog$stripme $file $destfile"
+ $run eval "$install_prog\$stripme \$file \$destfile" || exit $?
+ test -n "$outputname" && ${rm}r "$tmpdir"
+ ;;
+ esac
+ done
+
+ for file in $staticlibs; do
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+
+ # Set up the ranlib parameters.
+ oldlib="$destdir/$name"
+
+ $show "$install_prog $file $oldlib"
+ $run eval "$install_prog \$file \$oldlib" || exit $?
+
+ if test -n "$stripme" && test -n "$old_striplib"; then
+ $show "$old_striplib $oldlib"
+ $run eval "$old_striplib $oldlib" || exit $?
+ fi
+
+ # Do each command in the postinstall commands.
+ cmds=$old_postinstall_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ done
+
+ if test -n "$future_libdirs"; then
+ $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2
+ fi
+
+ if test -n "$current_libdirs"; then
+ # Maybe just do a dry run.
+ test -n "$run" && current_libdirs=" -n$current_libdirs"
+ exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs'
+ else
+ exit $EXIT_SUCCESS
+ fi
+ ;;
+
+ # libtool finish mode
+ finish)
+ modename="$modename: finish"
+ libdirs="$nonopt"
+ admincmds=
+
+ if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+ for dir
+ do
+ libdirs="$libdirs $dir"
+ done
+
+ for libdir in $libdirs; do
+ if test -n "$finish_cmds"; then
+ # Do each command in the finish commands.
+ cmds=$finish_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd" || admincmds="$admincmds
+ $cmd"
+ done
+ IFS="$save_ifs"
+ fi
+ if test -n "$finish_eval"; then
+ # Do the single finish_eval.
+ eval cmds=\"$finish_eval\"
+ $run eval "$cmds" || admincmds="$admincmds
+ $cmds"
+ fi
+ done
+ fi
+
+ # Exit here if they wanted silent mode.
+ test "$show" = : && exit $EXIT_SUCCESS
+
+ $echo "X----------------------------------------------------------------------" | $Xsed
+ $echo "Libraries have been installed in:"
+ for libdir in $libdirs; do
+ $echo " $libdir"
+ done
+ $echo
+ $echo "If you ever happen to want to link against installed libraries"
+ $echo "in a given directory, LIBDIR, you must either use libtool, and"
+ $echo "specify the full pathname of the library, or use the \`-LLIBDIR'"
+ $echo "flag during linking and do at least one of the following:"
+ if test -n "$shlibpath_var"; then
+ $echo " - add LIBDIR to the \`$shlibpath_var' environment variable"
+ $echo " during execution"
+ fi
+ if test -n "$runpath_var"; then
+ $echo " - add LIBDIR to the \`$runpath_var' environment variable"
+ $echo " during linking"
+ fi
+ if test -n "$hardcode_libdir_flag_spec"; then
+ libdir=LIBDIR
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ $echo " - use the \`$flag' linker flag"
+ fi
+ if test -n "$admincmds"; then
+ $echo " - have your system administrator run these commands:$admincmds"
+ fi
+ if test -f /etc/ld.so.conf; then
+ $echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+ fi
+ $echo
+ $echo "See any operating system documentation about shared libraries for"
+ $echo "more information, such as the ld(1) and ld.so(8) manual pages."
+ $echo "X----------------------------------------------------------------------" | $Xsed
+ exit $EXIT_SUCCESS
+ ;;
+
+ # libtool execute mode
+ execute)
+ modename="$modename: execute"
+
+ # The first argument is the command name.
+ cmd="$nonopt"
+ if test -z "$cmd"; then
+ $echo "$modename: you must specify a COMMAND" 1>&2
+ $echo "$help"
+ exit $EXIT_FAILURE
+ fi
+
+ # Handle -dlopen flags immediately.
+ for file in $execute_dlfiles; do
+ if test ! -f "$file"; then
+ $echo "$modename: \`$file' is not a file" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ dir=
+ case $file in
+ *.la)
+ # Check to see that this really is a libtool archive.
+ if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Read the libtool library.
+ dlname=
+ library_names=
+
+ # If there is no directory component, then add one.
+ case $file in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Skip this library if it cannot be dlopened.
+ if test -z "$dlname"; then
+ # Warn if it was a shared library.
+ test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'"
+ continue
+ fi
+
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$file" && dir=.
+
+ if test -f "$dir/$objdir/$dlname"; then
+ dir="$dir/$objdir"
+ else
+ $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2
+ exit $EXIT_FAILURE
+ fi
+ ;;
+
+ *.lo)
+ # Just add the directory containing the .lo file.
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$file" && dir=.
+ ;;
+
+ *)
+ $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2
+ continue
+ ;;
+ esac
+
+ # Get the absolute pathname.
+ absdir=`cd "$dir" && pwd`
+ test -n "$absdir" && dir="$absdir"
+
+ # Now add the directory to shlibpath_var.
+ if eval "test -z \"\$$shlibpath_var\""; then
+ eval "$shlibpath_var=\"\$dir\""
+ else
+ eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+ fi
+ done
+
+ # This variable tells wrapper scripts just to set shlibpath_var
+ # rather than running their programs.
+ libtool_execute_magic="$magic"
+
+ # Check if any of the arguments is a wrapper script.
+ args=
+ for file
+ do
+ case $file in
+ -*) ;;
+ *)
+ # Do a test to see if this is really a libtool program.
+ if (${SED} -e '4q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ # If there is no directory component, then add one.
+ case $file in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ fi
+ ;;
+ esac
+ # Quote arguments (to preserve shell metacharacters).
+ file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"`
+ args="$args \"$file\""
+ done
+
+ if test -z "$run"; then
+ if test -n "$shlibpath_var"; then
+ # Export the shlibpath_var.
+ eval "export $shlibpath_var"
+ fi
+
+ # Restore saved environment variables
+ for lt_var in LANG LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+ do
+ eval "if test \"\${save_$lt_var+set}\" = set; then
+ $lt_var=\$save_$lt_var; export $lt_var
+ else
+ $lt_unset $lt_var
+ fi"
+ done
+
+
+ # Now prepare to actually exec the command.
+ exec_cmd="\$cmd$args"
+ else
+ # Display what would be done.
+ if test -n "$shlibpath_var"; then
+ eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\""
+ $echo "export $shlibpath_var"
+ fi
+ $echo "$cmd$args"
+ exit $EXIT_SUCCESS
+ fi
+ ;;
+
+ # libtool clean and uninstall mode
+ clean | uninstall)
+ modename="$modename: $mode"
+ rm="$nonopt"
+ files=
+ rmforce=
+ exit_status=0
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ for arg
+ do
+ case $arg in
+ -f) rm="$rm $arg"; rmforce=yes ;;
+ -*) rm="$rm $arg" ;;
+ *) files="$files $arg" ;;
+ esac
+ done
+
+ if test -z "$rm"; then
+ $echo "$modename: you must specify an RM program" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ rmdirs=
+
+ origobjdir="$objdir"
+ for file in $files; do
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$dir" = "X$file"; then
+ dir=.
+ objdir="$origobjdir"
+ else
+ objdir="$dir/$origobjdir"
+ fi
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ test "$mode" = uninstall && objdir="$dir"
+
+ # Remember objdir for removal later, being careful to avoid duplicates
+ if test "$mode" = clean; then
+ case " $rmdirs " in
+ *" $objdir "*) ;;
+ *) rmdirs="$rmdirs $objdir" ;;
+ esac
+ fi
+
+ # Don't error if the file doesn't exist and rm -f was used.
+ if (test -L "$file") >/dev/null 2>&1 \
+ || (test -h "$file") >/dev/null 2>&1 \
+ || test -f "$file"; then
+ :
+ elif test -d "$file"; then
+ exit_status=1
+ continue
+ elif test "$rmforce" = yes; then
+ continue
+ fi
+
+ rmfiles="$file"
+
+ case $name in
+ *.la)
+ # Possibly a libtool archive, so verify it.
+ if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ . $dir/$name
+
+ # Delete the libtool libraries and symlinks.
+ for n in $library_names; do
+ rmfiles="$rmfiles $objdir/$n"
+ done
+ test -n "$old_library" && rmfiles="$rmfiles $objdir/$old_library"
+
+ case "$mode" in
+ clean)
+ case " $library_names " in
+ # " " in the beginning catches empty $dlname
+ *" $dlname "*) ;;
+ *) rmfiles="$rmfiles $objdir/$dlname" ;;
+ esac
+ test -n "$libdir" && rmfiles="$rmfiles $objdir/$name $objdir/${name}i"
+ ;;
+ uninstall)
+ if test -n "$library_names"; then
+ # Do each command in the postuninstall commands.
+ cmds=$postuninstall_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd"
+ if test "$?" -ne 0 && test "$rmforce" != yes; then
+ exit_status=1
+ fi
+ done
+ IFS="$save_ifs"
+ fi
+
+ if test -n "$old_library"; then
+ # Do each command in the old_postuninstall commands.
+ cmds=$old_postuninstall_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $show "$cmd"
+ $run eval "$cmd"
+ if test "$?" -ne 0 && test "$rmforce" != yes; then
+ exit_status=1
+ fi
+ done
+ IFS="$save_ifs"
+ fi
+ # FIXME: should reinstall the best remaining shared library.
+ ;;
+ esac
+ fi
+ ;;
+
+ *.lo)
+ # Possibly a libtool object, so verify it.
+ if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+
+ # Read the .lo file
+ . $dir/$name
+
+ # Add PIC object to the list of files to remove.
+ if test -n "$pic_object" \
+ && test "$pic_object" != none; then
+ rmfiles="$rmfiles $dir/$pic_object"
+ fi
+
+ # Add non-PIC object to the list of files to remove.
+ if test -n "$non_pic_object" \
+ && test "$non_pic_object" != none; then
+ rmfiles="$rmfiles $dir/$non_pic_object"
+ fi
+ fi
+ ;;
+
+ *)
+ if test "$mode" = clean ; then
+ noexename=$name
+ case $file in
+ *.exe)
+ file=`$echo $file|${SED} 's,.exe$,,'`
+ noexename=`$echo $name|${SED} 's,.exe$,,'`
+ # $file with .exe has already been added to rmfiles,
+ # add $file without .exe
+ rmfiles="$rmfiles $file"
+ ;;
+ esac
+ # Do a test to see if this is a libtool program.
+ if (${SED} -e '4q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ relink_command=
+ . $dir/$noexename
+
+ # note $name still contains .exe if it was in $file originally
+ # as does the version of $file that was added into $rmfiles
+ rmfiles="$rmfiles $objdir/$name $objdir/${name}S.${objext}"
+ if test "$fast_install" = yes && test -n "$relink_command"; then
+ rmfiles="$rmfiles $objdir/lt-$name"
+ fi
+ if test "X$noexename" != "X$name" ; then
+ rmfiles="$rmfiles $objdir/lt-${noexename}.c"
+ fi
+ fi
+ fi
+ ;;
+ esac
+ $show "$rm $rmfiles"
+ $run $rm $rmfiles || exit_status=1
+ done
+ objdir="$origobjdir"
+
+ # Try to remove the ${objdir}s in the directories where we deleted files
+ for dir in $rmdirs; do
+ if test -d "$dir"; then
+ $show "rmdir $dir"
+ $run rmdir $dir >/dev/null 2>&1
+ fi
+ done
+
+ exit $exit_status
+ ;;
+
+ "")
+ $echo "$modename: you must specify a MODE" 1>&2
+ $echo "$generic_help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+ esac
+
+ if test -z "$exec_cmd"; then
+ $echo "$modename: invalid operation mode \`$mode'" 1>&2
+ $echo "$generic_help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+fi # test -z "$show_help"
+
+if test -n "$exec_cmd"; then
+ eval exec $exec_cmd
+ exit $EXIT_FAILURE
+fi
+
+# We need to display help for each of the modes.
+case $mode in
+"") $echo \
+"Usage: $modename [OPTION]... [MODE-ARG]...
+
+Provide generalized library-building support services.
+
+ --config show all configuration variables
+ --debug enable verbose shell tracing
+-n, --dry-run display commands without modifying any files
+ --features display basic configuration information and exit
+ --finish same as \`--mode=finish'
+ --help display this help message and exit
+ --mode=MODE use operation mode MODE [default=inferred from MODE-ARGS]
+ --quiet same as \`--silent'
+ --silent don't print informational messages
+ --tag=TAG use configuration variables from tag TAG
+ --version print version information
+
+MODE must be one of the following:
+
+ clean remove files from the build directory
+ compile compile a source file into a libtool object
+ execute automatically set library path, then run a program
+ finish complete the installation of libtool libraries
+ install install libraries or executables
+ link create a library or an executable
+ uninstall remove libraries from an installed directory
+
+MODE-ARGS vary depending on the MODE. Try \`$modename --help --mode=MODE' for
+a more detailed description of MODE.
+
+Report bugs to <bug-libtool@gnu.org>."
+ exit $EXIT_SUCCESS
+ ;;
+
+clean)
+ $echo \
+"Usage: $modename [OPTION]... --mode=clean RM [RM-OPTION]... FILE...
+
+Remove files from the build directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, object or program, all the files associated
+with it are deleted. Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+compile)
+ $echo \
+"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+ -o OUTPUT-FILE set the output file name to OUTPUT-FILE
+ -prefer-pic try to building PIC objects only
+ -prefer-non-pic try to building non-PIC objects only
+ -static always build a \`.o' file suitable for static linking
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+ ;;
+
+execute)
+ $echo \
+"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+ -dlopen FILE add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+ ;;
+
+finish)
+ $echo \
+"Usage: $modename [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges. Use
+the \`--dry-run' option if you just want to see what would be executed."
+ ;;
+
+install)
+ $echo \
+"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command. The first component should be
+either the \`install' or \`cp' program.
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+ ;;
+
+link)
+ $echo \
+"Usage: $modename [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+ -all-static do not do any dynamic linking at all
+ -avoid-version do not add a version suffix if possible
+ -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime
+ -dlpreopen FILE link in FILE and add its symbols to lt_preloaded_symbols
+ -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+ -export-symbols SYMFILE
+ try to export only the symbols listed in SYMFILE
+ -export-symbols-regex REGEX
+ try to export only the symbols matching REGEX
+ -LLIBDIR search LIBDIR for required installed libraries
+ -lNAME OUTPUT-FILE requires the installed library libNAME
+ -module build a library that can dlopened
+ -no-fast-install disable the fast-install mode
+ -no-install link a not-installable executable
+ -no-undefined declare that a library does not refer to external symbols
+ -o OUTPUT-FILE create OUTPUT-FILE from the specified objects
+ -objectlist FILE Use a list of object files found in FILE to specify objects
+ -precious-files-regex REGEX
+ don't remove output files matching REGEX
+ -release RELEASE specify package release information
+ -rpath LIBDIR the created library will eventually be installed in LIBDIR
+ -R[ ]LIBDIR add LIBDIR to the runtime path of programs and libraries
+ -static do not do any dynamic linking of uninstalled libtool libraries
+ -static-libtool-libs
+ do not do any dynamic linking of libtool libraries
+ -version-info CURRENT[:REVISION[:AGE]]
+ specify library version info [each variable defaults to 0]
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename. Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created,
+only library objects (\`.lo' files) may be specified, and \`-rpath' is
+required, except when creating a convenience library.
+
+If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created
+using \`ar' and \`ranlib', or on Windows using \`lib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file
+is created, otherwise an executable program is created."
+ ;;
+
+uninstall)
+ $echo \
+"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+*)
+ $echo "$modename: invalid operation mode \`$mode'" 1>&2
+ $echo "$help" 1>&2
+ exit $EXIT_FAILURE
+ ;;
+esac
+
+$echo
+$echo "Try \`$modename --help' for more information about other modes."
+
+exit $?
+
+# The TAGs below are defined such that we never get into a situation
+# in which we disable both kinds of libraries. Given conflicting
+# choices, we go for a static library, that is the most portable,
+# since we can't tell whether shared libraries were disabled because
+# the user asked for that or because the platform doesn't support
+# them. This is particularly important on AIX, because we don't
+# support having both static and shared libraries enabled at the same
+# time on that platform, so we default to a shared-only configuration.
+# If a disable-shared tag is given, we'll fallback to a static-only
+# configuration. But we'll never go from static-only to shared-only.
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-shared
+disable_libs=shared
+# ### END LIBTOOL TAG CONFIG: disable-shared
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-static
+disable_libs=static
+# ### END LIBTOOL TAG CONFIG: disable-static
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
diff --git a/driver/xf86-input-mouse/man/Makefile.am b/driver/xf86-input-mouse/man/Makefile.am
new file mode 100644
index 000000000..cc34e01d9
--- /dev/null
+++ b/driver/xf86-input-mouse/man/Makefile.am
@@ -0,0 +1,59 @@
+# $Id: Makefile.am,v 1.1 2006/11/26 19:55:03 matthieu Exp $
+#
+# Copyright 2005 Sun Microsystems, Inc. All rights reserved.
+#
+# Permission to use, copy, modify, distribute, and sell this software and its
+# documentation for any purpose is hereby granted without fee, provided that
+# the above copyright notice appear in all copies and that both that
+# copyright notice and this permission notice appear in supporting
+# documentation.
+#
+# The above copyright notice and this permission notice shall be included
+# in all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+# IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+# OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+# ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+# OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the copyright holders shall
+# not be used in advertising or otherwise to promote the sale, use or
+# other dealings in this Software without prior written authorization
+# from the copyright holders.
+#
+
+drivermandir = $(DRIVER_MAN_DIR)
+
+driverman_PRE = mousedrv.man
+
+driverman_DATA = $(driverman_PRE:man=@DRIVER_MAN_SUFFIX@)
+
+EXTRA_DIST = mousedrv.man
+
+CLEANFILES = $(driverman_DATA)
+
+SED = sed
+
+# Strings to replace in man pages
+XORGRELSTRING = @PACKAGE_STRING@
+ XORGMANNAME = X Version 11
+
+MAN_SUBSTS = \
+ -e 's|__vendorversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \
+ -e 's|__xorgversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \
+ -e 's|__xservername__|Xorg|g' \
+ -e 's|__xconfigfile__|xorg.conf|g' \
+ -e 's|__projectroot__|$(prefix)|g' \
+ -e 's|__appmansuffix__|$(APP_MAN_SUFFIX)|g' \
+ -e 's|__drivermansuffix__|$(DRIVER_MAN_SUFFIX)|g' \
+ -e 's|__adminmansuffix__|$(ADMIN_MAN_SUFFIX)|g' \
+ -e 's|__miscmansuffix__|$(MISC_MAN_SUFFIX)|g' \
+ -e 's|__filemansuffix__|$(FILE_MAN_SUFFIX)|g'
+
+SUFFIXES = .$(DRIVER_MAN_SUFFIX) .man
+
+.man.$(DRIVER_MAN_SUFFIX):
+ sed $(MAN_SUBSTS) < $< > $@
diff --git a/driver/xf86-input-mouse/man/Makefile.in b/driver/xf86-input-mouse/man/Makefile.in
new file mode 100644
index 000000000..24e21b823
--- /dev/null
+++ b/driver/xf86-input-mouse/man/Makefile.in
@@ -0,0 +1,425 @@
+# Makefile.in generated by automake 1.9.6 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# $Id: Makefile.in,v 1.1 2006/11/26 19:55:03 matthieu Exp $
+#
+# Copyright 2005 Sun Microsystems, Inc. All rights reserved.
+#
+# Permission to use, copy, modify, distribute, and sell this software and its
+# documentation for any purpose is hereby granted without fee, provided that
+# the above copyright notice appear in all copies and that both that
+# copyright notice and this permission notice appear in supporting
+# documentation.
+#
+# The above copyright notice and this permission notice shall be included
+# in all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+# IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR
+# OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+# ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+# OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the copyright holders shall
+# not be used in advertising or otherwise to promote the sale, use or
+# other dealings in this Software without prior written authorization
+# from the copyright holders.
+#
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+top_builddir = ..
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+INSTALL = @INSTALL@
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = man
+DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES =
+SOURCES =
+DIST_SOURCES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = `echo $$p | sed -e 's|^.*/||'`;
+am__installdirs = "$(DESTDIR)$(drivermandir)"
+drivermanDATA_INSTALL = $(INSTALL_DATA)
+DATA = $(driverman_DATA)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+ADMIN_MAN_DIR = @ADMIN_MAN_DIR@
+ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@
+AMDEP_FALSE = @AMDEP_FALSE@
+AMDEP_TRUE = @AMDEP_TRUE@
+AMTAR = @AMTAR@
+APP_MAN_DIR = @APP_MAN_DIR@
+APP_MAN_SUFFIX = @APP_MAN_SUFFIX@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@
+BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@
+BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@
+BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DRIVER_MAN_DIR = @DRIVER_MAN_DIR@
+DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@
+DRIVER_NAME = @DRIVER_NAME@
+ECHO = @ECHO@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+F77 = @F77@
+FFLAGS = @FFLAGS@
+FILE_MAN_DIR = @FILE_MAN_DIR@
+FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIB_MAN_DIR = @LIB_MAN_DIR@
+LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@
+LINUXDOC = @LINUXDOC@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAINT = @MAINT@
+MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@
+MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@
+MAKEINFO = @MAKEINFO@
+MAKE_HTML = @MAKE_HTML@
+MAKE_PDF = @MAKE_PDF@
+MAKE_PS = @MAKE_PS@
+MAKE_TEXT = @MAKE_TEXT@
+MISC_MAN_DIR = @MISC_MAN_DIR@
+MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@
+OBJEXT = @OBJEXT@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+PS2PDF = @PS2PDF@
+RANLIB = @RANLIB@
+SED = sed
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+XORG_CFLAGS = @XORG_CFLAGS@
+XORG_LIBS = @XORG_LIBS@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_F77 = @ac_ct_F77@
+ac_ct_RANLIB = @ac_ct_RANLIB@
+ac_ct_STRIP = @ac_ct_STRIP@
+ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@
+am__fastdepCC_FALSE = @am__fastdepCC_FALSE@
+am__fastdepCC_TRUE = @am__fastdepCC_TRUE@
+am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@
+am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+datadir = @datadir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+includedir = @includedir@
+infodir = @infodir@
+inputdir = @inputdir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+drivermandir = $(DRIVER_MAN_DIR)
+driverman_PRE = mousedrv.man
+driverman_DATA = $(driverman_PRE:man=@DRIVER_MAN_SUFFIX@)
+EXTRA_DIST = mousedrv.man
+CLEANFILES = $(driverman_DATA)
+
+# Strings to replace in man pages
+XORGRELSTRING = @PACKAGE_STRING@
+XORGMANNAME = X Version 11
+MAN_SUBSTS = \
+ -e 's|__vendorversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \
+ -e 's|__xorgversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \
+ -e 's|__xservername__|Xorg|g' \
+ -e 's|__xconfigfile__|xorg.conf|g' \
+ -e 's|__projectroot__|$(prefix)|g' \
+ -e 's|__appmansuffix__|$(APP_MAN_SUFFIX)|g' \
+ -e 's|__drivermansuffix__|$(DRIVER_MAN_SUFFIX)|g' \
+ -e 's|__adminmansuffix__|$(ADMIN_MAN_SUFFIX)|g' \
+ -e 's|__miscmansuffix__|$(MISC_MAN_SUFFIX)|g' \
+ -e 's|__filemansuffix__|$(FILE_MAN_SUFFIX)|g'
+
+SUFFIXES = .$(DRIVER_MAN_SUFFIX) .man
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .$(DRIVER_MAN_SUFFIX) .man
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu man/Makefile'; \
+ cd $(top_srcdir) && \
+ $(AUTOMAKE) --gnu man/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool
+uninstall-info-am:
+install-drivermanDATA: $(driverman_DATA)
+ @$(NORMAL_INSTALL)
+ test -z "$(drivermandir)" || $(mkdir_p) "$(DESTDIR)$(drivermandir)"
+ @list='$(driverman_DATA)'; for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ f=$(am__strip_dir) \
+ echo " $(drivermanDATA_INSTALL) '$$d$$p' '$(DESTDIR)$(drivermandir)/$$f'"; \
+ $(drivermanDATA_INSTALL) "$$d$$p" "$(DESTDIR)$(drivermandir)/$$f"; \
+ done
+
+uninstall-drivermanDATA:
+ @$(NORMAL_UNINSTALL)
+ @list='$(driverman_DATA)'; for p in $$list; do \
+ f=$(am__strip_dir) \
+ echo " rm -f '$(DESTDIR)$(drivermandir)/$$f'"; \
+ rm -f "$(DESTDIR)$(drivermandir)/$$f"; \
+ done
+tags: TAGS
+TAGS:
+
+ctags: CTAGS
+CTAGS:
+
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \
+ list='$(DISTFILES)'; for file in $$list; do \
+ case $$file in \
+ $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \
+ $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \
+ esac; \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test "$$dir" != "$$file" && test "$$dir" != "."; then \
+ dir="/$$dir"; \
+ $(mkdir_p) "$(distdir)$$dir"; \
+ else \
+ dir=''; \
+ fi; \
+ if test -d $$d/$$file; then \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \
+ fi; \
+ cp -pR $$d/$$file $(distdir)$$dir || exit 1; \
+ else \
+ test -f $(distdir)/$$file \
+ || cp -p $$d/$$file $(distdir)/$$file \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile $(DATA)
+installdirs:
+ for dir in "$(DESTDIR)$(drivermandir)"; do \
+ test -z "$$dir" || $(mkdir_p) "$$dir"; \
+ done
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ `test -z '$(STRIP)' || \
+ echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+ -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES)
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-libtool
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+info: info-am
+
+info-am:
+
+install-data-am: install-drivermanDATA
+
+install-exec-am:
+
+install-info: install-info-am
+
+install-man:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am: uninstall-drivermanDATA uninstall-info-am
+
+.PHONY: all all-am check check-am clean clean-generic clean-libtool \
+ distclean distclean-generic distclean-libtool distdir dvi \
+ dvi-am html html-am info info-am install install-am \
+ install-data install-data-am install-drivermanDATA \
+ install-exec install-exec-am install-info install-info-am \
+ install-man install-strip installcheck installcheck-am \
+ installdirs maintainer-clean maintainer-clean-generic \
+ mostlyclean mostlyclean-generic mostlyclean-libtool pdf pdf-am \
+ ps ps-am uninstall uninstall-am uninstall-drivermanDATA \
+ uninstall-info-am
+
+
+.man.$(DRIVER_MAN_SUFFIX):
+ sed $(MAN_SUBSTS) < $< > $@
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/driver/xf86-input-mouse/man/mousedrv.man b/driver/xf86-input-mouse/man/mousedrv.man
new file mode 100644
index 000000000..231935c40
--- /dev/null
+++ b/driver/xf86-input-mouse/man/mousedrv.man
@@ -0,0 +1,248 @@
+.\" $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.man,v 1.6 2003/04/03 22:18:31 dawes Exp $
+.\" shorthand for double quote that works everywhere.
+.ds q \N'34'
+.TH MOUSE __drivermansuffix__ __vendorversion__
+.SH NAME
+mouse \- Mouse input driver
+.SH SYNOPSIS
+.nf
+.B "Section \*qInputDevice\*q"
+.BI " Identifier \*q" idevname \*q
+.B " Driver \*qmouse\*q"
+.BI " Option \*qProtocol\*q \*q" protoname \*q
+.BI " Option \*qDevice\*q \*q" devpath \*q
+\ \ ...
+.B EndSection
+.fi
+.SH DESCRIPTION
+.B mouse
+is an __xservername__ input driver for mice. The driver supports most available
+mouse types and interfaces. USB mice are only supported on some OSs,
+and the level of support for PS/2 mice depends on the OS.
+.PP
+The
+.B mouse
+driver functions as a pointer input device, and may be used as the
+X server's core pointer. Multiple mice are supported by multiple
+instances of this driver.
+.SH SUPPORTED HARDWARE
+There is a detailed list of hardware that the
+.B mouse
+driver supports in the
+.I README.mouse
+document. This can be found
+in __projectroot__/lib/X11/doc/, or online at
+http://www.x.org/current/mouse.html.
+.SH CONFIGURATION DETAILS
+Please refer to __xconfigfile__(__filemansuffix__) for general configuration
+details and for options that can be used with all input drivers. This
+section only covers configuration details specific to this driver.
+.PP
+The driver can auto-detect the mouse type on some platforms. On some
+platforms this is limited to plug and play serial mice, and on some the
+auto-detection works for any mouse that the OS's kernel driver supports.
+On others, it is always necessary to specify the mouse protocol in the
+config file. The
+.I README.mouse
+document contains some detailed information about this.
+.PP
+The following driver
+.B Options
+are supported:
+.TP 7
+.BI "Option \*qProtocol\*q \*q" string \*q
+Specify the mouse protocol. Valid protocol types include:
+.PP
+.RS 12
+Auto, Microsoft, MouseSystems, MMSeries, Logitech, MouseMan, MMHitTab,
+GlidePoint, IntelliMouse, ThinkingMouse, ValuMouseScroll, AceCad, PS/2, ImPS/2,
+ExplorerPS/2, ThinkingMousePS/2, MouseManPlusPS/2, GlidePointPS/2,
+NetMousePS/2, NetScrollPS/2, BusMouse, SysMouse, WSMouse, USB, VUID, Xqueue.
+.RE
+.PP
+.RS 7
+Not all protocols are supported on all platforms. The "Auto" platform
+specifies that protocol auto-detection should be attempted. There is no
+default protocol setting, and specifying this option is mandatory.
+.RE
+.TP 7
+.BI "Option \*qDevice\*q \*q" string \*q
+Specifies the device through which the mouse can be accessed. A common
+setting is "/dev/mouse", which is often a symbolic link to the real
+device. This option is mandatory, and there is no default setting.
+.TP 7
+.BI "Option \*qButtons\*q \*q" integer \*q
+Specifies the number of mouse buttons. In cases where the number of buttons
+cannot be auto-detected, the default value is 3. The maximum number is 24.
+.TP 7
+.BI "Option \*qEmulate3Buttons\*q \*q" boolean \*q
+Enable/disable the emulation of the third (middle) mouse button for mice
+which only have two physical buttons. The third button is emulated by
+pressing both buttons simultaneously. Default: off
+.TP 7
+.BI "Option \*qEmulate3Timeout\*q \*q" integer \*q
+Sets the timeout (in milliseconds) that the driver waits before deciding
+if two buttons where pressed "simultaneously" when 3 button emulation is
+enabled. Default: 50.
+.TP 7
+.BI "Option \*qChordMiddle\*q \*q" boolean \*q
+Enable/disable handling of mice that send left+right events when the middle
+button is used. Default: off.
+.TP 7
+.BI "Option \*qEmulateWheel\*q \*q" boolean \*q
+Enable/disable "wheel" emulation. Wheel emulation means emulating button
+press/release events when the mouse is moved while a specific real button
+is pressed. Wheel button events (typically buttons 4 and 5) are
+usually used for scrolling. Wheel emulation is useful for getting wheel-like
+behaviour with trackballs. It can also be useful for mice with 4 or
+more buttons but no wheel. See the description of the
+.BR EmulateWheelButton ,
+.BR EmulateWheelInertia ,
+.BR XAxisMapping ,
+and
+.B YAxisMapping
+options below. Default: off.
+.TP 7
+.BI "Option \*qEmulateWheelButton\*q \*q" integer \*q
+Specifies which button must be held down to enable wheel emulation mode.
+While this button is down, X and/or Y pointer movement will generate button
+press/release events as specified for the
+.B XAxisMapping
+and
+.B YAxisMapping
+settings. Default: 4.
+.TP 7
+.BI "Option \*qEmulateWheelInertia\*q \*q" integer \*q
+Specifies how far (in pixels) the pointer must move to generate button
+press/release events in wheel emulation mode. Default: 10.
+.TP 7
+.BI "Option \*qEmulateWheelTimeout\*q \*q" integer \*q
+Specifies the time in milliseconds the
+.BR EmulateWheelButton
+must be pressed before wheel emulation is started. If the
+.BR EmulateWheelButton
+is released before this timeout, the original button press/release event
+is sent. Default: 200.
+.TP 7
+.BI "Option \*qXAxisMapping\*q \*q" "N1 N2" \*q
+Specifies which buttons are mapped to motion in the X direction in wheel
+emulation mode. Button number
+.I N1
+is mapped to the negative X axis motion and button number
+.I N2
+is mapped to the positive X axis motion. Default: no mapping.
+.TP 7
+.BI "Option \*qYAxisMapping\*q \*q" "N1 N2" \*q
+Specifies which buttons are mapped to motion in the Y direction in wheel
+emulation mode. Button number
+.I N1
+is mapped to the negative Y axis motion and button number
+.I N2
+is mapped to the positive Y axis motion. Default: no mapping.
+.TP 7
+.BI "Option \*qZAxisMapping\*q \*qX\*q"
+.TP 7
+.BI "Option \*qZAxisMapping\*q \*qY\*q"
+.TP 7
+.BI "Option \*qZAxisMapping\*q \*q" "N1 N2" \*q
+.TP 7
+.BI "Option \*qZAxisMapping\*q \*q" "N1 N2 N3 N4" \*q
+Set the mapping for the Z axis (wheel) motion to buttons or another axis
+.RB ( X
+or
+.BR Y ).
+Button number
+.I N1
+is mapped to the negative Z axis motion and button number
+.I N2
+is mapped to the positive Z axis motion. For mice with two wheels,
+four button numbers can be specified, with the negative and positive motion
+of the second wheel mapped respectively to buttons number
+.I N3
+and
+.IR N4 .
+Note that the protocols for mice with one and two wheels can be different
+and the driver may not be able to autodetect it.
+Default: "4 5".
+.TP 7
+.BI "Option \*qButtonMapping\*q \*q" "N1 N2 [...]" \*q
+Specifies how physical mouse buttons are mapped to logical buttons.
+Physcial button 1 is mapped to logical button
+.IR N1 ,
+physical button 2 to
+.IR N2 ,
+and so forth. This enables the use of physical buttons that are obscured by
+.IR ZAxisMapping .
+Default:\ "1\ 2\ 3\ 8\ 9\ 10\ ...".
+.TP 7
+.BI "Option \*qFlipXY\*q \*q" boolean \*q
+Enable/disable swapping the X and Y axes. This transformation is applied
+after the
+.BR InvX ,
+.B InvY
+and
+.BR AngleOffset
+transformations. Default: off.
+.TP 7
+.BI "Option \*qInvX\*q \*q" boolean \*q
+Invert the X axis. Default: off.
+.TP 7
+.BI "Option \*qInvY\*q \*q" boolean \*q
+Invert the Y axis. Default: off.
+.TP 7
+.BI "Option \*qAngleOffset\*q \*q" integer \*q
+Specify a clockwise angular offset (in degrees) to apply to the pointer
+motion. This transformation is applied before the
+.BR FlipXY ,
+.B InvX
+and
+.B InvY
+transformations. Default: 0.
+.TP 7
+.BI "Option \*qSampleRate\*q \*q" integer \*q
+Sets the number of motion/button events the mouse sends per second. Setting
+this is only supported for some mice, including some Logitech mice and
+some PS/2 mice on some platforms. Default: whatever the mouse is
+already set to.
+.TP 7
+.BI "Option \*qResolution\*q \*q" integer \*q
+Sets the resolution of the device in counts per inch. Setting this is
+only supported for some mice, including some PS/2 mice on some platforms.
+Default: whatever the mouse is already set to.
+.TP 7
+.BI "Option \*qDragLockButtons\*q \*q" "L1 B2 L3 B4" \*q
+Sets \*qdrag lock buttons\*q that simulate holding a button down, so
+that low dexterity people do not have to hold a button down at the
+same time they move a mouse cursor. Button numbers occur in pairs,
+with the lock button number occurring first, followed by the button
+number that is the target of the lock button.
+.TP 7
+.BI "Option \*qDragLockButtons\*q \*q" "M1" \*q
+Sets a \*qmaster drag lock button\*q that acts as a \*qMeta Key\*q
+indicating that the next button pressed is to be
+\*qdrag locked\*q.
+.TP 7
+.BI "Option \*qClearDTR\*q \*q" boolean \*q
+Enable/disable clearing the DTR line on the serial port used by the mouse.
+Some dual-protocol mice require the DTR line to be cleared to operate
+in the non-default protocol. This option is for serial mice only.
+Default: off.
+.TP 7
+.BI "Option \*qClearRTS\*q \*q" boolean \*q
+Enable/disable clearing the RTS line on the serial port used by the mouse.
+Some dual-protocol mice require the RTS line to be cleared to operate
+in the non-default protocol. This option is for serial mice only.
+Default: off.
+.TP 7
+.BI "Option \*qBaudRate\*q \*q" integer \*q
+Set the baud rate to use for communicating with a serial mouse. This
+option should rarely be required because the default is correct for almost
+all situations. Valid values include: 300, 1200, 2400, 4800, 9600, 19200.
+Default: 1200.
+.PP
+There are some other options that may be used to control various parameters
+for serial port communication, but they are not documented here because
+the driver sets them correctly for each mouse protocol type.
+.SH "SEE ALSO"
+__xservername__(__appmansuffix__), __xconfigfile__(__filemansuffix__), xorgconfig(__appmansuffix__), Xserver(__appmansuffix__), X(__miscmansuffix__),
+README.mouse.
diff --git a/driver/xf86-input-mouse/missing b/driver/xf86-input-mouse/missing
new file mode 100644
index 000000000..894e786e1
--- /dev/null
+++ b/driver/xf86-input-mouse/missing
@@ -0,0 +1,360 @@
+#! /bin/sh
+# Common stub for a few missing GNU programs while installing.
+
+scriptversion=2005-06-08.21
+
+# Copyright (C) 1996, 1997, 1999, 2000, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
+# Originally by Fran,cois Pinard <pinard@iro.umontreal.ca>, 1996.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA
+# 02110-1301, USA.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+if test $# -eq 0; then
+ echo 1>&2 "Try \`$0 --help' for more information"
+ exit 1
+fi
+
+run=:
+
+# In the cases where this matters, `missing' is being run in the
+# srcdir already.
+if test -f configure.ac; then
+ configure_ac=configure.ac
+else
+ configure_ac=configure.in
+fi
+
+msg="missing on your system"
+
+case "$1" in
+--run)
+ # Try to run requested program, and just exit if it succeeds.
+ run=
+ shift
+ "$@" && exit 0
+ # Exit code 63 means version mismatch. This often happens
+ # when the user try to use an ancient version of a tool on
+ # a file that requires a minimum version. In this case we
+ # we should proceed has if the program had been absent, or
+ # if --run hadn't been passed.
+ if test $? = 63; then
+ run=:
+ msg="probably too old"
+ fi
+ ;;
+
+ -h|--h|--he|--hel|--help)
+ echo "\
+$0 [OPTION]... PROGRAM [ARGUMENT]...
+
+Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an
+error status if there is no known handling for PROGRAM.
+
+Options:
+ -h, --help display this help and exit
+ -v, --version output version information and exit
+ --run try to run the given command, and emulate it if it fails
+
+Supported PROGRAM values:
+ aclocal touch file \`aclocal.m4'
+ autoconf touch file \`configure'
+ autoheader touch file \`config.h.in'
+ automake touch all \`Makefile.in' files
+ bison create \`y.tab.[ch]', if possible, from existing .[ch]
+ flex create \`lex.yy.c', if possible, from existing .c
+ help2man touch the output file
+ lex create \`lex.yy.c', if possible, from existing .c
+ makeinfo touch the output file
+ tar try tar, gnutar, gtar, then tar without non-portable flags
+ yacc create \`y.tab.[ch]', if possible, from existing .[ch]
+
+Send bug reports to <bug-automake@gnu.org>."
+ exit $?
+ ;;
+
+ -v|--v|--ve|--ver|--vers|--versi|--versio|--version)
+ echo "missing $scriptversion (GNU Automake)"
+ exit $?
+ ;;
+
+ -*)
+ echo 1>&2 "$0: Unknown \`$1' option"
+ echo 1>&2 "Try \`$0 --help' for more information"
+ exit 1
+ ;;
+
+esac
+
+# Now exit if we have it, but it failed. Also exit now if we
+# don't have it and --version was passed (most likely to detect
+# the program).
+case "$1" in
+ lex|yacc)
+ # Not GNU programs, they don't have --version.
+ ;;
+
+ tar)
+ if test -n "$run"; then
+ echo 1>&2 "ERROR: \`tar' requires --run"
+ exit 1
+ elif test "x$2" = "x--version" || test "x$2" = "x--help"; then
+ exit 1
+ fi
+ ;;
+
+ *)
+ if test -z "$run" && ($1 --version) > /dev/null 2>&1; then
+ # We have it, but it failed.
+ exit 1
+ elif test "x$2" = "x--version" || test "x$2" = "x--help"; then
+ # Could not run --version or --help. This is probably someone
+ # running `$TOOL --version' or `$TOOL --help' to check whether
+ # $TOOL exists and not knowing $TOOL uses missing.
+ exit 1
+ fi
+ ;;
+esac
+
+# If it does not exist, or fails to run (possibly an outdated version),
+# try to emulate it.
+case "$1" in
+ aclocal*)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified \`acinclude.m4' or \`${configure_ac}'. You might want
+ to install the \`Automake' and \`Perl' packages. Grab them from
+ any GNU archive site."
+ touch aclocal.m4
+ ;;
+
+ autoconf)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified \`${configure_ac}'. You might want to install the
+ \`Autoconf' and \`GNU m4' packages. Grab them from any GNU
+ archive site."
+ touch configure
+ ;;
+
+ autoheader)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified \`acconfig.h' or \`${configure_ac}'. You might want
+ to install the \`Autoconf' and \`GNU m4' packages. Grab them
+ from any GNU archive site."
+ files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^)]*\)).*/\1/p' ${configure_ac}`
+ test -z "$files" && files="config.h"
+ touch_files=
+ for f in $files; do
+ case "$f" in
+ *:*) touch_files="$touch_files "`echo "$f" |
+ sed -e 's/^[^:]*://' -e 's/:.*//'`;;
+ *) touch_files="$touch_files $f.in";;
+ esac
+ done
+ touch $touch_files
+ ;;
+
+ automake*)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified \`Makefile.am', \`acinclude.m4' or \`${configure_ac}'.
+ You might want to install the \`Automake' and \`Perl' packages.
+ Grab them from any GNU archive site."
+ find . -type f -name Makefile.am -print |
+ sed 's/\.am$/.in/' |
+ while read f; do touch "$f"; done
+ ;;
+
+ autom4te)
+ echo 1>&2 "\
+WARNING: \`$1' is needed, but is $msg.
+ You might have modified some files without having the
+ proper tools for further handling them.
+ You can get \`$1' as part of \`Autoconf' from any GNU
+ archive site."
+
+ file=`echo "$*" | sed -n 's/.*--output[ =]*\([^ ]*\).*/\1/p'`
+ test -z "$file" && file=`echo "$*" | sed -n 's/.*-o[ ]*\([^ ]*\).*/\1/p'`
+ if test -f "$file"; then
+ touch $file
+ else
+ test -z "$file" || exec >$file
+ echo "#! /bin/sh"
+ echo "# Created by GNU Automake missing as a replacement of"
+ echo "# $ $@"
+ echo "exit 0"
+ chmod +x $file
+ exit 1
+ fi
+ ;;
+
+ bison|yacc)
+ echo 1>&2 "\
+WARNING: \`$1' $msg. You should only need it if
+ you modified a \`.y' file. You may need the \`Bison' package
+ in order for those modifications to take effect. You can get
+ \`Bison' from any GNU archive site."
+ rm -f y.tab.c y.tab.h
+ if [ $# -ne 1 ]; then
+ eval LASTARG="\${$#}"
+ case "$LASTARG" in
+ *.y)
+ SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" y.tab.c
+ fi
+ SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" y.tab.h
+ fi
+ ;;
+ esac
+ fi
+ if [ ! -f y.tab.h ]; then
+ echo >y.tab.h
+ fi
+ if [ ! -f y.tab.c ]; then
+ echo 'main() { return 0; }' >y.tab.c
+ fi
+ ;;
+
+ lex|flex)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified a \`.l' file. You may need the \`Flex' package
+ in order for those modifications to take effect. You can get
+ \`Flex' from any GNU archive site."
+ rm -f lex.yy.c
+ if [ $# -ne 1 ]; then
+ eval LASTARG="\${$#}"
+ case "$LASTARG" in
+ *.l)
+ SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" lex.yy.c
+ fi
+ ;;
+ esac
+ fi
+ if [ ! -f lex.yy.c ]; then
+ echo 'main() { return 0; }' >lex.yy.c
+ fi
+ ;;
+
+ help2man)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified a dependency of a manual page. You may need the
+ \`Help2man' package in order for those modifications to take
+ effect. You can get \`Help2man' from any GNU archive site."
+
+ file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'`
+ if test -z "$file"; then
+ file=`echo "$*" | sed -n 's/.*--output=\([^ ]*\).*/\1/p'`
+ fi
+ if [ -f "$file" ]; then
+ touch $file
+ else
+ test -z "$file" || exec >$file
+ echo ".ab help2man is required to generate this page"
+ exit 1
+ fi
+ ;;
+
+ makeinfo)
+ echo 1>&2 "\
+WARNING: \`$1' is $msg. You should only need it if
+ you modified a \`.texi' or \`.texinfo' file, or any other file
+ indirectly affecting the aspect of the manual. The spurious
+ call might also be the consequence of using a buggy \`make' (AIX,
+ DU, IRIX). You might want to install the \`Texinfo' package or
+ the \`GNU make' package. Grab either from any GNU archive site."
+ # The file to touch is that specified with -o ...
+ file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'`
+ if test -z "$file"; then
+ # ... or it is the one specified with @setfilename ...
+ infile=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'`
+ file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $infile`
+ # ... or it is derived from the source name (dir/f.texi becomes f.info)
+ test -z "$file" && file=`echo "$infile" | sed 's,.*/,,;s,.[^.]*$,,'`.info
+ fi
+ # If the file does not exist, the user really needs makeinfo;
+ # let's fail without touching anything.
+ test -f $file || exit 1
+ touch $file
+ ;;
+
+ tar)
+ shift
+
+ # We have already tried tar in the generic part.
+ # Look for gnutar/gtar before invocation to avoid ugly error
+ # messages.
+ if (gnutar --version > /dev/null 2>&1); then
+ gnutar "$@" && exit 0
+ fi
+ if (gtar --version > /dev/null 2>&1); then
+ gtar "$@" && exit 0
+ fi
+ firstarg="$1"
+ if shift; then
+ case "$firstarg" in
+ *o*)
+ firstarg=`echo "$firstarg" | sed s/o//`
+ tar "$firstarg" "$@" && exit 0
+ ;;
+ esac
+ case "$firstarg" in
+ *h*)
+ firstarg=`echo "$firstarg" | sed s/h//`
+ tar "$firstarg" "$@" && exit 0
+ ;;
+ esac
+ fi
+
+ echo 1>&2 "\
+WARNING: I can't seem to be able to run \`tar' with the given arguments.
+ You may want to install GNU tar or Free paxutils, or check the
+ command line arguments."
+ exit 1
+ ;;
+
+ *)
+ echo 1>&2 "\
+WARNING: \`$1' is needed, and is $msg.
+ You might have modified some files without having the
+ proper tools for further handling them. Check the \`README' file,
+ it often tells you about the needed prerequisites for installing
+ this package. You may also peek at any GNU archive site, in case
+ some other package would contain this missing \`$1' program."
+ exit 1
+ ;;
+esac
+
+exit 0
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-end: "$"
+# End:
diff --git a/driver/xf86-input-mouse/src/Makefile.am b/driver/xf86-input-mouse/src/Makefile.am
new file mode 100644
index 000000000..3c0962b0a
--- /dev/null
+++ b/driver/xf86-input-mouse/src/Makefile.am
@@ -0,0 +1,31 @@
+# Copyright 2005 Adam Jackson.
+#
+# Permission is hereby granted, free of charge, to any person obtaining a
+# copy of this software and associated documentation files (the "Software"),
+# to deal in the Software without restriction, including without limitation
+# on the rights to use, copy, modify, merge, publish, distribute, sub
+# license, and/or sell copies of the Software, and to permit persons to whom
+# the Software is furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice (including the next
+# paragraph) shall be included in all copies or substantial portions of the
+# Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL
+# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+
+# this is obnoxious:
+# -module lets us name the module exactly how we want
+# -avoid-version prevents gratuitous .0.0.0 version numbers on the end
+# _ladir passes a dummy rpath to libtool so the thing will actually link
+# TODO: -nostdlib/-Bstatic/-lgcc platform magic, not installing the .a, etc.
+@DRIVER_NAME@_drv_la_LTLIBRARIES = @DRIVER_NAME@_drv.la
+@DRIVER_NAME@_drv_la_LDFLAGS = -module -avoid-version
+@DRIVER_NAME@_drv_ladir = @inputdir@
+
+@DRIVER_NAME@_drv_la_SOURCES = @DRIVER_NAME@.c @DRIVER_NAME@.h pnp.c mousePriv.h
diff --git a/driver/xf86-input-mouse/src/Makefile.in b/driver/xf86-input-mouse/src/Makefile.in
new file mode 100644
index 000000000..519247d49
--- /dev/null
+++ b/driver/xf86-input-mouse/src/Makefile.in
@@ -0,0 +1,511 @@
+# Makefile.in generated by automake 1.9.6 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# Copyright 2005 Adam Jackson.
+#
+# Permission is hereby granted, free of charge, to any person obtaining a
+# copy of this software and associated documentation files (the "Software"),
+# to deal in the Software without restriction, including without limitation
+# on the rights to use, copy, modify, merge, publish, distribute, sub
+# license, and/or sell copies of the Software, and to permit persons to whom
+# the Software is furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice (including the next
+# paragraph) shall be included in all copies or substantial portions of the
+# Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL
+# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+top_builddir = ..
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+INSTALL = @INSTALL@
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = src
+DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = `echo $$p | sed -e 's|^.*/||'`;
+am__installdirs = "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)"
+@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL = $(INSTALL)
+LTLIBRARIES = $(@DRIVER_NAME@_drv_la_LTLIBRARIES)
+@DRIVER_NAME@_drv_la_LIBADD =
+am_@DRIVER_NAME@_drv_la_OBJECTS = @DRIVER_NAME@.lo pnp.lo
+@DRIVER_NAME@_drv_la_OBJECTS = $(am_@DRIVER_NAME@_drv_la_OBJECTS)
+DEFAULT_INCLUDES = -I. -I$(srcdir) -I$(top_builddir)
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+ $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --tag=CC --mode=compile $(CC) $(DEFS) \
+ $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+ $(AM_CFLAGS) $(CFLAGS)
+CCLD = $(CC)
+LINK = $(LIBTOOL) --tag=CC --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+ $(AM_LDFLAGS) $(LDFLAGS) -o $@
+SOURCES = $(@DRIVER_NAME@_drv_la_SOURCES)
+DIST_SOURCES = $(@DRIVER_NAME@_drv_la_SOURCES)
+ETAGS = etags
+CTAGS = ctags
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+ADMIN_MAN_DIR = @ADMIN_MAN_DIR@
+ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@
+AMDEP_FALSE = @AMDEP_FALSE@
+AMDEP_TRUE = @AMDEP_TRUE@
+AMTAR = @AMTAR@
+APP_MAN_DIR = @APP_MAN_DIR@
+APP_MAN_SUFFIX = @APP_MAN_SUFFIX@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@
+BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@
+BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@
+BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DRIVER_MAN_DIR = @DRIVER_MAN_DIR@
+DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@
+DRIVER_NAME = @DRIVER_NAME@
+ECHO = @ECHO@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+F77 = @F77@
+FFLAGS = @FFLAGS@
+FILE_MAN_DIR = @FILE_MAN_DIR@
+FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIB_MAN_DIR = @LIB_MAN_DIR@
+LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@
+LINUXDOC = @LINUXDOC@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAINT = @MAINT@
+MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@
+MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@
+MAKEINFO = @MAKEINFO@
+MAKE_HTML = @MAKE_HTML@
+MAKE_PDF = @MAKE_PDF@
+MAKE_PS = @MAKE_PS@
+MAKE_TEXT = @MAKE_TEXT@
+MISC_MAN_DIR = @MISC_MAN_DIR@
+MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@
+OBJEXT = @OBJEXT@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+PKG_CONFIG = @PKG_CONFIG@
+PS2PDF = @PS2PDF@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+XORG_CFLAGS = @XORG_CFLAGS@
+XORG_LIBS = @XORG_LIBS@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_F77 = @ac_ct_F77@
+ac_ct_RANLIB = @ac_ct_RANLIB@
+ac_ct_STRIP = @ac_ct_STRIP@
+ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@
+am__fastdepCC_FALSE = @am__fastdepCC_FALSE@
+am__fastdepCC_TRUE = @am__fastdepCC_TRUE@
+am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@
+am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+datadir = @datadir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+includedir = @includedir@
+infodir = @infodir@
+inputdir = @inputdir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+
+# this is obnoxious:
+# -module lets us name the module exactly how we want
+# -avoid-version prevents gratuitous .0.0.0 version numbers on the end
+# _ladir passes a dummy rpath to libtool so the thing will actually link
+# TODO: -nostdlib/-Bstatic/-lgcc platform magic, not installing the .a, etc.
+@DRIVER_NAME@_drv_la_LTLIBRARIES = @DRIVER_NAME@_drv.la
+@DRIVER_NAME@_drv_la_LDFLAGS = -module -avoid-version
+@DRIVER_NAME@_drv_ladir = @inputdir@
+@DRIVER_NAME@_drv_la_SOURCES = @DRIVER_NAME@.c @DRIVER_NAME@.h pnp.c mousePriv.h
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu src/Makefile'; \
+ cd $(top_srcdir) && \
+ $(AUTOMAKE) --gnu src/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+install-@DRIVER_NAME@_drv_laLTLIBRARIES: $(@DRIVER_NAME@_drv_la_LTLIBRARIES)
+ @$(NORMAL_INSTALL)
+ test -z "$(@DRIVER_NAME@_drv_ladir)" || $(mkdir_p) "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)"
+ @list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \
+ if test -f $$p; then \
+ f=$(am__strip_dir) \
+ echo " $(LIBTOOL) --mode=install $(@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) '$$p' '$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$f'"; \
+ $(LIBTOOL) --mode=install $(@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) "$$p" "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$f"; \
+ else :; fi; \
+ done
+
+uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES:
+ @$(NORMAL_UNINSTALL)
+ @set -x; list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \
+ p=$(am__strip_dir) \
+ echo " $(LIBTOOL) --mode=uninstall rm -f '$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$p'"; \
+ $(LIBTOOL) --mode=uninstall rm -f "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$p"; \
+ done
+
+clean-@DRIVER_NAME@_drv_laLTLIBRARIES:
+ -test -z "$(@DRIVER_NAME@_drv_la_LTLIBRARIES)" || rm -f $(@DRIVER_NAME@_drv_la_LTLIBRARIES)
+ @list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \
+ dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \
+ test "$$dir" != "$$p" || dir=.; \
+ echo "rm -f \"$${dir}/so_locations\""; \
+ rm -f "$${dir}/so_locations"; \
+ done
+@DRIVER_NAME@_drv.la: $(@DRIVER_NAME@_drv_la_OBJECTS) $(@DRIVER_NAME@_drv_la_DEPENDENCIES)
+ $(LINK) -rpath $(@DRIVER_NAME@_drv_ladir) $(@DRIVER_NAME@_drv_la_LDFLAGS) $(@DRIVER_NAME@_drv_la_OBJECTS) $(@DRIVER_NAME@_drv_la_LIBADD) $(LIBS)
+
+mostlyclean-compile:
+ -rm -f *.$(OBJEXT)
+
+distclean-compile:
+ -rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/@DRIVER_NAME@.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pnp.Plo@am__quote@
+
+.c.o:
+@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \
+@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(COMPILE) -c $<
+
+.c.obj:
+@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ `$(CYGPATH_W) '$<'`; \
+@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(COMPILE) -c `$(CYGPATH_W) '$<'`
+
+.c.lo:
+@am__fastdepCC_TRUE@ if $(LTCOMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \
+@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Plo"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool
+uninstall-info-am:
+
+ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES)
+ list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ mkid -fID $$unique
+tags: TAGS
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$tags $$unique; \
+ fi
+ctags: CTAGS
+CTAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(CTAGS_ARGS)$$tags$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$tags $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && cd $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) $$here
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \
+ list='$(DISTFILES)'; for file in $$list; do \
+ case $$file in \
+ $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \
+ $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \
+ esac; \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test "$$dir" != "$$file" && test "$$dir" != "."; then \
+ dir="/$$dir"; \
+ $(mkdir_p) "$(distdir)$$dir"; \
+ else \
+ dir=''; \
+ fi; \
+ if test -d $$d/$$file; then \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \
+ fi; \
+ cp -pR $$d/$$file $(distdir)$$dir || exit 1; \
+ else \
+ test -f $(distdir)/$$file \
+ || cp -p $$d/$$file $(distdir)/$$file \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile $(LTLIBRARIES)
+installdirs:
+ for dir in "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)"; do \
+ test -z "$$dir" || $(mkdir_p) "$$dir"; \
+ done
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ `test -z '$(STRIP)' || \
+ echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-@DRIVER_NAME@_drv_laLTLIBRARIES clean-generic \
+ clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+ distclean-libtool distclean-tags
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+info: info-am
+
+info-am:
+
+install-data-am: install-@DRIVER_NAME@_drv_laLTLIBRARIES
+
+install-exec-am:
+
+install-info: install-info-am
+
+install-man:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am: uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES \
+ uninstall-info-am
+
+.PHONY: CTAGS GTAGS all all-am check check-am clean \
+ clean-@DRIVER_NAME@_drv_laLTLIBRARIES clean-generic \
+ clean-libtool ctags distclean distclean-compile \
+ distclean-generic distclean-libtool distclean-tags distdir dvi \
+ dvi-am html html-am info info-am install \
+ install-@DRIVER_NAME@_drv_laLTLIBRARIES install-am \
+ install-data install-data-am install-exec install-exec-am \
+ install-info install-info-am install-man install-strip \
+ installcheck installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags uninstall uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES \
+ uninstall-am uninstall-info-am
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/driver/xf86-input-mouse/src/mouse.c b/driver/xf86-input-mouse/src/mouse.c
new file mode 100644
index 000000000..d3eb62a00
--- /dev/null
+++ b/driver/xf86-input-mouse/src/mouse.c
@@ -0,0 +1,3796 @@
+/* $XdotOrg: driver/xf86-input-mouse/src/mouse.c,v 1.29 2006/04/21 11:15:23 mhopf Exp $ */
+/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.c,v 1.79 2003/11/03 05:11:48 tsi Exp $ */
+/*
+ *
+ * Copyright 1990,91 by Thomas Roell, Dinkelscherben, Germany.
+ * Copyright 1993 by David Dawes <dawes@xfree86.org>
+ * Copyright 2002 by SuSE Linux AG, Author: Egbert Eich
+ * Copyright 1994-2002 by The XFree86 Project, Inc.
+ * Copyright 2002 by Paul Elliott
+ *
+ * Permission to use, copy, modify, distribute, and sell this software and its
+ * documentation for any purpose is hereby granted without fee, provided that
+ * the above copyright notice appear in all copies and that both that
+ * copyright notice and this permission notice appear in supporting
+ * documentation, and that the names of copyright holders not be
+ * used in advertising or publicity pertaining to distribution of the
+ * software without specific, written prior permission. The copyright holders
+ * make no representations about the suitability of this
+ * software for any purpose. It is provided "as is" without express or
+ * implied warranty.
+ *
+ * THE COPYRIGHT HOLDERS DISCLAIM ALL WARRANTIES WITH REGARD TO THIS
+ * SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND
+ * FITNESS, IN NO EVENT SHALL THE COPYRIGHT HOLDERS BE LIABLE FOR ANY
+ * SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER
+ * RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF
+ * CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN
+ * CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ *
+ */
+/* Patch for PS/2 Intellimouse - Tim Goodwin 1997-11-06. */
+
+/*
+ * [JCH-96/01/21] Added fourth button support for PROT_GLIDEPOINT mouse
+ * protocol.
+ */
+
+/*
+ * [TVO-97/03/05] Added microsoft IntelliMouse support
+ */
+
+/*
+ * [PME-02/08/11] Added suport for drag lock buttons
+ * for use with 4 button trackballs for convenience
+ * and to help limited dexterity persons
+ */
+
+#ifdef HAVE_CONFIG_H
+#include "config.h"
+#endif
+
+#include <math.h>
+#include <string.h>
+#include <stdio.h>
+#include <stdlib.h>
+#define NEED_EVENTS
+#include <X11/X.h>
+#include <X11/Xproto.h>
+
+#include "xf86.h"
+
+#ifdef XINPUT
+#include <X11/extensions/XI.h>
+#include <X11/extensions/XIproto.h>
+#include "extnsionst.h"
+#include "extinit.h"
+#else
+#include "inputstr.h"
+#endif
+
+#include "xf86Xinput.h"
+#include "xf86_OSproc.h"
+#include "xf86OSmouse.h"
+
+#ifndef NEED_XF86_TYPES
+#define NEED_XF86_TYPES /* for xisb.h when !XFree86LOADER */
+#endif
+
+#include "compiler.h"
+
+#include "xisb.h"
+#include "mouse.h"
+#include "mousePriv.h"
+#include "mipointer.h"
+
+enum {
+ /* number of bits in mapped nibble */
+ NIB_BITS=4,
+ /* size of map of nibbles to bitmask */
+ NIB_SIZE= (1 << NIB_BITS),
+ /* mask for map */
+ NIB_MASK= (NIB_SIZE -1),
+ /* number of maps to map all the buttons */
+ NIB_COUNT = ((MSE_MAXBUTTONS+NIB_BITS-1)/NIB_BITS)
+};
+
+/*data to be used in implementing trackball drag locks.*/
+typedef struct _DragLockRec {
+
+ /* Fields used to implement trackball drag locks. */
+ /* mask for those buttons that are ordinary drag lock buttons */
+ int lockButtonsM;
+
+ /* mask for the master drag lock button if any */
+ int masterLockM;
+
+ /* button state up/down from last time adjusted for drag locks */
+ int lockLastButtons;
+
+ /*
+ * true if master lock state i.e. master drag lock
+ * button has just been pressed
+ */
+ int masterTS;
+
+ /* simulate these buttons being down although they are not */
+ int simulatedDown;
+
+ /*
+ * data to map bits for drag lock buttons to corresponding
+ * bits for the target buttons
+ */
+ int nib_table[NIB_COUNT][NIB_SIZE];
+
+} DragLockRec, *DragLockPtr;
+
+
+
+#ifdef XFree86LOADER
+static const OptionInfoRec *MouseAvailableOptions(void *unused);
+#endif
+static InputInfoPtr MousePreInit(InputDriverPtr drv, IDevPtr dev, int flags);
+#if 0
+static void MouseUnInit(InputDriverPtr drv, InputInfoPtr pInfo, int flags);
+#endif
+
+static int MouseProc(DeviceIntPtr device, int what);
+static Bool MouseConvert(LocalDevicePtr local, int first, int num, int v0,
+ int v1, int v2, int v3, int v4, int v5, int *x,
+ int *y);
+
+static void MouseCtrl(DeviceIntPtr device, PtrCtrl *ctrl);
+static void MousePostEvent(InputInfoPtr pInfo, int buttons,
+ int dx, int dy, int dz, int dw);
+static void MouseReadInput(InputInfoPtr pInfo);
+static void MouseBlockHandler(pointer data, struct timeval **waitTime,
+ pointer LastSelectMask);
+static void MouseWakeupHandler(pointer data, int i, pointer LastSelectMask);
+static void FlushButtons(MouseDevPtr pMse);
+
+static Bool SetupMouse(InputInfoPtr pInfo);
+static Bool initMouseHW(InputInfoPtr pInfo);
+#ifdef SUPPORT_MOUSE_RESET
+static Bool mouseReset(InputInfoPtr pInfo, unsigned char val);
+static void ps2WakeupHandler(pointer data, int i, pointer LastSelectMask);
+static void ps2BlockHandler(pointer data, struct timeval **waitTime,
+ pointer LastSelectMask);
+#endif
+
+/* mouse autoprobe stuff */
+static const char *autoOSProtocol(InputInfoPtr pInfo, int *protoPara);
+static void autoProbeMouse(InputInfoPtr pInfo, Bool inSync, Bool lostSync);
+static void checkForErraticMovements(InputInfoPtr pInfo, int dx, int dy);
+static Bool collectData(MouseDevPtr pMse, unsigned char u);
+static void SetMouseProto(MouseDevPtr pMse, MouseProtocolID protocolID);
+static Bool autoGood(MouseDevPtr pMse);
+
+#undef MOUSE
+_X_EXPORT InputDriverRec MOUSE = {
+ 1,
+ "mouse",
+ NULL,
+ MousePreInit,
+ /*MouseUnInit,*/NULL,
+ NULL,
+ 0
+};
+
+typedef enum {
+ OPTION_ALWAYS_CORE,
+ OPTION_SEND_CORE_EVENTS,
+ OPTION_CORE_POINTER,
+ OPTION_SEND_DRAG_EVENTS,
+ OPTION_HISTORY_SIZE,
+ OPTION_DEVICE,
+ OPTION_PROTOCOL,
+ OPTION_BUTTONS,
+ OPTION_EMULATE_3_BUTTONS,
+ OPTION_EMULATE_3_TIMEOUT,
+ OPTION_CHORD_MIDDLE,
+ OPTION_FLIP_XY,
+ OPTION_INV_X,
+ OPTION_INV_Y,
+ OPTION_ANGLE_OFFSET,
+ OPTION_Z_AXIS_MAPPING,
+ OPTION_SAMPLE_RATE,
+ OPTION_RESOLUTION,
+ OPTION_EMULATE_WHEEL,
+ OPTION_EMU_WHEEL_BUTTON,
+ OPTION_EMU_WHEEL_INERTIA,
+ OPTION_EMU_WHEEL_TIMEOUT,
+ OPTION_X_AXIS_MAPPING,
+ OPTION_Y_AXIS_MAPPING,
+ OPTION_AUTO_SOFT,
+ OPTION_CLEAR_DTR,
+ OPTION_CLEAR_RTS,
+ OPTION_BAUD_RATE,
+ OPTION_DATA_BITS,
+ OPTION_STOP_BITS,
+ OPTION_PARITY,
+ OPTION_FLOW_CONTROL,
+ OPTION_VTIME,
+ OPTION_VMIN,
+ OPTION_DRAGLOCKBUTTONS,
+ OPTION_DOUBLECLICK_BUTTONS,
+ OPTION_BUTTON_MAPPING
+} MouseOpts;
+
+#ifdef XFree86LOADER
+static const OptionInfoRec mouseOptions[] = {
+ { OPTION_ALWAYS_CORE, "AlwaysCore", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_SEND_CORE_EVENTS, "SendCoreEvents", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_CORE_POINTER, "CorePointer", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_SEND_DRAG_EVENTS, "SendDragEvents", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_HISTORY_SIZE, "HistorySize", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_DEVICE, "Device", OPTV_STRING, {0}, FALSE },
+ { OPTION_PROTOCOL, "Protocol", OPTV_STRING, {0}, FALSE },
+ { OPTION_BUTTONS, "Buttons", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_EMULATE_3_BUTTONS, "Emulate3Buttons",OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_EMULATE_3_TIMEOUT, "Emulate3Timeout",OPTV_INTEGER, {0}, FALSE },
+ { OPTION_CHORD_MIDDLE, "ChordMiddle", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_FLIP_XY, "FlipXY", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_INV_X, "InvX", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_INV_Y, "InvY", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_ANGLE_OFFSET, "AngleOffset", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_Z_AXIS_MAPPING, "ZAxisMapping", OPTV_STRING, {0}, FALSE },
+ { OPTION_SAMPLE_RATE, "SampleRate", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_RESOLUTION, "Resolution", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_EMULATE_WHEEL, "EmulateWheel", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_EMU_WHEEL_BUTTON, "EmulateWheelButton", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_EMU_WHEEL_INERTIA, "EmulateWheelInertia", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_EMU_WHEEL_TIMEOUT, "EmulateWheelTimeout", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_X_AXIS_MAPPING, "XAxisMapping", OPTV_STRING, {0}, FALSE },
+ { OPTION_Y_AXIS_MAPPING, "YAxisMapping", OPTV_STRING, {0}, FALSE },
+ { OPTION_AUTO_SOFT, "AutoSoft", OPTV_BOOLEAN, {0}, FALSE },
+ /* serial options */
+ { OPTION_CLEAR_DTR, "ClearDTR", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_CLEAR_RTS, "ClearRTS", OPTV_BOOLEAN, {0}, FALSE },
+ { OPTION_BAUD_RATE, "BaudRate", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_DATA_BITS, "DataBits", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_STOP_BITS, "StopBits", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_PARITY, "Parity", OPTV_STRING, {0}, FALSE },
+ { OPTION_FLOW_CONTROL, "FlowControl", OPTV_STRING, {0}, FALSE },
+ { OPTION_VTIME, "VTime", OPTV_INTEGER, {0}, FALSE },
+ { OPTION_VMIN, "VMin", OPTV_INTEGER, {0}, FALSE },
+ /* end serial options */
+ { OPTION_DRAGLOCKBUTTONS, "DragLockButtons",OPTV_STRING, {0}, FALSE },
+ { OPTION_DOUBLECLICK_BUTTONS,"DoubleClickButtons", OPTV_STRING, {0}, FALSE },
+ { OPTION_BUTTON_MAPPING, "ButtonMapping", OPTV_STRING, {0}, FALSE },
+ { -1, NULL, OPTV_NONE, {0}, FALSE }
+};
+#endif
+
+#define RETRY_COUNT 4
+
+/*
+ * Microsoft (all serial models), Logitech MouseMan, First Mouse, etc,
+ * ALPS GlidePoint, Thinking Mouse.
+ */
+static const char *msDefaults[] = {
+ "BaudRate", "1200",
+ "DataBits", "7",
+ "StopBits", "1",
+ "Parity", "None",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+/* MouseSystems */
+static const char *mlDefaults[] = {
+ "BaudRate", "1200",
+ "DataBits", "8",
+ "StopBits", "2",
+ "Parity", "None",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+/* MMSeries */
+static const char *mmDefaults[] = {
+ "BaudRate", "1200",
+ "DataBits", "8",
+ "StopBits", "1",
+ "Parity", "Odd",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+#if 0
+/* Logitech series 9 *//* same as msc: now mlDefaults */
+static const char *logiDefaults[] = {
+ "BaudRate", "1200",
+ "DataBits", "8",
+ "StopBits", "2",
+ "Parity", "None",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+#endif
+/* Hitachi Tablet */
+static const char *mmhitDefaults[] = {
+ "BaudRate", "1200",
+ "DataBits", "8",
+ "StopBits", "1",
+ "Parity", "None",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+/* AceCad Tablet */
+static const char *acecadDefaults[] = {
+ "BaudRate", "9600",
+ "DataBits", "8",
+ "StopBits", "1",
+ "Parity", "Odd",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+
+static MouseProtocolRec mouseProtocols[] = {
+
+ /* Serial protocols */
+ { "Microsoft", MSE_SERIAL, msDefaults, PROT_MS },
+ { "MouseSystems", MSE_SERIAL, mlDefaults, PROT_MSC },
+ { "MMSeries", MSE_SERIAL, mmDefaults, PROT_MM },
+ { "Logitech", MSE_SERIAL, mlDefaults, PROT_LOGI },
+ { "MouseMan", MSE_SERIAL, msDefaults, PROT_LOGIMAN },
+ { "MMHitTab", MSE_SERIAL, mmhitDefaults, PROT_MMHIT },
+ { "GlidePoint", MSE_SERIAL, msDefaults, PROT_GLIDE },
+ { "IntelliMouse", MSE_SERIAL, msDefaults, PROT_IMSERIAL },
+ { "ThinkingMouse", MSE_SERIAL, msDefaults, PROT_THINKING },
+ { "AceCad", MSE_SERIAL, acecadDefaults, PROT_ACECAD },
+ { "ValuMouseScroll", MSE_SERIAL, msDefaults, PROT_VALUMOUSESCROLL },
+
+ /* Standard PS/2 */
+ { "PS/2", MSE_PS2, NULL, PROT_PS2 },
+ { "GenericPS/2", MSE_PS2, NULL, PROT_GENPS2 },
+
+ /* Extended PS/2 */
+ { "ImPS/2", MSE_XPS2, NULL, PROT_IMPS2 },
+ { "ExplorerPS/2", MSE_XPS2, NULL, PROT_EXPPS2 },
+ { "ThinkingMousePS/2", MSE_XPS2, NULL, PROT_THINKPS2 },
+ { "MouseManPlusPS/2", MSE_XPS2, NULL, PROT_MMPS2 },
+ { "GlidePointPS/2", MSE_XPS2, NULL, PROT_GLIDEPS2 },
+ { "NetMousePS/2", MSE_XPS2, NULL, PROT_NETPS2 },
+ { "NetScrollPS/2", MSE_XPS2, NULL, PROT_NETSCPS2 },
+
+ /* Bus Mouse */
+ { "BusMouse", MSE_BUS, NULL, PROT_BM },
+
+ /* Auto-detect (PnP) */
+ { "Auto", MSE_AUTO, NULL, PROT_AUTO },
+
+ /* Misc (usually OS-specific) */
+ { "SysMouse", MSE_MISC, mlDefaults, PROT_SYSMOUSE },
+
+ /* end of list */
+ { NULL, MSE_NONE, NULL, PROT_UNKNOWN }
+};
+
+#ifdef XFree86LOADER
+/*ARGSUSED*/
+static const OptionInfoRec *
+MouseAvailableOptions(void *unused)
+{
+ return (mouseOptions);
+}
+#endif
+
+/* Process options common to all mouse types. */
+static void
+MouseCommonOptions(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse;
+ MessageType buttons_from = X_CONFIG;
+ char *s;
+ int origButtons;
+ int i;
+
+ pMse = pInfo->private;
+
+ pMse->buttons = xf86SetIntOption(pInfo->options, "Buttons", 0);
+ if (!pMse->buttons) {
+ pMse->buttons = MSE_DFLTBUTTONS;
+ buttons_from = X_DEFAULT;
+ }
+ origButtons = pMse->buttons;
+
+ pMse->emulate3Buttons = xf86SetBoolOption(pInfo->options,
+ "Emulate3Buttons", FALSE);
+ if (!xf86FindOptionValue(pInfo->options,"Emulate3Buttons")) {
+ pMse->emulate3ButtonsSoft = TRUE;
+ pMse->emulate3Buttons = TRUE;
+ }
+
+ pMse->emulate3Timeout = xf86SetIntOption(pInfo->options,
+ "Emulate3Timeout", 50);
+ if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft) {
+ MessageType from = X_CONFIG;
+ if (pMse->emulate3ButtonsSoft)
+ from = X_DEFAULT;
+ xf86Msg(from, "%s: Emulate3Buttons, Emulate3Timeout: %d\n",
+ pInfo->name, pMse->emulate3Timeout);
+ }
+
+ pMse->chordMiddle = xf86SetBoolOption(pInfo->options, "ChordMiddle", FALSE);
+ if (pMse->chordMiddle)
+ xf86Msg(X_CONFIG, "%s: ChordMiddle\n", pInfo->name);
+ pMse->flipXY = xf86SetBoolOption(pInfo->options, "FlipXY", FALSE);
+ if (pMse->flipXY)
+ xf86Msg(X_CONFIG, "%s: FlipXY\n", pInfo->name);
+ if (xf86SetBoolOption(pInfo->options, "InvX", FALSE)) {
+ pMse->invX = -1;
+ xf86Msg(X_CONFIG, "%s: InvX\n", pInfo->name);
+ } else
+ pMse->invX = 1;
+ if (xf86SetBoolOption(pInfo->options, "InvY", FALSE)) {
+ pMse->invY = -1;
+ xf86Msg(X_CONFIG, "%s: InvY\n", pInfo->name);
+ } else
+ pMse->invY = 1;
+ pMse->angleOffset = xf86SetIntOption(pInfo->options, "AngleOffset", 0);
+
+
+ if (pMse->pDragLock)
+ xfree(pMse->pDragLock);
+ pMse->pDragLock = NULL;
+
+ s = xf86SetStrOption(pInfo->options, "DragLockButtons", NULL);
+
+ if (s) {
+ int lock; /* lock button */
+ int target; /* target button */
+ int lockM,targetM; /* bitmasks for drag lock, target */
+ int i, j; /* indexes */
+ char *s1; /* parse input string */
+ DragLockPtr pLock;
+
+ pLock = pMse->pDragLock = xcalloc(1, sizeof(DragLockRec));
+ /* init code */
+
+ /* initial string to be taken apart */
+ s1 = s;
+
+ /* keep getting numbers which are buttons */
+ while ((s1 != NULL) && (lock = strtol(s1, &s1, 10)) != 0) {
+
+ /* check sanity for a button */
+ if ((lock < 0) || (lock > MSE_MAXBUTTONS)) {
+ xf86Msg(X_WARNING, "DragLock: Invalid button number = %d\n",
+ lock);
+ break;
+ };
+ /* turn into a button mask */
+ lockM = 1 << (lock - 1);
+
+ /* try to get drag lock button */
+ if ((s1 == NULL) || ((target=strtol(s1, &s1, 10)) == 0)) {
+ /*if no target, must be a master drag lock button */
+ /* save master drag lock mask */
+ pLock->masterLockM = lockM;
+ xf86Msg(X_CONFIG,
+ "DragLock button %d is master drag lock",
+ lock);
+ } else {
+ /* have target button number*/
+ /* check target button number for sanity */
+ if ((target < 0) || (target > MSE_MAXBUTTONS)) {
+ xf86Msg(X_WARNING,
+ "DragLock: Invalid button number for target=%d\n",
+ target);
+ break;
+ }
+
+ /* target button mask */
+ targetM = 1 << (target - 1);
+
+ xf86Msg(X_CONFIG,
+ "DragLock: button %d is drag lock for button %d\n",
+ lock,target);
+ lock--;
+
+ /* initialize table that maps drag lock mask to target mask */
+ pLock->nib_table[lock / NIB_BITS][1 << (lock % NIB_BITS)] =
+ targetM;
+
+ /* add new drag lock to mask of drag locks */
+ pLock->lockButtonsM |= lockM;
+ }
+
+ }
+
+ /*
+ * fill out rest of map that maps sets of drag lock buttons
+ * to sets of target buttons, in the form of masks
+ */
+
+ /* for each nibble */
+ for (i = 0; i < NIB_COUNT; i++) {
+ /* for each possible set of bits for that nibble */
+ for (j = 0; j < NIB_SIZE; j++) {
+ int ff, fM, otherbits;
+
+ /* get first bit set in j*/
+ ff = ffs(j) - 1;
+ /* if 0 bits set nothing to do */
+ if (ff >= 0) {
+ /* form mask for fist bit set */
+ fM = 1 << ff;
+ /* mask off first bit set to get remaining bits set*/
+ otherbits = j & ~fM;
+ /*
+ * if otherbits =0 then only 1 bit set
+ * so j=fM
+ * nib_table[i][fM] already calculated if fM has
+ * only 1 bit set.
+ * nib_table[i][j] has already been filled in
+ * by previous loop. otherwise
+ * otherbits < j so nibtable[i][otherbits]
+ * has already been calculated.
+ */
+ if (otherbits)
+ pLock->nib_table[i][j] =
+ pLock->nib_table[i][fM] |
+ pLock->nib_table[i][otherbits];
+
+ }
+ }
+ }
+ xfree(s);
+ }
+
+ s = xf86SetStrOption(pInfo->options, "ZAxisMapping", "4 5");
+ if (s) {
+ int b1 = 0, b2 = 0, b3 = 0, b4 = 0;
+ char *msg = NULL;
+
+ pMse->negativeZ = pMse->positiveZ = MSE_NOAXISMAP;
+ pMse->negativeW = pMse->positiveW = MSE_NOAXISMAP;
+ if (!xf86NameCmp(s, "x")) {
+ pMse->negativeZ = pMse->positiveZ = MSE_MAPTOX;
+ msg = xstrdup("X axis");
+ } else if (!xf86NameCmp(s, "y")) {
+ pMse->negativeZ = pMse->positiveZ = MSE_MAPTOY;
+ msg = xstrdup("Y axis");
+ } else if (sscanf(s, "%d %d %d %d", &b1, &b2, &b3, &b4) >= 2 &&
+ b1 > 0 && b1 <= MSE_MAXBUTTONS &&
+ b2 > 0 && b2 <= MSE_MAXBUTTONS) {
+ msg = xstrdup("buttons XX and YY");
+ if (msg)
+ sprintf(msg, "buttons %d and %d", b1, b2);
+ pMse->negativeZ = 1 << (b1-1);
+ pMse->positiveZ = 1 << (b2-1);
+ if (b3 > 0 && b3 <= MSE_MAXBUTTONS &&
+ b4 > 0 && b4 <= MSE_MAXBUTTONS) {
+ if (msg)
+ xfree(msg);
+ msg = xstrdup("buttons XX, YY, ZZ and WW");
+ if (msg)
+ sprintf(msg, "buttons %d, %d, %d and %d", b1, b2, b3, b4);
+ pMse->negativeW = 1 << (b3-1);
+ pMse->positiveW = 1 << (b4-1);
+ }
+ if (b1 > pMse->buttons) pMse->buttons = b1;
+ if (b2 > pMse->buttons) pMse->buttons = b2;
+ if (b3 > pMse->buttons) pMse->buttons = b3;
+ if (b4 > pMse->buttons) pMse->buttons = b4;
+ }
+ if (msg) {
+ xf86Msg(X_CONFIG, "%s: ZAxisMapping: %s\n", pInfo->name, msg);
+ xfree(msg);
+ } else {
+ xf86Msg(X_WARNING, "%s: Invalid ZAxisMapping value: \"%s\"\n",
+ pInfo->name, s);
+ }
+ xfree(s);
+ }
+ if (xf86SetBoolOption(pInfo->options, "EmulateWheel", FALSE)) {
+ Bool yFromConfig = FALSE;
+ int wheelButton;
+
+ pMse->emulateWheel = TRUE;
+ wheelButton = xf86SetIntOption(pInfo->options,
+ "EmulateWheelButton", 4);
+ if (wheelButton < 0 || wheelButton > MSE_MAXBUTTONS) {
+ xf86Msg(X_WARNING, "%s: Invalid EmulateWheelButton value: %d\n",
+ pInfo->name, wheelButton);
+ wheelButton = 4;
+ }
+ pMse->wheelButton = wheelButton;
+
+ pMse->wheelInertia = xf86SetIntOption(pInfo->options,
+ "EmulateWheelInertia", 10);
+ if (pMse->wheelInertia <= 0) {
+ xf86Msg(X_WARNING, "%s: Invalid EmulateWheelInertia value: %d\n",
+ pInfo->name, pMse->wheelInertia);
+ pMse->wheelInertia = 10;
+ }
+ pMse->wheelButtonTimeout = xf86SetIntOption(pInfo->options,
+ "EmulateWheelTimeout", 200);
+ if (pMse->wheelButtonTimeout <= 0) {
+ xf86Msg(X_WARNING, "%s: Invalid EmulateWheelTimeout value: %d\n",
+ pInfo->name, pMse->wheelButtonTimeout);
+ pMse->wheelButtonTimeout = 200;
+ }
+
+ pMse->negativeX = MSE_NOAXISMAP;
+ pMse->positiveX = MSE_NOAXISMAP;
+ s = xf86SetStrOption(pInfo->options, "XAxisMapping", NULL);
+ if (s) {
+ int b1 = 0, b2 = 0;
+ char *msg = NULL;
+
+ if ((sscanf(s, "%d %d", &b1, &b2) == 2) &&
+ b1 > 0 && b1 <= MSE_MAXBUTTONS &&
+ b2 > 0 && b2 <= MSE_MAXBUTTONS) {
+ msg = xstrdup("buttons XX and YY");
+ if (msg)
+ sprintf(msg, "buttons %d and %d", b1, b2);
+ pMse->negativeX = b1;
+ pMse->positiveX = b2;
+ if (b1 > pMse->buttons) pMse->buttons = b1;
+ if (b2 > pMse->buttons) pMse->buttons = b2;
+ } else {
+ xf86Msg(X_WARNING, "%s: Invalid XAxisMapping value: \"%s\"\n",
+ pInfo->name, s);
+ }
+ if (msg) {
+ xf86Msg(X_CONFIG, "%s: XAxisMapping: %s\n", pInfo->name, msg);
+ xfree(msg);
+ }
+ xfree(s);
+ }
+ s = xf86SetStrOption(pInfo->options, "YAxisMapping", NULL);
+ if (s) {
+ int b1 = 0, b2 = 0;
+ char *msg = NULL;
+
+ if ((sscanf(s, "%d %d", &b1, &b2) == 2) &&
+ b1 > 0 && b1 <= MSE_MAXBUTTONS &&
+ b2 > 0 && b2 <= MSE_MAXBUTTONS) {
+ msg = xstrdup("buttons XX and YY");
+ if (msg)
+ sprintf(msg, "buttons %d and %d", b1, b2);
+ pMse->negativeY = b1;
+ pMse->positiveY = b2;
+ if (b1 > pMse->buttons) pMse->buttons = b1;
+ if (b2 > pMse->buttons) pMse->buttons = b2;
+ yFromConfig = TRUE;
+ } else {
+ xf86Msg(X_WARNING, "%s: Invalid YAxisMapping value: \"%s\"\n",
+ pInfo->name, s);
+ }
+ if (msg) {
+ xf86Msg(X_CONFIG, "%s: YAxisMapping: %s\n", pInfo->name, msg);
+ xfree(msg);
+ }
+ xfree(s);
+ }
+ if (!yFromConfig) {
+ pMse->negativeY = 4;
+ pMse->positiveY = 5;
+ if (pMse->negativeY > pMse->buttons)
+ pMse->buttons = pMse->negativeY;
+ if (pMse->positiveY > pMse->buttons)
+ pMse->buttons = pMse->positiveY;
+ xf86Msg(X_DEFAULT, "%s: YAxisMapping: buttons %d and %d\n",
+ pInfo->name, pMse->negativeY, pMse->positiveY);
+ }
+ xf86Msg(X_CONFIG, "%s: EmulateWheel, EmulateWheelButton: %d, "
+ "EmulateWheelInertia: %d, "
+ "EmulateWheelTimeout: %d\n",
+ pInfo->name, wheelButton, pMse->wheelInertia,
+ pMse->wheelButtonTimeout);
+ }
+ s = xf86SetStrOption(pInfo->options, "ButtonMapping", NULL);
+ if (s) {
+ int b, n = 0;
+ char *s1 = s;
+ /* keep getting numbers which are buttons */
+ while (s1 && n < MSE_MAXBUTTONS && (b = strtol(s1, &s1, 10)) != 0) {
+ /* check sanity for a button */
+ if (b < 0 || b > MSE_MAXBUTTONS) {
+ xf86Msg(X_WARNING,
+ "ButtonMapping: Invalid button number = %d\n", b);
+ break;
+ };
+ pMse->buttonMap[n++] = 1 << (b-1);
+ if (b > pMse->buttons) pMse->buttons = b;
+ }
+ xfree(s);
+ }
+ /* get maximum of mapped buttons */
+ for (i = pMse->buttons-1; i >= 0; i--) {
+ int f = ffs (pMse->buttonMap[i]);
+ if (f > pMse->buttons)
+ pMse->buttons = f;
+ }
+ if (origButtons != pMse->buttons)
+ buttons_from = X_CONFIG;
+ xf86Msg(buttons_from, "%s: Buttons: %d\n", pInfo->name, pMse->buttons);
+
+ pMse->doubleClickSourceButtonMask = 0;
+ pMse->doubleClickTargetButtonMask = 0;
+ pMse->doubleClickTargetButton = 0;
+ s = xf86SetStrOption(pInfo->options, "DoubleClickButtons", NULL);
+ if (s) {
+ int b1 = 0, b2 = 0;
+ char *msg = NULL;
+
+ if ((sscanf(s, "%d %d", &b1, &b2) == 2) &&
+ (b1 > 0) && (b1 <= MSE_MAXBUTTONS) && (b2 > 0) && (b2 <= MSE_MAXBUTTONS)) {
+ msg = xstrdup("buttons XX and YY");
+ if (msg)
+ sprintf(msg, "buttons %d and %d", b1, b2);
+ pMse->doubleClickTargetButton = b1;
+ pMse->doubleClickTargetButtonMask = 1 << (b1 - 1);
+ pMse->doubleClickSourceButtonMask = 1 << (b2 - 1);
+ if (b1 > pMse->buttons) pMse->buttons = b1;
+ if (b2 > pMse->buttons) pMse->buttons = b2;
+ } else {
+ xf86Msg(X_WARNING, "%s: Invalid DoubleClickButtons value: \"%s\"\n",
+ pInfo->name, s);
+ }
+ if (msg) {
+ xf86Msg(X_CONFIG, "%s: DoubleClickButtons: %s\n", pInfo->name, msg);
+ xfree(msg);
+ }
+ xfree(s);
+ }
+}
+/*
+ * map bits corresponding to lock buttons.
+ * for each bit for a lock button,
+ * turn on bit corresponding to button button that the lock
+ * button services.
+ */
+
+static int
+lock2targetMap(DragLockPtr pLock, int lockMask)
+{
+ int result,i;
+ result = 0;
+
+ /*
+ * for each nibble group of bits, use
+ * map for that group to get corresponding
+ * bits, turn them on.
+ * if 4 or less buttons only first map will
+ * need to be used.
+ */
+ for (i = 0; (i < NIB_COUNT) && lockMask; i++) {
+ result |= pLock->nib_table[i][lockMask& NIB_MASK];
+
+ lockMask &= ~NIB_MASK;
+ lockMask >>= NIB_BITS;
+ }
+ return result;
+}
+
+static void
+MouseHWOptions(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse = pInfo->private;
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+
+ if (mPriv == NULL)
+ return;
+
+ if ((mPriv->soft
+ = xf86SetBoolOption(pInfo->options, "AutoSoft", FALSE))) {
+ xf86Msg(X_CONFIG, "Don't initialize mouse when auto-probing\n");
+ }
+ pMse->sampleRate = xf86SetIntOption(pInfo->options, "SampleRate", 0);
+ if (pMse->sampleRate) {
+ xf86Msg(X_CONFIG, "%s: SampleRate: %d\n", pInfo->name,
+ pMse->sampleRate);
+ }
+ pMse->resolution = xf86SetIntOption(pInfo->options, "Resolution", 0);
+ if (pMse->resolution) {
+ xf86Msg(X_CONFIG, "%s: Resolution: %d\n", pInfo->name,
+ pMse->resolution);
+ }
+}
+
+static void
+MouseSerialOptions(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse = pInfo->private;
+ Bool clearDTR, clearRTS;
+
+
+ pMse->baudRate = xf86SetIntOption(pInfo->options, "BaudRate", 0);
+ if (pMse->baudRate) {
+ xf86Msg(X_CONFIG, "%s: BaudRate: %d\n", pInfo->name,
+ pMse->baudRate);
+ }
+
+ if ((clearDTR = xf86SetBoolOption(pInfo->options, "ClearDTR",FALSE)))
+ pMse->mouseFlags |= MF_CLEAR_DTR;
+
+
+ if ((clearRTS = xf86SetBoolOption(pInfo->options, "ClearRTS",FALSE)))
+ pMse->mouseFlags |= MF_CLEAR_RTS;
+
+ if (clearDTR || clearRTS) {
+ xf86Msg(X_CONFIG, "%s: ", pInfo->name);
+ if (clearDTR) {
+ xf86ErrorF("ClearDTR");
+ if (clearRTS)
+ xf86ErrorF(", ");
+ }
+ if (clearRTS) {
+ xf86ErrorF("ClearRTS");
+ }
+ xf86ErrorF("\n");
+ }
+}
+
+static MouseProtocolID
+ProtocolNameToID(const char *name)
+{
+ int i;
+
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (xf86NameCmp(name, mouseProtocols[i].name) == 0)
+ return mouseProtocols[i].id;
+ return PROT_UNKNOWN;
+}
+
+static const char *
+ProtocolIDToName(MouseProtocolID id)
+{
+ int i;
+
+ switch (id) {
+ case PROT_UNKNOWN:
+ return "Unknown";
+ break;
+ case PROT_UNSUP:
+ return "Unsupported";
+ break;
+ default:
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (id == mouseProtocols[i].id)
+ return mouseProtocols[i].name;
+ return "Invalid";
+ }
+}
+
+const char *
+xf86MouseProtocolIDToName(MouseProtocolID id)
+{
+ return ProtocolIDToName(id);
+}
+
+MouseProtocolID
+xf86MouseProtocolNameToID(const char *name)
+{
+ return ProtocolNameToID(name);
+}
+
+static int
+ProtocolIDToClass(MouseProtocolID id)
+{
+ int i;
+
+ switch (id) {
+ case PROT_UNKNOWN:
+ case PROT_UNSUP:
+ return MSE_NONE;
+ break;
+ default:
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (id == mouseProtocols[i].id)
+ return mouseProtocols[i].class;
+ return MSE_NONE;
+ }
+}
+
+static MouseProtocolPtr
+GetProtocol(MouseProtocolID id) {
+ int i;
+
+ switch (id) {
+ case PROT_UNKNOWN:
+ case PROT_UNSUP:
+ return NULL;
+ break;
+ default:
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (id == mouseProtocols[i].id) {
+ return &mouseProtocols[i];
+ }
+ return NULL;
+ }
+}
+
+static OSMouseInfoPtr osInfo = NULL;
+
+static Bool
+InitProtocols(void)
+{
+ int classes;
+ int i;
+ const char *osname = NULL;
+
+ if (osInfo)
+ return TRUE;
+
+ osInfo = xf86OSMouseInit(0);
+ if (!osInfo)
+ return FALSE;
+ if (!osInfo->SupportedInterfaces)
+ return FALSE;
+
+ classes = osInfo->SupportedInterfaces();
+ if (!classes)
+ return FALSE;
+
+ /* Mark unsupported interface classes. */
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (!(mouseProtocols[i].class & classes))
+ mouseProtocols[i].id = PROT_UNSUP;
+
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (mouseProtocols[i].class & MSE_MISC)
+ if (!osInfo->CheckProtocol ||
+ !osInfo->CheckProtocol(mouseProtocols[i].name))
+ mouseProtocols[i].id = PROT_UNSUP;
+
+ /* NetBSD uses PROT_BM for "PS/2". */
+ xf86GetOS(&osname, NULL, NULL, NULL);
+ if (osname && xf86NameCmp(osname, "netbsd") == 0)
+ for (i = 0; mouseProtocols[i].name; i++)
+ if (mouseProtocols[i].id == PROT_PS2)
+ mouseProtocols[i].id = PROT_BM;
+
+ return TRUE;
+}
+
+static InputInfoPtr
+MousePreInit(InputDriverPtr drv, IDevPtr dev, int flags)
+{
+ InputInfoPtr pInfo;
+ MouseDevPtr pMse;
+ mousePrivPtr mPriv;
+ MessageType protocolFrom = X_DEFAULT, deviceFrom = X_CONFIG;
+ const char *protocol, *osProt = NULL;
+ const char *device;
+ MouseProtocolID protocolID;
+ MouseProtocolPtr pProto;
+ Bool detected;
+ int i;
+
+ if (!InitProtocols())
+ return NULL;
+
+ if (!(pInfo = xf86AllocateInput(drv, 0)))
+ return NULL;
+
+ /* Initialise the InputInfoRec. */
+ pInfo->name = dev->identifier;
+ pInfo->type_name = XI_MOUSE;
+ pInfo->flags = XI86_POINTER_CAPABLE | XI86_SEND_DRAG_EVENTS;
+ pInfo->device_control = MouseProc;
+ pInfo->read_input = MouseReadInput;
+ pInfo->motion_history_proc = xf86GetMotionEvents;
+ pInfo->history_size = 0;
+ pInfo->control_proc = NULL;
+ pInfo->close_proc = NULL;
+ pInfo->switch_mode = NULL;
+ pInfo->conversion_proc = MouseConvert;
+ pInfo->reverse_conversion_proc = NULL;
+ pInfo->fd = -1;
+ pInfo->dev = NULL;
+ pInfo->private_flags = 0;
+ pInfo->always_core_feedback = 0;
+ pInfo->conf_idev = dev;
+
+ /* Check if SendDragEvents has been disabled. */
+ if (!xf86SetBoolOption(dev->commonOptions, "SendDragEvents", TRUE)) {
+ pInfo->flags &= ~XI86_SEND_DRAG_EVENTS;
+ }
+
+ /* Allocate the MouseDevRec and initialise it. */
+ /*
+ * XXX This should be done by a function in the core server since the
+ * MouseDevRec is defined in the os-support layer.
+ */
+ if (!(pMse = xcalloc(sizeof(MouseDevRec), 1)))
+ return pInfo;
+ pInfo->private = pMse;
+ pMse->Ctrl = MouseCtrl;
+ pMse->PostEvent = MousePostEvent;
+ pMse->CommonOptions = MouseCommonOptions;
+
+ /* Find the protocol type. */
+ protocol = xf86SetStrOption(dev->commonOptions, "Protocol", NULL);
+ if (protocol) {
+ protocolFrom = X_CONFIG;
+ } else if (osInfo->DefaultProtocol) {
+ protocol = osInfo->DefaultProtocol();
+ protocolFrom = X_DEFAULT;
+ }
+ if (!protocol) {
+ xf86Msg(X_ERROR, "%s: No Protocol specified\n", pInfo->name);
+ return pInfo;
+ }
+
+ /* Default Mapping: 1 2 3 8 9 10 11 ... */
+ for (i = 0; i < MSE_MAXBUTTONS; i++)
+ pMse->buttonMap[i] = 1 << (i > 2 && i < MSE_MAXBUTTONS-4 ? i+4 : i);
+
+ protocolID = ProtocolNameToID(protocol);
+ do {
+ detected = TRUE;
+ switch (protocolID) {
+ case PROT_AUTO:
+ if (osInfo->SetupAuto) {
+ if ((osProt = osInfo->SetupAuto(pInfo,NULL))) {
+ MouseProtocolID id = ProtocolNameToID(osProt);
+ if (id == PROT_UNKNOWN || id == PROT_UNSUP) {
+ protocolID = id;
+ protocol = osProt;
+ detected = FALSE;
+ }
+ }
+ }
+ break;
+ case PROT_UNKNOWN:
+ /* Check for a builtin OS-specific protocol,
+ * and call its PreInit. */
+ if (osInfo->CheckProtocol
+ && osInfo->CheckProtocol(protocol)) {
+ if (!xf86CheckStrOption(dev->commonOptions, "Device", NULL) &&
+ HAVE_FIND_DEVICE && osInfo->FindDevice) {
+ xf86Msg(X_WARNING, "%s: No Device specified, "
+ "looking for one...\n", pInfo->name);
+ if (!osInfo->FindDevice(pInfo, protocol, 0)) {
+ xf86Msg(X_ERROR, "%s: Cannot find which device "
+ "to use.\n", pInfo->name);
+ } else
+ deviceFrom = X_PROBED;
+ }
+ if (osInfo->PreInit) {
+ osInfo->PreInit(pInfo, protocol, 0);
+ }
+ return pInfo;
+ }
+ xf86Msg(X_ERROR, "%s: Unknown protocol \"%s\"\n",
+ pInfo->name, protocol);
+ return pInfo;
+ break;
+ case PROT_UNSUP:
+ xf86Msg(X_ERROR,
+ "%s: Protocol \"%s\" is not supported on this "
+ "platform\n", pInfo->name, protocol);
+ return pInfo;
+ break;
+ default:
+ break;
+
+ }
+ } while (!detected);
+
+ if (!xf86CheckStrOption(dev->commonOptions, "Device", NULL) &&
+ HAVE_FIND_DEVICE && osInfo->FindDevice) {
+ xf86Msg(X_WARNING, "%s: No Device specified, looking for one...\n",
+ pInfo->name);
+ if (!osInfo->FindDevice(pInfo, protocol, 0)) {
+ xf86Msg(X_ERROR, "%s: Cannot find which device to use.\n",
+ pInfo->name);
+ } else {
+ deviceFrom = X_PROBED;
+ xf86MarkOptionUsedByName(dev->commonOptions, "Device");
+ }
+ }
+
+ device = xf86CheckStrOption(dev->commonOptions, "Device", NULL);
+ if (device)
+ xf86Msg(deviceFrom, "%s: Device: \"%s\"\n", pInfo->name, device);
+
+ xf86Msg(protocolFrom, "%s: Protocol: \"%s\"\n", pInfo->name, protocol);
+ if (!(pProto = GetProtocol(protocolID)))
+ return pInfo;
+
+ pMse->protocolID = protocolID;
+ pMse->oldProtocolID = protocolID; /* hack */
+
+ pMse->autoProbe = FALSE;
+ /* Collect the options, and process the common options. */
+ xf86CollectInputOptions(pInfo, pProto->defaults, NULL);
+ xf86ProcessCommonOptions(pInfo, pInfo->options);
+
+ /* XXX should handle this OS dependency elsewhere. */
+#ifndef __OS2ELF__
+ /* OS/2 has a mouse handled by the OS - it cannot fail here */
+
+ /* Check if the device can be opened. */
+ pInfo->fd = xf86OpenSerial(pInfo->options);
+ if (pInfo->fd == -1) {
+ if (xf86GetAllowMouseOpenFail())
+ xf86Msg(X_WARNING, "%s: cannot open input device\n", pInfo->name);
+ else {
+ xf86Msg(X_ERROR, "%s: cannot open input device\n", pInfo->name);
+ if (pMse->mousePriv)
+ xfree(pMse->mousePriv);
+ xfree(pMse);
+ pInfo->private = NULL;
+ return pInfo;
+ }
+ }
+ xf86CloseSerial(pInfo->fd);
+#endif
+ pInfo->fd = -1;
+
+ if (!(mPriv = (pointer) xcalloc(sizeof(mousePrivRec), 1)))
+ return pInfo;
+ pMse->mousePriv = mPriv;
+ pMse->CommonOptions(pInfo);
+ pMse->checkMovements = checkForErraticMovements;
+ pMse->autoProbeMouse = autoProbeMouse;
+ pMse->collectData = collectData;
+ pMse->dataGood = autoGood;
+
+ MouseHWOptions(pInfo);
+ MouseSerialOptions(pInfo);
+
+ pInfo->flags |= XI86_CONFIGURED;
+ return pInfo;
+}
+
+
+static void
+MouseReadInput(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse;
+ int j, buttons, dx, dy, dz, dw, baddata;
+ int pBufP;
+ int c;
+ unsigned char *pBuf, u;
+
+
+ pMse = pInfo->private;
+ pBufP = pMse->protoBufTail;
+ pBuf = pMse->protoBuf;
+
+ /*
+ * Set blocking to -1 on the first call because we know there is data to
+ * read. Xisb automatically clears it after one successful read so that
+ * succeeding reads are preceeded by a select with a 0 timeout to prevent
+ * read from blocking indefinitely.
+ */
+ XisbBlockDuration(pMse->buffer, -1);
+
+ while ((c = XisbRead(pMse->buffer)) >= 0) {
+ u = (unsigned char)c;
+
+#if defined (EXTMOUSEDEBUG) || defined (MOUSEDATADEBUG)
+ ErrorF("mouse byte: %2.2x\n",u);
+#endif
+
+#if 1
+ /* if we do autoprobing collect the data */
+ if (pMse->collectData && pMse->autoProbe)
+ if (pMse->collectData(pMse,u))
+ continue;
+#endif
+#ifdef SUPPORT_MOUSE_RESET
+ if (mouseReset(pInfo,u)) {
+ pBufP = 0;
+ continue;
+ }
+#endif
+ if (pBufP >= pMse->protoPara[4]) {
+ /*
+ * Buffer contains a full packet, which has already been processed:
+ * Empty the buffer and check for optional 4th byte, which will be
+ * processed directly, without being put into the buffer first.
+ */
+ pBufP = 0;
+ if ((u & pMse->protoPara[0]) != pMse->protoPara[1] &&
+ (u & pMse->protoPara[5]) == pMse->protoPara[6]) {
+ /*
+ * Hack for Logitech MouseMan Mouse - Middle button
+ *
+ * Unfortunately this mouse has variable length packets: the
+ * standard Microsoft 3 byte packet plus an optional 4th byte
+ * whenever the middle button status changes.
+ *
+ * We have already processed the standard packet with the
+ * movement and button info. Now post an event message with
+ * the old status of the left and right buttons and the
+ * updated middle button.
+ */
+ /*
+ * Even worse, different MouseMen and TrackMen differ in the
+ * 4th byte: some will send 0x00/0x20, others 0x01/0x21, or
+ * even 0x02/0x22, so I have to strip off the lower bits.
+ * [CHRIS-211092]
+ *
+ * [JCH-96/01/21]
+ * HACK for ALPS "fourth button". (It's bit 0x10 of the
+ * "fourth byte" and it is activated by tapping the glidepad
+ * with the finger! 8^) We map it to bit bit3, and the
+ * reverse map in xf86Events just has to be extended so that
+ * it is identified as Button 4. The lower half of the
+ * reverse-map may remain unchanged.
+ */
+ /*
+ * [KAZU-030897]
+ * Receive the fourth byte only when preceeding three bytes
+ * have been detected (pBufP >= pMse->protoPara[4]). In the
+ * previous versions, the test was pBufP == 0; we may have
+ * mistakingly received a byte even if we didn't see anything
+ * preceeding the byte.
+ */
+#ifdef EXTMOUSEDEBUG
+ ErrorF("mouse 4th byte %02x\n",u);
+#endif
+ dx = dy = dz = dw = 0;
+ buttons = 0;
+ switch (pMse->protocolID) {
+
+ /*
+ * [KAZU-221197]
+ * IntelliMouse, NetMouse (including NetMouse Pro) and Mie
+ * Mouse always send the fourth byte, whereas the fourth byte
+ * is optional for GlidePoint and ThinkingMouse. The fourth
+ * byte is also optional for MouseMan+ and FirstMouse+ in
+ * their native mode. It is always sent if they are in the
+ * IntelliMouse compatible mode.
+ */
+ case PROT_IMSERIAL: /* IntelliMouse, NetMouse, Mie Mouse,
+ MouseMan+ */
+ dz = (u & 0x08) ?
+ (u & 0x0f) - 16 : (u & 0x0f);
+ if ((dz >= 7) || (dz <= -7))
+ dz = 0;
+ buttons |= ((int)(u & 0x10) >> 3)
+ | ((int)(u & 0x20) >> 2)
+ | (pMse->lastButtons & 0x05);
+ break;
+
+ case PROT_GLIDE:
+ case PROT_THINKING:
+ buttons |= ((int)(u & 0x10) >> 1);
+ /* fall through */
+
+ default:
+ buttons |= ((int)(u & 0x20) >> 4) |
+ (pMse->lastButtons & 0x05);
+ break;
+ }
+ goto post_event;
+ }
+ }
+ /* End of packet buffer flush and 4th byte hack. */
+
+ /*
+ * Append next byte to buffer (which is empty or contains an
+ * incomplete packet); iterate if packet (still) not complete.
+ */
+ pBuf[pBufP++] = u;
+ if (pBufP != pMse->protoPara[4]) continue;
+#ifdef EXTMOUSEDEBUG2
+ {
+ int i;
+ ErrorF("received %d bytes",pBufP);
+ for ( i=0; i < pBufP; i++)
+ ErrorF(" %02x",pBuf[i]);
+ ErrorF("\n");
+ }
+#endif
+
+ /*
+ * Hack for resyncing: We check here for a package that is:
+ * a) illegal (detected by wrong data-package header)
+ * b) invalid (0x80 == -128 and that might be wrong for MouseSystems)
+ * c) bad header-package
+ *
+ * NOTE: b) is a violation of the MouseSystems-Protocol, since values
+ * of -128 are allowed, but since they are very seldom we can
+ * easily use them as package-header with no button pressed.
+ * NOTE/2: On a PS/2 mouse any byte is valid as a data byte.
+ * Furthermore, 0x80 is not valid as a header byte. For a PS/2
+ * mouse we skip checking data bytes. For resyncing a PS/2
+ * mouse we require the two most significant bits in the header
+ * byte to be 0. These are the overflow bits, and in case of
+ * an overflow we actually lose sync. Overflows are very rare,
+ * however, and we quickly gain sync again after an overflow
+ * condition. This is the best we can do. (Actually, we could
+ * use bit 0x08 in the header byte for resyncing, since that
+ * bit is supposed to be always on, but nobody told Microsoft...)
+ */
+
+ /*
+ * [KAZU,OYVIND-120398]
+ * The above hack is wrong! Because of b) above, we shall see
+ * erroneous mouse events so often when the MouseSystem mouse is
+ * moved quickly. As for the PS/2 and its variants, we don't need
+ * to treat them as special cases, because protoPara[2] and
+ * protoPara[3] are both 0x00 for them, thus, any data bytes will
+ * never be discarded. 0x80 is rejected for MMSeries, Logitech
+ * and MMHittab protocols, because protoPara[2] and protoPara[3]
+ * are 0x80 and 0x00 respectively. The other protocols are 7-bit
+ * protocols; there is no use checking 0x80.
+ *
+ * All in all we should check the condition a) only.
+ */
+
+ /*
+ * [OYVIND-120498]
+ * Check packet for valid data:
+ * If driver is in sync with datastream, the packet is considered
+ * bad if any byte (header and/or data) contains an invalid value.
+ *
+ * If packet is bad, we discard the first byte and shift the buffer.
+ * Next iteration will then check the new situation for validity.
+ *
+ * If flag MF_SAFE is set in proto[7] and the driver
+ * is out of sync, the packet is also considered bad if
+ * any of the data bytes contains a valid header byte value.
+ * This situation could occur if the buffer contains
+ * the tail of one packet and the header of the next.
+ *
+ * Note: The driver starts in out-of-sync mode (pMse->inSync = 0).
+ */
+
+ baddata = 0;
+
+ /* All databytes must be valid. */
+ for (j = 1; j < pBufP; j++ )
+ if ((pBuf[j] & pMse->protoPara[2]) != pMse->protoPara[3])
+ baddata = 1;
+
+ /* If out of sync, don't mistake a header byte for data. */
+ if ((pMse->protoPara[7] & MPF_SAFE) && !pMse->inSync)
+ for (j = 1; j < pBufP; j++ )
+ if ((pBuf[j] & pMse->protoPara[0]) == pMse->protoPara[1])
+ baddata = 1;
+
+ /* Accept or reject the packet ? */
+ if ((pBuf[0] & pMse->protoPara[0]) != pMse->protoPara[1] || baddata) {
+ if (pMse->inSync) {
+#ifdef EXTMOUSEDEBUG
+ ErrorF("mouse driver lost sync\n");
+#endif
+ }
+#ifdef EXTMOUSEDEBUG
+ ErrorF("skipping byte %02x\n",*pBuf);
+#endif
+ /* Tell auto probe that we are out of sync */
+ if (pMse->autoProbeMouse && pMse->autoProbe)
+ pMse->autoProbeMouse(pInfo, FALSE, pMse->inSync);
+ pMse->protoBufTail = --pBufP;
+ for (j = 0; j < pBufP; j++)
+ pBuf[j] = pBuf[j+1];
+ pMse->inSync = 0;
+ continue;
+ }
+ /* Tell auto probe that we were successful */
+ if (pMse->autoProbeMouse && pMse->autoProbe)
+ pMse->autoProbeMouse(pInfo, TRUE, FALSE);
+
+ if (!pMse->inSync) {
+#ifdef EXTMOUSEDEBUG
+ ErrorF("mouse driver back in sync\n");
+#endif
+ pMse->inSync = 1;
+ }
+
+ if (!pMse->dataGood(pMse))
+ continue;
+
+ /*
+ * Packet complete and verified, now process it ...
+ */
+ REDO_INTERPRET:
+ dz = dw = 0;
+ switch (pMse->protocolID) {
+ case PROT_LOGIMAN: /* MouseMan / TrackMan [CHRIS-211092] */
+ case PROT_MS: /* Microsoft */
+ if (pMse->chordMiddle)
+ buttons = (((int) pBuf[0] & 0x30) == 0x30) ? 2 :
+ ((int)(pBuf[0] & 0x20) >> 3)
+ | ((int)(pBuf[0] & 0x10) >> 4);
+ else
+ buttons = (pMse->lastButtons & 2)
+ | ((int)(pBuf[0] & 0x20) >> 3)
+ | ((int)(pBuf[0] & 0x10) >> 4);
+ dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F));
+ dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F));
+ break;
+
+ case PROT_GLIDE: /* ALPS GlidePoint */
+ case PROT_THINKING: /* ThinkingMouse */
+ case PROT_IMSERIAL: /* IntelliMouse, NetMouse, Mie Mouse, MouseMan+ */
+ buttons = (pMse->lastButtons & (8 + 2))
+ | ((int)(pBuf[0] & 0x20) >> 3)
+ | ((int)(pBuf[0] & 0x10) >> 4);
+ dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F));
+ dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F));
+ break;
+
+ case PROT_MSC: /* Mouse Systems Corp */
+ buttons = (~pBuf[0]) & 0x07;
+ dx = (char)(pBuf[1]) + (char)(pBuf[3]);
+ dy = - ((char)(pBuf[2]) + (char)(pBuf[4]));
+ break;
+
+ case PROT_MMHIT: /* MM_HitTablet */
+ buttons = pBuf[0] & 0x07;
+ if (buttons != 0)
+ buttons = 1 << (buttons - 1);
+ dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1];
+ dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2];
+ break;
+
+ case PROT_ACECAD: /* ACECAD */
+ /* ACECAD is almost exactly like MM but the buttons are different */
+ buttons = (pBuf[0] & 0x02) | ((pBuf[0] & 0x04) >> 2) |
+ ((pBuf[0] & 1) << 2);
+ dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1];
+ dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2];
+ break;
+
+ case PROT_MM: /* MM Series */
+ case PROT_LOGI: /* Logitech Mice */
+ buttons = pBuf[0] & 0x07;
+ dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1];
+ dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2];
+ break;
+
+ case PROT_BM: /* BusMouse */
+ buttons = (~pBuf[0]) & 0x07;
+ dx = (char)pBuf[1];
+ dy = - (char)pBuf[2];
+ break;
+
+ case PROT_PS2: /* PS/2 mouse */
+ case PROT_GENPS2: /* generic PS/2 mouse */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2; /* Left */
+ dx = (pBuf[0] & 0x10) ? (int)pBuf[1]-256 : (int)pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -((int)pBuf[2]-256) : -(int)pBuf[2];
+ break;
+
+ /* PS/2 mouse variants */
+ case PROT_IMPS2: /* IntelliMouse PS/2 */
+ case PROT_NETPS2: /* NetMouse PS/2 */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2 | /* Left */
+ (pBuf[0] & 0x40) >> 3 | /* button 4 */
+ (pBuf[0] & 0x80) >> 3; /* button 5 */
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ /*
+ * The next cast must be 'signed char' for platforms (like PPC)
+ * where char defaults to unsigned.
+ */
+ dz = (signed char)(pBuf[3] | ((pBuf[3] & 0x08) ? 0xf8 : 0));
+ if ((pBuf[3] & 0xf8) && ((pBuf[3] & 0xf8) != 0xf8)) {
+ if (pMse->autoProbe) {
+ SetMouseProto(pMse, PROT_EXPPS2);
+ xf86Msg(X_INFO,
+ "Mouse autoprobe: Changing protocol to %s\n",
+ pMse->protocol);
+
+ goto REDO_INTERPRET;
+ } else
+ dz = 0;
+ }
+ break;
+
+ case PROT_EXPPS2: /* IntelliMouse Explorer PS/2 */
+ if (pMse->autoProbe && (pBuf[3] & 0xC0)) {
+ SetMouseProto(pMse, PROT_IMPS2);
+ xf86Msg(X_INFO,"Mouse autoprobe: Changing protocol to %s\n",
+ pMse->protocol);
+ goto REDO_INTERPRET;
+ }
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2 | /* Left */
+ (pBuf[3] & 0x10) >> 1 | /* button 4 */
+ (pBuf[3] & 0x20) >> 1; /* button 5 */
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ if (pMse->negativeW != MSE_NOAXISMAP) {
+ switch (pBuf[3] & 0x0f) {
+ case 0x00: break;
+ case 0x01: dz = 1; break;
+ case 0x02: dw = 1; break;
+ case 0x0e: dw = -1; break;
+ case 0x0f: dz = -1; break;
+ default:
+ xf86Msg(X_INFO,
+ "Mouse autoprobe: Disabling secondary wheel\n");
+ pMse->negativeW = pMse->positiveW = MSE_NOAXISMAP;
+ }
+ }
+ if (pMse->negativeW == MSE_NOAXISMAP)
+ dz = (pBuf[3]&0x08) ? (pBuf[3]&0x0f) - 16 : (pBuf[3]&0x0f);
+ break;
+
+ case PROT_MMPS2: /* MouseMan+ PS/2 */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2; /* Left */
+ dx = (pBuf[0] & 0x10) ? pBuf[1] - 256 : pBuf[1];
+ if (((pBuf[0] & 0x48) == 0x48) &&
+ (abs(dx) > 191) &&
+ ((((pBuf[2] & 0x03) << 2) | 0x02) == (pBuf[1] & 0x0f))) {
+ /* extended data packet */
+ switch ((((pBuf[0] & 0x30) >> 2) | ((pBuf[1] & 0x30) >> 4))) {
+ case 1: /* wheel data packet */
+ buttons |= ((pBuf[2] & 0x10) ? 0x08 : 0) | /* 4th button */
+ ((pBuf[2] & 0x20) ? 0x10 : 0); /* 5th button */
+ dx = dy = 0;
+ dz = (pBuf[2] & 0x08) ? (pBuf[2] & 0x0f) - 16 :
+ (pBuf[2] & 0x0f);
+ break;
+ case 2: /* Logitech reserves this packet type */
+ /*
+ * IBM ScrollPoint uses this packet to encode its
+ * stick movement.
+ */
+ buttons |= (pMse->lastButtons & ~0x07);
+ dx = dy = 0;
+ dz = (pBuf[2] & 0x80) ? ((pBuf[2] >> 4) & 0x0f) - 16 :
+ ((pBuf[2] >> 4) & 0x0f);
+ dw = (pBuf[2] & 0x08) ? (pBuf[2] & 0x0f) - 16 :
+ (pBuf[2] & 0x0f);
+ break;
+ case 0: /* device type packet - shouldn't happen */
+ default:
+ buttons |= (pMse->lastButtons & ~0x07);
+ dx = dy = 0;
+ dz = 0;
+ break;
+ }
+ } else {
+ buttons |= (pMse->lastButtons & ~0x07);
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ }
+ break;
+
+ case PROT_GLIDEPS2: /* GlidePoint PS/2 */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2 | /* Left */
+ ((pBuf[0] & 0x08) ? 0 : 0x08);/* fourth button */
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ break;
+
+ case PROT_NETSCPS2: /* NetScroll PS/2 */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2 | /* Left */
+ ((pBuf[3] & 0x02) ? 0x08 : 0) | /* button 4 */
+ ((pBuf[3] & 0x01) ? 0x10 : 0); /* button 5 */
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ dz = (pBuf[3] & 0x10) ? pBuf[4] - 256 : pBuf[4];
+ break;
+
+ case PROT_THINKPS2: /* ThinkingMouse PS/2 */
+ buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */
+ (pBuf[0] & 0x02) >> 1 | /* Right */
+ (pBuf[0] & 0x01) << 2 | /* Left */
+ ((pBuf[0] & 0x08) ? 0x08 : 0);/* fourth button */
+ pBuf[1] |= (pBuf[0] & 0x40) ? 0x80 : 0x00;
+ dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1];
+ dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2];
+ break;
+
+ case PROT_SYSMOUSE: /* sysmouse */
+ buttons = (~pBuf[0]) & 0x07;
+ dx = (signed char)(pBuf[1]) + (signed char)(pBuf[3]);
+ dy = - ((signed char)(pBuf[2]) + (signed char)(pBuf[4]));
+ /* FreeBSD sysmouse sends additional data bytes */
+ if (pMse->protoPara[4] >= 8) {
+ /*
+ * These casts must be 'signed char' for platforms (like PPC)
+ * where char defaults to unsigned.
+ */
+ dz = ((signed char)(pBuf[5] << 1) +
+ (signed char)(pBuf[6] << 1)) >> 1;
+ buttons |= (int)(~pBuf[7] & 0x7f) << 3;
+ }
+ break;
+
+ case PROT_VALUMOUSESCROLL: /* Kensington ValuMouseScroll */
+ buttons = ((int)(pBuf[0] & 0x20) >> 3)
+ | ((int)(pBuf[0] & 0x10) >> 4)
+ | ((int)(pBuf[3] & 0x10) >> 3);
+ dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F));
+ dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F));
+ dz = (pBuf[3] & 0x08) ? ((int)(pBuf[3] & 0x0F) - 0x10) :
+ ((int)(pBuf[3] & 0x0F));
+ break;
+
+ default: /* There's a table error */
+#ifdef EXTMOUSEDEBUG
+ ErrorF("mouse table error\n");
+#endif
+ continue;
+ }
+#ifdef EXTMOUSEDEBUG
+ ErrorF("packet");
+ for ( j=0; j < pBufP; j++)
+ ErrorF(" %02x",pBuf[j]);
+ ErrorF("\n");
+#endif
+
+post_event:
+#ifdef EXTMOUSEDEBUG
+ ErrorF("dx=%i dy=%i dz=%i dw=%i buttons=%x\n",dx,dy,dz,dw,buttons);
+#endif
+ /* When auto-probing check if data makes sense */
+ if (pMse->checkMovements && pMse->autoProbe)
+ pMse->checkMovements(pInfo,dx,dy);
+ /* post an event */
+ pMse->PostEvent(pInfo, buttons, dx, dy, dz, dw);
+
+ /*
+ * We don't reset pBufP here yet, as there may be an additional data
+ * byte in some protocols. See above.
+ */
+ }
+ pMse->protoBufTail = pBufP;
+}
+
+/*
+ * MouseCtrl --
+ * Alter the control parameters for the mouse. Note that all special
+ * protocol values are handled by dix.
+ */
+
+static void
+MouseCtrl(DeviceIntPtr device, PtrCtrl *ctrl)
+{
+ InputInfoPtr pInfo;
+ MouseDevPtr pMse;
+
+ pInfo = device->public.devicePrivate;
+ pMse = pInfo->private;
+
+#ifdef EXTMOUSEDEBUG
+ ErrorF("MouseCtrl pMse=%p\n", pMse);
+#endif
+
+ pMse->num = ctrl->num;
+ pMse->den = ctrl->den;
+ pMse->threshold = ctrl->threshold;
+}
+
+/*
+ ***************************************************************************
+ *
+ * MouseProc --
+ *
+ ***************************************************************************
+ */
+
+static int
+MouseProc(DeviceIntPtr device, int what)
+{
+ InputInfoPtr pInfo;
+ MouseDevPtr pMse;
+ mousePrivPtr mPriv;
+ unsigned char map[MSE_MAXBUTTONS + 1];
+ int i;
+
+ pInfo = device->public.devicePrivate;
+ pMse = pInfo->private;
+ pMse->device = device;
+
+ switch (what)
+ {
+ case DEVICE_INIT:
+ device->public.on = FALSE;
+ /*
+ * [KAZU-241097] We don't know exactly how many buttons the
+ * device has, so setup the map with the maximum number.
+ */
+ for (i = 0; i < MSE_MAXBUTTONS; i++)
+ map[i + 1] = i + 1;
+
+ InitPointerDeviceStruct((DevicePtr)device, map,
+ min(pMse->buttons, MSE_MAXBUTTONS),
+ miPointerGetMotionEvents, pMse->Ctrl,
+ miPointerGetMotionBufferSize());
+
+ /* X valuator */
+ xf86InitValuatorAxisStruct(device, 0, 0, -1, 1, 0, 1);
+ xf86InitValuatorDefaults(device, 0);
+ /* Y valuator */
+ xf86InitValuatorAxisStruct(device, 1, 0, -1, 1, 0, 1);
+ xf86InitValuatorDefaults(device, 1);
+ xf86MotionHistoryAllocate(pInfo);
+
+#ifdef EXTMOUSEDEBUG
+ ErrorF("assigning %p atom=%d name=%s\n", device, pInfo->atom,
+ pInfo->name);
+#endif
+ break;
+
+ case DEVICE_ON:
+ pInfo->fd = xf86OpenSerial(pInfo->options);
+ if (pInfo->fd == -1)
+ xf86Msg(X_WARNING, "%s: cannot open input device\n", pInfo->name);
+ else {
+ if (pMse->xisbscale)
+ pMse->buffer = XisbNew(pInfo->fd, pMse->xisbscale * 4);
+ else
+ pMse->buffer = XisbNew(pInfo->fd, 64);
+ if (!pMse->buffer) {
+ xf86CloseSerial(pInfo->fd);
+ pInfo->fd = -1;
+ } else {
+ if (!SetupMouse(pInfo)) {
+ xf86CloseSerial(pInfo->fd);
+ pInfo->fd = -1;
+ XisbFree(pMse->buffer);
+ pMse->buffer = NULL;
+ } else {
+ mPriv = (mousePrivPtr)pMse->mousePriv;
+ if (mPriv != NULL) {
+ if ( pMse->protocolID != PROT_AUTO) {
+ pMse->inSync = TRUE; /* @@@ */
+ if (mPriv->soft)
+ mPriv->autoState = AUTOPROBE_GOOD;
+ else
+ mPriv->autoState = AUTOPROBE_H_GOOD;
+ } else {
+ if (mPriv->soft)
+ mPriv->autoState = AUTOPROBE_NOPROTO;
+ else
+ mPriv->autoState = AUTOPROBE_H_NOPROTO;
+ }
+ }
+ xf86FlushInput(pInfo->fd);
+ xf86AddEnabledDevice(pInfo);
+ }
+ }
+ }
+ pMse->lastButtons = 0;
+ pMse->lastMappedButtons = 0;
+ pMse->emulateState = 0;
+ pMse->emulate3Pending = FALSE;
+ pMse->wheelButtonExpires = GetTimeInMillis ();
+ device->public.on = TRUE;
+ FlushButtons(pMse);
+ if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft)
+ {
+ RegisterBlockAndWakeupHandlers (MouseBlockHandler, MouseWakeupHandler,
+ (pointer) pInfo);
+ }
+ break;
+
+ case DEVICE_OFF:
+ case DEVICE_CLOSE:
+ if (pInfo->fd != -1) {
+ xf86RemoveEnabledDevice(pInfo);
+ if (pMse->buffer) {
+ XisbFree(pMse->buffer);
+ pMse->buffer = NULL;
+ }
+ xf86CloseSerial(pInfo->fd);
+ pInfo->fd = -1;
+ if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft)
+ {
+ RemoveBlockAndWakeupHandlers (MouseBlockHandler, MouseWakeupHandler,
+ (pointer) pInfo);
+ }
+ }
+ device->public.on = FALSE;
+ usleep(300000);
+ break;
+ }
+ return Success;
+}
+
+/*
+ ***************************************************************************
+ *
+ * MouseConvert --
+ * Convert valuators to X and Y.
+ *
+ ***************************************************************************
+ */
+static Bool
+MouseConvert(InputInfoPtr pInfo, int first, int num, int v0, int v1, int v2,
+ int v3, int v4, int v5, int *x, int *y)
+{
+ if (first != 0 || num != 2)
+ return FALSE;
+
+ *x = v0;
+ *y = v1;
+
+ return TRUE;
+}
+
+/**********************************************************************
+ *
+ * FlushButtons -- send button up events for sanity.
+ *
+ **********************************************************************/
+
+static void
+FlushButtons(MouseDevPtr pMse)
+{
+
+ /* If no button down is pending xf86PostButtonEvent()
+ * will discard them. So we are on the safe side. */
+
+ int i, blocked;
+
+ pMse->lastButtons = 0;
+ pMse->lastMappedButtons = 0;
+
+ blocked = xf86BlockSIGIO ();
+ for (i = 1; i <= 5; i++)
+ xf86PostButtonEvent(pMse->device,0,i,0,0,0);
+ xf86UnblockSIGIO (blocked);
+}
+
+/**********************************************************************
+ *
+ * Emulate3Button support code
+ *
+ **********************************************************************/
+
+
+/*
+ * Lets create a simple finite-state machine for 3 button emulation:
+ *
+ * We track buttons 1 and 3 (left and right). There are 11 states:
+ * 0 ground - initial state
+ * 1 delayed left - left pressed, waiting for right
+ * 2 delayed right - right pressed, waiting for left
+ * 3 pressed middle - right and left pressed, emulated middle sent
+ * 4 pressed left - left pressed and sent
+ * 5 pressed right - right pressed and sent
+ * 6 released left - left released after emulated middle
+ * 7 released right - right released after emulated middle
+ * 8 repressed left - left pressed after released left
+ * 9 repressed right - right pressed after released right
+ * 10 pressed both - both pressed, not emulating middle
+ *
+ * At each state, we need handlers for the following events
+ * 0: no buttons down
+ * 1: left button down
+ * 2: right button down
+ * 3: both buttons down
+ * 4: emulate3Timeout passed without a button change
+ * Note that button events are not deltas, they are the set of buttons being
+ * pressed now. It's possible (ie, mouse hardware does it) to go from (eg)
+ * left down to right down without anything in between, so all cases must be
+ * handled.
+ *
+ * a handler consists of three values:
+ * 0: action1
+ * 1: action2
+ * 2: new emulation state
+ *
+ * action > 0: ButtonPress
+ * action = 0: nothing
+ * action < 0: ButtonRelease
+ *
+ * The comment preceeding each section is the current emulation state.
+ * The comments to the right are of the form
+ * <button state> (<events>) -> <new emulation state>
+ * which should be read as
+ * If the buttons are in <button state>, generate <events> then go to
+ * <new emulation state>.
+ */
+static signed char stateTab[11][5][3] = {
+/* 0 ground */
+ {
+ { 0, 0, 0 }, /* nothing -> ground (no change) */
+ { 0, 0, 1 }, /* left -> delayed left */
+ { 0, 0, 2 }, /* right -> delayed right */
+ { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */
+ { 0, 0, -1 } /* timeout N/A */
+ },
+/* 1 delayed left */
+ {
+ { 1, -1, 0 }, /* nothing (left event) -> ground */
+ { 0, 0, 1 }, /* left -> delayed left (no change) */
+ { 1, -1, 2 }, /* right (left event) -> delayed right */
+ { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */
+ { 1, 0, 4 }, /* timeout (left press) -> pressed left */
+ },
+/* 2 delayed right */
+ {
+ { 3, -3, 0 }, /* nothing (right event) -> ground */
+ { 3, -3, 1 }, /* left (right event) -> delayed left (no change) */
+ { 0, 0, 2 }, /* right -> delayed right (no change) */
+ { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */
+ { 3, 0, 5 }, /* timeout (right press) -> pressed right */
+ },
+/* 3 pressed middle */
+ {
+ { -2, 0, 0 }, /* nothing (middle release) -> ground */
+ { 0, 0, 7 }, /* left -> released right */
+ { 0, 0, 6 }, /* right -> released left */
+ { 0, 0, 3 }, /* left & right -> pressed middle (no change) */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 4 pressed left */
+ {
+ { -1, 0, 0 }, /* nothing (left release) -> ground */
+ { 0, 0, 4 }, /* left -> pressed left (no change) */
+ { -1, 0, 2 }, /* right (left release) -> delayed right */
+ { 3, 0, 10 }, /* left & right (right press) -> pressed both */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 5 pressed right */
+ {
+ { -3, 0, 0 }, /* nothing (right release) -> ground */
+ { -3, 0, 1 }, /* left (right release) -> delayed left */
+ { 0, 0, 5 }, /* right -> pressed right (no change) */
+ { 1, 0, 10 }, /* left & right (left press) -> pressed both */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 6 released left */
+ {
+ { -2, 0, 0 }, /* nothing (middle release) -> ground */
+ { -2, 0, 1 }, /* left (middle release) -> delayed left */
+ { 0, 0, 6 }, /* right -> released left (no change) */
+ { 1, 0, 8 }, /* left & right (left press) -> repressed left */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 7 released right */
+ {
+ { -2, 0, 0 }, /* nothing (middle release) -> ground */
+ { 0, 0, 7 }, /* left -> released right (no change) */
+ { -2, 0, 2 }, /* right (middle release) -> delayed right */
+ { 3, 0, 9 }, /* left & right (right press) -> repressed right */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 8 repressed left */
+ {
+ { -2, -1, 0 }, /* nothing (middle release, left release) -> ground */
+ { -2, 0, 4 }, /* left (middle release) -> pressed left */
+ { -1, 0, 6 }, /* right (left release) -> released left */
+ { 0, 0, 8 }, /* left & right -> repressed left (no change) */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 9 repressed right */
+ {
+ { -2, -3, 0 }, /* nothing (middle release, right release) -> ground */
+ { -3, 0, 7 }, /* left (right release) -> released right */
+ { -2, 0, 5 }, /* right (middle release) -> pressed right */
+ { 0, 0, 9 }, /* left & right -> repressed right (no change) */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+/* 10 pressed both */
+ {
+ { -1, -3, 0 }, /* nothing (left release, right release) -> ground */
+ { -3, 0, 4 }, /* left (right release) -> pressed left */
+ { -1, 0, 5 }, /* right (left release) -> pressed right */
+ { 0, 0, 10 }, /* left & right -> pressed both (no change) */
+ { 0, 0, -1 }, /* timeout N/A */
+ },
+};
+
+/*
+ * Table to allow quick reversal of natural button mapping to correct mapping
+ */
+
+/*
+ * [JCH-96/01/21] The ALPS GlidePoint pad extends the MS protocol
+ * with a fourth button activated by tapping the PAD.
+ * The 2nd line corresponds to 4th button on; the drv sends
+ * the buttons in the following map (MSBit described first) :
+ * 0 | 4th | 1st | 2nd | 3rd
+ * And we remap them (MSBit described first) :
+ * 0 | 4th | 3rd | 2nd | 1st
+ */
+static char reverseMap[16] = { 0, 4, 2, 6,
+ 1, 5, 3, 7,
+ 8, 12, 10, 14,
+ 9, 13, 11, 15 };
+
+static char hitachMap[16] = { 0, 2, 1, 3,
+ 8, 10, 9, 11,
+ 4, 6, 5, 7,
+ 12, 14, 13, 15 };
+
+#define reverseBits(map, b) (((b) & ~0x0f) | map[(b) & 0x0f])
+
+static CARD32
+buttonTimer(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse;
+ int sigstate;
+ int id;
+
+ pMse = pInfo->private;
+
+ sigstate = xf86BlockSIGIO ();
+
+ pMse->emulate3Pending = FALSE;
+ if ((id = stateTab[pMse->emulateState][4][0]) != 0) {
+ xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0);
+ pMse->emulateState = stateTab[pMse->emulateState][4][2];
+ } else {
+ ErrorF("Got unexpected buttonTimer in state %d\n", pMse->emulateState);
+ }
+
+ xf86UnblockSIGIO (sigstate);
+ return 0;
+}
+
+static Bool
+Emulate3ButtonsSoft(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse = pInfo->private;
+
+ if (!pMse->emulate3ButtonsSoft)
+ return TRUE;
+
+ pMse->emulate3Buttons = FALSE;
+
+ if (pMse->emulate3Pending)
+ buttonTimer(pInfo);
+
+ xf86Msg(X_INFO,"3rd Button detected: disabling emulate3Button\n");
+
+ return FALSE;
+}
+
+static void MouseBlockHandler(pointer data,
+ struct timeval **waitTime,
+ pointer LastSelectMask)
+{
+ InputInfoPtr pInfo = (InputInfoPtr) data;
+ MouseDevPtr pMse = (MouseDevPtr) pInfo->private;
+ int ms;
+
+ if (pMse->emulate3Pending)
+ {
+ ms = pMse->emulate3Expires - GetTimeInMillis ();
+ if (ms <= 0)
+ ms = 0;
+ AdjustWaitForDelay (waitTime, ms);
+ }
+}
+
+static void MouseWakeupHandler(pointer data,
+ int i,
+ pointer LastSelectMask)
+{
+ InputInfoPtr pInfo = (InputInfoPtr) data;
+ MouseDevPtr pMse = (MouseDevPtr) pInfo->private;
+ int ms;
+
+ if (pMse->emulate3Pending)
+ {
+ ms = pMse->emulate3Expires - GetTimeInMillis ();
+ if (ms <= 0)
+ buttonTimer (pInfo);
+ }
+}
+
+/*******************************************************************
+ *
+ * Post mouse events
+ *
+ *******************************************************************/
+
+static void
+MouseDoPostEvent(InputInfoPtr pInfo, int buttons, int dx, int dy)
+{
+ MouseDevPtr pMse;
+ int emulateButtons;
+ int id, change;
+ int emuWheelDelta, emuWheelButton, emuWheelButtonMask;
+ int wheelButtonMask;
+ int ms;
+
+ pMse = pInfo->private;
+
+ change = buttons ^ pMse->lastMappedButtons;
+ pMse->lastMappedButtons = buttons;
+
+ /* Do single button double click */
+ if (pMse->doubleClickSourceButtonMask) {
+ if (buttons & pMse->doubleClickSourceButtonMask) {
+ if (!(pMse->doubleClickOldSourceState)) {
+ /* double-click button has just been pressed. Ignore it if target button
+ * is already down.
+ */
+ if (!(buttons & pMse->doubleClickTargetButtonMask)) {
+ /* Target button isn't down, so send a double-click */
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 1, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 0, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 1, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 0, 0, 0);
+ }
+ }
+ pMse->doubleClickOldSourceState = 1;
+ }
+ else
+ pMse->doubleClickOldSourceState = 0;
+
+ /* Whatever happened, mask the double-click button so it doesn't get
+ * processed as a normal button as well.
+ */
+ buttons &= ~(pMse->doubleClickSourceButtonMask);
+ change &= ~(pMse->doubleClickSourceButtonMask);
+ }
+
+ if (pMse->emulateWheel) {
+ /* Emulate wheel button handling */
+ wheelButtonMask = 1 << (pMse->wheelButton - 1);
+
+ if (change & wheelButtonMask) {
+ if (buttons & wheelButtonMask) {
+ /* Start timeout handling */
+ pMse->wheelButtonExpires = GetTimeInMillis () + pMse->wheelButtonTimeout;
+ ms = - pMse->wheelButtonTimeout;
+ } else {
+ ms = pMse->wheelButtonExpires - GetTimeInMillis ();
+
+ if (0 < ms) {
+ /*
+ * If the button is released early enough emit the button
+ * press/release events
+ */
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->wheelButton, 1, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, pMse->wheelButton, 0, 0, 0);
+ }
+ }
+ } else
+ ms = pMse->wheelButtonExpires - GetTimeInMillis ();
+
+ /* Intercept wheel emulation. */
+ if (buttons & wheelButtonMask) {
+ if (ms <= 0) {
+ /* Y axis movement */
+ if (pMse->negativeY != MSE_NOAXISMAP) {
+ pMse->wheelYDistance += dy;
+ if (pMse->wheelYDistance < 0) {
+ emuWheelDelta = -pMse->wheelInertia;
+ emuWheelButton = pMse->negativeY;
+ } else {
+ emuWheelDelta = pMse->wheelInertia;
+ emuWheelButton = pMse->positiveY;
+ }
+ emuWheelButtonMask = 1 << (emuWheelButton - 1);
+ while (abs(pMse->wheelYDistance) > pMse->wheelInertia) {
+ pMse->wheelYDistance -= emuWheelDelta;
+
+ /*
+ * Synthesize the press and release, but not when
+ * the button to be synthesized is already pressed
+ * "for real".
+ */
+ if (!(emuWheelButtonMask & buttons) ||
+ (emuWheelButtonMask & wheelButtonMask)) {
+ xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 1, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 0, 0, 0);
+ }
+ }
+ }
+
+ /* X axis movement */
+ if (pMse->negativeX != MSE_NOAXISMAP) {
+ pMse->wheelXDistance += dx;
+ if (pMse->wheelXDistance < 0) {
+ emuWheelDelta = -pMse->wheelInertia;
+ emuWheelButton = pMse->negativeX;
+ } else {
+ emuWheelDelta = pMse->wheelInertia;
+ emuWheelButton = pMse->positiveX;
+ }
+ emuWheelButtonMask = 1 << (emuWheelButton - 1);
+ while (abs(pMse->wheelXDistance) > pMse->wheelInertia) {
+ pMse->wheelXDistance -= emuWheelDelta;
+
+ /*
+ * Synthesize the press and release, but not when
+ * the button to be synthesized is already pressed
+ * "for real".
+ */
+ if (!(emuWheelButtonMask & buttons) ||
+ (emuWheelButtonMask & wheelButtonMask)) {
+ xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 1, 0, 0);
+ xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 0, 0, 0);
+ }
+ }
+ }
+ }
+
+ /* Absorb the mouse movement while the wheel button is pressed. */
+ dx = 0;
+ dy = 0;
+ }
+ /*
+ * Button events for the wheel button are only emitted through
+ * the timeout code.
+ */
+ buttons &= ~wheelButtonMask;
+ change &= ~wheelButtonMask;
+ }
+
+ if (pMse->emulate3ButtonsSoft && pMse->emulate3Pending && (dx || dy))
+ buttonTimer(pInfo);
+
+ if (dx || dy)
+ xf86PostMotionEvent(pInfo->dev, 0, 0, 2, dx, dy);
+
+ if (change) {
+
+ /*
+ * adjust buttons state for drag locks!
+ * if there is drag locks
+ */
+ if (pMse->pDragLock) {
+ DragLockPtr pLock;
+ int tarOfGoingDown, tarOfDown;
+ int realbuttons;
+
+ /* get drag lock block */
+ pLock = pMse->pDragLock;
+ /* save real buttons */
+ realbuttons = buttons;
+
+ /* if drag lock used */
+
+ /* state of drag lock buttons not seen always up */
+
+ buttons &= ~pLock->lockButtonsM;
+
+ /*
+ * if lock buttons being depressed changes state of
+ * targets simulatedDown.
+ */
+ tarOfGoingDown = lock2targetMap(pLock,
+ realbuttons & change & pLock->lockButtonsM);
+ pLock->simulatedDown ^= tarOfGoingDown;
+
+ /* targets of drag locks down */
+ tarOfDown = lock2targetMap(pLock,
+ realbuttons & pLock->lockButtonsM);
+
+ /*
+ * when simulatedDown set and target pressed,
+ * simulatedDown goes false
+ */
+ pLock->simulatedDown &= ~(realbuttons & change);
+
+ /*
+ * if master drag lock released
+ * then master drag lock state on
+ */
+ pLock->masterTS |= (~realbuttons & change) & pLock->masterLockM;
+
+ /* if master state, buttons going down are simulatedDown */
+ if (pLock->masterTS)
+ pLock->simulatedDown |= (realbuttons & change);
+
+ /* if any button pressed, no longer in master drag lock state */
+ if (realbuttons & change)
+ pLock->masterTS = 0;
+
+ /* if simulatedDown or drag lock down, simulate down */
+ buttons |= (pLock->simulatedDown | tarOfDown);
+
+ /* master button not seen */
+ buttons &= ~(pLock->masterLockM);
+
+ /* buttons changed since last time */
+ change = buttons ^ pLock->lockLastButtons;
+
+ /* save this time for next last time. */
+ pLock->lockLastButtons = buttons;
+ }
+
+ if (pMse->emulate3Buttons
+ && (!(buttons & 0x02) || Emulate3ButtonsSoft(pInfo))) {
+
+ /* handle all but buttons 1 & 3 normally */
+
+ change &= ~05;
+
+ /* emulate the third button by the other two */
+
+ emulateButtons = (buttons & 01) | ((buttons &04) >> 1);
+
+ if ((id = stateTab[pMse->emulateState][emulateButtons][0]) != 0)
+ xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0);
+ if ((id = stateTab[pMse->emulateState][emulateButtons][1]) != 0)
+ xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0);
+
+ pMse->emulateState =
+ stateTab[pMse->emulateState][emulateButtons][2];
+
+ if (stateTab[pMse->emulateState][4][0] != 0) {
+ pMse->emulate3Expires = GetTimeInMillis () + pMse->emulate3Timeout;
+ pMse->emulate3Pending = TRUE;
+ } else {
+ pMse->emulate3Pending = FALSE;
+ }
+ }
+
+ while (change) {
+ id = ffs(change);
+ change &= ~(1 << (id - 1));
+ xf86PostButtonEvent(pInfo->dev, 0, id,
+ (buttons & (1 << (id - 1))), 0, 0);
+ }
+
+ }
+}
+
+static void
+MousePostEvent(InputInfoPtr pInfo, int truebuttons,
+ int dx, int dy, int dz, int dw)
+{
+ MouseDevPtr pMse;
+ int zbutton = 0, wbutton = 0, zbuttoncount = 0, wbuttoncount = 0;
+ int i, b, buttons = 0;
+
+ pMse = pInfo->private;
+ if (pMse->protocolID == PROT_MMHIT)
+ b = reverseBits(hitachMap, truebuttons);
+ else
+ b = reverseBits(reverseMap, truebuttons);
+
+ /* Remap mouse buttons */
+ b &= (1<<MSE_MAXBUTTONS)-1;
+ for (i = 0; b; i++) {
+ if (b & 1)
+ buttons |= pMse->buttonMap[i];
+ b >>= 1;
+ }
+
+ /* Map the Z axis movement. */
+ /* XXX Could this go in the conversion_proc? */
+ switch (pMse->negativeZ) {
+ case MSE_NOZMAP: /* do nothing */
+ dz = 0;
+ break;
+ case MSE_MAPTOX:
+ if (dz != 0) {
+ dx = dz;
+ dz = 0;
+ }
+ break;
+ case MSE_MAPTOY:
+ if (dz != 0) {
+ dy = dz;
+ dz = 0;
+ }
+ break;
+ default: /* buttons */
+ buttons &= ~(pMse->negativeZ | pMse->positiveZ);
+ if (dz < 0) {
+ zbutton = pMse->negativeZ;
+ zbuttoncount = -dz;
+ } else if (dz > 0) {
+ zbutton = pMse->positiveZ;
+ zbuttoncount = dz;
+ }
+ dz = 0;
+ break;
+ }
+ switch (pMse->negativeW) {
+ case MSE_NOZMAP: /* do nothing */
+ dw = 0;
+ break;
+ case MSE_MAPTOX:
+ if (dw != 0) {
+ dx = dw;
+ dw = 0;
+ }
+ break;
+ case MSE_MAPTOY:
+ if (dw != 0) {
+ dy = dw;
+ dw = 0;
+ }
+ break;
+ default: /* buttons */
+ buttons &= ~(pMse->negativeW | pMse->positiveW);
+ if (dw < 0) {
+ wbutton = pMse->negativeW;
+ wbuttoncount = -dw;
+ } else if (dw > 0) {
+ wbutton = pMse->positiveW;
+ wbuttoncount = dw;
+ }
+ dw = 0;
+ break;
+ }
+
+
+ /* Apply angle offset */
+ if (pMse->angleOffset != 0) {
+ double rad = 3.141592653 * pMse->angleOffset / 180.0;
+ int ndx = dx;
+ dx = (int)((dx * cos(rad)) + (dy * sin(rad)) + 0.5);
+ dy = (int)((dy * cos(rad)) - (ndx * sin(rad)) + 0.5);
+ }
+
+ dx = pMse->invX * dx;
+ dy = pMse->invY * dy;
+ if (pMse->flipXY) {
+ int tmp = dx;
+ dx = dy;
+ dy = tmp;
+ }
+
+ /* If mouse wheel movement has to be mapped on a button, we need to
+ * loop for button press and release events. */
+ do {
+ MouseDoPostEvent(pInfo, buttons | zbutton | wbutton, dx, dy);
+ dx = dy = 0;
+ if (zbutton || wbutton)
+ MouseDoPostEvent(pInfo, buttons, 0, 0);
+ if (--zbuttoncount <= 0)
+ zbutton = 0;
+ if (--wbuttoncount <= 0)
+ wbutton = 0;
+ } while (zbutton || wbutton);
+
+ pMse->lastButtons = truebuttons;
+}
+/******************************************************************
+ *
+ * Mouse Setup Code
+ *
+ ******************************************************************/
+/*
+ * This array is indexed by the MouseProtocolID values, so the order of the
+ * entries must match that of the MouseProtocolID enum in xf86OSmouse.h.
+ */
+static unsigned char proto[PROT_NUMPROTOS][8] = {
+ /* --header-- ---data--- packet -4th-byte- mouse */
+ /* mask id mask id bytes mask id flags */
+ /* Serial mice */
+ { 0x40, 0x40, 0x40, 0x00, 3, ~0x23, 0x00, MPF_NONE }, /* MicroSoft */
+ { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_SAFE }, /* MouseSystems */
+ { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MMSeries */
+ { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* Logitech */
+ { 0x40, 0x40, 0x40, 0x00, 3, ~0x23, 0x00, MPF_NONE }, /* MouseMan */
+ { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MM_HitTablet */
+ { 0x40, 0x40, 0x40, 0x00, 3, ~0x33, 0x00, MPF_NONE }, /* GlidePoint */
+ { 0x40, 0x40, 0x40, 0x00, 3, ~0x3f, 0x00, MPF_NONE }, /* IntelliMouse */
+ { 0x40, 0x40, 0x40, 0x00, 3, ~0x33, 0x00, MPF_NONE }, /* ThinkingMouse */
+ { 0x80, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* ACECAD */
+ { 0x40, 0x40, 0x40, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* ValuMouseScroll */
+ /* PS/2 variants */
+ { 0xc0, 0x00, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* PS/2 mouse */
+ { 0xc8, 0x08, 0x00, 0x00, 3, 0x00, 0x00, MPF_NONE }, /* genericPS/2 mouse*/
+ { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* IntelliMouse */
+ { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* Explorer */
+ { 0x80, 0x80, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* ThinkingMouse */
+ { 0x08, 0x08, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MouseMan+ */
+ { 0xc0, 0x00, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* GlidePoint */
+ { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* NetMouse */
+ { 0xc0, 0x00, 0x00, 0x00, 6, 0x00, 0xff, MPF_NONE }, /* NetScroll */
+ /* Bus Mouse */
+ { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_NONE }, /* BusMouse */
+ { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_NONE }, /* Auto (dummy) */
+ { 0xf8, 0x80, 0x00, 0x00, 8, 0x00, 0xff, MPF_NONE }, /* SysMouse */
+};
+
+
+/*
+ * SetupMouse --
+ * Sets up the mouse parameters
+ */
+static Bool
+SetupMouse(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse;
+ int i;
+ int protoPara[8] = {-1, -1, -1, -1, -1, -1, -1, -1};
+ const char *name = NULL;
+ Bool automatic = FALSE;
+
+ pMse = pInfo->private;
+
+ /* Handle the "Auto" protocol. */
+ if (pMse->protocolID == PROT_AUTO) {
+ /*
+ * We come here when user specifies protocol "auto" in
+ * the configuration file or thru the xf86misc extensions.
+ * So we initialize autoprobing here.
+ * Probe for PnP/OS mouse first. If unsuccessful
+ * try to guess protocol from incoming data.
+ */
+ automatic = TRUE;
+ pMse->autoProbe = TRUE;
+ name = autoOSProtocol(pInfo,protoPara);
+ if (name) {
+#ifdef EXTMOUSEDEBUG
+ ErrorF("PnP/OS Mouse detected: %s\n",name);
+#endif
+ }
+ }
+
+ SetMouseProto(pMse, pMse->protocolID);
+
+ if (automatic) {
+ if (name) {
+ /* Possible protoPara overrides from SetupAuto. */
+ for (i = 0; i < sizeof(pMse->protoPara); i++)
+ if (protoPara[i] != -1)
+ pMse->protoPara[i] = protoPara[i];
+ /* if we come here PnP/OS mouse probing was successful */
+ } else {
+#if 1
+ /* PnP/OS mouse probing wasn't successful; we look at data */
+#else
+ xf86Msg(X_ERROR, "%s: cannot determine the mouse protocol\n",
+ pInfo->name);
+ return FALSE;
+#endif
+ }
+ }
+
+ /*
+ * If protocol has changed fetch the default options
+ * for the new protocol.
+ */
+ if (pMse->oldProtocolID != pMse->protocolID) {
+ pointer tmp = NULL;
+ if ((pMse->protocolID >= 0)
+ && (pMse->protocolID < PROT_NUMPROTOS)
+ && mouseProtocols[pMse->protocolID].defaults)
+ tmp = xf86OptionListCreate(
+ mouseProtocols[pMse->protocolID].defaults, -1, 0);
+ pInfo->options = xf86OptionListMerge(pInfo->options, tmp);
+ /*
+ * If baudrate is set write it back to the option
+ * list so that the serial interface code can access
+ * the new value. Not set means default.
+ */
+ if (pMse->baudRate)
+ xf86ReplaceIntOption(pInfo->options, "BaudRate", pMse->baudRate);
+ pMse->oldProtocolID = pMse->protocolID; /* hack */
+ }
+
+
+ /* Set the port parameters. */
+ if (!automatic)
+ xf86SetSerial(pInfo->fd, pInfo->options);
+
+ if (!initMouseHW(pInfo))
+ return FALSE;
+
+ pMse->protoBufTail = 0;
+ pMse->inSync = 0;
+
+ return TRUE;
+}
+
+/********************************************************************
+ *
+ * Mouse HW setup code
+ *
+ ********************************************************************/
+
+/*
+** The following lines take care of the Logitech MouseMan protocols.
+** The "Logitech" protocol is for the old "series 9" Logitech products.
+** All products since then use the "MouseMan" protocol. Some models
+** were programmable, but most (all?) of the current models are not.
+**
+** NOTE: There are different versions of both MouseMan and TrackMan!
+** Hence I add another protocol PROT_LOGIMAN, which the user can
+** specify as MouseMan in his XF86Config file. This entry was
+** formerly handled as a special case of PROT_MS. However, people
+** who don't have the middle button problem, can still specify
+** Microsoft and use PROT_MS.
+**
+** By default, these mice should use a 3 byte Microsoft protocol
+** plus a 4th byte for the middle button. However, the mouse might
+** have switched to a different protocol before we use it, so I send
+** the proper sequence just in case.
+**
+** NOTE: - all commands to (at least the European) MouseMan have to
+** be sent at 1200 Baud.
+** - each command starts with a '*'.
+** - whenever the MouseMan receives a '*', it will switch back
+** to 1200 Baud. Hence I have to select the desired protocol
+** first, then select the baud rate.
+**
+** The protocols supported by the (European) MouseMan are:
+** - 5 byte packed binary protocol, as with the Mouse Systems
+** mouse. Selected by sequence "*U".
+** - 2 button 3 byte MicroSoft compatible protocol. Selected
+** by sequence "*V".
+** - 3 button 3+1 byte MicroSoft compatible protocol (default).
+** Selected by sequence "*X".
+**
+** The following baud rates are supported:
+** - 1200 Baud (default). Selected by sequence "*n".
+** - 9600 Baud. Selected by sequence "*q".
+**
+** Selecting a sample rate is no longer supported with the MouseMan!
+** [CHRIS-211092]
+*/
+
+/*
+ * Do a reset wrap mode before reset.
+ */
+#define do_ps2Reset(x) { \
+ int i = RETRY_COUNT;\
+ while (i-- > 0) { \
+ xf86FlushInput(x->fd); \
+ if (ps2Reset(x)) break; \
+ } \
+ }
+
+
+static Bool
+initMouseHW(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse = pInfo->private;
+ const char *s;
+ unsigned char c;
+ int speed;
+ pointer options;
+ unsigned char *param = NULL;
+ int paramlen = 0;
+ int count = RETRY_COUNT;
+ Bool ps2Init = TRUE;
+
+ switch (pMse->protocolID) {
+ case PROT_LOGI: /* Logitech Mice */
+ /*
+ * The baud rate selection command must be sent at the current
+ * baud rate; try all likely settings.
+ */
+ speed = pMse->baudRate;
+ switch (speed) {
+ case 9600:
+ s = "*q";
+ break;
+ case 4800:
+ s = "*p";
+ break;
+ case 2400:
+ s = "*o";
+ break;
+ case 1200:
+ s = "*n";
+ break;
+ default:
+ /* Fallback value */
+ speed = 1200;
+ s = "*n";
+ }
+ xf86SetSerialSpeed(pInfo->fd, 9600);
+ xf86WriteSerial(pInfo->fd, s, 2);
+ usleep(100000);
+ xf86SetSerialSpeed(pInfo->fd, 4800);
+ xf86WriteSerial(pInfo->fd, s, 2);
+ usleep(100000);
+ xf86SetSerialSpeed(pInfo->fd, 2400);
+ xf86WriteSerial(pInfo->fd, s, 2);
+ usleep(100000);
+ xf86SetSerialSpeed(pInfo->fd, 1200);
+ xf86WriteSerial(pInfo->fd, s, 2);
+ usleep(100000);
+ xf86SetSerialSpeed(pInfo->fd, speed);
+
+ /* Select MM series data format. */
+ xf86WriteSerial(pInfo->fd, "S", 1);
+ usleep(100000);
+ /* Set the parameters up for the MM series protocol. */
+ options = pInfo->options;
+ xf86CollectInputOptions(pInfo, mmDefaults, NULL);
+ xf86SetSerial(pInfo->fd, pInfo->options);
+ pInfo->options = options;
+
+ /* Select report rate/frequency. */
+ if (pMse->sampleRate <= 0) c = 'O'; /* 100 */
+ else if (pMse->sampleRate <= 15) c = 'J'; /* 10 */
+ else if (pMse->sampleRate <= 27) c = 'K'; /* 20 */
+ else if (pMse->sampleRate <= 42) c = 'L'; /* 35 */
+ else if (pMse->sampleRate <= 60) c = 'R'; /* 50 */
+ else if (pMse->sampleRate <= 85) c = 'M'; /* 67 */
+ else if (pMse->sampleRate <= 125) c = 'Q'; /* 100 */
+ else c = 'N'; /* 150 */
+ xf86WriteSerial(pInfo->fd, &c, 1);
+ break;
+
+ case PROT_LOGIMAN:
+ speed = pMse->baudRate;
+ switch (speed) {
+ case 9600:
+ s = "*q";
+ break;
+ case 1200:
+ s = "*n";
+ break;
+ default:
+ /* Fallback value */
+ speed = 1200;
+ s = "*n";
+ }
+ xf86SetSerialSpeed(pInfo->fd, 1200);
+ xf86WriteSerial(pInfo->fd, "*n", 2);
+ xf86WriteSerial(pInfo->fd, "*X", 2);
+ xf86WriteSerial(pInfo->fd, s, 2);
+ usleep(100000);
+ xf86SetSerialSpeed(pInfo->fd, speed);
+ break;
+
+ case PROT_MMHIT: /* MM_HitTablet */
+ /*
+ * Initialize Hitachi PUMA Plus - Model 1212E to desired settings.
+ * The tablet must be configured to be in MM mode, NO parity,
+ * Binary Format. pMse->sampleRate controls the sensitivity
+ * of the tablet. We only use this tablet for it's 4-button puck
+ * so we don't run in "Absolute Mode".
+ */
+ xf86WriteSerial(pInfo->fd, "z8", 2); /* Set Parity = "NONE" */
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "zb", 2); /* Set Format = "Binary" */
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "@", 1); /* Set Report Mode = "Stream" */
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "R", 1); /* Set Output Rate = "45 rps" */
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "I\x20", 2); /* Set Incrememtal Mode "20" */
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "E", 1); /* Set Data Type = "Relative */
+ usleep(50000);
+ /*
+ * These sample rates translate to 'lines per inch' on the Hitachi
+ * tablet.
+ */
+ if (pMse->sampleRate <= 40) c = 'g';
+ else if (pMse->sampleRate <= 100) c = 'd';
+ else if (pMse->sampleRate <= 200) c = 'e';
+ else if (pMse->sampleRate <= 500) c = 'h';
+ else if (pMse->sampleRate <= 1000) c = 'j';
+ else c = 'd';
+ xf86WriteSerial(pInfo->fd, &c, 1);
+ usleep(50000);
+ xf86WriteSerial(pInfo->fd, "\021", 1); /* Resume DATA output */
+ break;
+
+ case PROT_THINKING: /* ThinkingMouse */
+ /* This mouse may send a PnP ID string, ignore it. */
+ usleep(200000);
+ xf86FlushInput(pInfo->fd);
+ /* Send the command to initialize the beast. */
+ for (s = "E5E5"; *s; ++s) {
+ xf86WriteSerial(pInfo->fd, s, 1);
+ if ((xf86WaitForInput(pInfo->fd, 1000000) <= 0))
+ break;
+ xf86ReadSerial(pInfo->fd, &c, 1);
+ if (c != *s)
+ break;
+ }
+ break;
+
+ case PROT_MSC: /* MouseSystems Corp */
+ usleep(100000);
+ xf86FlushInput(pInfo->fd);
+ break;
+
+ case PROT_ACECAD:
+ /* initialize */
+ /* A nul character resets. */
+ xf86WriteSerial(pInfo->fd, "", 1);
+ usleep(50000);
+ /* Stream out relative mode high resolution increments of 1. */
+ xf86WriteSerial(pInfo->fd, "@EeI!", 5);
+ break;
+
+ case PROT_BM: /* bus/InPort mouse */
+ if (osInfo->SetBMRes)
+ osInfo->SetBMRes(pInfo, pMse->protocol, pMse->sampleRate,
+ pMse->resolution);
+ break;
+
+ case PROT_GENPS2:
+ ps2Init = FALSE;
+ break;
+
+ case PROT_PS2:
+ case PROT_GLIDEPS2:
+ break;
+
+ case PROT_IMPS2: /* IntelliMouse */
+ {
+ static unsigned char seq[] = { 243, 200, 243, 100, 243, 80 };
+ param = seq;
+ paramlen = sizeof(seq);
+ }
+ break;
+
+ case PROT_EXPPS2: /* IntelliMouse Explorer */
+ {
+ static unsigned char seq[] = { 243, 200, 243, 100, 243, 80,
+ 243, 200, 243, 200, 243, 80 };
+
+ param = seq;
+ paramlen = sizeof(seq);
+ }
+ break;
+
+ case PROT_NETPS2: /* NetMouse, NetMouse Pro, Mie Mouse */
+ case PROT_NETSCPS2: /* NetScroll */
+ {
+ static unsigned char seq[] = { 232, 3, 230, 230, 230, 233 };
+
+ param = seq;
+ paramlen = sizeof(seq);
+ }
+ break;
+
+ case PROT_MMPS2: /* MouseMan+, FirstMouse+ */
+ {
+ static unsigned char seq[] = { 230, 232, 0, 232, 3, 232, 2, 232, 1,
+ 230, 232, 3, 232, 1, 232, 2, 232, 3 };
+ param = seq;
+ paramlen = sizeof(seq);
+ }
+ break;
+
+ case PROT_THINKPS2: /* ThinkingMouse */
+ {
+ static unsigned char seq[] = { 243, 10, 232, 0, 243, 20, 243, 60,
+ 243, 40, 243, 20, 243, 20, 243, 60,
+ 243, 40, 243, 20, 243, 20 };
+ param = seq;
+ paramlen = sizeof(seq);
+ }
+ break;
+ case PROT_SYSMOUSE:
+ if (osInfo->SetMiscRes)
+ osInfo->SetMiscRes(pInfo, pMse->protocol, pMse->sampleRate,
+ pMse->resolution);
+ break;
+
+ default:
+ /* Nothing to do. */
+ break;
+ }
+
+ if (pMse->class & (MSE_PS2 | MSE_XPS2)) {
+ /*
+ * If one part of the PS/2 mouse initialization fails
+ * redo complete initialization. There are mice which
+ * have occasional problems with initialization and
+ * are in an unknown state.
+ */
+ if (ps2Init) {
+ REDO:
+ do_ps2Reset(pInfo);
+ if (paramlen > 0) {
+ if (!ps2SendPacket(pInfo,param,paramlen)) {
+ usleep(30000);
+ xf86FlushInput(pInfo->fd);
+ if (!count--)
+ return TRUE;
+ goto REDO;
+ }
+ ps2GetDeviceID(pInfo);
+ usleep(30000);
+ xf86FlushInput(pInfo->fd);
+ }
+
+ if (osInfo->SetPS2Res) {
+ osInfo->SetPS2Res(pInfo, pMse->protocol, pMse->sampleRate,
+ pMse->resolution);
+ } else {
+ unsigned char c2[2];
+
+ c = 0xE6; /*230*/ /* 1:1 scaling */
+ if (!ps2SendPacket(pInfo,&c,1)) {
+ if (!count--)
+ return TRUE;
+ goto REDO;
+ }
+ c2[0] = 0xF3; /*243*/ /* set sampling rate */
+ if (pMse->sampleRate > 0) {
+ if (pMse->sampleRate >= 200)
+ c2[1] = 200;
+ else if (pMse->sampleRate >= 100)
+ c2[1] = 100;
+ else if (pMse->sampleRate >= 80)
+ c2[1] = 80;
+ else if (pMse->sampleRate >= 60)
+ c2[1] = 60;
+ else if (pMse->sampleRate >= 40)
+ c2[1] = 40;
+ else
+ c2[1] = 20;
+ } else {
+ c2[1] = 100;
+ }
+ if (!ps2SendPacket(pInfo,c2,2)) {
+ if (!count--)
+ return TRUE;
+ goto REDO;
+ }
+ c2[0] = 0xE8; /*232*/ /* set device resolution */
+ if (pMse->resolution > 0) {
+ if (pMse->resolution >= 200)
+ c2[1] = 3;
+ else if (pMse->resolution >= 100)
+ c2[1] = 2;
+ else if (pMse->resolution >= 50)
+ c2[1] = 1;
+ else
+ c2[1] = 0;
+ } else {
+ c2[1] = 3; /* used to be 2, W. uses 3 */
+ }
+ if (!ps2SendPacket(pInfo,c2,2)) {
+ if (!count--)
+ return TRUE;
+ goto REDO;
+ }
+ usleep(30000);
+ xf86FlushInput(pInfo->fd);
+ if (!ps2EnableDataReporting(pInfo)) {
+ xf86Msg(X_INFO, "%s: ps2EnableDataReporting: failed\n",
+ pInfo->name);
+ xf86FlushInput(pInfo->fd);
+ if (!count--)
+ return TRUE;
+ goto REDO;
+ } else {
+ xf86Msg(X_INFO, "%s: ps2EnableDataReporting: succeeded\n",
+ pInfo->name);
+ }
+ }
+ /*
+ * The PS/2 reset handling needs to be rechecked.
+ * We need to wait until after the 4.3 release.
+ */
+ }
+ } else {
+ if (paramlen > 0) {
+ if (xf86WriteSerial(pInfo->fd, param, paramlen) != paramlen)
+ xf86Msg(X_ERROR, "%s: Mouse initialization failed\n",
+ pInfo->name);
+ usleep(30000);
+ xf86FlushInput(pInfo->fd);
+ }
+ }
+
+ return TRUE;
+}
+
+#ifdef SUPPORT_MOUSE_RESET
+static Bool
+mouseReset(InputInfoPtr pInfo, unsigned char val)
+{
+ MouseDevPtr pMse = pInfo->private;
+ mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv;
+ CARD32 prevEvent = mousepriv->lastEvent;
+ Bool expectReset = FALSE;
+ Bool ret = FALSE;
+
+ mousepriv->lastEvent = GetTimeInMillis();
+
+#ifdef EXTMOUSEDEBUG
+ ErrorF("byte: 0x%x time: %li\n",val,mousepriv->lastEvent);
+#endif
+ /*
+ * We believe that the following is true:
+ * When the mouse is replugged it will send a reset package
+ * It takes several seconds to replug a mouse: We don't see
+ * events for several seconds before we see the replug event package.
+ * There is no significant delay between consecutive bytes
+ * of a replug event package.
+ * There are no bytes sent after the replug event package until
+ * the mouse is reset.
+ */
+
+ if (mousepriv->current == 0
+ && (mousepriv->lastEvent - prevEvent) < 4000)
+ return FALSE;
+
+ if (mousepriv->current > 0
+ && (mousepriv->lastEvent - prevEvent) >= 1000) {
+ mousepriv->inReset = FALSE;
+ mousepriv->current = 0;
+ return FALSE;
+ }
+
+ if (mousepriv->inReset)
+ mousepriv->inReset = FALSE;
+
+#ifdef EXTMOUSEDEBUG
+ ErrorF("Mouse Current: %i 0x%x\n",mousepriv->current, val);
+#endif
+
+ /* here we put the mouse specific reset detction */
+ /* They need to do three things: */
+ /* Check if byte may be a reset byte */
+ /* If so: Set expectReset TRUE */
+ /* If convinced: Set inReset TRUE */
+ /* Register BlockAndWakeupHandler */
+
+ /* PS/2 */
+ {
+ unsigned char seq[] = { 0xaa, 0x00 };
+ int len = sizeof(seq);
+
+ if (seq[mousepriv->current] == val)
+ expectReset = TRUE;
+
+ if (len == mousepriv->current + 1) {
+ mousepriv->inReset = TRUE;
+ mousepriv->expires = GetTimeInMillis() + 1000;
+
+#ifdef EXTMOUSEDEBUG
+ ErrorF("Found PS/2 Reset string\n");
+#endif
+ RegisterBlockAndWakeupHandlers (ps2BlockHandler,
+ ps2WakeupHandler, (pointer) pInfo);
+ ret = TRUE;
+ }
+ }
+
+ if (!expectReset)
+ mousepriv->current = 0;
+ else
+ mousepriv->current++;
+ return ret;
+}
+
+static void
+ps2BlockHandler(pointer data, struct timeval **waitTime,
+ pointer LastSelectMask)
+{
+ InputInfoPtr pInfo = (InputInfoPtr) data;
+ MouseDevPtr pMse = (MouseDevPtr) pInfo->private;
+ mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv;
+ int ms;
+
+ if (mousepriv->inReset) {
+ ms = mousepriv->expires - GetTimeInMillis ();
+ if (ms <= 0)
+ ms = 0;
+ AdjustWaitForDelay (waitTime, ms);
+ } else
+ RemoveBlockAndWakeupHandlers (ps2BlockHandler, ps2WakeupHandler,
+ (pointer) pInfo);
+}
+
+static void
+ps2WakeupHandler(pointer data, int i, pointer LastSelectMask)
+{
+ InputInfoPtr pInfo = (InputInfoPtr) data;
+ MouseDevPtr pMse = (MouseDevPtr) pInfo->private;
+ mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv;
+ int ms;
+
+ if (mousepriv->inReset) {
+ unsigned char val;
+ int blocked;
+
+ ms = mousepriv->expires - GetTimeInMillis();
+ if (ms > 0)
+ return;
+
+ blocked = xf86BlockSIGIO ();
+
+ xf86MsgVerb(X_INFO,3,
+ "Got reinsert event: reinitializing PS/2 mouse\n");
+ val = 0xf4;
+ if (xf86WriteSerial(pInfo->fd, &val, 1) != 1)
+ xf86Msg(X_ERROR, "%s: Write to mouse failed\n",
+ pInfo->name);
+ xf86UnblockSIGIO(blocked);
+ }
+ RemoveBlockAndWakeupHandlers (ps2BlockHandler, ps2WakeupHandler,
+ (pointer) pInfo);
+}
+#endif /* SUPPORT_MOUSE_RESET */
+
+/************************************************************
+ *
+ * Autoprobe stuff
+ *
+ ************************************************************/
+#ifdef EXTMOUSEDEBUG
+# define AP_DBG(x) { ErrorF("Autoprobe: "); ErrorF x; }
+# define AP_DBGC(x) ErrorF x ;
+# else
+# define AP_DBG(x)
+# define AP_DBGC(x)
+#endif
+
+MouseProtocolID hardProtocolList[] = { PROT_MSC, PROT_MM, PROT_LOGI,
+ PROT_LOGIMAN, PROT_MMHIT,
+ PROT_GLIDE, PROT_IMSERIAL,
+ PROT_THINKING, PROT_ACECAD,
+ PROT_THINKPS2, PROT_MMPS2,
+ PROT_GLIDEPS2,
+ PROT_NETSCPS2, PROT_EXPPS2,PROT_IMPS2,
+ PROT_GENPS2, PROT_NETPS2,
+ PROT_MS,
+ PROT_UNKNOWN
+};
+
+MouseProtocolID softProtocolList[] = { PROT_MSC, PROT_MM, PROT_LOGI,
+ PROT_LOGIMAN, PROT_MMHIT,
+ PROT_GLIDE, PROT_IMSERIAL,
+ PROT_THINKING, PROT_ACECAD,
+ PROT_THINKPS2, PROT_MMPS2,
+ PROT_GLIDEPS2,
+ PROT_NETSCPS2 ,PROT_IMPS2,
+ PROT_GENPS2,
+ PROT_MS,
+ PROT_UNKNOWN
+};
+
+static const char *
+autoOSProtocol(InputInfoPtr pInfo, int *protoPara)
+{
+ MouseDevPtr pMse = pInfo->private;
+ const char *name = NULL;
+ MouseProtocolID protocolID = PROT_UNKNOWN;
+
+ /* Check if the OS has a detection mechanism. */
+ if (osInfo->SetupAuto) {
+ name = osInfo->SetupAuto(pInfo, protoPara);
+ if (name) {
+ protocolID = ProtocolNameToID(name);
+ switch (protocolID) {
+ case PROT_UNKNOWN:
+ /* Check for a builtin OS-specific protocol. */
+ if (osInfo->CheckProtocol && osInfo->CheckProtocol(name)) {
+ /* We can only come here if the protocol has been
+ * changed to auto thru the xf86misc extension
+ * and we have detected an OS specific builtin
+ * protocol. Currently we cannot handle this */
+ name = NULL;
+ } else
+ name = NULL;
+ break;
+ case PROT_UNSUP:
+ name = NULL;
+ break;
+ default:
+ break;
+ }
+ }
+ }
+ if (!name) {
+ /* A PnP serial mouse? */
+ protocolID = MouseGetPnpProtocol(pInfo);
+ if (protocolID >= 0 && protocolID < PROT_NUMPROTOS) {
+ name = ProtocolIDToName(protocolID);
+ xf86Msg(X_PROBED, "%s: PnP-detected protocol: \"%s\"\n",
+ pInfo->name, name);
+ }
+ }
+ if (!name && HAVE_GUESS_PROTOCOL && osInfo->GuessProtocol) {
+ name = osInfo->GuessProtocol(pInfo, 0);
+ if (name)
+ protocolID = ProtocolNameToID(name);
+ }
+
+ if (name) {
+ pMse->protocolID = protocolID;
+ }
+
+ return name;
+}
+
+/*
+ * createProtocolList() -- create a list of protocols which may
+ * match on the incoming data stream.
+ */
+static void
+createProtoList(MouseDevPtr pMse, MouseProtocolID *protoList)
+{
+ int i, j, k = 0;
+ MouseProtocolID prot;
+ unsigned char *para;
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+ MouseProtocolID *tmplist = NULL;
+ int blocked;
+
+ AP_DBGC(("Autoprobe: "));
+ for (i = 0; i < mPriv->count; i++)
+ AP_DBGC(("%2.2x ", (unsigned char) mPriv->data[i]));
+ AP_DBGC(("\n"));
+
+ blocked = xf86BlockSIGIO ();
+
+ /* create a private copy first so we can write in the old list */
+ if ((tmplist = xalloc(sizeof(MouseProtocolID) * NUM_AUTOPROBE_PROTOS))){
+ for (i = 0; protoList[i] != PROT_UNKNOWN; i++) {
+ tmplist[i] = protoList[i];
+ }
+ tmplist[i] = PROT_UNKNOWN;
+ protoList = tmplist;
+ } else
+ return;
+
+ for (i = 0; ((prot = protoList[i]) != PROT_UNKNOWN
+ && (k < NUM_AUTOPROBE_PROTOS - 1)) ; i++) {
+ Bool bad = TRUE;
+ unsigned char byte = 0;
+ int count = 0;
+ int next_header_candidate = 0;
+ int header_count = 0;
+
+ if (!GetProtocol(prot))
+ continue;
+ para = proto[prot];
+
+ AP_DBG(("Protocol: %s ", ProtocolIDToName(prot)));
+
+#ifdef EXTMOUSEDEBUG
+ for (j = 0; j < 7; j++)
+ AP_DBGC(("%2.2x ", (unsigned char) para[j]));
+ AP_DBGC(("\n"));
+#endif
+ j = 0;
+ while (1) {
+ /* look for header */
+ while (j < mPriv->count) {
+ if (((byte = mPriv->data[j++]) & para[0]) == para[1]){
+ AP_DBG(("found header %2.2x\n",byte));
+ next_header_candidate = j;
+ count = 1;
+ break;
+ } else {
+ /*
+ * Bail ot if number of bytes per package have
+ * been tested for header.
+ * Take bytes per package of leading garbage into
+ * account.
+ */
+ if (j > para[4] && ++header_count > para[4]) {
+ j = mPriv->count;
+ break;
+ }
+ }
+ }
+ /* check if remaining data matches protocol */
+ while (j < mPriv->count) {
+ byte = mPriv->data[j++];
+ if (count == para[4]) {
+ count = 0;
+ /* check and eat excess byte */
+ if (((byte & para[0]) != para[1])
+ && ((byte & para[5]) == para[6])) {
+ AP_DBG(("excess byte found\n"));
+ continue;
+ }
+ }
+ if (count == 0) {
+ /* validate next header */
+ bad = FALSE;
+ AP_DBG(("Complete set found\n"));
+ if ((byte & para[0]) != para[1]) {
+ AP_DBG(("Autoprobe: header bad\n"));
+ bad = TRUE;
+ break;
+ } else {
+ count++;
+ continue;
+ }
+ }
+ /* validate data */
+ else if (((byte & para[2]) != para[3])
+ || ((para[7] & MPF_SAFE)
+ && ((byte & para[0]) == para[1]))) {
+ AP_DBG(("data bad\n"));
+ bad = TRUE;
+ break;
+ } else {
+ count ++;
+ continue;
+ }
+ }
+ if (!bad) {
+ /* this is a matching protocol */
+ mPriv->protoList[k++] = prot;
+ AP_DBG(("Autoprobe: Adding protocol %s to list (entry %i)\n",
+ ProtocolIDToName(prot),k-1));
+ break;
+ }
+ j = next_header_candidate;
+ next_header_candidate = 0;
+ /* we have tested number of bytes per package for header */
+ if (j > para[4] && ++header_count > para[4])
+ break;
+ /* we have not found anything that looks like a header */
+ if (!next_header_candidate)
+ break;
+ AP_DBG(("Looking for new header\n"));
+ }
+ }
+
+ xf86UnblockSIGIO(blocked);
+
+ mPriv->protoList[k] = PROT_UNKNOWN;
+
+ xfree(tmplist);
+}
+
+
+/* This only needs to be done once */
+void **serialDefaultsList = NULL;
+
+/*
+ * createSerialDefaultsLists() - create a list of the different default
+ * settings for the serial interface of the known protocols.
+ */
+static void
+createSerialDefaultsList(void)
+{
+ int i = 0, j, k;
+
+ serialDefaultsList = (void **)xnfalloc(sizeof(void*));
+ serialDefaultsList[0] = NULL;
+
+ for (j = 0; mouseProtocols[j].name; j++) {
+ if (!mouseProtocols[j].defaults)
+ continue;
+ for (k = 0; k < i; k++)
+ if (mouseProtocols[j].defaults == serialDefaultsList[k])
+ continue;
+ i++;
+ serialDefaultsList = (void**)xnfrealloc(serialDefaultsList,
+ sizeof(void*)*(i+1));
+ serialDefaultsList[i-1] = mouseProtocols[j].defaults;
+ serialDefaultsList[i] = NULL;
+ }
+}
+
+typedef enum {
+ STATE_INVALID,
+ STATE_UNCERTAIN,
+ STATE_VALID
+} validState;
+
+/* Probing threshold values */
+#define PROBE_UNCERTAINTY 50
+#define BAD_CERTAINTY 6
+#define BAD_INC_CERTAINTY 1
+#define BAD_INC_CERTAINTY_WHEN_SYNC_LOST 2
+
+static validState
+validCount(mousePrivPtr mPriv, Bool inSync, Bool lostSync)
+{
+ if (inSync) {
+ if (!--mPriv->goodCount) {
+ /* we are sure to have found the correct protocol */
+ mPriv->badCount = 0;
+ return STATE_VALID;
+ }
+ AP_DBG(("%i successful rounds to go\n",
+ mPriv->goodCount));
+ return STATE_UNCERTAIN;
+ }
+
+
+ /* We are out of sync again */
+ mPriv->goodCount = PROBE_UNCERTAINTY;
+ /* We increase uncertainty of having the correct protocol */
+ mPriv->badCount+= lostSync ? BAD_INC_CERTAINTY_WHEN_SYNC_LOST
+ : BAD_INC_CERTAINTY;
+
+ if (mPriv->badCount < BAD_CERTAINTY) {
+ /* We are not convinced yet to have the wrong protocol */
+ AP_DBG(("Changing protocol after: %i rounds\n",
+ BAD_CERTAINTY - mPriv->badCount));
+ return STATE_UNCERTAIN;
+ }
+ return STATE_INVALID;
+}
+
+#define RESET_VALIDATION mPriv->goodCount = PROBE_UNCERTAINTY;\
+ mPriv->badCount = 0;\
+ mPriv->prevDx = 0;\
+ mPriv->prevDy = 0;\
+ mPriv->accDx = 0;\
+ mPriv->accDy = 0;\
+ mPriv->acc = 0;
+
+static void
+autoProbeMouse(InputInfoPtr pInfo, Bool inSync, Bool lostSync)
+{
+ MouseDevPtr pMse = pInfo->private;
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+
+ MouseProtocolID *protocolList = NULL;
+
+ while (1) {
+ switch (mPriv->autoState) {
+ case AUTOPROBE_GOOD:
+ if (inSync)
+ return;
+ AP_DBG(("State GOOD\n"));
+ RESET_VALIDATION;
+ mPriv->autoState = AUTOPROBE_VALIDATE1;
+ return;
+ case AUTOPROBE_H_GOOD:
+ if (inSync)
+ return;
+ AP_DBG(("State H_GOOD\n"));
+ RESET_VALIDATION;
+ mPriv->autoState = AUTOPROBE_H_VALIDATE2;
+ return;
+ case AUTOPROBE_H_NOPROTO:
+ AP_DBG(("State H_NOPROTO\n"));
+ mPriv->protocolID = 0;
+ mPriv->autoState = AUTOPROBE_H_SETPROTO;
+ break;
+ case AUTOPROBE_H_SETPROTO:
+ AP_DBG(("State H_SETPROTO\n"));
+ if ((pMse->protocolID = hardProtocolList[mPriv->protocolID++])
+ == PROT_UNKNOWN) {
+ mPriv->protocolID = 0;
+ break;
+ } else if (GetProtocol(pMse->protocolID) && SetupMouse(pInfo)) {
+ FlushButtons(pMse);
+ RESET_VALIDATION;
+ AP_DBG(("Autoprobe: Trying Protocol: %s\n",
+ ProtocolIDToName(pMse->protocolID)));
+ mPriv->autoState = AUTOPROBE_H_VALIDATE1;
+ return;
+ }
+ break;
+ case AUTOPROBE_H_VALIDATE1:
+ AP_DBG(("State H_VALIDATE1\n"));
+ switch (validCount(mPriv,inSync,lostSync)) {
+ case STATE_INVALID:
+ mPriv->autoState = AUTOPROBE_H_SETPROTO;
+ break;
+ case STATE_VALID:
+ xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n",
+ ProtocolIDToName(pMse->protocolID));
+ mPriv->autoState = AUTOPROBE_H_GOOD;
+ return;
+ case STATE_UNCERTAIN:
+ return;
+ default:
+ break;
+ }
+ break;
+ case AUTOPROBE_H_VALIDATE2:
+ AP_DBG(("State H_VALIDATE2\n"));
+ switch (validCount(mPriv,inSync,lostSync)) {
+ case STATE_INVALID:
+ mPriv->autoState = AUTOPROBE_H_AUTODETECT;
+ break;
+ case STATE_VALID:
+ xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n",
+ ProtocolIDToName(pMse->protocolID));
+ mPriv->autoState = AUTOPROBE_H_GOOD;
+ return;
+ case STATE_UNCERTAIN:
+ return;
+ }
+ break;
+ case AUTOPROBE_H_AUTODETECT:
+ AP_DBG(("State H_AUTODETECT\n"));
+ pMse->protocolID = PROT_AUTO;
+ AP_DBG(("Looking for PnP/OS mouse\n"));
+ mPriv->count = 0;
+ SetupMouse(pInfo);
+ if (pMse->protocolID != PROT_AUTO)
+ mPriv->autoState = AUTOPROBE_H_GOOD;
+ else
+ mPriv->autoState = AUTOPROBE_H_NOPROTO;
+ break;
+ case AUTOPROBE_NOPROTO:
+ AP_DBG(("State NOPROTO\n"));
+ mPriv->count = 0;
+ mPriv->serialDefaultsNum = -1;
+ mPriv->autoState = AUTOPROBE_COLLECT;
+ break;
+ case AUTOPROBE_COLLECT:
+ AP_DBG(("State COLLECT\n"));
+ if (mPriv->count <= NUM_MSE_AUTOPROBE_BYTES)
+ return;
+ protocolList = softProtocolList;
+ mPriv->autoState = AUTOPROBE_CREATE_PROTOLIST;
+ break;
+ case AUTOPROBE_CREATE_PROTOLIST:
+ AP_DBG(("State CREATE_PROTOLIST\n"));
+ createProtoList(pMse, protocolList);
+ mPriv->protocolID = 0;
+ mPriv->autoState = AUTOPROBE_SWITCH_PROTOCOL;
+ break;
+ case AUTOPROBE_AUTODETECT:
+ AP_DBG(("State AUTODETECT\n"));
+ pMse->protocolID = PROT_AUTO;
+ AP_DBG(("Looking for PnP/OS mouse\n"));
+ mPriv->count = 0;
+ SetupMouse(pInfo);
+ if (pMse->protocolID != PROT_AUTO)
+ mPriv->autoState = AUTOPROBE_GOOD;
+ else
+ mPriv->autoState = AUTOPROBE_NOPROTO;
+ break;
+ case AUTOPROBE_VALIDATE1:
+ AP_DBG(("State VALIDATE1\n"));
+ switch (validCount(mPriv,inSync,lostSync)) {
+ case STATE_INVALID:
+ mPriv->autoState = AUTOPROBE_AUTODETECT;
+ break;
+ case STATE_VALID:
+ xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n",
+ ProtocolIDToName(pMse->protocolID));
+ mPriv->autoState = AUTOPROBE_GOOD;
+ break;
+ case STATE_UNCERTAIN:
+ return;
+ }
+ break;
+ case AUTOPROBE_VALIDATE2:
+ AP_DBG(("State VALIDATE2\n"));
+ switch (validCount(mPriv,inSync,lostSync)) {
+ case STATE_INVALID:
+ protocolList = &mPriv->protoList[mPriv->protocolID];
+ mPriv->autoState = AUTOPROBE_CREATE_PROTOLIST;
+ break;
+ case STATE_VALID:
+ xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n",
+ ProtocolIDToName(pMse->protocolID));
+ mPriv->autoState = AUTOPROBE_GOOD;
+ break;
+ case STATE_UNCERTAIN:
+ return;
+ }
+ break;
+ case AUTOPROBE_SWITCHSERIAL:
+ {
+ pointer serialDefaults;
+ AP_DBG(("State SWITCHSERIAL\n"));
+
+ if (!serialDefaultsList)
+ createSerialDefaultsList();
+
+ AP_DBG(("Switching serial params\n"));
+ if ((serialDefaults =
+ serialDefaultsList[++mPriv->serialDefaultsNum]) == NULL) {
+ mPriv->serialDefaultsNum = 0;
+ } else {
+ pointer tmp = xf86OptionListCreate(serialDefaults, -1, 0);
+ xf86SetSerial(pInfo->fd, tmp);
+ xf86OptionListFree(tmp);
+ mPriv->count = 0;
+ mPriv->autoState = AUTOPROBE_COLLECT;
+ }
+ break;
+ }
+ case AUTOPROBE_SWITCH_PROTOCOL:
+ {
+ MouseProtocolID proto;
+ void *defaults;
+ AP_DBG(("State SWITCH_PROTOCOL\n"));
+ proto = mPriv->protoList[mPriv->protocolID++];
+ if (proto == PROT_UNKNOWN)
+ mPriv->autoState = AUTOPROBE_SWITCHSERIAL;
+ else if (!(defaults = GetProtocol(proto)->defaults)
+ || (mPriv->serialDefaultsNum == -1
+ && (defaults == msDefaults))
+ || (mPriv->serialDefaultsNum != -1
+ && serialDefaultsList[mPriv->serialDefaultsNum]
+ == defaults)) {
+ AP_DBG(("Changing Protocol to %s\n",
+ ProtocolIDToName(proto)));
+ SetMouseProto(pMse,proto);
+ FlushButtons(pMse);
+ RESET_VALIDATION;
+ mPriv->autoState = AUTOPROBE_VALIDATE2;
+ return;
+ }
+ break;
+ }
+ }
+ }
+}
+
+static Bool
+autoGood(MouseDevPtr pMse)
+{
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+
+ if (!pMse->autoProbe)
+ return TRUE;
+
+ switch (mPriv->autoState) {
+ case AUTOPROBE_GOOD:
+ case AUTOPROBE_H_GOOD:
+ return TRUE;
+ case AUTOPROBE_VALIDATE1: /* @@@ */
+ case AUTOPROBE_H_VALIDATE1: /* @@@ */
+ case AUTOPROBE_VALIDATE2:
+ case AUTOPROBE_H_VALIDATE2:
+ if (mPriv->goodCount < PROBE_UNCERTAINTY/2)
+ return TRUE;
+ default:
+ return FALSE;
+ }
+}
+
+
+#define TOT_THRESHOLD 3000
+#define VAL_THRESHOLD 40
+
+/*
+ * checkForErraticMovements() -- check if mouse 'jumps around'.
+ */
+static void
+checkForErraticMovements(InputInfoPtr pInfo, int dx, int dy)
+{
+ MouseDevPtr pMse = pInfo->private;
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+#if 1
+ if (!mPriv->goodCount)
+ return;
+#endif
+#if 0
+ if (abs(dx - mPriv->prevDx) > 300
+ || abs(dy - mPriv->prevDy) > 300)
+ AP_DBG(("erratic1 behaviour\n"));
+#endif
+ if (abs(dx) > VAL_THRESHOLD) {
+ if (sign(dx) == sign(mPriv->prevDx)) {
+ mPriv->accDx += dx;
+ if (abs(mPriv->accDx) > mPriv->acc) {
+ mPriv->acc = abs(mPriv->accDx);
+ AP_DBG(("acc=%i\n",mPriv->acc));
+ }
+ else
+ AP_DBG(("accDx=%i\n",mPriv->accDx));
+ } else {
+ mPriv->accDx = 0;
+ }
+ }
+
+ if (abs(dy) > VAL_THRESHOLD) {
+ if (sign(dy) == sign(mPriv->prevDy)) {
+ mPriv->accDy += dy;
+ if (abs(mPriv->accDy) > mPriv->acc) {
+ mPriv->acc = abs(mPriv->accDy);
+ AP_DBG(("acc: %i\n",mPriv->acc));
+ } else
+ AP_DBG(("accDy=%i\n",mPriv->accDy));
+ } else {
+ mPriv->accDy = 0;
+ }
+ }
+ mPriv->prevDx = dx;
+ mPriv->prevDy = dy;
+ if (mPriv->acc > TOT_THRESHOLD) {
+ mPriv->goodCount = PROBE_UNCERTAINTY;
+ mPriv->prevDx = 0;
+ mPriv->prevDy = 0;
+ mPriv->accDx = 0;
+ mPriv->accDy = 0;
+ mPriv->acc = 0;
+ AP_DBG(("erratic2 behaviour\n"));
+ autoProbeMouse(pInfo, FALSE,TRUE);
+ }
+}
+
+static void
+SetMouseProto(MouseDevPtr pMse, MouseProtocolID protocolID)
+{
+ pMse->protocolID = protocolID;
+ pMse->protocol = ProtocolIDToName(pMse->protocolID);
+ pMse->class = ProtocolIDToClass(pMse->protocolID);
+ if ((pMse->protocolID >= 0) && (pMse->protocolID < PROT_NUMPROTOS))
+ memcpy(pMse->protoPara, proto[pMse->protocolID],
+ sizeof(pMse->protoPara));
+
+ if (pMse->emulate3ButtonsSoft)
+ pMse->emulate3Buttons = TRUE;
+}
+
+/*
+ * collectData() -- collect data bytes sent by mouse.
+ */
+static Bool
+collectData(MouseDevPtr pMse, unsigned char u)
+{
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+ if (mPriv->count < NUM_MSE_AUTOPROBE_TOTAL) {
+ mPriv->data[mPriv->count++] = u;
+ if (mPriv->count <= NUM_MSE_AUTOPROBE_BYTES) {
+ return TRUE;
+ }
+ }
+ return FALSE;
+}
+
+/**************** end of autoprobe stuff *****************/
+
+
+
+#ifdef XFree86LOADER
+ModuleInfoRec MouseInfo = {
+ 1,
+ "MOUSE",
+ NULL,
+ 0,
+ MouseAvailableOptions,
+};
+
+static void
+xf86MouseUnplug(pointer p)
+{
+}
+static pointer
+xf86MousePlug(pointer module,
+ pointer options,
+ int *errmaj,
+ int *errmin)
+{
+ static Bool Initialised = FALSE;
+
+ if (!Initialised) {
+ Initialised = TRUE;
+#ifndef REMOVE_LOADER_CHECK_MODULE_INFO
+ if (xf86LoaderCheckSymbol("xf86AddModuleInfo"))
+#endif
+ xf86AddModuleInfo(&MouseInfo, module);
+ }
+
+ xf86AddInputDriver(&MOUSE, module, 0);
+
+ return module;
+}
+
+static XF86ModuleVersionInfo xf86MouseVersionRec =
+{
+ "mouse",
+ MODULEVENDORSTRING,
+ MODINFOSTRING1,
+ MODINFOSTRING2,
+ XORG_VERSION_CURRENT,
+ 1, 1, 1,
+ ABI_CLASS_XINPUT,
+ ABI_XINPUT_VERSION,
+ MOD_CLASS_XINPUT,
+ {0, 0, 0, 0} /* signature, to be patched into the file by */
+ /* a tool */
+};
+
+_X_EXPORT XF86ModuleData mouseModuleData = {
+ &xf86MouseVersionRec,
+ xf86MousePlug,
+ xf86MouseUnplug
+};
+
+/*
+ Look at hitachi device stuff.
+*/
+#endif /* XFree86LOADER */
+
+
diff --git a/driver/xf86-input-mouse/src/mouse.h b/driver/xf86-input-mouse/src/mouse.h
new file mode 100644
index 000000000..16c5a8272
--- /dev/null
+++ b/driver/xf86-input-mouse/src/mouse.h
@@ -0,0 +1,15 @@
+/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.h,v 1.13 2003/11/03 05:11:49 tsi Exp $ */
+
+/*
+ * Copyright (c) 1997-1999 by The XFree86 Project, Inc.
+ */
+
+#ifndef MOUSE_H_
+#define MOUSE_H_
+
+#include "xf86OSmouse.h"
+
+const char * xf86MouseProtocolIDToName(MouseProtocolID id);
+MouseProtocolID xf86MouseProtocolNameToID(const char *name);
+
+#endif
diff --git a/driver/xf86-input-mouse/src/mousePriv.h b/driver/xf86-input-mouse/src/mousePriv.h
new file mode 100644
index 000000000..262d02963
--- /dev/null
+++ b/driver/xf86-input-mouse/src/mousePriv.h
@@ -0,0 +1,80 @@
+/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mousePriv.h,v 1.11 2003/11/03 05:11:49 tsi Exp $ */
+/*
+ * Copyright (c) 1997-1999 by The XFree86 Project, Inc.
+ */
+
+#ifndef _X_MOUSEPRIV_H
+#define _X_MOUSEPRIV_H
+
+#if 0
+# define MOUSEINITDEBUG
+# define MOUSEDATADEBUG
+#endif
+
+#include "mouse.h"
+#include "xf86Xinput.h"
+/* Private interface for the mouse driver. */
+
+typedef enum {
+ AUTOPROBE_H_NOPROTO,
+ AUTOPROBE_H_GOOD,
+ AUTOPROBE_H_AUTODETECT,
+ AUTOPROBE_H_VALIDATE1,
+ AUTOPROBE_H_VALIDATE2,
+ AUTOPROBE_H_SETPROTO,
+ AUTOPROBE_NOPROTO,
+ AUTOPROBE_COLLECT,
+ AUTOPROBE_CREATE_PROTOLIST,
+ AUTOPROBE_GOOD,
+ AUTOPROBE_AUTODETECT,
+ AUTOPROBE_VALIDATE1,
+ AUTOPROBE_VALIDATE2,
+ AUTOPROBE_SWITCHSERIAL,
+ AUTOPROBE_SWITCH_PROTOCOL
+} mseAutoProbeStates;
+
+typedef struct {
+ const char * name;
+ int class;
+ const char ** defaults;
+ MouseProtocolID id;
+} MouseProtocolRec, *MouseProtocolPtr;
+
+#define NUM_MSE_AUTOPROBE_BYTES 24 /* multiple of 3,4 and 6 byte packages */
+#define NUM_MSE_AUTOPROBE_TOTAL 64
+#define NUM_AUTOPROBE_PROTOS 17
+
+
+typedef struct {
+ int current;
+ Bool inReset;
+ CARD32 lastEvent;
+ CARD32 expires;
+ Bool soft;
+ int goodCount;
+ int badCount;
+ int protocolID;
+ int count;
+ char data[NUM_MSE_AUTOPROBE_TOTAL];
+ mseAutoProbeStates autoState;
+ MouseProtocolID protoList[NUM_AUTOPROBE_PROTOS];
+ int serialDefaultsNum;
+ int prevDx, prevDy;
+ int accDx, accDy;
+ int acc;
+ CARD32 pnpLast;
+ Bool disablePnPauto;
+} mousePrivRec, *mousePrivPtr;
+
+/* mouse proto flags */
+#define MPF_NONE 0x00
+#define MPF_SAFE 0x01
+
+/* pnp.c */
+MouseProtocolID MouseGetPnpProtocol(InputInfoPtr pInfo);
+Bool ps2Reset(InputInfoPtr pInfo);
+Bool ps2EnableDataReporting(InputInfoPtr pInfo);
+Bool ps2SendPacket(InputInfoPtr pInfo, unsigned char *bytes, int len);
+int ps2GetDeviceID(InputInfoPtr pInfo);
+
+#endif /* _X_MOUSE_H */
diff --git a/driver/xf86-input-mouse/src/pnp.c b/driver/xf86-input-mouse/src/pnp.c
new file mode 100644
index 000000000..edbc694cf
--- /dev/null
+++ b/driver/xf86-input-mouse/src/pnp.c
@@ -0,0 +1,792 @@
+/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/pnp.c,v 1.20tsi Exp $ */
+/*
+ * Copyright 1998 by Kazutaka YOKOTA <yokota@zodiac.mech.utsunomiya-u.ac.jp>
+ *
+ * Permission to use, copy, modify, distribute, and sell this software and its
+ * documentation for any purpose is hereby granted without fee, provided that
+ * the above copyright notice appear in all copies and that both that
+ * copyright notice and this permission notice appear in supporting
+ * documentation, and that the name of Kazutaka YOKOTA not be used in
+ * advertising or publicity pertaining to distribution of the software without
+ * specific, written prior permission. Kazutaka YOKOTA makes no representations
+ * about the suitability of this software for any purpose. It is provided
+ * "as is" without express or implied warranty.
+ *
+ * KAZUTAKA YOKOTA DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE,
+ * INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO
+ * EVENT SHALL KAZUTAKA YOKOTA BE LIABLE FOR ANY SPECIAL, INDIRECT OR
+ * CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE,
+ * DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER
+ * TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include "config.h"
+#endif
+
+#include <stdio.h>
+#include <string.h>
+#include <unistd.h>
+#define NEED_EVENTS
+#include <X11/X.h>
+#include <X11/Xproto.h>
+#include "inputstr.h"
+#include "scrnintstr.h"
+#include "xf86.h"
+#include "xf86Priv.h"
+#include "xf86Xinput.h"
+#include "xf86_OSproc.h"
+#include "xf86OSmouse.h"
+#include "mouse.h"
+#include "mousePriv.h"
+
+#ifdef MOUSEINITDEBUG
+# define DEBUG
+# define EXTMOUSEDEBUG
+#endif
+
+/* serial PnP ID string */
+typedef struct {
+ int revision; /* PnP revision, 100 for 1.00 */
+ char *eisaid; /* EISA ID including mfr ID and product ID */
+ char *serial; /* serial No, optional */
+ char *class; /* device class, optional */
+ char *compat; /* list of compatible drivers, optional */
+ char *description; /* product description, optional */
+ int neisaid; /* length of the above fields... */
+ int nserial;
+ int nclass;
+ int ncompat;
+ int ndescription;
+} pnpid_t;
+
+/* symbol table entry */
+typedef struct {
+ char *name;
+ MouseProtocolID val;
+} symtab_t;
+
+/* PnP EISA/product IDs */
+static symtab_t pnpprod[] = {
+ { "KML0001", PROT_THINKING }, /* Kensignton ThinkingMouse */
+ { "MSH0001", PROT_IMSERIAL }, /* MS IntelliMouse */
+ { "MSH0004", PROT_IMSERIAL }, /* MS IntelliMouse TrackBall */
+ { "KYEEZ00", PROT_MS }, /* Genius EZScroll */
+ { "KYE0001", PROT_MS }, /* Genius PnP Mouse */
+ { "KYE0002", PROT_MS }, /* MouseSystem (Genius?) SmartScroll */
+ { "KYE0003", PROT_IMSERIAL }, /* Genius NetMouse */
+ { "LGI800C", PROT_IMSERIAL }, /* Logitech MouseMan (4 button model) */
+ { "LGI8033", PROT_IMSERIAL }, /* Logitech Cordless MouseMan Wheel */
+ { "LGI8050", PROT_IMSERIAL }, /* Logitech MouseMan+ */
+ { "LGI8051", PROT_IMSERIAL }, /* Logitech FirstMouse+ */
+ { "LGI8001", PROT_LOGIMAN }, /* Logitech serial */
+ { "A4W0005", PROT_IMSERIAL }, /* A4 Tech 4D/4D+ Mouse */
+ { "PEC9802", PROT_IMSERIAL }, /* 8D Scroll Mouse */
+
+ { "PNP0F00", PROT_BM }, /* MS bus */
+ { "PNP0F01", PROT_MS }, /* MS serial */
+ { "PNP0F02", PROT_BM }, /* MS InPort */
+ { "PNP0F03", PROT_PS2 }, /* MS PS/2 */
+ /*
+ * EzScroll returns PNP0F04 in the compatible device field; but it
+ * doesn't look compatible... XXX
+ */
+ { "PNP0F04", PROT_MSC }, /* MouseSystems */
+ { "PNP0F05", PROT_MSC }, /* MouseSystems */
+#ifdef notyet
+ { "PNP0F06", PROT_??? }, /* Genius Mouse */
+ { "PNP0F07", PROT_??? }, /* Genius Mouse */
+#endif
+ { "PNP0F08", PROT_LOGIMAN }, /* Logitech serial */
+ { "PNP0F09", PROT_MS }, /* MS BallPoint serial */
+ { "PNP0F0A", PROT_MS }, /* MS PnP serial */
+ { "PNP0F0B", PROT_MS }, /* MS PnP BallPoint serial */
+ { "PNP0F0C", PROT_MS }, /* MS serial comatible */
+ { "PNP0F0D", PROT_BM }, /* MS InPort comatible */
+ { "PNP0F0E", PROT_PS2 }, /* MS PS/2 comatible */
+ { "PNP0F0F", PROT_MS }, /* MS BallPoint comatible */
+#ifdef notyet
+ { "PNP0F10", PROT_??? }, /* TI QuickPort */
+#endif
+ { "PNP0F11", PROT_BM }, /* MS bus comatible */
+ { "PNP0F12", PROT_PS2 }, /* Logitech PS/2 */
+ { "PNP0F13", PROT_PS2 }, /* PS/2 */
+#ifdef notyet
+ { "PNP0F14", PROT_??? }, /* MS Kids Mouse */
+#endif
+ { "PNP0F15", PROT_BM }, /* Logitech bus */
+#ifdef notyet
+ { "PNP0F16", PROT_??? }, /* Logitech SWIFT */
+#endif
+ { "PNP0F17", PROT_LOGIMAN }, /* Logitech serial compat */
+ { "PNP0F18", PROT_BM }, /* Logitech bus compatible */
+ { "PNP0F19", PROT_PS2 }, /* Logitech PS/2 compatible */
+#ifdef notyet
+ { "PNP0F1A", PROT_??? }, /* Logitech SWIFT compatible */
+ { "PNP0F1B", PROT_??? }, /* HP Omnibook */
+ { "PNP0F1C", PROT_??? }, /* Compaq LTE TrackBall PS/2 */
+ { "PNP0F1D", PROT_??? }, /* Compaq LTE TrackBall serial */
+ { "PNP0F1E", PROT_??? }, /* MS Kids Trackball */
+#endif
+ { NULL, PROT_UNKNOWN },
+};
+
+static const char *pnpSerial[] = {
+ "BaudRate", "1200",
+ "DataBits", "7",
+ "StopBits", "1",
+ "Parity", "None",
+ "FlowControl", "None",
+ "VTime", "0",
+ "VMin", "1",
+ NULL
+};
+
+static int pnpgets(InputInfoPtr, char *, Bool *prePNP);
+static int pnpparse(InputInfoPtr, pnpid_t *, char *, int);
+static MouseProtocolID prepnpparse(InputInfoPtr pInfo, char *buf);
+static symtab_t *pnpproto(pnpid_t *);
+static symtab_t *gettoken(symtab_t *, char *, int);
+static MouseProtocolID getPs2ProtocolPnP(InputInfoPtr pInfo);
+static MouseProtocolID probePs2ProtocolPnP(InputInfoPtr pInfo);
+
+static MouseProtocolID
+MouseGetSerialPnpProtocol(InputInfoPtr pInfo)
+{
+ char buf[256]; /* PnP ID string may be up to 256 bytes long */
+ pnpid_t pnpid;
+ symtab_t *t;
+ int len;
+ Bool prePNP;
+
+ if ((len = pnpgets(pInfo, buf, &prePNP)) > 0)
+ {
+ if (!prePNP) {
+ if (pnpparse(pInfo, &pnpid, buf, len) &&
+ (t = pnpproto(&pnpid)) != NULL) {
+ xf86MsgVerb(X_INFO, 2, "%s: PnP-detected protocol ID: %d\n",
+ pInfo->name, t->val);
+ return (t->val);
+ }
+ } else
+ return prepnpparse(pInfo,buf);
+ }
+ return PROT_UNKNOWN;
+}
+
+MouseProtocolID
+MouseGetPnpProtocol(InputInfoPtr pInfo)
+{
+ MouseDevPtr pMse = pInfo->private;
+ mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv;
+ MouseProtocolID val;
+ CARD32 last;
+
+ if ((val = MouseGetSerialPnpProtocol(pInfo)) != PROT_UNKNOWN) {
+ if (val == MouseGetSerialPnpProtocol(pInfo))
+ return val;
+ }
+
+#if 1
+ last = mPriv->pnpLast;
+ mPriv->pnpLast = currentTime.milliseconds;
+
+ if (last) {
+ if (last - currentTime.milliseconds < 100
+ || (mPriv->disablePnPauto
+ && (last - currentTime.milliseconds < 10000))) {
+#ifdef EXTMOUSEDEBUG
+ xf86ErrorF("Mouse: Disabling PnP\n");
+#endif
+ mPriv->disablePnPauto = TRUE;
+ return PROT_UNKNOWN;
+ }
+ }
+
+#ifdef EXTMOUSEDEBUG
+ if (mPriv->disablePnPauto)
+ xf86ErrorF("Mouse: Enabling PnP\n");
+#endif
+ mPriv->disablePnPauto = FALSE;
+
+ if (mPriv->soft)
+ return getPs2ProtocolPnP(pInfo);
+ else
+ return probePs2ProtocolPnP(pInfo);
+#else
+ return PROT_UNKNOWN;
+#endif
+}
+
+/*
+ * Try to elicit a PnP ID as described in
+ * Microsoft, Hayes: "Plug and Play External COM Device Specification,
+ * rev 1.00", 1995.
+ *
+ * The routine does not fully implement the COM Enumerator as per Section
+ * 2.1 of the document. In particular, we don't have idle state in which
+ * the driver software monitors the com port for dynamic connection or
+ * removal of a device at the port, because `moused' simply quits if no
+ * device is found.
+ *
+ * In addition, as PnP COM device enumeration procedure slightly has
+ * changed since its first publication, devices which follow earlier
+ * revisions of the above spec. may fail to respond if the rev 1.0
+ * procedure is used. XXX
+ */
+static int
+pnpgets(InputInfoPtr pInfo, char *buf, Bool *prePNP)
+{
+ int i;
+ char c;
+ pointer pnpOpts;
+
+#if 0
+ /*
+ * This is the procedure described in rev 1.0 of PnP COM device spec.
+ * Unfortunately, some devices which comform to earlier revisions of
+ * the spec gets confused and do not return the ID string...
+ */
+
+ /* port initialization (2.1.2) */
+ if ((i = xf86GetSerialModemState(pInfo->fd)) == -1)
+ return 0;
+ i |= XF86_M_DTR; /* DTR = 1 */
+ i &= ~XF86_M_RTS; /* RTS = 0 */
+ if (xf86SetSerialModemState(pInfo->fd, i) == -1)
+ goto disconnect_idle;
+ usleep(200000);
+ if ((i = xf86GetSerialModemState(pInfo->fd)) == -1 ||
+ (i & XF86_M_DSR) == 0)
+ goto disconnect_idle;
+
+ /* port setup, 1st phase (2.1.3) */
+ pnpOpts = xf86OptionListCreate(pnpSerial, -1, 1);
+ xf86SetSerial(pInfo->fd, pnpOpts);
+ i = TIOCM_DTR | TIOCM_RTS; /* DTR = 0, RTS = 0 */
+ xf86SerialModemClearBits(pInfo->fd, i);
+ usleep(200000);
+ i = TIOCM_DTR; /* DTR = 1, RTS = 0 */
+ xf86SerialModemSetBits(pInfo->fd, i);
+ usleep(200000);
+
+ /* wait for response, 1st phase (2.1.4) */
+ xf86FlushInput(pInfo->fd);
+ i = TIOCM_RTS; /* DTR = 1, RTS = 1 */
+ xf86SerialModemSetBits(pInfo->fd, i);
+
+ /* try to read something */
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0) {
+
+ /* port setup, 2nd phase (2.1.5) */
+ i = TIOCM_DTR | TIOCM_RTS; /* DTR = 0, RTS = 0 */
+ xf86SerialModemClearBits(pInfo->fd, i);
+ usleep(200000);
+
+ /* wait for respose, 2nd phase (2.1.6) */
+ xf86FlushInput(pInfo->fd);
+ i = TIOCM_DTR | TIOCM_RTS; /* DTR = 1, RTS = 1 */
+ xf86SerialModemSetBits(pInfo->fd, i);
+
+ /* try to read something */
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0)
+ goto connect_idle;
+ }
+#else
+ /*
+ * This is a simplified procedure; it simply toggles RTS.
+ */
+
+ if ((i = xf86GetSerialModemState(pInfo->fd)) == -1)
+ return 0;
+ i |= XF86_M_DTR; /* DTR = 1 */
+ i &= ~XF86_M_RTS; /* RTS = 0 */
+ if (xf86SetSerialModemState(pInfo->fd, i) == -1)
+ goto disconnect_idle;
+ usleep(200000);
+
+ pnpOpts = xf86OptionListCreate(pnpSerial, -1, 1);
+ xf86SetSerial(pInfo->fd, pnpOpts);
+
+ /* wait for respose */
+ xf86FlushInput(pInfo->fd);
+ i = XF86_M_DTR | XF86_M_RTS; /* DTR = 1, RTS = 1 */
+ xf86SerialModemSetBits(pInfo->fd, i);
+
+ /* try to read something */
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0)
+ goto connect_idle;
+#endif
+
+ /* collect PnP COM device ID (2.1.7) */
+ i = 0;
+ *prePNP = FALSE;
+
+ usleep(200000); /* the mouse must send `Begin ID' within 200msec */
+ while (xf86ReadSerial(pInfo->fd, &c, 1) == 1) {
+ /* we may see "M", or "M3..." before `Begin ID' */
+ if (c == 'M')
+ *prePNP = TRUE;
+
+ if ((c == 0x08) || (c == 0x28)) { /* Begin ID */
+ *prePNP = FALSE;
+ buf[0] = c;
+ i = 1;
+ break;
+ }
+ if (*prePNP)
+ buf[i++] = c;
+
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0)
+ break;
+ }
+ if (i <= 0) {
+ /* we haven't seen `Begin ID' in time... */
+ goto connect_idle;
+ }
+ if (*prePNP)
+ return i;
+
+ ++c; /* make it `End ID' */
+ for (;;) {
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0)
+ break;
+
+ xf86ReadSerial(pInfo->fd, &buf[i], 1);
+ if (buf[i++] == c) /* End ID */
+ break;
+ if (i >= 256)
+ break;
+ }
+ if (buf[i - 1] != c)
+ goto connect_idle;
+ return i;
+
+ /*
+ * According to PnP spec, we should set DTR = 1 and RTS = 0 while
+ * in idle state. But, `moused' shall set DTR = RTS = 1 and proceed,
+ * assuming there is something at the port even if it didn't
+ * respond to the PnP enumeration procedure.
+ */
+disconnect_idle:
+ i = XF86_M_DTR | XF86_M_RTS; /* DTR = 1, RTS = 1 */
+ xf86SerialModemSetBits(pInfo->fd, i);
+connect_idle:
+ return 0;
+}
+
+static int
+pnpparse(InputInfoPtr pInfo, pnpid_t *id, char *buf, int len)
+{
+ char s[3];
+ int offset;
+ int sum = 0;
+ int i, j;
+
+ id->revision = 0;
+ id->eisaid = NULL;
+ id->serial = NULL;
+ id->class = NULL;
+ id->compat = NULL;
+ id->description = NULL;
+ id->neisaid = 0;
+ id->nserial = 0;
+ id->nclass = 0;
+ id->ncompat = 0;
+ id->ndescription = 0;
+
+ offset = 0x28 - buf[0];
+
+ /* calculate checksum */
+ for (i = 0; i < len - 3; ++i) {
+ sum += buf[i];
+ buf[i] += offset;
+ }
+ sum += buf[len - 1];
+ for (; i < len; ++i)
+ buf[i] += offset;
+ xf86MsgVerb(X_INFO, 2, "%s: PnP ID string: `%*.*s'\n", pInfo->name,
+ len, len, buf);
+
+ /* revision */
+ buf[1] -= offset;
+ buf[2] -= offset;
+ id->revision = ((buf[1] & 0x3f) << 6) | (buf[2] & 0x3f);
+ xf86MsgVerb(X_INFO, 2, "%s: PnP rev %d.%02d\n", pInfo->name,
+ id->revision / 100, id->revision % 100);
+
+ /* EISA vender and product ID */
+ id->eisaid = &buf[3];
+ id->neisaid = 7;
+
+ /* option strings */
+ i = 10;
+ if (buf[i] == '\\') {
+ /* device serial # */
+ for (j = ++i; i < len; ++i) {
+ if (buf[i] == '\\')
+ break;
+ }
+ if (i >= len)
+ i -= 3;
+ if (i - j == 8) {
+ id->serial = &buf[j];
+ id->nserial = 8;
+ }
+ }
+ if (buf[i] == '\\') {
+ /* PnP class */
+ for (j = ++i; i < len; ++i) {
+ if (buf[i] == '\\')
+ break;
+ }
+ if (i >= len)
+ i -= 3;
+ if (i > j + 1) {
+ id->class = &buf[j];
+ id->nclass = i - j;
+ }
+ }
+ if (buf[i] == '\\') {
+ /* compatible driver */
+ for (j = ++i; i < len; ++i) {
+ if (buf[i] == '\\')
+ break;
+ }
+ /*
+ * PnP COM spec prior to v0.96 allowed '*' in this field,
+ * it's not allowed now; just ignore it.
+ */
+ if (buf[j] == '*')
+ ++j;
+ if (i >= len)
+ i -= 3;
+ if (i > j + 1) {
+ id->compat = &buf[j];
+ id->ncompat = i - j;
+ }
+ }
+ if (buf[i] == '\\') {
+ /* product description */
+ for (j = ++i; i < len; ++i) {
+ if (buf[i] == ';')
+ break;
+ }
+ if (i >= len)
+ i -= 3;
+ if (i > j + 1) {
+ id->description = &buf[j];
+ id->ndescription = i - j;
+ }
+ }
+
+ /* checksum exists if there are any optional fields */
+ if ((id->nserial > 0) || (id->nclass > 0)
+ || (id->ncompat > 0) || (id->ndescription > 0)) {
+ xf86MsgVerb(X_INFO, 4, "%s: PnP checksum: 0x%02X\n", pInfo->name, sum);
+ sprintf(s, "%02X", sum & 0x0ff);
+ if (strncmp(s, &buf[len - 3], 2) != 0) {
+#if 0
+ /*
+ * Checksum error!!
+ * I found some mice do not comply with the PnP COM device
+ * spec regarding checksum... XXX
+ */
+ return FALSE;
+#endif
+ }
+ }
+
+ return TRUE;
+}
+
+/* We can only identify MS at the moment */
+static MouseProtocolID
+prepnpparse(InputInfoPtr pInfo, char *buf)
+{
+ if (buf[0] == 'M' && buf[1] == '3')
+ return PROT_MS;
+ return PROT_UNKNOWN;
+}
+
+
+static symtab_t *
+pnpproto(pnpid_t *id)
+{
+ symtab_t *t;
+ int i, j;
+
+ if (id->nclass > 0)
+ if (strncmp(id->class, "MOUSE", id->nclass) != 0)
+ /* this is not a mouse! */
+ return NULL;
+
+ if (id->neisaid > 0) {
+ t = gettoken(pnpprod, id->eisaid, id->neisaid);
+ if (t->val != -1)
+ return t;
+ }
+
+ /*
+ * The 'Compatible drivers' field may contain more than one
+ * ID separated by ','.
+ */
+ if (id->ncompat <= 0)
+ return NULL;
+ for (i = 0; i < id->ncompat; ++i) {
+ for (j = i; id->compat[i] != ','; ++i)
+ if (i >= id->ncompat)
+ break;
+ if (i > j) {
+ t = gettoken(pnpprod, id->compat + j, i - j);
+ if (t->val != -1)
+ return t;
+ }
+ }
+
+ return NULL;
+}
+
+/* name/val mapping */
+
+static symtab_t *
+gettoken(tab, s, len)
+symtab_t *tab;
+char *s;
+int len;
+{
+ int i;
+
+ for (i = 0; tab[i].name != NULL; ++i) {
+ if (strncmp(tab[i].name, s, len) == 0)
+ break;
+ }
+ return &tab[i];
+}
+
+/******************* PS/2 PnP probing ****************/
+
+static int
+readMouse(InputInfoPtr pInfo, unsigned char *u)
+{
+
+ if (xf86WaitForInput(pInfo->fd, 200000) <= 0)
+ return FALSE;
+
+ xf86ReadSerial(pInfo->fd, u, 1);
+ return TRUE;
+}
+
+static void
+ps2DisableWrapMode(InputInfoPtr pInfo)
+{
+ unsigned char reset_wrap_mode[] = { 0xEC };
+ ps2SendPacket(pInfo, reset_wrap_mode, sizeof(reset_wrap_mode));
+}
+
+Bool
+ps2SendPacket(InputInfoPtr pInfo, unsigned char *bytes, int len)
+{
+ unsigned char c;
+ int i,j;
+
+#ifdef DEBUG
+ xf86ErrorF("Ps/2 data package:");
+ for (i = 0; i < len; i++)
+ xf86ErrorF(" %x", *(bytes + i));
+ xf86ErrorF("\n");
+#endif
+
+ for (i = 0; i < len; i++) {
+ for (j = 0; j < 10; j++) {
+ xf86WriteSerial(pInfo->fd, bytes + i, 1);
+ usleep(10000);
+ if (!readMouse(pInfo,&c)) {
+#ifdef DEBUG
+ xf86ErrorF("sending 0x%x to PS/2 unsuccessful\n",*(bytes + i));
+#endif
+ return FALSE;
+ }
+#ifdef DEBUG
+ xf86ErrorF("Recieved: 0x%x\n",c);
+#endif
+ if (c == 0xFA) /* ACK */
+ break;
+
+ if (c == 0xFE) /* resend */
+ continue;
+
+
+ if (c == 0xFC) /* error */
+ return FALSE;
+
+ /* Some mice accidently enter wrap mode during init */
+ if (c == *(bytes + i) /* wrap mode */
+ && (*(bytes + i) != 0xEC)) /* avoid recursion */
+ ps2DisableWrapMode(pInfo);
+
+ return FALSE;
+ }
+ if (j == 10)
+ return FALSE;
+ }
+
+ return TRUE;
+}
+
+static Bool
+ps2DisableDataReporting(InputInfoPtr pInfo)
+{
+ unsigned char packet[] = { 0xF5 };
+ return ps2SendPacket(pInfo, packet, sizeof(packet));
+}
+
+Bool
+ps2EnableDataReporting(InputInfoPtr pInfo)
+{
+ unsigned char packet[] = { 0xF4 };
+ return ps2SendPacket(pInfo, packet, sizeof(packet));
+}
+
+int
+ps2GetDeviceID(InputInfoPtr pInfo)
+{
+ unsigned char u;
+ unsigned char packet[] = { 0xf2 };
+
+ usleep(30000);
+ xf86FlushInput(pInfo->fd);
+ if (!ps2SendPacket(pInfo, packet, sizeof(packet)))
+ return -1;
+ while (1) {
+ if (!readMouse(pInfo,&u))
+ return -1;
+ if (u != 0xFA)
+ break;
+ }
+#ifdef DEBUG
+ xf86ErrorF("Obtained Mouse Type: %x\n",u);
+#endif
+ return (int) u;
+}
+
+Bool
+ps2Reset(InputInfoPtr pInfo)
+{
+ unsigned char u;
+ unsigned char packet[] = { 0xff };
+ unsigned char reply[] = { 0xaa, 0x00 };
+ unsigned int i;
+#ifdef DEBUG
+ xf86ErrorF("PS/2 Mouse reset\n");
+#endif
+ if (!ps2SendPacket(pInfo, packet, sizeof(packet)))
+ return FALSE;
+ /* we need a little delay here */
+ xf86WaitForInput(pInfo->fd, 500000);
+ for (i = 0; i < sizeof(reply) ; i++) {
+ if (!readMouse(pInfo,&u)) {
+ goto EXIT;
+ }
+ if (u != reply[i])
+ goto EXIT;
+ }
+ return TRUE;
+
+ EXIT:
+ xf86FlushInput(pInfo->fd);
+ return FALSE;
+}
+
+static MouseProtocolID
+probePs2ProtocolPnP(InputInfoPtr pInfo)
+{
+ unsigned char u;
+ MouseProtocolID ret = PROT_UNKNOWN;
+
+ xf86FlushInput(pInfo->fd);
+
+ ps2DisableDataReporting(pInfo);
+
+ if (ps2Reset(pInfo)) { /* Reset PS2 device */
+ unsigned char seq[] = { 243, 200, 243, 100, 243, 80 };
+ /* Try to identify Intelli Mouse */
+ if (ps2SendPacket(pInfo, seq, sizeof(seq))) {
+ u = ps2GetDeviceID(pInfo);
+ if (u == 0x03) {
+ /* found IntelliMouse now try IntelliExplorer */
+ unsigned char seq[] = { 243, 200, 243, 200, 243, 80 };
+ if (ps2SendPacket(pInfo,seq,sizeof(seq))) {
+ u = ps2GetDeviceID(pInfo);
+ if (u == 0x04)
+ ret = PROT_EXPPS2;
+ else
+ ret = PROT_IMPS2;
+ }
+ } else if (ps2Reset(pInfo)) /* reset again to find sane state */
+ ret = PROT_PS2;
+ }
+
+ if (ret != PROT_UNKNOWN)
+ ps2EnableDataReporting(pInfo);
+ }
+ return ret;
+}
+
+static struct ps2protos {
+ int Id;
+ MouseProtocolID protoID;
+} ps2 [] = {
+ { 0x0, PROT_PS2 },
+ { 0x3, PROT_IMPS2 },
+ { 0x4, PROT_EXPPS2 },
+ { -1 , PROT_UNKNOWN }
+};
+
+
+static MouseProtocolID
+getPs2ProtocolPnP(InputInfoPtr pInfo)
+{
+ int Id;
+ int i;
+ MouseProtocolID proto;
+ int count = 4;
+
+ xf86FlushInput(pInfo->fd);
+
+ while (--count)
+ if (ps2DisableDataReporting(pInfo))
+ break;
+
+ if (!count) {
+ proto = PROT_UNKNOWN;
+ goto EXIT;
+ }
+
+ if ((Id = ps2GetDeviceID(pInfo)) == -1) {
+ proto = PROT_UNKNOWN;
+ goto EXIT;
+ }
+
+ if (-1 == ps2EnableDataReporting(pInfo)) {
+ proto = PROT_UNKNOWN;
+ goto EXIT;
+ }
+
+ for (i = 0; ps2[i].protoID != PROT_UNKNOWN; i++) {
+ if (ps2[i].Id == Id) {
+ xf86MsgVerb(X_PROBED,2,"Found PS/2 proto ID %x\n",Id);
+ proto = ps2[i].protoID;
+ goto EXIT;
+ }
+ }
+
+ proto = PROT_UNKNOWN;
+ xf86Msg(X_ERROR,"Found unknown PS/2 proto ID %x\n",Id);
+
+ EXIT:
+ xf86FlushInput(pInfo->fd);
+ return proto;
+}
+